diff options
author | Sam Potts <sam@potts.es> | 2019-03-16 12:14:20 +1100 |
---|---|---|
committer | Sam Potts <sam@potts.es> | 2019-03-16 12:14:20 +1100 |
commit | 35f7ee9c59ff082a5b71aae43ffccab4cdf10fdf (patch) | |
tree | 75b8f7c56ec7fa6696991e52197172c9c6c7c3cd /demo/dist | |
parent | bdd513635fffa33f66735c80209e6ae77e0426b4 (diff) | |
parent | c202551e6d0b11656a99b41f3f8b3a48f2bf1e0a (diff) | |
download | plyr-35f7ee9c59ff082a5b71aae43ffccab4cdf10fdf.tar.lz plyr-35f7ee9c59ff082a5b71aae43ffccab4cdf10fdf.tar.xz plyr-35f7ee9c59ff082a5b71aae43ffccab4cdf10fdf.zip |
Merge branch 'develop' into css-variables
# Conflicts:
# demo/dist/demo.css
# demo/index.html
# dist/plyr.css
# gulpfile.js
# package.json
# yarn.lock
Diffstat (limited to 'demo/dist')
-rw-r--r-- | demo/dist/demo.css | 2 | ||||
-rw-r--r-- | demo/dist/demo.js | 11112 | ||||
-rw-r--r-- | demo/dist/demo.js.map | 1 | ||||
-rw-r--r-- | demo/dist/demo.min.js | 2 | ||||
-rw-r--r-- | demo/dist/demo.min.js.map | 1 | ||||
-rw-r--r-- | demo/dist/demo.svg | 1 |
6 files changed, 9884 insertions, 1235 deletions
diff --git a/demo/dist/demo.css b/demo/dist/demo.css index 26340f61..32511c5d 100644 --- a/demo/dist/demo.css +++ b/demo/dist/demo.css @@ -1 +1 @@ -@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:300;src:url(https://cdn.plyr.io/static/fonts/gordita-light.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-light.woff) format("woff")}@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:400;src:url(https://cdn.plyr.io/static/fonts/gordita-regular.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-regular.woff) format("woff")}@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:500;src:url(https://cdn.plyr.io/static/fonts/gordita-medium.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-medium.woff) format("woff")}@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:600;src:url(https://cdn.plyr.io/static/fonts/gordita-bold.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-bold.woff) format("woff")}@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:900;src:url(https://cdn.plyr.io/static/fonts/gordita-black.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-black.woff) format("woff")}@keyframes fadein{0%{opacity:0}100%{opacity:1}}/*! normalize.css v7.0.0 | MIT License | github.com/necolas/normalize.css */html{line-height:1.15;-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%}body{margin:0}article,aside,footer,header,nav,section{display:block}h1{font-size:2em;margin:.67em 0}figcaption,figure,main{display:block}figure{margin:1em 40px}hr{box-sizing:content-box;height:0;overflow:visible}pre{font-family:monospace,monospace;font-size:1em}a,button.faux-link{background-color:transparent;-webkit-text-decoration-skip:objects}abbr[title]{border-bottom:none;text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted}b,strong{font-weight:inherit}b,strong{font-weight:bolder}code,kbd,samp{font-family:monospace,monospace;font-size:1em}dfn{font-style:italic}mark{background-color:#ff0;color:#000}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}audio,video{display:inline-block}audio:not([controls]){display:none;height:0}img{border-style:none}svg:not(:root){overflow:hidden}button,input,optgroup,select,textarea{font-family:sans-serif;font-size:100%;line-height:1.15;margin:0}button,input{overflow:visible}button,select{text-transform:none}[type=reset],[type=submit],button,html [type=button]{-webkit-appearance:button}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{border-style:none;padding:0}[type=button]:-moz-focusring,[type=reset]:-moz-focusring,[type=submit]:-moz-focusring,button:-moz-focusring{outline:1px dotted ButtonText}fieldset{padding:.35em .75em .625em}legend{box-sizing:border-box;color:inherit;display:table;max-width:100%;padding:0;white-space:normal}progress{display:inline-block;vertical-align:baseline}textarea{overflow:auto}[type=checkbox],[type=radio]{box-sizing:border-box;padding:0}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}details,menu{display:block}summary{display:list-item}canvas{display:inline-block}template{display:none}[hidden]{display:none}*,::after,::before{box-sizing:border-box}body,html{display:flex;width:100%}html{background:linear-gradient(to left top,#4dc1ff,#0074b3);background-attachment:fixed;height:100%}body{align-items:center;display:flex;flex-direction:column;min-height:100%}.grid{flex:1;overflow:auto}main{margin:auto;padding-bottom:1px;text-align:center}aside{align-items:center;background:#fff;color:#55646b;display:flex;flex-shrink:0;justify-content:center;padding:15px;position:relative;text-align:center;text-shadow:none;width:100%}aside .icon{fill:#4baaf4;margin-right:10px}aside p{margin:0}aside a,aside button.faux-link{color:#4baaf4}aside a.tab-focus,aside button.tab-focus.faux-link{box-shadow:0 0 0 3px rgba(75,170,244,.35);outline:0}.grid{margin:0 auto;padding:20px}@media only screen and (min-width:768px){.grid{align-items:center;display:flex;max-width:1260px;width:100%}.grid>*{flex:1}}html{font-size:100%}body{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;font-size:15px;font-size:.9375rem;color:#fff;font-family:Gordita,Avenir,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-weight:500;line-height:1.75;text-shadow:0 1px 1px rgba(0,0,0,.15)}button,input,select,textarea{font:inherit}p,small{margin:0 0 20px}small{font-size:13px;font-size:.8125rem;display:block}h1{font-size:64px;font-size:4rem;font-weight:600;letter-spacing:-.025em;line-height:1.2;margin:0 0 20px}.button,.button__count{align-items:center;background:#fff;border:0;border-radius:4px;box-shadow:0 1px 1px rgba(0,0,0,.1);color:#55646b;display:inline-flex;padding:15px;position:relative;text-shadow:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;vertical-align:middle}.button{font-weight:600;padding-left:20px;padding-right:20px;transition:all .2s ease}.button:focus,.button:hover{color:#343f4a}.button:focus::after,.button:hover::after{display:none}.button:hover{box-shadow:0 2px 2px rgba(0,0,0,.1);transform:translateY(-1px)}.button:focus{outline:0}.button.tab-focus{box-shadow:0 0 0 3px rgba(255,255,255,.35);outline:0}.button:active{transform:translateY(1px)}.button--with-count{display:inline-flex}.button--with-count .button .icon{flex-shrink:0}.button__count{animation:fadein .2s ease;margin-left:10px}.button__count::before{border:5px solid transparent;border-left-width:0;border-right-color:#fff;content:'';height:0;position:absolute;right:100%;top:50%;transform:translateY(-50%);width:0}header{padding-bottom:20px;text-align:center}header .call-to-action{margin-top:30px}@media only screen and (min-width:768px){header{margin-right:60px;max-width:360px;padding-bottom:40px;text-align:left}}.icon{fill:currentColor;height:16px;vertical-align:-3px;width:16px}a svg,button svg,button.faux-link svg,label svg{pointer-events:none}.btn .icon,a .icon,button.faux-link .icon{margin-right:6px}button.faux-link{background:0 0;border:0;border-radius:0;cursor:pointer;font:inherit;line-height:1.75;margin:0;padding:0;position:relative;text-align:inherit;text-shadow:inherit;-moz-user-select:text;vertical-align:baseline;width:auto}a,button.faux-link{border-bottom:1px dotted currentColor;color:#fff;font-weight:600;position:relative;text-decoration:none;transition:all .2s ease}a::after,button.faux-link::after{background:currentColor;content:'';height:1px;left:50%;position:absolute;top:100%;transform:translateX(-50%);transition:width .2s ease;width:0}a:focus,a:hover,button.faux-link:focus,button.faux-link:hover{border-bottom-color:transparent;outline:0}a:focus::after,a:hover::after,button.faux-link:focus::after,button.faux-link:hover::after{width:100%}a.tab-focus,button.tab-focus.faux-link{box-shadow:0 0 0 3px rgba(255,255,255,.35);outline:0}a.no-border::after,button.no-border.faux-link::after{display:none}li,ul{list-style:none;margin:0;padding:0}audio,img,video{max-width:100%;vertical-align:middle}nav{display:flex;justify-content:center;margin-bottom:20px}video{max-width:100%;vertical-align:middle}.plyr{border-radius:4px;box-shadow:0 2px 5px rgba(0,0,0,.2);margin:20px auto}.plyr.plyr--audio{max-width:480px}.plyr__video-wrapper::after{border:1px solid rgba(0,0,0,.15);border-radius:inherit;bottom:0;content:'';left:0;pointer-events:none;position:absolute;right:0;top:0;z-index:3}.plyr__cite{display:none;margin-top:20px}.plyr__cite .icon{margin-right:4px}.plyr--audio~ul .plyr__cite--audio,.plyr--video:not(.plyr--youtube):not(.plyr--vimeo)~ul .plyr__cite--video,.plyr--vimeo~ul .plyr__cite--vimeo,.plyr--youtube~ul .plyr__cite--youtube{display:block}:root{--plyr-color-main:#1aafff;--plyr-color-gunmetal:#2f343d;--plyr-color-fiord:#4f5b5f;--plyr-color-lynch:#6b7d85;--plyr-color-heather:#b7c5cd}:root{--plyr-tab-focus-default-color:#1aafff}:root{--plyr-captions-background:rgba(0, 0, 0, 0.8);--plyr-captions-text-color:#fff}:root{--plyr-control-icon-size:18px;--plyr-control-spacing:10px;--plyr-control-padding:7px;--plyr-control-radius:3px;--plyr-video-controls-bg:#000;--plyr-video-control-color:#fff;--plyr-video-control-color-hover:#fff;--plyr-video-control-bg-hover:var(--plyr-color-main);--plyr-audio-controls-bg:#fff;--plyr-audio-control-color:var(--plyr-color-fiord);--plyr-audio-control-color-hover:#fff;--plyr-audio-control-bg-hover:var(--plyr-color-main)}@keyframes plyr-progress{to{background-position:25px 0}}@keyframes plyr-popup{0%{opacity:.5;transform:translateY(10px)}to{opacity:1;transform:translateY(0)}}@keyframes plyr-fade-in{from{opacity:0}to{opacity:1}}.plyr{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;direction:ltr;font-family:inherit;font-variant-numeric:tabular-nums;font-weight:500;line-height:1.7;max-width:100%;min-width:200px;position:relative;text-shadow:none;transition:box-shadow .3s ease}.plyr audio,.plyr video{border-radius:inherit;height:auto;vertical-align:middle;width:100%}.plyr button{font:inherit;line-height:inherit;width:auto}.plyr:focus{outline:0}.plyr--full-ui{box-sizing:border-box}.plyr--full-ui *,.plyr--full-ui ::after,.plyr--full-ui ::before{box-sizing:inherit}.plyr--full-ui a,.plyr--full-ui button,.plyr--full-ui button.faux-link,.plyr--full-ui input,.plyr--full-ui label{touch-action:manipulation}.plyr__badge{background:#4f5b5f;border-radius:2px;color:#fff;font-size:9px;line-height:1;padding:3px 4px}.plyr--full-ui ::-webkit-media-text-track-container{display:none}.plyr__captions{animation:plyr-fade-in .3s ease;bottom:0;color:#fff;color:var(--plyr-captions-text-color);display:none;font-size:12px;left:0;padding:10px;position:absolute;text-align:center;transition:transform .4s ease-in-out;width:100%}.plyr__captions .plyr__caption{background:rgba(0,0,0,.8);background:var(--plyr-captions-background);border-radius:2px;-webkit-box-decoration-break:clone;box-decoration-break:clone;line-height:185%;padding:.2em .5em;white-space:pre-wrap}.plyr__captions .plyr__caption div{display:inline}.plyr__captions span:empty{display:none}@media (min-width:480px){.plyr__captions{font-size:13px;padding:20px}}@media (min-width:768px){.plyr__captions{font-size:18px}}.plyr--captions-active .plyr__captions{display:block}.plyr:not(.plyr--hide-controls) .plyr__controls:not(:empty)~.plyr__captions{transform:translateY(-40px)}.plyr__control{background:0 0;border:0;border-radius:3px;border-radius:var(--plyr-control-radius);color:inherit;cursor:pointer;flex-shrink:0;overflow:visible;padding:7px;padding:var(--plyr-control-padding);position:relative;transition:all .3s ease}.plyr__control svg{display:block;fill:currentColor;height:18px;height:var(--plyr-control-icon-size);pointer-events:none;width:18px;width:var(--plyr-control-icon-size)}.plyr__control:focus{outline:0}.plyr__control.plyr__tab-focus{outline-color:#1aafff;outline-color:var(--plyr-color-main);outline-offset:2px;outline-style:dotted;outline-width:3px}a.plyr__control,button.plyr__control.faux-link{text-decoration:none}a.plyr__control::after,a.plyr__control::before,button.plyr__control.faux-link::after,button.plyr__control.faux-link::before{display:none}.plyr__control.plyr__control--pressed .icon--not-pressed,.plyr__control.plyr__control--pressed .label--not-pressed,.plyr__control:not(.plyr__control--pressed) .icon--pressed,.plyr__control:not(.plyr__control--pressed) .label--pressed{display:none}.plyr--audio .plyr__control.plyr__tab-focus,.plyr--audio .plyr__control:hover,.plyr--audio .plyr__control[aria-expanded=true]{background:#1aafff;background:var(--plyr-color-main);color:#fff}.plyr--video .plyr__control svg{filter:drop-shadow(0 1px 1px rgba(0, 0, 0, .15))}.plyr--video .plyr__control.plyr__tab-focus,.plyr--video .plyr__control:hover,.plyr--video .plyr__control[aria-expanded=true]{background:#1aafff;background:var(--plyr-audio-control-bg-hover);color:#fff;color:var(--plyr-audio-control-color-hover)}.plyr__control--overlaid{background:#1aafff;background:var(--plyr-video-control-bg-hover);border:0;border-radius:100%;box-shadow:0 1px 1px rgba(0,0,0,.15);color:#fff;color:var(--plyr-video-control-color);display:none;left:50%;padding:15px;position:absolute;top:50%;transform:translate(-50%,-50%);z-index:2}.plyr__control--overlaid svg{left:2px;position:relative}.plyr__control--overlaid:focus,.plyr__control--overlaid:hover{background:#1aafff;background:var(--plyr-video-control-bg-hover)}.plyr--playing .plyr__control--overlaid{opacity:0;visibility:hidden}.plyr--full-ui.plyr--video .plyr__control--overlaid{display:block}.plyr--full-ui ::-webkit-media-controls{display:none}.plyr__controls{align-items:center;display:flex;justify-content:flex-end;text-align:center}.plyr__controls .plyr__menu,.plyr__controls .plyr__progress,.plyr__controls .plyr__time,.plyr__controls .plyr__volume,.plyr__controls>.plyr__control{margin-left:5px}.plyr__controls .plyr__menu+.plyr__control,.plyr__controls .plyr__progress+.plyr__control,.plyr__controls>.plyr__control+.plyr__control,.plyr__controls>.plyr__control+.plyr__menu{margin-left:2px}.plyr__controls>.plyr__control:first-child,.plyr__controls>.plyr__control:first-child+[data-plyr=pause]{margin-left:0;margin-right:auto}.plyr__controls:empty{display:none}@media (min-width:480px){.plyr__controls .plyr__menu,.plyr__controls .plyr__progress,.plyr__controls .plyr__time,.plyr__controls .plyr__volume,.plyr__controls>.plyr__control{margin-left:10px}}.plyr--audio .plyr__controls{background:#fff;border-radius:inherit;color:#4f5b5f;color:var(--plyr-color-fiord);padding:10px}.plyr--video .plyr__controls{background:linear-gradient(rgba(0,0,0,0),rgba(0,0,0,.7));border-bottom-left-radius:inherit;border-bottom-right-radius:inherit;bottom:0;color:#fff;left:0;padding:20px 5px 5px;position:absolute;right:0;transition:opacity .4s ease-in-out,transform .4s ease-in-out;z-index:3}@media (min-width:480px){.plyr--video .plyr__controls{padding:35px 10px 10px}}.plyr--video.plyr--hide-controls .plyr__controls{opacity:0;pointer-events:none;transform:translateY(100%)}.plyr [data-plyr=airplay],.plyr [data-plyr=captions],.plyr [data-plyr=fullscreen],.plyr [data-plyr=pip]{display:none}.plyr--airplay-supported [data-plyr=airplay],.plyr--captions-enabled [data-plyr=captions],.plyr--fullscreen-enabled [data-plyr=fullscreen],.plyr--pip-supported [data-plyr=pip]{display:inline-block}.plyr__video-embed{height:0;padding-bottom:56.25%;position:relative}.plyr__video-embed iframe{border:0;height:100%;left:0;position:absolute;top:0;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;width:100%}.plyr--full-ui .plyr__video-embed>.plyr__video-embed__container{padding-bottom:240%;position:relative;transform:translateY(-38.28125%)}.plyr__menu{display:flex;position:relative}.plyr__menu .plyr__control svg{transition:transform .3s ease}.plyr__menu .plyr__control[aria-expanded=true] svg{transform:rotate(90deg)}.plyr__menu .plyr__control[aria-expanded=true] .plyr__tooltip{display:none}.plyr__menu__container{animation:plyr-popup .2s ease;background:rgba(255,255,255,.9);border-radius:4px;bottom:100%;box-shadow:0 1px 2px rgba(0,0,0,.15);color:#4f5b5f;font-size:13px;margin-bottom:10px;position:absolute;right:-3px;text-align:left;white-space:nowrap;z-index:3}.plyr__menu__container>div{overflow:hidden;transition:height .35s cubic-bezier(.4,0,.2,1),width .35s cubic-bezier(.4,0,.2,1)}.plyr__menu__container::after{border:4px solid transparent;border-top-color:rgba(255,255,255,.9);content:'';height:0;position:absolute;right:15px;top:100%;width:0}.plyr__menu__container [role=menu]{padding:7px}.plyr__menu__container [role=menuitem],.plyr__menu__container [role=menuitemradio]{margin-top:2px}.plyr__menu__container [role=menuitem]:first-child,.plyr__menu__container [role=menuitemradio]:first-child{margin-top:0}.plyr__menu__container .plyr__control{align-items:center;color:#4f5b5f;display:flex;font-size:13px;padding:4px 11px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;width:100%}.plyr__menu__container .plyr__control>span{align-items:inherit;display:flex;width:100%}.plyr__menu__container .plyr__control::after{border:4px solid transparent;content:'';position:absolute;top:50%;transform:translateY(-50%)}.plyr__menu__container .plyr__control--forward{padding-right:28px}.plyr__menu__container .plyr__control--forward::after{border-left-color:rgba(79,91,95,.8);right:5px}.plyr__menu__container .plyr__control--forward.plyr__tab-focus::after,.plyr__menu__container .plyr__control--forward:hover::after{border-left-color:currentColor}.plyr__menu__container .plyr__control--back{font-weight:500;margin:7px;margin-bottom:3px;padding-left:28px;position:relative;width:calc(100% - 14px)}.plyr__menu__container .plyr__control--back::after{border-right-color:rgba(79,91,95,.8);left:7px}.plyr__menu__container .plyr__control--back::before{background:#b7c5cd;box-shadow:0 1px 0 #fff;content:'';height:1px;left:0;margin-top:4px;overflow:hidden;position:absolute;right:0;top:100%}.plyr__menu__container .plyr__control--back.plyr__tab-focus::after,.plyr__menu__container .plyr__control--back:hover::after{border-right-color:currentColor}.plyr__menu__container .plyr__control[role=menuitemradio]{padding-left:7px}.plyr__menu__container .plyr__control[role=menuitemradio]::after,.plyr__menu__container .plyr__control[role=menuitemradio]::before{border-radius:100%}.plyr__menu__container .plyr__control[role=menuitemradio]::before{background:rgba(0,0,0,.1);content:'';display:block;flex-shrink:0;height:16px;margin-right:10px;transition:all .3s ease;width:16px}.plyr__menu__container .plyr__control[role=menuitemradio]::after{background:#fff;border:0;height:6px;left:12px;opacity:0;top:50%;transform:translateY(-50%) scale(0);transition:transform .3s ease,opacity .3s ease;width:6px}.plyr__menu__container .plyr__control[role=menuitemradio][aria-checked=true]::before{background:#1aafff}.plyr__menu__container .plyr__control[role=menuitemradio][aria-checked=true]::after{opacity:1;transform:translateY(-50%) scale(1)}.plyr__menu__container .plyr__control[role=menuitemradio].plyr__tab-focus::before,.plyr__menu__container .plyr__control[role=menuitemradio]:hover::before{background:rgba(0,0,0,.1)}.plyr__menu__container .plyr__menu__value{align-items:center;display:flex;margin-left:auto;margin-right:-5px;overflow:hidden;padding-left:25px;pointer-events:none}.plyr--full-ui input[type=range]{-webkit-appearance:none;background:0 0;border:0;border-radius:28px;color:#1aafff;color:var(--plyr-color-main);display:block;height:20px;margin:0;padding:0;transition:box-shadow .3s ease;width:100%}.plyr--full-ui input[type=range]::-webkit-slider-runnable-track{background:0 0;border:0;border-radius:2px;height:4px;transition:box-shadow .3s ease;-webkit-user-select:none;user-select:none;background-image:linear-gradient(to right,currentColor 0,transparent 0);background-image:linear-gradient(to right,currentColor var(--value,0),transparent var(--value,0))}.plyr--full-ui input[type=range]::-webkit-slider-thumb{background:#fff;border:0;border-radius:100%;box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2);height:14px;position:relative;transition:all .2s ease;width:14px;-webkit-appearance:none;margin-top:-5px}.plyr--full-ui input[type=range]::-moz-range-track{background:0 0;border:0;border-radius:2px;height:4px;transition:box-shadow .3s ease;-moz-user-select:none;user-select:none}.plyr--full-ui input[type=range]::-moz-range-thumb{background:#fff;border:0;border-radius:100%;box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2);height:14px;position:relative;transition:all .2s ease;width:14px}.plyr--full-ui input[type=range]::-moz-range-progress{background:currentColor;border-radius:2px;height:4px}.plyr--full-ui input[type=range]::-ms-track{background:0 0;border:0;border-radius:2px;height:4px;transition:box-shadow .3s ease;-ms-user-select:none;user-select:none;color:transparent}.plyr--full-ui input[type=range]::-ms-fill-upper{background:0 0;border:0;border-radius:2px;height:4px;transition:box-shadow .3s ease;-ms-user-select:none;user-select:none}.plyr--full-ui input[type=range]::-ms-fill-lower{background:0 0;border:0;border-radius:2px;height:4px;transition:box-shadow .3s ease;-ms-user-select:none;user-select:none;background:currentColor}.plyr--full-ui input[type=range]::-ms-thumb{background:#fff;border:0;border-radius:100%;box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2);height:14px;position:relative;transition:all .2s ease;width:14px;margin-top:0}.plyr--full-ui input[type=range]::-ms-tooltip{display:none}.plyr--full-ui input[type=range]:focus{outline:0}.plyr--full-ui input[type=range]::-moz-focus-outer{border:0}.plyr--full-ui input[type=range].plyr__tab-focus::-webkit-slider-runnable-track{outline-color:#1aafff;outline-color:var(--plyr-color-main);outline-offset:2px;outline-style:dotted;outline-width:3px}.plyr--full-ui input[type=range].plyr__tab-focus::-moz-range-track{outline-color:#1aafff;outline-color:var(--plyr-color-main);outline-offset:2px;outline-style:dotted;outline-width:3px}.plyr--full-ui input[type=range].plyr__tab-focus::-ms-track{outline-color:#1aafff;outline-color:var(--plyr-color-main);outline-offset:2px;outline-style:dotted;outline-width:3px}.plyr--full-ui.plyr--video input[type=range]::-webkit-slider-runnable-track{background-color:rgba(255,255,255,.25)}.plyr--full-ui.plyr--video input[type=range]::-moz-range-track{background-color:rgba(255,255,255,.25)}.plyr--full-ui.plyr--video input[type=range]::-ms-track{background-color:rgba(255,255,255,.25)}.plyr--full-ui.plyr--video input[type=range]:active::-webkit-slider-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(255,255,255,.5)}.plyr--full-ui.plyr--video input[type=range]:active::-moz-range-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(255,255,255,.5)}.plyr--full-ui.plyr--video input[type=range]:active::-ms-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(255,255,255,.5)}.plyr--full-ui.plyr--audio input[type=range]::-webkit-slider-runnable-track{background-color:rgba(183,197,205,.66)}.plyr--full-ui.plyr--audio input[type=range]::-moz-range-track{background-color:rgba(183,197,205,.66)}.plyr--full-ui.plyr--audio input[type=range]::-ms-track{background-color:rgba(183,197,205,.66)}.plyr--full-ui.plyr--audio input[type=range]:active::-webkit-slider-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(0,0,0,.1)}.plyr--full-ui.plyr--audio input[type=range]:active::-moz-range-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(0,0,0,.1)}.plyr--full-ui.plyr--audio input[type=range]:active::-ms-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(0,0,0,.1)}.plyr__poster{background-color:#000;background-position:50% 50%;background-repeat:no-repeat;background-size:contain;height:100%;left:0;opacity:0;position:absolute;top:0;transition:opacity .2s ease;width:100%;z-index:1}.plyr--stopped.plyr__poster-enabled .plyr__poster{opacity:1}.plyr__time{font-size:11px}.plyr__time+.plyr__time::before{content:'\2044';margin-right:10px}@media (max-width:767px){.plyr__time+.plyr__time{display:none}}.plyr--video .plyr__time{text-shadow:0 1px 1px rgba(0,0,0,.15)}.plyr__tooltip{background:rgba(255,255,255,.9);border-radius:3px;bottom:100%;box-shadow:0 1px 2px rgba(0,0,0,.15);color:#4f5b5f;font-size:12px;font-weight:500;left:50%;line-height:1.3;margin-bottom:10px;opacity:0;padding:5px 7.5px;pointer-events:none;position:absolute;transform:translate(-50%,10px) scale(.8);transform-origin:50% 100%;transition:transform .2s .1s ease,opacity .2s .1s ease;white-space:nowrap;z-index:2}.plyr__tooltip::before{border-left:4px solid transparent;border-right:4px solid transparent;border-top:4px solid rgba(255,255,255,.9);bottom:-4px;content:'';height:0;left:50%;position:absolute;transform:translateX(-50%);width:0;z-index:2}.plyr .plyr__control.plyr__tab-focus .plyr__tooltip,.plyr .plyr__control:hover .plyr__tooltip,.plyr__tooltip--visible{opacity:1;transform:translate(-50%,0) scale(1)}.plyr .plyr__control:hover .plyr__tooltip{z-index:3}.plyr__controls>.plyr__control:first-child .plyr__tooltip,.plyr__controls>.plyr__control:first-child+.plyr__control .plyr__tooltip{left:0;transform:translate(0,10px) scale(.8);transform-origin:0 100%}.plyr__controls>.plyr__control:first-child .plyr__tooltip::before,.plyr__controls>.plyr__control:first-child+.plyr__control .plyr__tooltip::before{left:16px}.plyr__controls>.plyr__control:last-child .plyr__tooltip{left:auto;right:0;transform:translate(0,10px) scale(.8);transform-origin:100% 100%}.plyr__controls>.plyr__control:last-child .plyr__tooltip::before{left:auto;right:16px;transform:translateX(50%)}.plyr__controls>.plyr__control:first-child .plyr__tooltip--visible,.plyr__controls>.plyr__control:first-child+.plyr__control .plyr__tooltip--visible,.plyr__controls>.plyr__control:first-child+.plyr__control.plyr__tab-focus .plyr__tooltip,.plyr__controls>.plyr__control:first-child+.plyr__control:hover .plyr__tooltip,.plyr__controls>.plyr__control:first-child.plyr__tab-focus .plyr__tooltip,.plyr__controls>.plyr__control:first-child:hover .plyr__tooltip,.plyr__controls>.plyr__control:last-child .plyr__tooltip--visible,.plyr__controls>.plyr__control:last-child.plyr__tab-focus .plyr__tooltip,.plyr__controls>.plyr__control:last-child:hover .plyr__tooltip{transform:translate(0,0) scale(1)}.plyr--video{background:#000;overflow:hidden}.plyr--video.plyr--menu-open{overflow:visible}.plyr__video-wrapper{background:#000;border-radius:inherit;overflow:hidden;position:relative;z-index:0}.plyr__progress{flex:1;left:7px;margin-right:14px;position:relative}.plyr__progress input[type=range],.plyr__progress__buffer{margin-left:-7px;margin-right:-7px;width:calc(100% + 14px)}.plyr__progress input[type=range]{position:relative;z-index:2}.plyr__progress .plyr__tooltip{font-size:11px;left:0}.plyr__progress__buffer{-webkit-appearance:none;background:0 0;border:0;border-radius:100px;height:4px;left:0;margin-top:-2px;padding:0;position:absolute;top:50%}.plyr__progress__buffer::-webkit-progress-bar{background:0 0;transition:width .2s ease}.plyr__progress__buffer::-webkit-progress-value{background:currentColor;border-radius:100px;min-width:4px}.plyr__progress__buffer::-moz-progress-bar{background:currentColor;border-radius:100px;min-width:4px;transition:width .2s ease}.plyr__progress__buffer::-ms-fill{border-radius:100px;transition:width .2s ease}.plyr--video .plyr__progress__buffer{box-shadow:0 1px 1px rgba(0,0,0,.15);color:rgba(255,255,255,.25)}.plyr--audio .plyr__progress__buffer{color:rgba(183,197,205,.66)}.plyr--loading .plyr__progress__buffer{animation:plyr-progress 1s linear infinite;background-image:linear-gradient(-45deg,rgba(47,52,61,.6) 25%,transparent 25%,transparent 50%,rgba(47,52,61,.6) 50%,rgba(47,52,61,.6) 75%,transparent 75%,transparent);background-repeat:repeat-x;background-size:25px 25px;color:transparent}.plyr--video.plyr--loading .plyr__progress__buffer{background-color:rgba(255,255,255,.25)}.plyr--audio.plyr--loading .plyr__progress__buffer{background-color:rgba(183,197,205,.66)}.plyr__volume{align-items:center;display:flex;flex:1;position:relative}.plyr__volume input[type=range]{margin-left:5px;position:relative;z-index:2}@media (min-width:480px){.plyr__volume{max-width:90px}}@media (min-width:768px){.plyr__volume{max-width:110px}}.plyr--is-ios .plyr__volume{display:none!important}.plyr--is-ios.plyr--vimeo [data-plyr=mute]{display:none!important}.plyr:-webkit-full-screen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-moz-full-screen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-ms-fullscreen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:fullscreen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-webkit-full-screen video{height:100%}.plyr:-moz-full-screen video{height:100%}.plyr:-ms-fullscreen video{height:100%}.plyr:fullscreen video{height:100%}.plyr:-webkit-full-screen .plyr__video-wrapper{height:100%;width:100%}.plyr:-moz-full-screen .plyr__video-wrapper{height:100%;width:100%}.plyr:-ms-fullscreen .plyr__video-wrapper{height:100%;width:100%}.plyr:fullscreen .plyr__video-wrapper{height:100%;width:100%}.plyr:-webkit-full-screen .plyr__video-embed{overflow:visible}.plyr:-moz-full-screen .plyr__video-embed{overflow:visible}.plyr:-ms-fullscreen .plyr__video-embed{overflow:visible}.plyr:fullscreen .plyr__video-embed{overflow:visible}.plyr:-webkit-full-screen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-moz-full-screen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-ms-fullscreen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:fullscreen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-webkit-full-screen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-moz-full-screen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-ms-fullscreen .plyr__control .icon--exit-fullscreen{display:block}.plyr:fullscreen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-webkit-full-screen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-moz-full-screen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-ms-fullscreen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:fullscreen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-webkit-full-screen.plyr--hide-controls{cursor:none}.plyr:-moz-full-screen.plyr--hide-controls{cursor:none}.plyr:-ms-fullscreen.plyr--hide-controls{cursor:none}.plyr:fullscreen.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr:-webkit-full-screen .plyr__captions{font-size:21px}.plyr:-moz-full-screen .plyr__captions{font-size:21px}.plyr:-ms-fullscreen .plyr__captions{font-size:21px}.plyr:fullscreen .plyr__captions{font-size:21px}}.plyr:-webkit-full-screen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-webkit-full-screen video{height:100%}.plyr:-webkit-full-screen .plyr__video-wrapper{height:100%;width:100%}.plyr:-webkit-full-screen .plyr__video-embed{overflow:visible}.plyr:-webkit-full-screen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-webkit-full-screen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-webkit-full-screen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-webkit-full-screen.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr:-webkit-full-screen .plyr__captions{font-size:21px}}.plyr:-moz-full-screen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-moz-full-screen video{height:100%}.plyr:-moz-full-screen .plyr__video-wrapper{height:100%;width:100%}.plyr:-moz-full-screen .plyr__video-embed{overflow:visible}.plyr:-moz-full-screen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-moz-full-screen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-moz-full-screen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-moz-full-screen.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr:-moz-full-screen .plyr__captions{font-size:21px}}.plyr:-ms-fullscreen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-ms-fullscreen video{height:100%}.plyr:-ms-fullscreen .plyr__video-wrapper{height:100%;width:100%}.plyr:-ms-fullscreen .plyr__video-embed{overflow:visible}.plyr:-ms-fullscreen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-ms-fullscreen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-ms-fullscreen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-ms-fullscreen.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr:-ms-fullscreen .plyr__captions{font-size:21px}}.plyr--fullscreen-fallback{background:#000;border-radius:0!important;height:100%;margin:0;width:100%;bottom:0;left:0;position:fixed;right:0;top:0;z-index:10000000}.plyr--fullscreen-fallback video{height:100%}.plyr--fullscreen-fallback .plyr__video-wrapper{height:100%;width:100%}.plyr--fullscreen-fallback .plyr__video-embed{overflow:visible}.plyr--fullscreen-fallback.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr--fullscreen-fallback .plyr__control .icon--exit-fullscreen{display:block}.plyr--fullscreen-fallback .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr--fullscreen-fallback.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr--fullscreen-fallback .plyr__captions{font-size:21px}}.plyr__ads{border-radius:inherit;bottom:0;cursor:pointer;left:0;overflow:hidden;position:absolute;right:0;top:0;z-index:-1}.plyr__ads>div,.plyr__ads>div iframe{height:100%;position:absolute;width:100%}.plyr__ads::after{background:rgba(47,52,61,.8);border-radius:2px;bottom:10px;color:#fff;content:attr(data-badge-text);font-size:11px;padding:2px 6px;pointer-events:none;position:absolute;right:10px;z-index:3}.plyr__ads::after:empty{display:none}.plyr__cues{background:currentColor;display:block;height:4px;left:0;margin:-2px 0 0;opacity:.8;position:absolute;top:50%;width:3px;z-index:3}.plyr--no-transition{transition:none!important}.plyr__sr-only{clip:rect(1px,1px,1px,1px);overflow:hidden;border:0!important;height:1px!important;padding:0!important;position:absolute!important;width:1px!important}.plyr [hidden]{display:none!important}.no-border{border:0}[hidden]{display:none}.sr-only{border:0;clip:rect(0 0 0 0);height:1px;margin:-1px;opacity:.001;overflow:hidden;padding:0;position:absolute;width:1px}
\ No newline at end of file +@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:300;src:url(https://cdn.plyr.io/static/fonts/gordita-light.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-light.woff) format("woff")}@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:400;src:url(https://cdn.plyr.io/static/fonts/gordita-regular.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-regular.woff) format("woff")}@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:500;src:url(https://cdn.plyr.io/static/fonts/gordita-medium.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-medium.woff) format("woff")}@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:600;src:url(https://cdn.plyr.io/static/fonts/gordita-bold.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-bold.woff) format("woff")}@font-face{font-display:swap;font-family:Gordita;font-style:normal;font-weight:900;src:url(https://cdn.plyr.io/static/fonts/gordita-black.woff2) format("woff2"),url(https://cdn.plyr.io/static/fonts/gordita-black.woff) format("woff")}@keyframes fadein{0%{opacity:0}100%{opacity:1}}/*! normalize.css v7.0.0 | MIT License | github.com/necolas/normalize.css */html{line-height:1.15;-ms-text-size-adjust:100%;-webkit-text-size-adjust:100%}body{margin:0}article,aside,footer,header,nav,section{display:block}h1{font-size:2em;margin:.67em 0}figcaption,figure,main{display:block}figure{margin:1em 40px}hr{box-sizing:content-box;height:0;overflow:visible}pre{font-family:monospace,monospace;font-size:1em}a,button.faux-link{background-color:transparent;-webkit-text-decoration-skip:objects}abbr[title]{border-bottom:none;text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted}b,strong{font-weight:inherit}b,strong{font-weight:bolder}code,kbd,samp{font-family:monospace,monospace;font-size:1em}dfn{font-style:italic}mark{background-color:#ff0;color:#000}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}audio,video{display:inline-block}audio:not([controls]){display:none;height:0}img{border-style:none}svg:not(:root){overflow:hidden}button,input,optgroup,select,textarea{font-family:sans-serif;font-size:100%;line-height:1.15;margin:0}button,input{overflow:visible}button,select{text-transform:none}[type=reset],[type=submit],button,html [type=button]{-webkit-appearance:button}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{border-style:none;padding:0}[type=button]:-moz-focusring,[type=reset]:-moz-focusring,[type=submit]:-moz-focusring,button:-moz-focusring{outline:1px dotted ButtonText}fieldset{padding:.35em .75em .625em}legend{box-sizing:border-box;color:inherit;display:table;max-width:100%;padding:0;white-space:normal}progress{display:inline-block;vertical-align:baseline}textarea{overflow:auto}[type=checkbox],[type=radio]{box-sizing:border-box;padding:0}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}details,menu{display:block}summary{display:list-item}canvas{display:inline-block}template{display:none}[hidden]{display:none}*,::after,::before{box-sizing:border-box}body,html{display:flex;width:100%}html{background:linear-gradient(to left top,#4dc1ff,#0074b3);background-attachment:fixed;height:100%}body{align-items:center;display:flex;flex-direction:column;min-height:100%}.grid{flex:1;overflow:auto}main{margin:auto;padding-bottom:1px;text-align:center}aside{align-items:center;background:#fff;color:#55646b;display:flex;flex-shrink:0;justify-content:center;padding:15px;position:relative;text-align:center;text-shadow:none;width:100%}aside .icon{fill:#4baaf4;margin-right:10px}aside p{margin:0}aside a,aside button.faux-link{color:#4baaf4}aside a.tab-focus,aside button.tab-focus.faux-link{box-shadow:0 0 0 3px rgba(75,170,244,.35);outline:0}.grid{margin:0 auto;padding:20px}@media only screen and (min-width:768px){.grid{align-items:center;display:flex;max-width:1260px;width:100%}.grid>*{flex:1}}html{font-size:100%}body{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;font-size:15px;font-size:.9375rem;color:#fff;font-family:Gordita,Avenir,"Helvetica Neue",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-weight:500;line-height:1.75;text-shadow:0 1px 1px rgba(0,0,0,.15)}button,input,select,textarea{font:inherit}p,small{margin:0 0 20px}small{font-size:13px;font-size:.8125rem;display:block}h1{font-size:64px;font-size:4rem;font-weight:600;letter-spacing:-.025em;line-height:1.2;margin:0 0 20px}.button,.button__count{align-items:center;background:#fff;border:0;border-radius:4px;box-shadow:0 1px 1px rgba(0,0,0,.1);color:#55646b;display:inline-flex;padding:15px;position:relative;text-shadow:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;vertical-align:middle}.button{font-weight:600;padding-left:20px;padding-right:20px;transition:all .2s ease}.button:focus,.button:hover{color:#343f4a}.button:focus::after,.button:hover::after{display:none}.button:hover{box-shadow:0 2px 2px rgba(0,0,0,.1);transform:translateY(-1px)}.button:focus{outline:0}.button.tab-focus{box-shadow:0 0 0 3px rgba(255,255,255,.35);outline:0}.button:active{transform:translateY(1px)}.button--with-count{display:inline-flex}.button--with-count .button .icon{flex-shrink:0}.button__count{animation:fadein .2s ease;margin-left:10px}.button__count::before{border:5px solid transparent;border-left-width:0;border-right-color:#fff;content:'';height:0;position:absolute;right:100%;top:50%;transform:translateY(-50%);width:0}header{padding-bottom:20px;text-align:center}header .call-to-action{margin-top:30px}@media only screen and (min-width:768px){header{margin-right:60px;max-width:360px;padding-bottom:40px;text-align:left}}.icon{fill:currentColor;height:16px;vertical-align:-3px;width:16px}a svg,button svg,button.faux-link svg,label svg{pointer-events:none}.btn .icon,a .icon,button.faux-link .icon{margin-right:6px}button.faux-link{background:0 0;border:0;border-radius:0;cursor:pointer;font:inherit;line-height:1.75;margin:0;padding:0;position:relative;text-align:inherit;text-shadow:inherit;-moz-user-select:text;vertical-align:baseline;width:auto}a,button.faux-link{border-bottom:1px dotted currentColor;color:#fff;font-weight:600;position:relative;text-decoration:none;transition:all .2s ease}a::after,button.faux-link::after{background:currentColor;content:'';height:1px;left:50%;position:absolute;top:100%;transform:translateX(-50%);transition:width .2s ease;width:0}a:focus,a:hover,button.faux-link:focus,button.faux-link:hover{border-bottom-color:transparent;outline:0}a:focus::after,a:hover::after,button.faux-link:focus::after,button.faux-link:hover::after{width:100%}a.tab-focus,button.tab-focus.faux-link{box-shadow:0 0 0 3px rgba(255,255,255,.35);outline:0}a.no-border::after,button.no-border.faux-link::after{display:none}li,ul{list-style:none;margin:0;padding:0}audio,img,video{max-width:100%;vertical-align:middle}nav{display:flex;justify-content:center;margin-bottom:20px}video{max-width:100%;vertical-align:middle}.plyr{border-radius:4px;box-shadow:0 2px 5px rgba(0,0,0,.2);margin:20px auto}.plyr.plyr--audio{max-width:480px}.plyr__video-wrapper::after{border:1px solid rgba(0,0,0,.15);border-radius:inherit;bottom:0;content:'';left:0;pointer-events:none;position:absolute;right:0;top:0;z-index:3}.plyr__cite{display:none;margin-top:20px}.plyr__cite .icon{margin-right:4px}.plyr--audio~ul .plyr__cite--audio,.plyr--video:not(.plyr--youtube):not(.plyr--vimeo)~ul .plyr__cite--video,.plyr--vimeo~ul .plyr__cite--vimeo,.plyr--youtube~ul .plyr__cite--youtube{display:block}:root{--plyr-color-main:#1aafff;--plyr-color-gunmetal:#2f343d;--plyr-color-fiord:#4f5b5f;--plyr-color-lynch:#6b7d85;--plyr-color-heather:#b7c5cd}:root{--plyr-tab-focus-default-color:#1aafff}:root{--plyr-captions-background:rgba(0, 0, 0, 0.8);--plyr-captions-text-color:#fff}:root{--plyr-control-icon-size:18px;--plyr-control-spacing:10px;--plyr-control-padding:7px;--plyr-control-radius:3px;--plyr-video-controls-bg:#000;--plyr-video-control-color:#fff;--plyr-video-control-color-hover:#fff;--plyr-video-control-bg-hover:var(--plyr-color-main);--plyr-audio-controls-bg:#fff;--plyr-audio-control-color:var(--plyr-color-fiord);--plyr-audio-control-color-hover:#fff;--plyr-audio-control-bg-hover:var(--plyr-color-main)}@keyframes plyr-progress{to{background-position:25px 0}}@keyframes plyr-popup{0%{opacity:.5;transform:translateY(10px)}to{opacity:1;transform:translateY(0)}}@keyframes plyr-fade-in{from{opacity:0}to{opacity:1}}.plyr{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;direction:ltr;font-family:inherit;font-variant-numeric:tabular-nums;font-weight:500;line-height:1.7;max-width:100%;min-width:200px;position:relative;text-shadow:none;transition:box-shadow .3s ease}.plyr audio,.plyr video{border-radius:inherit;height:auto;vertical-align:middle;width:100%}.plyr button{font:inherit;line-height:inherit;width:auto}.plyr:focus{outline:0}.plyr--full-ui{box-sizing:border-box}.plyr--full-ui *,.plyr--full-ui ::after,.plyr--full-ui ::before{box-sizing:inherit}.plyr--full-ui a,.plyr--full-ui button,.plyr--full-ui button.faux-link,.plyr--full-ui input,.plyr--full-ui label{touch-action:manipulation}.plyr__badge{background:#4f5b5f;border-radius:2px;color:#fff;font-size:9px;line-height:1;padding:3px 4px}.plyr--full-ui ::-webkit-media-text-track-container{display:none}.plyr__captions{animation:plyr-fade-in .3s ease;bottom:0;color:#fff;color:var(--plyr-captions-text-color);display:none;font-size:12px;left:0;padding:10px;position:absolute;text-align:center;transition:transform .4s ease-in-out;width:100%}.plyr__captions .plyr__caption{background:rgba(0,0,0,.8);background:var(--plyr-captions-background);border-radius:2px;-webkit-box-decoration-break:clone;box-decoration-break:clone;line-height:185%;padding:.2em .5em;white-space:pre-wrap}.plyr__captions .plyr__caption div{display:inline}.plyr__captions span:empty{display:none}@media (min-width:480px){.plyr__captions{font-size:13px;padding:20px}}@media (min-width:768px){.plyr__captions{font-size:18px}}.plyr--captions-active .plyr__captions{display:block}.plyr:not(.plyr--hide-controls) .plyr__controls:not(:empty)~.plyr__captions{transform:translateY(-40px)}.plyr__control{background:0 0;border:0;border-radius:3px;border-radius:var(--plyr-control-radius);color:inherit;cursor:pointer;flex-shrink:0;overflow:visible;padding:7px;padding:var(--plyr-control-padding);position:relative;transition:all .3s ease}.plyr__control svg{display:block;fill:currentColor;height:18px;height:var(--plyr-control-icon-size);pointer-events:none;width:18px;width:var(--plyr-control-icon-size)}.plyr__control:focus{outline:0}.plyr__control.plyr__tab-focus{outline-color:#1aafff;outline-color:var(--plyr-color-main);outline-offset:2px;outline-style:dotted;outline-width:3px}a.plyr__control,button.plyr__control.faux-link{text-decoration:none}a.plyr__control::after,a.plyr__control::before,button.plyr__control.faux-link::after,button.plyr__control.faux-link::before{display:none}.plyr__control.plyr__control--pressed .icon--not-pressed,.plyr__control.plyr__control--pressed .label--not-pressed,.plyr__control:not(.plyr__control--pressed) .icon--pressed,.plyr__control:not(.plyr__control--pressed) .label--pressed{display:none}.plyr--audio .plyr__control.plyr__tab-focus,.plyr--audio .plyr__control:hover,.plyr--audio .plyr__control[aria-expanded=true]{background:#1aafff;background:var(--plyr-color-main);color:#fff}.plyr--video .plyr__control svg{filter:drop-shadow(0 1px 1px rgba(0, 0, 0, .15))}.plyr--video .plyr__control.plyr__tab-focus,.plyr--video .plyr__control:hover,.plyr--video .plyr__control[aria-expanded=true]{background:#1aafff;background:var(--plyr-video-control-bg-hover);color:#fff;color:var(--plyr-video-control-color-hover)}.plyr__control--overlaid{background:#1aafff;background:var(--plyr-video-control-bg-hover);border:0;border-radius:100%;box-shadow:0 1px 1px rgba(0,0,0,.15);color:#fff;color:var(--plyr-video-control-color);display:none;left:50%;padding:15px;position:absolute;top:50%;transform:translate(-50%,-50%);z-index:2}.plyr__control--overlaid svg{left:2px;position:relative}.plyr__control--overlaid:focus,.plyr__control--overlaid:hover{background:#1aafff;background:var(--plyr-video-control-bg-hover)}.plyr--playing .plyr__control--overlaid{opacity:0;visibility:hidden}.plyr--full-ui.plyr--video .plyr__control--overlaid{display:block}.plyr--full-ui ::-webkit-media-controls{display:none}.plyr__controls{align-items:center;display:flex;justify-content:flex-end;text-align:center}.plyr__controls .plyr__menu,.plyr__controls .plyr__progress,.plyr__controls .plyr__time,.plyr__controls .plyr__volume,.plyr__controls>.plyr__control{margin-left:5px}.plyr__controls .plyr__menu+.plyr__control,.plyr__controls .plyr__progress+.plyr__control,.plyr__controls>.plyr__control+.plyr__control,.plyr__controls>.plyr__control+.plyr__menu{margin-left:2px}.plyr__controls>.plyr__control:first-child,.plyr__controls>.plyr__control:first-child+[data-plyr=pause]{margin-left:0;margin-right:auto}.plyr__controls:empty{display:none}@media (min-width:480px){.plyr__controls .plyr__menu,.plyr__controls .plyr__progress,.plyr__controls .plyr__time,.plyr__controls .plyr__volume,.plyr__controls>.plyr__control{margin-left:10px}}.plyr--audio .plyr__controls{background:#fff;border-radius:inherit;color:#4f5b5f;color:var(--plyr-color-fiord);padding:10px}.plyr--video .plyr__controls{background:linear-gradient(rgba(0,0,0,0),rgba(0,0,0,.7));border-bottom-left-radius:inherit;border-bottom-right-radius:inherit;bottom:0;color:#fff;left:0;padding:20px 5px 5px;position:absolute;right:0;transition:opacity .4s ease-in-out,transform .4s ease-in-out;z-index:3}@media (min-width:480px){.plyr--video .plyr__controls{padding:35px 10px 10px}}.plyr--video.plyr--hide-controls .plyr__controls{opacity:0;pointer-events:none;transform:translateY(100%)}.plyr [data-plyr=airplay],.plyr [data-plyr=captions],.plyr [data-plyr=fullscreen],.plyr [data-plyr=pip]{display:none}.plyr--airplay-supported [data-plyr=airplay],.plyr--captions-enabled [data-plyr=captions],.plyr--fullscreen-enabled [data-plyr=fullscreen],.plyr--pip-supported [data-plyr=pip]{display:inline-block}.plyr__video-embed{height:0;padding-bottom:56.25%;position:relative}.plyr__video-embed iframe{border:0;height:100%;left:0;position:absolute;top:0;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;width:100%}.plyr--full-ui .plyr__video-embed>.plyr__video-embed__container{padding-bottom:240%;position:relative;transform:translateY(-38.28125%)}.plyr__menu{display:flex;position:relative}.plyr__menu .plyr__control svg{transition:transform .3s ease}.plyr__menu .plyr__control[aria-expanded=true] svg{transform:rotate(90deg)}.plyr__menu .plyr__control[aria-expanded=true] .plyr__tooltip{display:none}.plyr__menu__container{animation:plyr-popup .2s ease;background:rgba(255,255,255,.9);border-radius:4px;bottom:100%;box-shadow:0 1px 2px rgba(0,0,0,.15);color:#4f5b5f;font-size:13px;margin-bottom:10px;position:absolute;right:-3px;text-align:left;white-space:nowrap;z-index:3}.plyr__menu__container>div{overflow:hidden;transition:height .35s cubic-bezier(.4,0,.2,1),width .35s cubic-bezier(.4,0,.2,1)}.plyr__menu__container::after{border:4px solid transparent;border-top-color:rgba(255,255,255,.9);content:'';height:0;position:absolute;right:15px;top:100%;width:0}.plyr__menu__container [role=menu]{padding:7px}.plyr__menu__container [role=menuitem],.plyr__menu__container [role=menuitemradio]{margin-top:2px}.plyr__menu__container [role=menuitem]:first-child,.plyr__menu__container [role=menuitemradio]:first-child{margin-top:0}.plyr__menu__container .plyr__control{align-items:center;color:#4f5b5f;display:flex;font-size:13px;padding:4px 11px;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;width:100%}.plyr__menu__container .plyr__control>span{align-items:inherit;display:flex;width:100%}.plyr__menu__container .plyr__control::after{border:4px solid transparent;content:'';position:absolute;top:50%;transform:translateY(-50%)}.plyr__menu__container .plyr__control--forward{padding-right:28px}.plyr__menu__container .plyr__control--forward::after{border-left-color:rgba(79,91,95,.8);right:5px}.plyr__menu__container .plyr__control--forward.plyr__tab-focus::after,.plyr__menu__container .plyr__control--forward:hover::after{border-left-color:currentColor}.plyr__menu__container .plyr__control--back{font-weight:500;margin:7px;margin-bottom:3px;padding-left:28px;position:relative;width:calc(100% - 14px)}.plyr__menu__container .plyr__control--back::after{border-right-color:rgba(79,91,95,.8);left:7px}.plyr__menu__container .plyr__control--back::before{background:#b7c5cd;box-shadow:0 1px 0 #fff;content:'';height:1px;left:0;margin-top:4px;overflow:hidden;position:absolute;right:0;top:100%}.plyr__menu__container .plyr__control--back.plyr__tab-focus::after,.plyr__menu__container .plyr__control--back:hover::after{border-right-color:currentColor}.plyr__menu__container .plyr__control[role=menuitemradio]{padding-left:7px}.plyr__menu__container .plyr__control[role=menuitemradio]::after,.plyr__menu__container .plyr__control[role=menuitemradio]::before{border-radius:100%}.plyr__menu__container .plyr__control[role=menuitemradio]::before{background:rgba(0,0,0,.1);content:'';display:block;flex-shrink:0;height:16px;margin-right:10px;transition:all .3s ease;width:16px}.plyr__menu__container .plyr__control[role=menuitemradio]::after{background:#fff;border:0;height:6px;left:12px;opacity:0;top:50%;transform:translateY(-50%) scale(0);transition:transform .3s ease,opacity .3s ease;width:6px}.plyr__menu__container .plyr__control[role=menuitemradio][aria-checked=true]::before{background:#1aafff}.plyr__menu__container .plyr__control[role=menuitemradio][aria-checked=true]::after{opacity:1;transform:translateY(-50%) scale(1)}.plyr__menu__container .plyr__control[role=menuitemradio].plyr__tab-focus::before,.plyr__menu__container .plyr__control[role=menuitemradio]:hover::before{background:rgba(0,0,0,.1)}.plyr__menu__container .plyr__menu__value{align-items:center;display:flex;margin-left:auto;margin-right:-5px;overflow:hidden;padding-left:25px;pointer-events:none}.plyr--full-ui input[type=range]{-webkit-appearance:none;background:0 0;border:0;border-radius:26px;color:#1aafff;color:var(--plyr-color-main);display:block;height:19px;margin:0;padding:0;transition:box-shadow .3s ease;width:100%}.plyr--full-ui input[type=range]::-webkit-slider-runnable-track{background:0 0;border:0;border-radius:2.5px;height:5px;transition:box-shadow .3s ease;-webkit-user-select:none;user-select:none;background-image:linear-gradient(to right,currentColor 0,transparent 0);background-image:linear-gradient(to right,currentColor var(--value,0),transparent var(--value,0))}.plyr--full-ui input[type=range]::-webkit-slider-thumb{background:#fff;border:0;border-radius:100%;box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2);height:13px;position:relative;transition:all .2s ease;width:13px;-webkit-appearance:none;margin-top:-4px}.plyr--full-ui input[type=range]::-moz-range-track{background:0 0;border:0;border-radius:2.5px;height:5px;transition:box-shadow .3s ease;-moz-user-select:none;user-select:none}.plyr--full-ui input[type=range]::-moz-range-thumb{background:#fff;border:0;border-radius:100%;box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2);height:13px;position:relative;transition:all .2s ease;width:13px}.plyr--full-ui input[type=range]::-moz-range-progress{background:currentColor;border-radius:2.5px;height:5px}.plyr--full-ui input[type=range]::-ms-track{background:0 0;border:0;border-radius:2.5px;height:5px;transition:box-shadow .3s ease;-ms-user-select:none;user-select:none;color:transparent}.plyr--full-ui input[type=range]::-ms-fill-upper{background:0 0;border:0;border-radius:2.5px;height:5px;transition:box-shadow .3s ease;-ms-user-select:none;user-select:none}.plyr--full-ui input[type=range]::-ms-fill-lower{background:0 0;border:0;border-radius:2.5px;height:5px;transition:box-shadow .3s ease;-ms-user-select:none;user-select:none;background:currentColor}.plyr--full-ui input[type=range]::-ms-thumb{background:#fff;border:0;border-radius:100%;box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2);height:13px;position:relative;transition:all .2s ease;width:13px;margin-top:0}.plyr--full-ui input[type=range]::-ms-tooltip{display:none}.plyr--full-ui input[type=range]:focus{outline:0}.plyr--full-ui input[type=range]::-moz-focus-outer{border:0}.plyr--full-ui input[type=range].plyr__tab-focus::-webkit-slider-runnable-track{outline-color:#1aafff;outline-color:var(--plyr-color-main);outline-offset:2px;outline-style:dotted;outline-width:3px}.plyr--full-ui input[type=range].plyr__tab-focus::-moz-range-track{outline-color:#1aafff;outline-color:var(--plyr-color-main);outline-offset:2px;outline-style:dotted;outline-width:3px}.plyr--full-ui input[type=range].plyr__tab-focus::-ms-track{outline-color:#1aafff;outline-color:var(--plyr-color-main);outline-offset:2px;outline-style:dotted;outline-width:3px}.plyr--full-ui.plyr--video input[type=range]::-webkit-slider-runnable-track{background-color:rgba(255,255,255,.25)}.plyr--full-ui.plyr--video input[type=range]::-moz-range-track{background-color:rgba(255,255,255,.25)}.plyr--full-ui.plyr--video input[type=range]::-ms-track{background-color:rgba(255,255,255,.25)}.plyr--full-ui.plyr--video input[type=range]:active::-webkit-slider-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(255,255,255,.5)}.plyr--full-ui.plyr--video input[type=range]:active::-moz-range-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(255,255,255,.5)}.plyr--full-ui.plyr--video input[type=range]:active::-ms-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(255,255,255,.5)}.plyr--full-ui.plyr--audio input[type=range]::-webkit-slider-runnable-track{background-color:rgba(183,197,205,.66)}.plyr--full-ui.plyr--audio input[type=range]::-moz-range-track{background-color:rgba(183,197,205,.66)}.plyr--full-ui.plyr--audio input[type=range]::-ms-track{background-color:rgba(183,197,205,.66)}.plyr--full-ui.plyr--audio input[type=range]:active::-webkit-slider-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(0,0,0,.1)}.plyr--full-ui.plyr--audio input[type=range]:active::-moz-range-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(0,0,0,.1)}.plyr--full-ui.plyr--audio input[type=range]:active::-ms-thumb{box-shadow:0 1px 1px rgba(0,0,0,.15),0 0 0 1px rgba(47,52,61,.2),0 0 0 3px rgba(0,0,0,.1)}.plyr__poster{background-color:#000;background-position:50% 50%;background-repeat:no-repeat;background-size:contain;height:100%;left:0;opacity:0;position:absolute;top:0;transition:opacity .2s ease;width:100%;z-index:1}.plyr--stopped.plyr__poster-enabled .plyr__poster{opacity:1}.plyr__time{font-size:11px}.plyr__time+.plyr__time::before{content:'\2044';margin-right:10px}@media (max-width:767px){.plyr__time+.plyr__time{display:none}}.plyr--video .plyr__time{text-shadow:0 1px 1px rgba(0,0,0,.15)}.plyr__tooltip{background:rgba(255,255,255,.9);border-radius:3px;bottom:100%;box-shadow:0 1px 2px rgba(0,0,0,.15);color:#4f5b5f;font-size:12px;font-weight:500;left:50%;line-height:1.3;margin-bottom:10px;opacity:0;padding:5px 7.5px;pointer-events:none;position:absolute;transform:translate(-50%,10px) scale(.8);transform-origin:50% 100%;transition:transform .2s .1s ease,opacity .2s .1s ease;white-space:nowrap;z-index:2}.plyr__tooltip::before{border-left:4px solid transparent;border-right:4px solid transparent;border-top:4px solid rgba(255,255,255,.9);bottom:-4px;content:'';height:0;left:50%;position:absolute;transform:translateX(-50%);width:0;z-index:2}.plyr .plyr__control.plyr__tab-focus .plyr__tooltip,.plyr .plyr__control:hover .plyr__tooltip,.plyr__tooltip--visible{opacity:1;transform:translate(-50%,0) scale(1)}.plyr .plyr__control:hover .plyr__tooltip{z-index:3}.plyr__controls>.plyr__control:first-child .plyr__tooltip,.plyr__controls>.plyr__control:first-child+.plyr__control .plyr__tooltip{left:0;transform:translate(0,10px) scale(.8);transform-origin:0 100%}.plyr__controls>.plyr__control:first-child .plyr__tooltip::before,.plyr__controls>.plyr__control:first-child+.plyr__control .plyr__tooltip::before{left:16px}.plyr__controls>.plyr__control:last-child .plyr__tooltip{left:auto;right:0;transform:translate(0,10px) scale(.8);transform-origin:100% 100%}.plyr__controls>.plyr__control:last-child .plyr__tooltip::before{left:auto;right:16px;transform:translateX(50%)}.plyr__controls>.plyr__control:first-child .plyr__tooltip--visible,.plyr__controls>.plyr__control:first-child+.plyr__control .plyr__tooltip--visible,.plyr__controls>.plyr__control:first-child+.plyr__control.plyr__tab-focus .plyr__tooltip,.plyr__controls>.plyr__control:first-child+.plyr__control:hover .plyr__tooltip,.plyr__controls>.plyr__control:first-child.plyr__tab-focus .plyr__tooltip,.plyr__controls>.plyr__control:first-child:hover .plyr__tooltip,.plyr__controls>.plyr__control:last-child .plyr__tooltip--visible,.plyr__controls>.plyr__control:last-child.plyr__tab-focus .plyr__tooltip,.plyr__controls>.plyr__control:last-child:hover .plyr__tooltip{transform:translate(0,0) scale(1)}.plyr--video{background:#000;overflow:hidden}.plyr--video.plyr--menu-open{overflow:visible}.plyr__video-wrapper{background:#000;border-radius:inherit;overflow:hidden;position:relative;z-index:0}.plyr__progress{flex:1;left:6.5px;margin-right:13px;position:relative}.plyr__progress input[type=range],.plyr__progress__buffer{margin-left:-6.5px;margin-right:-6.5px;width:calc(100% + 13px)}.plyr__progress input[type=range]{position:relative;z-index:2}.plyr__progress .plyr__tooltip{font-size:11px;left:0}.plyr__progress__buffer{-webkit-appearance:none;background:0 0;border:0;border-radius:100px;height:5px;left:0;margin-top:-2.5px;padding:0;position:absolute;top:50%}.plyr__progress__buffer::-webkit-progress-bar{background:0 0}.plyr__progress__buffer::-webkit-progress-value{background:currentColor;border-radius:100px;min-width:5px;transition:width .2s ease}.plyr__progress__buffer::-moz-progress-bar{background:currentColor;border-radius:100px;min-width:5px;transition:width .2s ease}.plyr__progress__buffer::-ms-fill{border-radius:100px;transition:width .2s ease}.plyr--video .plyr__progress__buffer{box-shadow:0 1px 1px rgba(0,0,0,.15);color:rgba(255,255,255,.25)}.plyr--audio .plyr__progress__buffer{color:rgba(183,197,205,.66)}.plyr--loading .plyr__progress__buffer{animation:plyr-progress 1s linear infinite;background-image:linear-gradient(-45deg,rgba(47,52,61,.6) 25%,transparent 25%,transparent 50%,rgba(47,52,61,.6) 50%,rgba(47,52,61,.6) 75%,transparent 75%,transparent);background-repeat:repeat-x;background-size:25px 25px;color:transparent}.plyr--video.plyr--loading .plyr__progress__buffer{background-color:rgba(255,255,255,.25)}.plyr--audio.plyr--loading .plyr__progress__buffer{background-color:rgba(183,197,205,.66)}.plyr__volume{align-items:center;display:flex;flex:1;position:relative}.plyr__volume input[type=range]{margin-left:5px;position:relative;z-index:2}@media (min-width:480px){.plyr__volume{max-width:90px}}@media (min-width:768px){.plyr__volume{max-width:110px}}.plyr--is-ios .plyr__volume{display:none!important}.plyr--is-ios.plyr--vimeo [data-plyr=mute]{display:none!important}.plyr:-webkit-full-screen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-ms-fullscreen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:fullscreen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-webkit-full-screen video{height:100%}.plyr:-ms-fullscreen video{height:100%}.plyr:fullscreen video{height:100%}.plyr:-webkit-full-screen .plyr__video-wrapper{height:100%;width:100%}.plyr:-ms-fullscreen .plyr__video-wrapper{height:100%;width:100%}.plyr:fullscreen .plyr__video-wrapper{height:100%;width:100%}.plyr:-webkit-full-screen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-ms-fullscreen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:fullscreen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-webkit-full-screen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-ms-fullscreen .plyr__control .icon--exit-fullscreen{display:block}.plyr:fullscreen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-webkit-full-screen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-ms-fullscreen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:fullscreen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-webkit-full-screen.plyr--hide-controls{cursor:none}.plyr:-ms-fullscreen.plyr--hide-controls{cursor:none}.plyr:fullscreen.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr:-webkit-full-screen .plyr__captions{font-size:21px}.plyr:-ms-fullscreen .plyr__captions{font-size:21px}.plyr:fullscreen .plyr__captions{font-size:21px}}.plyr:-webkit-full-screen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-webkit-full-screen video{height:100%}.plyr:-webkit-full-screen .plyr__video-wrapper{height:100%;width:100%}.plyr:-webkit-full-screen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-webkit-full-screen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-webkit-full-screen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-webkit-full-screen.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr:-webkit-full-screen .plyr__captions{font-size:21px}}.plyr:-moz-full-screen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-moz-full-screen video{height:100%}.plyr:-moz-full-screen .plyr__video-wrapper{height:100%;width:100%}.plyr:-moz-full-screen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-moz-full-screen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-moz-full-screen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-moz-full-screen.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr:-moz-full-screen .plyr__captions{font-size:21px}}.plyr:-ms-fullscreen{background:#000;border-radius:0!important;height:100%;margin:0;width:100%}.plyr:-ms-fullscreen video{height:100%}.plyr:-ms-fullscreen .plyr__video-wrapper{height:100%;width:100%}.plyr:-ms-fullscreen.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr:-ms-fullscreen .plyr__control .icon--exit-fullscreen{display:block}.plyr:-ms-fullscreen .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr:-ms-fullscreen.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr:-ms-fullscreen .plyr__captions{font-size:21px}}.plyr--fullscreen-fallback{background:#000;border-radius:0!important;height:100%;margin:0;width:100%;bottom:0;left:0;position:fixed;right:0;top:0;z-index:10000000}.plyr--fullscreen-fallback video{height:100%}.plyr--fullscreen-fallback .plyr__video-wrapper{height:100%;width:100%}.plyr--fullscreen-fallback.plyr--vimeo .plyr__video-wrapper{height:0;top:50%;transform:translateY(-50%)}.plyr--fullscreen-fallback .plyr__control .icon--exit-fullscreen{display:block}.plyr--fullscreen-fallback .plyr__control .icon--exit-fullscreen+svg{display:none}.plyr--fullscreen-fallback.plyr--hide-controls{cursor:none}@media (min-width:1024px){.plyr--fullscreen-fallback .plyr__captions{font-size:21px}}.plyr__ads{border-radius:inherit;bottom:0;cursor:pointer;left:0;overflow:hidden;position:absolute;right:0;top:0;z-index:-1}.plyr__ads>div,.plyr__ads>div iframe{height:100%;position:absolute;width:100%}.plyr__ads::after{background:rgba(47,52,61,.8);border-radius:2px;bottom:10px;color:#fff;content:attr(data-badge-text);font-size:11px;padding:2px 6px;pointer-events:none;position:absolute;right:10px;z-index:3}.plyr__ads::after:empty{display:none}.plyr__cues{background:currentColor;display:block;height:5px;left:0;margin:-2.5px 0 0;opacity:.8;position:absolute;top:50%;width:3px;z-index:3}.plyr__preview-thumb{background-color:rgba(255,255,255,.9);border-radius:3px;bottom:100%;box-shadow:0 1px 2px rgba(0,0,0,.15);margin-bottom:10px;opacity:0;padding:3px;pointer-events:none;position:absolute;transform:translate(0,10px) scale(.8);transform-origin:50% 100%;transition:transform .2s .1s ease,opacity .2s .1s ease;z-index:2}.plyr__preview-thumb--is-shown{opacity:1;transform:translate(0,0) scale(1)}.plyr__preview-thumb::before{border-left:4px solid transparent;border-right:4px solid transparent;border-top:4px solid rgba(255,255,255,.9);bottom:-4px;content:'';height:0;left:50%;position:absolute;transform:translateX(-50%);width:0;z-index:2}.plyr__preview-thumb__image-container{background:#b7c5cd;border-radius:2px;overflow:hidden;position:relative;z-index:0}.plyr__preview-thumb__image-container img{height:100%;left:0;max-height:none;max-width:none;position:absolute;top:0;width:100%}.plyr__preview-thumb__time-container{bottom:6px;left:0;position:absolute;right:0;white-space:nowrap;z-index:3}.plyr__preview-thumb__time-container span{background-color:rgba(0,0,0,.55);border-radius:2px;color:#fff;font-size:11px;padding:3px 6px}.plyr__preview-scrubbing{bottom:0;filter:blur(1px);height:100%;left:0;margin:auto;opacity:0;overflow:hidden;position:absolute;right:0;top:0;transition:opacity .3s ease;width:100%;z-index:1}.plyr__preview-scrubbing--is-shown{opacity:1}.plyr__preview-scrubbing img{height:100%;left:0;max-height:none;max-width:none;-o-object-fit:contain;object-fit:contain;position:absolute;top:0;width:100%}.plyr--no-transition{transition:none!important}.plyr__sr-only{clip:rect(1px,1px,1px,1px);overflow:hidden;border:0!important;height:1px!important;padding:0!important;position:absolute!important;width:1px!important}.plyr [hidden]{display:none!important}.no-border{border:0}[hidden]{display:none}.sr-only{border:0;clip:rect(0 0 0 0);height:1px;margin:-1px;opacity:.001;overflow:hidden;padding:0;position:absolute;width:1px}
\ No newline at end of file diff --git a/demo/dist/demo.js b/demo/dist/demo.js index e3d4e6c2..30103056 100644 --- a/demo/dist/demo.js +++ b/demo/dist/demo.js @@ -7,107 +7,211 @@ typeof navigator === "object" && (function () { return module = { exports: {} }, fn(module, module.exports), module.exports; } - var stringify_1 = createCommonjsModule(function (module, exports) { - /* - json-stringify-safe - Like JSON.stringify, but doesn't throw on circular references. + function _typeof(obj) { + if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { + _typeof = function (obj) { + return typeof obj; + }; + } else { + _typeof = function (obj) { + return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; + }; + } + + return _typeof(obj); + } - Originally forked from https://github.com/isaacs/json-stringify-safe - version 5.0.1 on 3/8/2017 and modified to handle Errors serialization - and IE8 compatibility. Tests for this are in test/vendor. + function _classCallCheck(instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError("Cannot call a class as a function"); + } + } - ISC license: https://github.com/isaacs/json-stringify-safe/blob/master/LICENSE - */ + function _defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } + } + + function _createClass(Constructor, protoProps, staticProps) { + if (protoProps) _defineProperties(Constructor.prototype, protoProps); + if (staticProps) _defineProperties(Constructor, staticProps); + return Constructor; + } + + function _defineProperty(obj, key, value) { + if (key in obj) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true + }); + } else { + obj[key] = value; + } + + return obj; + } - exports = module.exports = stringify; - exports.getSerialize = serializer; + function _slicedToArray(arr, i) { + return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _nonIterableRest(); + } + + function _toConsumableArray(arr) { + return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _nonIterableSpread(); + } + + function _arrayWithoutHoles(arr) { + if (Array.isArray(arr)) { + for (var i = 0, arr2 = new Array(arr.length); i < arr.length; i++) arr2[i] = arr[i]; - function indexOf(haystack, needle) { - for (var i = 0; i < haystack.length; ++i) { - if (haystack[i] === needle) return i; + return arr2; } - return -1; } - function stringify(obj, replacer, spaces, cycleReplacer) { - return JSON.stringify(obj, serializer(replacer, cycleReplacer), spaces); + function _arrayWithHoles(arr) { + if (Array.isArray(arr)) return arr; } - // https://github.com/ftlabs/js-abbreviate/blob/fa709e5f139e7770a71827b1893f22418097fbda/index.js#L95-L106 - function stringifyError(value) { - var err = { - // These properties are implemented as magical getters and don't show up in for in - stack: value.stack, - message: value.message, - name: value.name - }; + function _iterableToArray(iter) { + if (Symbol.iterator in Object(iter) || Object.prototype.toString.call(iter) === "[object Arguments]") return Array.from(iter); + } + + function _iterableToArrayLimit(arr, i) { + var _arr = []; + var _n = true; + var _d = false; + var _e = undefined; - for (var i in value) { - if (Object.prototype.hasOwnProperty.call(value, i)) { - err[i] = value[i]; + try { + for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { + _arr.push(_s.value); + + if (i && _arr.length === i) break; + } + } catch (err) { + _d = true; + _e = err; + } finally { + try { + if (!_n && _i["return"] != null) _i["return"](); + } finally { + if (_d) throw _e; } } - return err; + return _arr; } - function serializer(replacer, cycleReplacer) { - var stack = []; - var keys = []; + function _nonIterableSpread() { + throw new TypeError("Invalid attempt to spread non-iterable instance"); + } - if (cycleReplacer == null) { - cycleReplacer = function(key, value) { - if (stack[0] === value) { - return '[Circular ~]'; - } - return '[Circular ~.' + keys.slice(0, indexOf(stack, value)).join('.') + ']'; - }; + function _nonIterableRest() { + throw new TypeError("Invalid attempt to destructure non-iterable instance"); + } + + var stringify_1 = createCommonjsModule(function (module, exports) { + /* + json-stringify-safe + Like JSON.stringify, but doesn't throw on circular references. + + Originally forked from https://github.com/isaacs/json-stringify-safe + version 5.0.1 on 3/8/2017 and modified to handle Errors serialization + and IE8 compatibility. Tests for this are in test/vendor. + + ISC license: https://github.com/isaacs/json-stringify-safe/blob/master/LICENSE + */ + exports = module.exports = stringify; + exports.getSerialize = serializer; + + function indexOf(haystack, needle) { + for (var i = 0; i < haystack.length; ++i) { + if (haystack[i] === needle) return i; + } + + return -1; } - return function(key, value) { - if (stack.length > 0) { - var thisPos = indexOf(stack, this); - ~thisPos ? stack.splice(thisPos + 1) : stack.push(this); - ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key); + function stringify(obj, replacer, spaces, cycleReplacer) { + return JSON.stringify(obj, serializer(replacer, cycleReplacer), spaces); + } // https://github.com/ftlabs/js-abbreviate/blob/fa709e5f139e7770a71827b1893f22418097fbda/index.js#L95-L106 + - if (~indexOf(stack, value)) { - value = cycleReplacer.call(this, key, value); + function stringifyError(value) { + var err = { + // These properties are implemented as magical getters and don't show up in for in + stack: value.stack, + message: value.message, + name: value.name + }; + + for (var i in value) { + if (Object.prototype.hasOwnProperty.call(value, i)) { + err[i] = value[i]; } - } else { - stack.push(value); } - return replacer == null - ? value instanceof Error ? stringifyError(value) : value - : replacer.call(this, key, value); - }; - } + return err; + } + + function serializer(replacer, cycleReplacer) { + var stack = []; + var keys = []; + + if (cycleReplacer == null) { + cycleReplacer = function cycleReplacer(key, value) { + if (stack[0] === value) { + return '[Circular ~]'; + } + + return '[Circular ~.' + keys.slice(0, indexOf(stack, value)).join('.') + ']'; + }; + } + + return function (key, value) { + if (stack.length > 0) { + var thisPos = indexOf(stack, this); + ~thisPos ? stack.splice(thisPos + 1) : stack.push(this); + ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key); + + if (~indexOf(stack, value)) { + value = cycleReplacer.call(this, key, value); + } + } else { + stack.push(value); + } + + return replacer == null ? value instanceof Error ? stringifyError(value) : value : replacer.call(this, key, value); + }; + } }); var stringify_2 = stringify_1.getSerialize; - var _window = - typeof window !== 'undefined' - ? window - : typeof commonjsGlobal !== 'undefined' - ? commonjsGlobal - : typeof self !== 'undefined' - ? self - : {}; + var _window = typeof window !== 'undefined' ? window : typeof commonjsGlobal !== 'undefined' ? commonjsGlobal : typeof self !== 'undefined' ? self : {}; function isObject(what) { - return typeof what === 'object' && what !== null; - } - - // Yanked from https://git.io/vS8DV re-used under CC0 + return _typeof(what) === 'object' && what !== null; + } // Yanked from https://git.io/vS8DV re-used under CC0 // with some tiny modifications + + function isError(value) { switch (Object.prototype.toString.call(value)) { case '[object Error]': return true; + case '[object Exception]': return true; + case '[object DOMException]': return true; + default: return value instanceof Error; } @@ -153,12 +257,14 @@ typeof navigator === "object" && (function () { return false; } } + return true; } function supportsErrorEvent() { try { new ErrorEvent(''); // eslint-disable-line no-new + return true; } catch (e) { return false; @@ -168,6 +274,7 @@ typeof navigator === "object" && (function () { function supportsDOMError() { try { new DOMError(''); // eslint-disable-line no-new + return true; } catch (e) { return false; @@ -177,6 +284,7 @@ typeof navigator === "object" && (function () { function supportsDOMException() { try { new DOMException(''); // eslint-disable-line no-new + return true; } catch (e) { return false; @@ -188,18 +296,21 @@ typeof navigator === "object" && (function () { try { new Headers(); // eslint-disable-line no-new + new Request(''); // eslint-disable-line no-new + new Response(); // eslint-disable-line no-new + return true; } catch (e) { return false; } - } - - // Despite all stars in the sky saying that Edge supports old draft syntax, aka 'never', 'always', 'origin' and 'default + } // Despite all stars in the sky saying that Edge supports old draft syntax, aka 'never', 'always', 'origin' and 'default // https://caniuse.com/#feat=referrer-policy // It doesn't. And it throw exception instead of ignoring this parameter... // REF: https://github.com/getsentry/raven-js/issues/1233 + + function supportsReferrerPolicy() { if (!supportsFetch()) return false; @@ -221,9 +332,11 @@ typeof navigator === "object" && (function () { function wrappedCallback(callback) { function dataCallback(data, original) { var normalizedData = callback(data) || data; + if (original) { return original(normalizedData) || normalizedData; } + return normalizedData; } @@ -241,6 +354,7 @@ typeof navigator === "object" && (function () { } } else { j = obj.length; + if (j) { for (i = 0; i < j; i++) { callback.call(null, i, obj[i]); @@ -253,12 +367,12 @@ typeof navigator === "object" && (function () { if (!obj2) { return obj1; } - each(obj2, function(key, value) { + + each(obj2, function (key, value) { obj1[key] = value; }); return obj1; } - /** * This function is only used for react-native. * react-native freezes object that have already been sent over the @@ -267,10 +381,13 @@ typeof navigator === "object" && (function () { * supported because it's not relevant for other "platforms". See related issue: * https://github.com/getsentry/react-native-sentry/issues/57 */ + + function objectFrozen(obj) { if (!Object.isFrozen) { return false; } + return Object.isFrozen(obj); } @@ -278,12 +395,13 @@ typeof navigator === "object" && (function () { if (typeof max !== 'number') { throw new Error('2nd argument to `truncate` function should be a number'); } + if (typeof str !== 'string' || max === 0) { return str; } - return str.length <= max ? str : str.substr(0, max) + '\u2026'; - } + return str.length <= max ? str : str.substr(0, max) + "\u2026"; + } /** * hasKey, a better form of hasOwnProperty * Example: hasKey(MainHostObject, property) === true/false @@ -291,6 +409,8 @@ typeof navigator === "object" && (function () { * @param {Object} host object to check property * @param {string} key to check */ + + function hasKey(object, key) { return Object.prototype.hasOwnProperty.call(object, key); } @@ -299,12 +419,13 @@ typeof navigator === "object" && (function () { // Combine an array of regular expressions and strings into one large regexp // Be mad. var sources = [], - i = 0, - len = patterns.length, - pattern; + i = 0, + len = patterns.length, + pattern; for (; i < len; i++) { pattern = patterns[i]; + if (isString(pattern)) { // If it's a string, we need to escape it // Taken from: https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions @@ -312,28 +433,28 @@ typeof navigator === "object" && (function () { } else if (pattern && pattern.source) { // If it's a regexp already, we want to extract the source sources.push(pattern.source); - } - // Intentionally skip other cases + } // Intentionally skip other cases + } + return new RegExp(sources.join('|'), 'i'); } function urlencode(o) { var pairs = []; - each(o, function(key, value) { + each(o, function (key, value) { pairs.push(encodeURIComponent(key) + '=' + encodeURIComponent(value)); }); return pairs.join('&'); - } - - // borrowed from https://tools.ietf.org/html/rfc3986#appendix-B + } // borrowed from https://tools.ietf.org/html/rfc3986#appendix-B // intentionally using regex and not <a/> href parsing trick because React Native and other // environments where DOM might not be available + + function parseUrl(url) { if (typeof url !== 'string') return {}; - var match = url.match(/^(([^:\/?#]+):)?(\/\/([^\/?#]*))?([^?#]*)(\?([^#]*))?(#(.*))?$/); + var match = url.match(/^(([^:\/?#]+):)?(\/\/([^\/?#]*))?([^?#]*)(\?([^#]*))?(#(.*))?$/); // coerce to undefined values to empty string so we don't get 'undefined' - // coerce to undefined values to empty string so we don't get 'undefined' var query = match[6] || ''; var fragment = match[8] || ''; return { @@ -341,8 +462,10 @@ typeof navigator === "object" && (function () { host: match[4], path: match[5], relative: match[5] + query + fragment // everything minus origin + }; } + function uuid4() { var crypto = _window.crypto || _window.msCrypto; @@ -350,41 +473,32 @@ typeof navigator === "object" && (function () { // Use window.crypto API if available // eslint-disable-next-line no-undef var arr = new Uint16Array(8); - crypto.getRandomValues(arr); + crypto.getRandomValues(arr); // set 4 in byte 7 - // set 4 in byte 7 - arr[3] = (arr[3] & 0xfff) | 0x4000; - // set 2 most significant bits of byte 9 to '10' - arr[4] = (arr[4] & 0x3fff) | 0x8000; + arr[3] = arr[3] & 0xfff | 0x4000; // set 2 most significant bits of byte 9 to '10' - var pad = function(num) { + arr[4] = arr[4] & 0x3fff | 0x8000; + + var pad = function pad(num) { var v = num.toString(16); + while (v.length < 4) { v = '0' + v; } + return v; }; - return ( - pad(arr[0]) + - pad(arr[1]) + - pad(arr[2]) + - pad(arr[3]) + - pad(arr[4]) + - pad(arr[5]) + - pad(arr[6]) + - pad(arr[7]) - ); + return pad(arr[0]) + pad(arr[1]) + pad(arr[2]) + pad(arr[3]) + pad(arr[4]) + pad(arr[5]) + pad(arr[6]) + pad(arr[7]); } else { // http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#2117523 - return 'xxxxxxxxxxxx4xxxyxxxxxxxxxxxxxxx'.replace(/[xy]/g, function(c) { - var r = (Math.random() * 16) | 0, - v = c === 'x' ? r : (r & 0x3) | 0x8; + return 'xxxxxxxxxxxx4xxxyxxxxxxxxxxxxxxx'.replace(/[xy]/g, function (c) { + var r = Math.random() * 16 | 0, + v = c === 'x' ? r : r & 0x3 | 0x8; return v.toString(16); }); } } - /** * Given a child DOM element, returns a query-selector statement describing that * and its ancestors @@ -392,142 +506,139 @@ typeof navigator === "object" && (function () { * @param elem * @returns {string} */ + + function htmlTreeAsString(elem) { /* eslint no-extra-parens:0*/ var MAX_TRAVERSE_HEIGHT = 5, - MAX_OUTPUT_LEN = 80, - out = [], - height = 0, - len = 0, - separator = ' > ', - sepLength = separator.length, - nextStr; + MAX_OUTPUT_LEN = 80, + out = [], + height = 0, + len = 0, + separator = ' > ', + sepLength = separator.length, + nextStr; while (elem && height++ < MAX_TRAVERSE_HEIGHT) { - nextStr = htmlElementAsString(elem); - // bail out if + nextStr = htmlElementAsString(elem); // bail out if // - nextStr is the 'html' element // - the length of the string that would be created exceeds MAX_OUTPUT_LEN // (ignore this limit if we are on the first iteration) - if ( - nextStr === 'html' || - (height > 1 && len + out.length * sepLength + nextStr.length >= MAX_OUTPUT_LEN) - ) { + + if (nextStr === 'html' || height > 1 && len + out.length * sepLength + nextStr.length >= MAX_OUTPUT_LEN) { break; } out.push(nextStr); - len += nextStr.length; elem = elem.parentNode; } return out.reverse().join(separator); } - /** * Returns a simple, query-selector representation of a DOM element * e.g. [HTMLElement] => input#foo.btn[name=baz] * @param HTMLElement * @returns {string} */ + + function htmlElementAsString(elem) { var out = [], - className, - classes, - key, - attr, - i; + className, + classes, + key, + attr, + i; if (!elem || !elem.tagName) { return ''; } out.push(elem.tagName.toLowerCase()); + if (elem.id) { out.push('#' + elem.id); } className = elem.className; + if (className && isString(className)) { classes = className.split(/\s+/); + for (i = 0; i < classes.length; i++) { out.push('.' + classes[i]); } } + var attrWhitelist = ['type', 'name', 'title', 'alt']; + for (i = 0; i < attrWhitelist.length; i++) { key = attrWhitelist[i]; attr = elem.getAttribute(key); + if (attr) { out.push('[' + key + '="' + attr + '"]'); } } + return out.join(''); } - /** * Returns true if either a OR b is truthy, but not both */ + + function isOnlyOneTruthy(a, b) { return !!(!!a ^ !!b); } - /** * Returns true if both parameters are undefined */ + + function isBothUndefined(a, b) { return isUndefined(a) && isUndefined(b); } - /** * Returns true if the two input exception interfaces have the same content */ + + function isSameException(ex1, ex2) { if (isOnlyOneTruthy(ex1, ex2)) return false; - ex1 = ex1.values[0]; ex2 = ex2.values[0]; + if (ex1.type !== ex2.type || ex1.value !== ex2.value) return false; // in case both stacktraces are undefined, we can't decide so default to false - if (ex1.type !== ex2.type || ex1.value !== ex2.value) return false; - - // in case both stacktraces are undefined, we can't decide so default to false if (isBothUndefined(ex1.stacktrace, ex2.stacktrace)) return false; - return isSameStacktrace(ex1.stacktrace, ex2.stacktrace); } - /** * Returns true if the two input stack trace interfaces have the same content */ + + function isSameStacktrace(stack1, stack2) { if (isOnlyOneTruthy(stack1, stack2)) return false; - var frames1 = stack1.frames; - var frames2 = stack2.frames; + var frames2 = stack2.frames; // Exit early if stacktrace is malformed - // Exit early if stacktrace is malformed - if (frames1 === undefined || frames2 === undefined) return false; + if (frames1 === undefined || frames2 === undefined) return false; // Exit early if frame count differs - // Exit early if frame count differs - if (frames1.length !== frames2.length) return false; + if (frames1.length !== frames2.length) return false; // Iterate through every frame; bail out if anything differs - // Iterate through every frame; bail out if anything differs var a, b; + for (var i = 0; i < frames1.length; i++) { a = frames1[i]; b = frames2[i]; - if ( - a.filename !== b.filename || - a.lineno !== b.lineno || - a.colno !== b.colno || - a['function'] !== b['function'] - ) - return false; + if (a.filename !== b.filename || a.lineno !== b.lineno || a.colno !== b.colno || a['function'] !== b['function']) return false; } + return true; } - /** * Polyfill a method * @param obj object e.g. `document` @@ -535,26 +646,29 @@ typeof navigator === "object" && (function () { * @param replacement replacement function * @param track {optional} record instrumentation to an array */ + + function fill(obj, name, replacement, track) { if (obj == null) return; var orig = obj[name]; obj[name] = replacement(orig); obj[name].__raven__ = true; obj[name].__orig__ = orig; + if (track) { track.push([obj, name, orig]); } } - /** * Join values in array * @param input array of values to be joined together * @param delimiter string to be placed in-between values * @returns {string} */ + + function safeJoin(input, delimiter) { if (!isArray(input)) return ''; - var output = []; for (var i = 0; i < input.length; i++) { @@ -566,11 +680,11 @@ typeof navigator === "object" && (function () { } return output.join(delimiter); - } + } // Default Node.js REPL depth + + + var MAX_SERIALIZE_EXCEPTION_DEPTH = 3; // 50kB, as 100kB is max payload size, so half sounds reasonable - // Default Node.js REPL depth - var MAX_SERIALIZE_EXCEPTION_DEPTH = 3; - // 50kB, as 100kB is max payload size, so half sounds reasonable var MAX_SERIALIZE_EXCEPTION_SIZE = 50 * 1024; var MAX_SERIALIZE_KEYS_LENGTH = 40; @@ -586,22 +700,15 @@ typeof navigator === "object" && (function () { if (typeof value === 'string') { var maxLength = 40; return truncate(value, maxLength); - } else if ( - typeof value === 'number' || - typeof value === 'boolean' || - typeof value === 'undefined' - ) { + } else if (typeof value === 'number' || typeof value === 'boolean' || typeof value === 'undefined') { return value; } - var type = Object.prototype.toString.call(value); + var type = Object.prototype.toString.call(value); // Node.js REPL notation - // Node.js REPL notation if (type === '[object Object]') return '[Object]'; if (type === '[object Array]') return '[Array]'; - if (type === '[object Function]') - return value.name ? '[Function: ' + value.name + ']' : '[Function]'; - + if (type === '[object Function]') return value.name ? '[Function: ' + value.name + ']' : '[Function]'; return value; } @@ -609,12 +716,12 @@ typeof navigator === "object" && (function () { if (depth === 0) return serializeValue(value); if (isPlainObject(value)) { - return Object.keys(value).reduce(function(acc, key) { + return Object.keys(value).reduce(function (acc, key) { acc[key] = serializeObject(value[key], depth - 1); return acc; }, {}); } else if (Array.isArray(value)) { - return value.map(function(val) { + return value.map(function (val) { return serializeObject(val, depth - 1); }); } @@ -624,10 +731,8 @@ typeof navigator === "object" && (function () { function serializeException(ex, depth, maxSize) { if (!isPlainObject(ex)) return ex; - depth = typeof depth !== 'number' ? MAX_SERIALIZE_EXCEPTION_DEPTH : depth; maxSize = typeof depth !== 'number' ? MAX_SERIALIZE_EXCEPTION_SIZE : maxSize; - var serialized = serializeObject(ex, depth); if (jsonSize(stringify_1(serialized)) > maxSize) { @@ -640,12 +745,10 @@ typeof navigator === "object" && (function () { function serializeKeysForMessage(keys, maxLength) { if (typeof keys === 'number' || typeof keys === 'string') return keys.toString(); if (!Array.isArray(keys)) return ''; - - keys = keys.filter(function(key) { + keys = keys.filter(function (key) { return typeof key === 'string'; }); if (keys.length === 0) return '[object has no keys]'; - maxLength = typeof maxLength !== 'number' ? MAX_SERIALIZE_KEYS_LENGTH : maxLength; if (keys[0].length >= maxLength) return keys[0]; @@ -653,16 +756,14 @@ typeof navigator === "object" && (function () { var serialized = keys.slice(0, usedKeys).join(', '); if (serialized.length > maxLength) continue; if (usedKeys === keys.length) return serialized; - return serialized + '\u2026'; + return serialized + "\u2026"; } return ''; } function sanitize(input, sanitizeKeys) { - if (!isArray(sanitizeKeys) || (isArray(sanitizeKeys) && sanitizeKeys.length === 0)) - return input; - + if (!isArray(sanitizeKeys) || isArray(sanitizeKeys) && sanitizeKeys.length === 0) return input; var sanitizeRegExp = joinRegExp(sanitizeKeys); var sanitizeMask = '********'; var safeInput; @@ -675,18 +776,19 @@ typeof navigator === "object" && (function () { function sanitizeWorker(workerInput) { if (isArray(workerInput)) { - return workerInput.map(function(val) { + return workerInput.map(function (val) { return sanitizeWorker(val); }); } if (isPlainObject(workerInput)) { - return Object.keys(workerInput).reduce(function(acc, k) { + return Object.keys(workerInput).reduce(function (acc, k) { if (sanitizeRegExp.test(k)) { acc[k] = sanitizeMask; } else { acc[k] = sanitizeWorker(workerInput[k]); } + return acc; }, {}); } @@ -749,19 +851,14 @@ typeof navigator === "object" && (function () { var TraceKit = { collectWindowErrors: true, debug: false - }; + }; // This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785) + + var _window$1 = typeof window !== 'undefined' ? window : typeof commonjsGlobal !== 'undefined' ? commonjsGlobal : typeof self !== 'undefined' ? self : {}; // global reference to slice - // This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785) - var _window$1 = - typeof window !== 'undefined' - ? window - : typeof commonjsGlobal !== 'undefined' ? commonjsGlobal : typeof self !== 'undefined' ? self : {}; - // global reference to slice var _slice = [].slice; - var UNKNOWN_FUNCTION = '?'; + var UNKNOWN_FUNCTION = '?'; // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Error#Error_types - // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Error#Error_types var ERROR_TYPES_RE = /^(?:[Uu]ncaught (?:exception: )?)?(?:((?:Eval|Internal|Range|Reference|Syntax|Type|URI|)Error): )?(.*)$/; function getLocationHref() { @@ -770,21 +867,14 @@ typeof navigator === "object" && (function () { } function getLocationOrigin() { - if (typeof document === 'undefined' || document.location == null) return ''; + if (typeof document === 'undefined' || document.location == null) return ''; // Oh dear IE10... - // Oh dear IE10... if (!document.location.origin) { - return ( - document.location.protocol + - '//' + - document.location.hostname + - (document.location.port ? ':' + document.location.port : '') - ); + return document.location.protocol + '//' + document.location.hostname + (document.location.port ? ':' + document.location.port : ''); } return document.location.origin; } - /** * TraceKit.report: cross-browser processing of unhandled exceptions * @@ -824,25 +914,28 @@ typeof navigator === "object" && (function () { * Handlers receive a stackInfo object as described in the * TraceKit.computeStackTrace docs. */ - TraceKit.report = (function reportModuleWrapper() { - var handlers = [], - lastArgs = null, - lastException = null, - lastExceptionStack = null; + + TraceKit.report = function reportModuleWrapper() { + var handlers = [], + lastArgs = null, + lastException = null, + lastExceptionStack = null; /** * Add a crash handler. * @param {Function} handler */ + function subscribe(handler) { installGlobalHandler(); handlers.push(handler); } - /** * Remove a crash handler. * @param {Function} handler */ + + function unsubscribe(handler) { for (var i = handlers.length - 1; i >= 0; --i) { if (handlers[i] === handler) { @@ -850,24 +943,28 @@ typeof navigator === "object" && (function () { } } } - /** * Remove all crash handlers. */ + + function unsubscribeAll() { uninstallGlobalHandler(); handlers = []; } - /** * Dispatch stack information to all handlers. * @param {Object.<string, *>} stack */ + + function notifyHandlers(stack, isWindowError) { var exception = null; + if (isWindowError && !TraceKit.collectWindowErrors) { return; } + for (var i in handlers) { if (handlers.hasOwnProperty(i)) { try { @@ -884,7 +981,6 @@ typeof navigator === "object" && (function () { } var _oldOnerrorHandler, _onErrorHandlerInstalled; - /** * Ensures all global unhandled exceptions are recorded. * Supported by Gecko and IE. @@ -896,24 +992,20 @@ typeof navigator === "object" && (function () { * occurred. * @param {?Error} ex The actual Error object. */ + + function traceKitWindowOnError(msg, url, lineNo, colNo, ex) { - var stack = null; - // If 'ex' is ErrorEvent, get real Error from inside - var exception = utils.isErrorEvent(ex) ? ex.error : ex; - // If 'msg' is ErrorEvent, get real message from inside + var stack = null; // If 'ex' is ErrorEvent, get real Error from inside + + var exception = utils.isErrorEvent(ex) ? ex.error : ex; // If 'msg' is ErrorEvent, get real message from inside + var message = utils.isErrorEvent(msg) ? msg.message : msg; if (lastExceptionStack) { - TraceKit.computeStackTrace.augmentStackTraceWithInitialElement( - lastExceptionStack, - url, - lineNo, - message - ); + TraceKit.computeStackTrace.augmentStackTraceWithInitialElement(lastExceptionStack, url, lineNo, message); processLastException(); } else if (exception && utils.isError(exception)) { // non-string `exception` arg; attempt to extract stack trace - // New chrome and blink send along a real error object // Let's just report that like a normal error. // See: https://mikewest.org/2013/08/debugging-runtime-errors-with-window-onerror @@ -925,12 +1017,12 @@ typeof navigator === "object" && (function () { line: lineNo, column: colNo }; - var name = undefined; var groups; if ({}.toString.call(message) === '[object String]') { var groups = message.match(ERROR_TYPES_RE); + if (groups) { name = groups[1]; message = groups[2]; @@ -938,7 +1030,6 @@ typeof navigator === "object" && (function () { } location.func = UNKNOWN_FUNCTION; - stack = { name: name, message: message, @@ -959,6 +1050,7 @@ typeof navigator === "object" && (function () { if (_onErrorHandlerInstalled) { return; } + _oldOnerrorHandler = _window$1.onerror; _window$1.onerror = traceKitWindowOnError; _onErrorHandlerInstalled = true; @@ -968,6 +1060,7 @@ typeof navigator === "object" && (function () { if (!_onErrorHandlerInstalled) { return; } + _window$1.onerror = _oldOnerrorHandler; _onErrorHandlerInstalled = false; _oldOnerrorHandler = undefined; @@ -975,13 +1068,12 @@ typeof navigator === "object" && (function () { function processLastException() { var _lastExceptionStack = lastExceptionStack, - _lastArgs = lastArgs; + _lastArgs = lastArgs; lastArgs = null; lastExceptionStack = null; lastException = null; notifyHandlers.apply(null, [_lastExceptionStack, false].concat(_lastArgs)); } - /** * Reports an unhandled Error to TraceKit. * @param {Error} ex @@ -989,8 +1081,11 @@ typeof navigator === "object" && (function () { * Only used for window.onerror to not cause an infinite loop of * rethrowing. */ + + function report(ex, rethrow) { var args = _slice.call(arguments, 1); + if (lastExceptionStack) { if (lastException === ex) { return; // already caught by an inner catch block, ignore @@ -1002,13 +1097,12 @@ typeof navigator === "object" && (function () { var stack = TraceKit.computeStackTrace(ex); lastExceptionStack = stack; lastException = ex; - lastArgs = args; - - // If the stack trace is incomplete, wait for 2 seconds for + lastArgs = args; // If the stack trace is incomplete, wait for 2 seconds for // slow slow IE to see if onerror occurs or not before reporting // this exception; otherwise, we will end up with an incomplete // stack trace - setTimeout(function() { + + setTimeout(function () { if (lastException === ex) { processLastException(); } @@ -1023,8 +1117,7 @@ typeof navigator === "object" && (function () { report.unsubscribe = unsubscribe; report.uninstall = unsubscribeAll; return report; - })(); - + }(); /** * TraceKit.computeStackTrace: cross-browser stack traces in JavaScript * @@ -1076,7 +1169,9 @@ typeof navigator === "object" && (function () { * inner function that actually caused the exception). * */ - TraceKit.computeStackTrace = (function computeStackTraceWrapper() { + + + TraceKit.computeStackTrace = function computeStackTraceWrapper() { // Contents of Exception in various browsers. // // SAFARI: @@ -1122,13 +1217,12 @@ typeof navigator === "object" && (function () { */ function computeStackTraceFromStackProp(ex) { if (typeof ex.stack === 'undefined' || !ex.stack) return; - var chrome = /^\s*at (?:(.*?) ?\()?((?:file|https?|blob|chrome-extension|native|eval|webpack|<anonymous>|[a-z]:|\/).*?)(?::(\d+))?(?::(\d+))?\)?\s*$/i; - var winjs = /^\s*at (?:((?:\[object object\])?.+) )?\(?((?:file|ms-appx(?:-web)|https?|webpack|blob):.*?):(\d+)(?::(\d+))?\)?\s*$/i; - // NOTE: blob urls are now supposed to always have an origin, therefore it's format + var winjs = /^\s*at (?:((?:\[object object\])?.+) )?\(?((?:file|ms-appx(?:-web)|https?|webpack|blob):.*?):(\d+)(?::(\d+))?\)?\s*$/i; // NOTE: blob urls are now supposed to always have an origin, therefore it's format // which is `blob:http://url/path/with-some-uuid`, is matched by `blob.*?:\/` as well - var gecko = /^\s*(.*?)(?:\((.*?)\))?(?:^|@)((?:file|https?|blob|chrome|webpack|resource|moz-extension).*?:\/.*?|\[native code\]|[^@]*bundle)(?::(\d+))?(?::(\d+))?\s*$/i; - // Used to additionally parse URL/line/column from eval frames + + var gecko = /^\s*(.*?)(?:\((.*?)\))?(?:^|@)((?:file|https?|blob|chrome|webpack|resource|moz-extension).*?:\/.*?|\[native code\]|[^@]*bundle)(?::(\d+))?(?::(\d+))?\s*$/i; // Used to additionally parse URL/line/column from eval frames + var geckoEval = /(\S+) line (\d+)(?: > eval line \d+)* > eval/i; var chromeEval = /\((\S*)(?::(\d+))(?::(\d+))\)/; var lines = ex.stack.split('\n'); @@ -1139,15 +1233,20 @@ typeof navigator === "object" && (function () { var reference = /^(.*) is undefined$/.exec(ex.message); for (var i = 0, j = lines.length; i < j; ++i) { - if ((parts = chrome.exec(lines[i]))) { + if (parts = chrome.exec(lines[i])) { var isNative = parts[2] && parts[2].indexOf('native') === 0; // start of line + var isEval = parts[2] && parts[2].indexOf('eval') === 0; // start of line + if (isEval && (submatch = chromeEval.exec(parts[2]))) { // throw out eval line/column and use top-most line/column number parts[2] = submatch[1]; // url + parts[3] = submatch[2]; // line + parts[4] = submatch[3]; // column } + element = { url: !isNative ? parts[2] : null, func: parts[1] || UNKNOWN_FUNCTION, @@ -1155,7 +1254,7 @@ typeof navigator === "object" && (function () { line: parts[3] ? +parts[3] : null, column: parts[4] ? +parts[4] : null }; - } else if ((parts = winjs.exec(lines[i]))) { + } else if (parts = winjs.exec(lines[i])) { element = { url: parts[2], func: parts[1] || UNKNOWN_FUNCTION, @@ -1163,8 +1262,9 @@ typeof navigator === "object" && (function () { line: +parts[3], column: parts[4] ? +parts[4] : null }; - } else if ((parts = gecko.exec(lines[i]))) { + } else if (parts = gecko.exec(lines[i])) { var isEval = parts[3] && parts[3].indexOf(' > eval') > -1; + if (isEval && (submatch = geckoEval.exec(parts[3]))) { // throw out eval line/column and use top-most line number parts[3] = submatch[1]; @@ -1177,6 +1277,7 @@ typeof navigator === "object" && (function () { // NOTE: this hack doesn't work if top-most frame is eval stack[0].column = ex.columnNumber + 1; } + element = { url: parts[3], func: parts[1] || UNKNOWN_FUNCTION, @@ -1200,31 +1301,26 @@ typeof navigator === "object" && (function () { // that much of an issue. var xhr = new XMLHttpRequest(); xhr.open('GET', element.url, false); - xhr.send(null); + xhr.send(null); // If we failed to download the source, skip this patch - // If we failed to download the source, skip this patch if (xhr.status === 200) { - var source = xhr.responseText || ''; - - // We trim the source down to the last 300 characters as sourceMappingURL is always at the end of the file. + var source = xhr.responseText || ''; // We trim the source down to the last 300 characters as sourceMappingURL is always at the end of the file. // Why 300? To be in line with: https://github.com/getsentry/sentry/blob/4af29e8f2350e20c28a6933354e4f42437b4ba42/src/sentry/lang/javascript/processor.py#L164-L175 - source = source.slice(-300); - // Now we dig out the source map URL - var sourceMaps = source.match(/\/\/# sourceMappingURL=(.*)$/); + source = source.slice(-300); // Now we dig out the source map URL - // If we don't find a source map comment or we find more than one, continue on to the next element. - if (sourceMaps) { - var sourceMapAddress = sourceMaps[1]; + var sourceMaps = source.match(/\/\/# sourceMappingURL=(.*)$/); // If we don't find a source map comment or we find more than one, continue on to the next element. - // Now we check to see if it's a relative URL. + if (sourceMaps) { + var sourceMapAddress = sourceMaps[1]; // Now we check to see if it's a relative URL. // If it is, convert it to an absolute one. + if (sourceMapAddress.charAt(0) === '~') { sourceMapAddress = getLocationOrigin() + sourceMapAddress.slice(1); - } - - // Now we strip the '.map' off of the end of the URL and update the + } // Now we strip the '.map' off of the end of the URL and update the // element so that Sentry can match the map to the blob. + + element.url = sourceMapAddress.slice(0, -4); } } @@ -1244,7 +1340,6 @@ typeof navigator === "object" && (function () { stack: stack }; } - /** * Adds information about the first frame to incomplete stack traces. * Safari and IE require this to get complete data on the first frame. @@ -1258,6 +1353,8 @@ typeof navigator === "object" && (function () { * @return {boolean} Whether or not the stack information was * augmented. */ + + function augmentStackTraceWithInitialElement(stackInfo, url, lineNo, message) { var initial = { url: url, @@ -1275,10 +1372,7 @@ typeof navigator === "object" && (function () { if (stackInfo.stack[0].url === initial.url) { if (stackInfo.stack[0].line === initial.line) { return false; // already in stack trace - } else if ( - !stackInfo.stack[0].line && - stackInfo.stack[0].func === initial.func - ) { + } else if (!stackInfo.stack[0].line && stackInfo.stack[0].func === initial.func) { stackInfo.stack[0].line = initial.line; return false; } @@ -1294,7 +1388,6 @@ typeof navigator === "object" && (function () { return false; } - /** * Computes stack trace information by walking the arguments.caller * chain at the time the exception occurred. This will cause earlier @@ -1304,19 +1397,17 @@ typeof navigator === "object" && (function () { * @param {Error} ex * @return {?Object.<string, *>} Stack trace information. */ + + function computeStackTraceByWalkingCallerChain(ex, depth) { var functionName = /function\s+([_$a-zA-Z\xA0-\uFFFF][_$a-zA-Z0-9\xA0-\uFFFF]*)?\s*\(/i, - stack = [], - funcs = {}, - recursion = false, - parts, - item; - - for ( - var curr = computeStackTraceByWalkingCallerChain.caller; - curr && !recursion; - curr = curr.caller - ) { + stack = [], + funcs = {}, + recursion = false, + parts, + item; + + for (var curr = computeStackTraceByWalkingCallerChain.caller; curr && !recursion; curr = curr.caller) { if (curr === computeStackTrace || curr === TraceKit.report) { // console.log('skipping internal function'); continue; @@ -1331,7 +1422,7 @@ typeof navigator === "object" && (function () { if (curr.name) { item.func = curr.name; - } else if ((parts = functionName.exec(curr.toString()))) { + } else if (parts = functionName.exec(curr.toString())) { item.func = parts[1]; } @@ -1362,26 +1453,23 @@ typeof navigator === "object" && (function () { url: getLocationHref(), stack: stack }; - augmentStackTraceWithInitialElement( - result, - ex.sourceURL || ex.fileName, - ex.line || ex.lineNumber, - ex.message || ex.description - ); + augmentStackTraceWithInitialElement(result, ex.sourceURL || ex.fileName, ex.line || ex.lineNumber, ex.message || ex.description); return result; } - /** * Computes a stack trace for an exception. * @param {Error} ex * @param {(string|number)=} depth */ + + function computeStackTrace(ex, depth) { var stack = null; depth = depth == null ? 0 : +depth; try { stack = computeStackTraceFromStackProp(ex); + if (stack) { return stack; } @@ -1393,6 +1481,7 @@ typeof navigator === "object" && (function () { try { stack = computeStackTraceByWalkingCallerChain(ex, depth + 1); + if (stack) { return stack; } @@ -1401,6 +1490,7 @@ typeof navigator === "object" && (function () { throw e; } } + return { name: ex.name, message: ex.message, @@ -1410,9 +1500,8 @@ typeof navigator === "object" && (function () { computeStackTrace.augmentStackTraceWithInitialElement = augmentStackTraceWithInitialElement; computeStackTrace.computeStackTraceFromStackProp = computeStackTraceFromStackProp; - return computeStackTrace; - })(); + }(); var tracekit = TraceKit; @@ -1442,43 +1531,49 @@ typeof navigator === "object" && (function () { function safeAdd(x, y) { var lsw = (x & 0xffff) + (y & 0xffff); var msw = (x >> 16) + (y >> 16) + (lsw >> 16); - return (msw << 16) | (lsw & 0xffff); + return msw << 16 | lsw & 0xffff; } - /* * Bitwise rotate a 32-bit number to the left. */ + + function bitRotateLeft(num, cnt) { - return (num << cnt) | (num >>> (32 - cnt)); + return num << cnt | num >>> 32 - cnt; } - /* * These functions implement the four basic operations the algorithm uses. */ + + function md5cmn(q, a, b, x, s, t) { return safeAdd(bitRotateLeft(safeAdd(safeAdd(a, q), safeAdd(x, t)), s), b); } + function md5ff(a, b, c, d, x, s, t) { - return md5cmn((b & c) | (~b & d), a, b, x, s, t); + return md5cmn(b & c | ~b & d, a, b, x, s, t); } + function md5gg(a, b, c, d, x, s, t) { - return md5cmn((b & d) | (c & ~d), a, b, x, s, t); + return md5cmn(b & d | c & ~d, a, b, x, s, t); } + function md5hh(a, b, c, d, x, s, t) { return md5cmn(b ^ c ^ d, a, b, x, s, t); } + function md5ii(a, b, c, d, x, s, t) { return md5cmn(c ^ (b | ~d), a, b, x, s, t); } - /* * Calculate the MD5 of an array of little-endian words, and a bit length. */ + + function binlMD5(x, len) { /* append padding */ - x[len >> 5] |= 0x80 << (len % 32); - x[(((len + 64) >>> 9) << 4) + 14] = len; - + x[len >> 5] |= 0x80 << len % 32; + x[(len + 64 >>> 9 << 4) + 14] = len; var i; var olda; var oldb; @@ -1494,7 +1589,6 @@ typeof navigator === "object" && (function () { oldb = b; oldc = c; oldd = d; - a = md5ff(a, b, c, d, x[i], 7, -680876936); d = md5ff(d, a, b, c, x[i + 1], 12, -389564586); c = md5ff(c, d, a, b, x[i + 2], 17, 606105819); @@ -1511,7 +1605,6 @@ typeof navigator === "object" && (function () { d = md5ff(d, a, b, c, x[i + 13], 12, -40341101); c = md5ff(c, d, a, b, x[i + 14], 17, -1502002290); b = md5ff(b, c, d, a, x[i + 15], 22, 1236535329); - a = md5gg(a, b, c, d, x[i + 1], 5, -165796510); d = md5gg(d, a, b, c, x[i + 6], 9, -1069501632); c = md5gg(c, d, a, b, x[i + 11], 14, 643717713); @@ -1528,7 +1621,6 @@ typeof navigator === "object" && (function () { d = md5gg(d, a, b, c, x[i + 2], 9, -51403784); c = md5gg(c, d, a, b, x[i + 7], 14, 1735328473); b = md5gg(b, c, d, a, x[i + 12], 20, -1926607734); - a = md5hh(a, b, c, d, x[i + 5], 4, -378558); d = md5hh(d, a, b, c, x[i + 8], 11, -2022574463); c = md5hh(c, d, a, b, x[i + 11], 16, 1839030562); @@ -1545,7 +1637,6 @@ typeof navigator === "object" && (function () { d = md5hh(d, a, b, c, x[i + 12], 11, -421815835); c = md5hh(c, d, a, b, x[i + 15], 16, 530742520); b = md5hh(b, c, d, a, x[i + 2], 23, -995338651); - a = md5ii(a, b, c, d, x[i], 6, -198630844); d = md5ii(d, a, b, c, x[i + 7], 10, 1126891415); c = md5ii(c, d, a, b, x[i + 14], 15, -1416354905); @@ -1562,56 +1653,66 @@ typeof navigator === "object" && (function () { d = md5ii(d, a, b, c, x[i + 11], 10, -1120210379); c = md5ii(c, d, a, b, x[i + 2], 15, 718787259); b = md5ii(b, c, d, a, x[i + 9], 21, -343485551); - a = safeAdd(a, olda); b = safeAdd(b, oldb); c = safeAdd(c, oldc); d = safeAdd(d, oldd); } + return [a, b, c, d]; } - /* * Convert an array of little-endian words to a string */ + + function binl2rstr(input) { var i; var output = ''; var length32 = input.length * 32; + for (i = 0; i < length32; i += 8) { - output += String.fromCharCode((input[i >> 5] >>> (i % 32)) & 0xff); + output += String.fromCharCode(input[i >> 5] >>> i % 32 & 0xff); } + return output; } - /* * Convert a raw string to an array of little-endian words * Characters >255 have their high-byte silently ignored. */ + + function rstr2binl(input) { var i; var output = []; output[(input.length >> 2) - 1] = undefined; + for (i = 0; i < output.length; i += 1) { output[i] = 0; } + var length8 = input.length * 8; + for (i = 0; i < length8; i += 8) { - output[i >> 5] |= (input.charCodeAt(i / 8) & 0xff) << (i % 32); + output[i >> 5] |= (input.charCodeAt(i / 8) & 0xff) << i % 32; } + return output; } - /* * Calculate the MD5 of a raw string */ + + function rstrMD5(s) { return binl2rstr(binlMD5(rstr2binl(s), s.length * 8)); } - /* * Calculate the HMAC-MD5, of a key and some data (raw strings) */ + + function rstrHMACMD5(key, data) { var i; var bkey = rstr2binl(key); @@ -1619,51 +1720,62 @@ typeof navigator === "object" && (function () { var opad = []; var hash; ipad[15] = opad[15] = undefined; + if (bkey.length > 16) { bkey = binlMD5(bkey, key.length * 8); } + for (i = 0; i < 16; i += 1) { ipad[i] = bkey[i] ^ 0x36363636; opad[i] = bkey[i] ^ 0x5c5c5c5c; } + hash = binlMD5(ipad.concat(rstr2binl(data)), 512 + data.length * 8); return binl2rstr(binlMD5(opad.concat(hash), 512 + 128)); } - /* * Convert a raw string to a hex string */ + + function rstr2hex(input) { var hexTab = '0123456789abcdef'; var output = ''; var x; var i; + for (i = 0; i < input.length; i += 1) { x = input.charCodeAt(i); - output += hexTab.charAt((x >>> 4) & 0x0f) + hexTab.charAt(x & 0x0f); + output += hexTab.charAt(x >>> 4 & 0x0f) + hexTab.charAt(x & 0x0f); } + return output; } - /* * Encode a string as utf-8 */ + + function str2rstrUTF8(input) { return unescape(encodeURIComponent(input)); } - /* * Take string arguments and return either raw or hex encoded strings */ + + function rawMD5(s) { return rstrMD5(str2rstrUTF8(s)); } + function hexMD5(s) { return rstr2hex(rawMD5(s)); } + function rawHMACMD5(k, d) { return rstrHMACMD5(str2rstrUTF8(k), str2rstrUTF8(d)); } + function hexHMACMD5(k, d) { return rstr2hex(rawHMACMD5(k, d)); } @@ -1673,11 +1785,14 @@ typeof navigator === "object" && (function () { if (!raw) { return hexMD5(string); } + return rawMD5(string); } + if (!raw) { return hexHMACMD5(key, string); } + return rawHMACMD5(key, string); } @@ -1687,12 +1802,12 @@ typeof navigator === "object" && (function () { this.name = 'RavenConfigError'; this.message = message; } + RavenConfigError.prototype = new Error(); RavenConfigError.prototype.constructor = RavenConfigError; - var configError = RavenConfigError; - var wrapMethod = function(console, level, callback) { + var wrapMethod = function wrapMethod(console, level, callback) { var originalConsoleLevel = console[level]; var originalConsole = console; @@ -1702,25 +1817,29 @@ typeof navigator === "object" && (function () { var sentryLevel = level === 'warn' ? 'warning' : level; - console[level] = function() { + console[level] = function () { var args = [].slice.call(arguments); - var msg = utils.safeJoin(args, ' '); - var data = {level: sentryLevel, logger: 'console', extra: {arguments: args}}; + var data = { + level: sentryLevel, + logger: 'console', + extra: { + arguments: args + } + }; if (level === 'assert') { if (args[0] === false) { // Default browsers message - msg = - 'Assertion failed: ' + (utils.safeJoin(args.slice(1), ' ') || 'console.assert'); + msg = 'Assertion failed: ' + (utils.safeJoin(args.slice(1), ' ') || 'console.assert'); data.extra.arguments = args.slice(1); callback && callback(msg, data); } } else { callback && callback(msg, data); - } + } // this fails for some browsers. :( + - // this fails for some browsers. :( if (originalConsoleLevel) { // IE9 doesn't allow calling apply on console functions directly // See: https://stackoverflow.com/questions/5472938/does-ie9-support-console-log-and-is-it-a-real-function#answer-5473193 @@ -1735,12 +1854,6 @@ typeof navigator === "object" && (function () { /*global XDomainRequest:false */ - - - - - - var isErrorEvent$1 = utils.isErrorEvent; var isDOMError$1 = utils.isDOMError; var isDOMException$1 = utils.isDOMException; @@ -1770,38 +1883,32 @@ typeof navigator === "object" && (function () { var serializeKeysForMessage$1 = utils.serializeKeysForMessage; var serializeException$1 = utils.serializeException; var sanitize$1 = utils.sanitize; - var wrapConsoleMethod = console$1.wrapMethod; - var dsnKeys = 'source protocol user pass host port path'.split(' '), - dsnPattern = /^(?:(\w+):)?\/\/(?:(\w+)(:\w+)?@)?([\w\.-]+)(?::(\d+))?(\/.*)/; + dsnPattern = /^(?:(\w+):)?\/\/(?:(\w+)(:\w+)?@)?([\w\.-]+)(?::(\d+))?(\/.*)/; function now() { return +new Date(); - } + } // This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785) + + + var _window$2 = typeof window !== 'undefined' ? window : typeof commonjsGlobal !== 'undefined' ? commonjsGlobal : typeof self !== 'undefined' ? self : {}; - // This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785) - var _window$2 = - typeof window !== 'undefined' - ? window - : typeof commonjsGlobal !== 'undefined' ? commonjsGlobal : typeof self !== 'undefined' ? self : {}; var _document = _window$2.document; var _navigator = _window$2.navigator; function keepOriginalCallback(original, callback) { - return isFunction$1(callback) - ? function(data) { - return callback(data, original); - } - : callback; - } - - // First, check for JSON support + return isFunction$1(callback) ? function (data) { + return callback(data, original); + } : callback; + } // First, check for JSON support // If there is no JSON, we no-op the core features of Raven // since JSON is required to encode the payload + + function Raven() { - this._hasJSON = !!(typeof JSON === 'object' && JSON.stringify); - // Raven can run in contexts where there's no document (react-native) + this._hasJSON = !!((typeof JSON === "undefined" ? "undefined" : _typeof(JSON)) === 'object' && JSON.stringify); // Raven can run in contexts where there's no document (react-native) + this._hasDocument = !isUndefined$1(_document); this._hasNavigator = !isUndefined$1(_navigator); this._lastCapturedException = null; @@ -1841,9 +1948,9 @@ typeof navigator === "object" && (function () { }; this._ignoreOnError = 0; this._isRavenInstalled = false; - this._originalErrorStackTraceLimit = Error.stackTraceLimit; - // capture references to window.console *and* all its methods first + this._originalErrorStackTraceLimit = Error.stackTraceLimit; // capture references to window.console *and* all its methods first // before the console plugin has a chance to monkey patch + this._originalConsole = _window$2.console || {}; this._originalConsoleMethods = {}; this._plugins = []; @@ -1854,30 +1961,30 @@ typeof navigator === "object" && (function () { this._keypressTimeout; this._location = _window$2.location; this._lastHref = this._location && this._location.href; - this._resetBackoff(); - // eslint-disable-next-line guard-for-in + this._resetBackoff(); // eslint-disable-next-line guard-for-in + + for (var method in this._originalConsole) { this._originalConsoleMethods[method] = this._originalConsole[method]; } } - /* * The core Raven singleton * * @this {Raven} */ + Raven.prototype = { // Hardcode version string so that raven source can be loaded directly via // webpack (using a build step causes webpack #1617). Grunt verifies that // this value matches package.json during build. // See: https://github.com/getsentry/raven-js/issues/465 VERSION: '3.27.0', - debug: false, - - TraceKit: tracekit, // alias to TraceKit + TraceKit: tracekit, + // alias to TraceKit /* * Configure Raven with a DSN and extra options @@ -1886,20 +1993,20 @@ typeof navigator === "object" && (function () { * @param {object} options Set of global options [optional] * @return {Raven} */ - config: function(dsn, options) { + config: function config(dsn, options) { var self = this; if (self._globalServer) { this._logDebug('error', 'Error: Raven has already been configured'); + return self; } - if (!dsn) return self; - var globalOptions = self._globalOptions; + if (!dsn) return self; + var globalOptions = self._globalOptions; // merge in options - // merge in options if (options) { - each$1(options, function(key, value) { + each$1(options, function (key, value) { // tags and extra are special and need to be put into context if (key === 'tags' || key === 'extra' || key === 'user') { self._globalContext[key] = value; @@ -1909,26 +2016,17 @@ typeof navigator === "object" && (function () { }); } - self.setDSN(dsn); - - // "Script error." is hard coded into browsers for errors that it can't read. + self.setDSN(dsn); // "Script error." is hard coded into browsers for errors that it can't read. // this is the result of a script being pulled in from an external domain and CORS. + globalOptions.ignoreErrors.push(/^Script error\.?$/); - globalOptions.ignoreErrors.push(/^Javascript error: Script error\.? on line 0$/); + globalOptions.ignoreErrors.push(/^Javascript error: Script error\.? on line 0$/); // join regexp rules into one big rule - // join regexp rules into one big rule globalOptions.ignoreErrors = joinRegExp$1(globalOptions.ignoreErrors); - globalOptions.ignoreUrls = globalOptions.ignoreUrls.length - ? joinRegExp$1(globalOptions.ignoreUrls) - : false; - globalOptions.whitelistUrls = globalOptions.whitelistUrls.length - ? joinRegExp$1(globalOptions.whitelistUrls) - : false; + globalOptions.ignoreUrls = globalOptions.ignoreUrls.length ? joinRegExp$1(globalOptions.ignoreUrls) : false; + globalOptions.whitelistUrls = globalOptions.whitelistUrls.length ? joinRegExp$1(globalOptions.whitelistUrls) : false; globalOptions.includePaths = joinRegExp$1(globalOptions.includePaths); - globalOptions.maxBreadcrumbs = Math.max( - 0, - Math.min(globalOptions.maxBreadcrumbs || 100, 100) - ); // default and hard limit is 100 + globalOptions.maxBreadcrumbs = Math.max(0, Math.min(globalOptions.maxBreadcrumbs || 100, 100)); // default and hard limit is 100 var autoBreadcrumbDefaults = { xhr: true, @@ -1937,30 +2035,29 @@ typeof navigator === "object" && (function () { location: true, sentry: true }; - var autoBreadcrumbs = globalOptions.autoBreadcrumbs; + if ({}.toString.call(autoBreadcrumbs) === '[object Object]') { autoBreadcrumbs = objectMerge$1(autoBreadcrumbDefaults, autoBreadcrumbs); } else if (autoBreadcrumbs !== false) { autoBreadcrumbs = autoBreadcrumbDefaults; } - globalOptions.autoBreadcrumbs = autoBreadcrumbs; + globalOptions.autoBreadcrumbs = autoBreadcrumbs; var instrumentDefaults = { tryCatch: true }; - var instrument = globalOptions.instrument; + if ({}.toString.call(instrument) === '[object Object]') { instrument = objectMerge$1(instrumentDefaults, instrument); } else if (instrument !== false) { instrument = instrumentDefaults; } - globalOptions.instrument = instrument; - tracekit.collectWindowErrors = !!globalOptions.collectWindowErrors; + globalOptions.instrument = instrument; + tracekit.collectWindowErrors = !!globalOptions.collectWindowErrors; // return for chaining - // return for chaining return self; }, @@ -1972,10 +2069,11 @@ typeof navigator === "object" && (function () { * * @return {Raven} */ - install: function() { + install: function install() { var self = this; + if (self.isSetup() && !self._isRavenInstalled) { - tracekit.report.subscribe(function() { + tracekit.report.subscribe(function () { self._handleOnErrorStackInfo.apply(self, arguments); }); @@ -1989,9 +2087,8 @@ typeof navigator === "object" && (function () { self._instrumentTryCatch(); } - if (self._globalOptions.autoBreadcrumbs) self._instrumentBreadcrumbs(); + if (self._globalOptions.autoBreadcrumbs) self._instrumentBreadcrumbs(); // Install all of the plugins - // Install all of the plugins self._drainPlugins(); self._isRavenInstalled = true; @@ -2006,24 +2103,20 @@ typeof navigator === "object" && (function () { * * @param {string} dsn The public Sentry DSN */ - setDSN: function(dsn) { + setDSN: function setDSN(dsn) { var self = this, - uri = self._parseDSN(dsn), - lastSlash = uri.path.lastIndexOf('/'), - path = uri.path.substr(1, lastSlash); + uri = self._parseDSN(dsn), + lastSlash = uri.path.lastIndexOf('/'), + path = uri.path.substr(1, lastSlash); self._dsn = dsn; self._globalKey = uri.user; self._globalSecret = uri.pass && uri.pass.substr(1); self._globalProject = uri.path.substr(lastSlash + 1); - self._globalServer = self._getGlobalServer(uri); - - self._globalEndpoint = - self._globalServer + '/' + path + 'api/' + self._globalProject + '/store/'; - - // Reset backoff state since we may be pointing at a + self._globalEndpoint = self._globalServer + '/' + path + 'api/' + self._globalProject + '/store/'; // Reset backoff state since we may be pointing at a // new project/server + this._resetBackoff(); }, @@ -2035,7 +2128,7 @@ typeof navigator === "object" && (function () { * @param {function} func The callback to be immediately executed within the context * @param {array} args An array of arguments to be called with the callback [optional] */ - context: function(options, func, args) { + context: function context(options, func, args) { if (isFunction$1(options)) { args = func || []; func = options; @@ -2053,33 +2146,33 @@ typeof navigator === "object" && (function () { * @param {function} _before A function to call before the try/catch wrapper [optional, private] * @return {function} The newly wrapped functions with a context */ - wrap: function(options, func, _before) { - var self = this; - // 1 argument has been passed, and it's not a function + wrap: function wrap(options, func, _before) { + var self = this; // 1 argument has been passed, and it's not a function // so just return it + if (isUndefined$1(func) && !isFunction$1(options)) { return options; - } + } // options is optional + - // options is optional if (isFunction$1(options)) { func = options; options = undefined; - } - - // At this point, we've passed along 2 arguments, and the second one + } // At this point, we've passed along 2 arguments, and the second one // is not a function either, so we'll just return the second argument. + + if (!isFunction$1(func)) { return func; - } + } // We don't wanna wrap it twice! + - // We don't wanna wrap it twice! try { if (func.__raven__) { return func; - } + } // If this has already been wrapped in the past, return that + - // If this has already been wrapped in the past, return that if (func.__raven_wrapper__) { return func.__raven_wrapper__; } @@ -2092,16 +2185,18 @@ typeof navigator === "object" && (function () { function wrapped() { var args = [], - i = arguments.length, - deep = !options || (options && options.deep !== false); + i = arguments.length, + deep = !options || options && options.deep !== false; if (_before && isFunction$1(_before)) { _before.apply(this, arguments); - } - - // Recursively wrap all of a function's arguments that are + } // Recursively wrap all of a function's arguments that are // functions themselves. - while (i--) args[i] = deep ? self.wrap(options, arguments[i]) : arguments[i]; + + + while (i--) { + args[i] = deep ? self.wrap(options, arguments[i]) : arguments[i]; + } try { // Attempt to invoke user-land function @@ -2111,25 +2206,25 @@ typeof navigator === "object" && (function () { return func.apply(this, args); } catch (e) { self._ignoreNextOnError(); + self.captureException(e, options); throw e; } - } + } // copy over properties of the old function + - // copy over properties of the old function for (var property in func) { if (hasKey$1(func, property)) { wrapped[property] = func[property]; } } - wrapped.prototype = func.prototype; - func.__raven_wrapper__ = wrapped; - // Signal that this function has been wrapped/filled already + wrapped.prototype = func.prototype; + func.__raven_wrapper__ = wrapped; // Signal that this function has been wrapped/filled already // for both debugging and to prevent it to being wrapped/filled twice + wrapped.__raven__ = true; wrapped.__orig__ = func; - return wrapped; }, @@ -2138,17 +2233,19 @@ typeof navigator === "object" && (function () { * * @return {Raven} */ - uninstall: function() { + uninstall: function uninstall() { tracekit.report.uninstall(); this._detachPromiseRejectionHandler(); + this._unpatchFunctionToString(); + this._restoreBuiltIns(); + this._restoreConsole(); Error.stackTraceLimit = this._originalErrorStackTraceLimit; this._isRavenInstalled = false; - return this; }, @@ -2160,8 +2257,9 @@ typeof navigator === "object" && (function () { * reason: the value with which the Promise was rejected * @return void */ - _promiseRejectionHandler: function(event) { + _promiseRejectionHandler: function _promiseRejectionHandler(event) { this._logDebug('debug', 'Raven caught unhandled promise rejection:', event); + this.captureException(event.reason, { mechanism: { type: 'onunhandledrejection', @@ -2175,10 +2273,9 @@ typeof navigator === "object" && (function () { * * @return {raven} */ - _attachPromiseRejectionHandler: function() { + _attachPromiseRejectionHandler: function _attachPromiseRejectionHandler() { this._promiseRejectionHandler = this._promiseRejectionHandler.bind(this); - _window$2.addEventListener && - _window$2.addEventListener('unhandledrejection', this._promiseRejectionHandler); + _window$2.addEventListener && _window$2.addEventListener('unhandledrejection', this._promiseRejectionHandler); return this; }, @@ -2187,9 +2284,8 @@ typeof navigator === "object" && (function () { * * @return {raven} */ - _detachPromiseRejectionHandler: function() { - _window$2.removeEventListener && - _window$2.removeEventListener('unhandledrejection', this._promiseRejectionHandler); + _detachPromiseRejectionHandler: function _detachPromiseRejectionHandler() { + _window$2.removeEventListener && _window$2.removeEventListener('unhandledrejection', this._promiseRejectionHandler); return this; }, @@ -2200,8 +2296,10 @@ typeof navigator === "object" && (function () { * @param {object} options A specific set of options for this error [optional] * @return {Raven} */ - captureException: function(ex, options) { - options = objectMerge$1({trimHeadFrames: 0}, options ? options : {}); + captureException: function captureException(ex, options) { + options = objectMerge$1({ + trimHeadFrames: 0 + }, options ? options : {}); if (isErrorEvent$1(ex) && ex.error) { // If it is an ErrorEvent with `error` property, extract it to get actual Error @@ -2213,16 +2311,12 @@ typeof navigator === "object" && (function () { // https://developer.mozilla.org/en-US/docs/Web/API/DOMException var name = ex.name || (isDOMError$1(ex) ? 'DOMError' : 'DOMException'); var message = ex.message ? name + ': ' + ex.message : name; - - return this.captureMessage( - message, - objectMerge$1(options, { - // neither DOMError or DOMException provide stack trace and we most likely wont get it this way as well - // but it's barely any overhead so we may at least try - stacktrace: true, - trimHeadFrames: options.trimHeadFrames + 1 - }) - ); + return this.captureMessage(message, objectMerge$1(options, { + // neither DOMError or DOMException provide stack trace and we most likely wont get it this way as well + // but it's barely any overhead so we may at least try + stacktrace: true, + trimHeadFrames: options.trimHeadFrames + 1 + })); } else if (isError$1(ex)) { // we have a real Error object ex = ex; @@ -2239,25 +2333,23 @@ typeof navigator === "object" && (function () { // it's not a valid ErrorEvent (one with an error property) // it's not an Error // So bail out and capture it as a simple message: - return this.captureMessage( - ex, - objectMerge$1(options, { - stacktrace: true, // if we fall back to captureMessage, default to attempting a new trace - trimHeadFrames: options.trimHeadFrames + 1 - }) - ); - } + return this.captureMessage(ex, objectMerge$1(options, { + stacktrace: true, + // if we fall back to captureMessage, default to attempting a new trace + trimHeadFrames: options.trimHeadFrames + 1 + })); + } // Store the raw exception object for potential debugging and introspection - // Store the raw exception object for potential debugging and introspection - this._lastCapturedException = ex; - // TraceKit.report will re-raise any exception passed to it, + this._lastCapturedException = ex; // TraceKit.report will re-raise any exception passed to it, // which means you have to wrap it in try/catch. Instead, we // can wrap it here and only re-raise if TraceKit.report // raises an exception different from the one we asked to // report on. + try { var stack = tracekit.computeStackTrace(ex); + this._handleStackInfo(stack, options); } catch (ex1) { if (ex !== ex1) { @@ -2267,17 +2359,14 @@ typeof navigator === "object" && (function () { return this; }, - - _getCaptureExceptionOptionsFromPlainObject: function(currentOptions, ex) { + _getCaptureExceptionOptionsFromPlainObject: function _getCaptureExceptionOptionsFromPlainObject(currentOptions, ex) { var exKeys = Object.keys(ex).sort(); var options = objectMerge$1(currentOptions, { - message: - 'Non-Error exception captured with keys: ' + serializeKeysForMessage$1(exKeys), + message: 'Non-Error exception captured with keys: ' + serializeKeysForMessage$1(exKeys), fingerprint: [md5_1(exKeys)], extra: currentOptions.extra || {} }); options.extra.__serialized__ = serializeException$1(ex); - return options; }, @@ -2288,113 +2377,89 @@ typeof navigator === "object" && (function () { * @param {object} options A specific set of options for this message [optional] * @return {Raven} */ - captureMessage: function(msg, options) { + captureMessage: function captureMessage(msg, options) { // config() automagically converts ignoreErrors from a list to a RegExp so we need to test for an // early call; we'll error on the side of logging anything called before configuration since it's // probably something you should see: - if ( - !!this._globalOptions.ignoreErrors.test && - this._globalOptions.ignoreErrors.test(msg) - ) { + if (!!this._globalOptions.ignoreErrors.test && this._globalOptions.ignoreErrors.test(msg)) { return; } options = options || {}; msg = msg + ''; // Make sure it's actually a string - var data = objectMerge$1( - { - message: msg - }, - options - ); - - var ex; - // Generate a "synthetic" stack trace from this point. + var data = objectMerge$1({ + message: msg + }, options); + var ex; // Generate a "synthetic" stack trace from this point. // NOTE: If you are a Sentry user, and you are seeing this stack frame, it is NOT indicative // of a bug with Raven.js. Sentry generates synthetic traces either by configuration, // or if it catches a thrown object without a "stack" property. + try { throw new Error(msg); } catch (ex1) { ex = ex1; - } + } // null exception name so `Error` isn't prefixed to msg - // null exception name so `Error` isn't prefixed to msg - ex.name = null; - var stack = tracekit.computeStackTrace(ex); - // stack[0] is `throw new Error(msg)` call itself, we are interested in the frame that was just before that, stack[1] - var initialCall = isArray$1(stack.stack) && stack.stack[1]; + ex.name = null; + var stack = tracekit.computeStackTrace(ex); // stack[0] is `throw new Error(msg)` call itself, we are interested in the frame that was just before that, stack[1] - // if stack[1] is `Raven.captureException`, it means that someone passed a string to it and we redirected that call + var initialCall = isArray$1(stack.stack) && stack.stack[1]; // if stack[1] is `Raven.captureException`, it means that someone passed a string to it and we redirected that call // to be handled by `captureMessage`, thus `initialCall` is the 3rd one, not 2nd // initialCall => captureException(string) => captureMessage(string) + if (initialCall && initialCall.func === 'Raven.captureException') { initialCall = stack.stack[2]; } - var fileurl = (initialCall && initialCall.url) || ''; + var fileurl = initialCall && initialCall.url || ''; - if ( - !!this._globalOptions.ignoreUrls.test && - this._globalOptions.ignoreUrls.test(fileurl) - ) { + if (!!this._globalOptions.ignoreUrls.test && this._globalOptions.ignoreUrls.test(fileurl)) { return; } - if ( - !!this._globalOptions.whitelistUrls.test && - !this._globalOptions.whitelistUrls.test(fileurl) - ) { + if (!!this._globalOptions.whitelistUrls.test && !this._globalOptions.whitelistUrls.test(fileurl)) { return; - } - - // Always attempt to get stacktrace if message is empty. + } // Always attempt to get stacktrace if message is empty. // It's the only way to provide any helpful information to the user. + + if (this._globalOptions.stacktrace || options.stacktrace || data.message === '') { // fingerprint on msg, not stack trace (legacy behavior, could be revisited) data.fingerprint = data.fingerprint == null ? msg : data.fingerprint; - - options = objectMerge$1( - { - trimHeadFrames: 0 - }, - options - ); - // Since we know this is a synthetic trace, the top frame (this function call) + options = objectMerge$1({ + trimHeadFrames: 0 + }, options); // Since we know this is a synthetic trace, the top frame (this function call) // MUST be from Raven.js, so mark it for trimming // We add to the trim counter so that callers can choose to trim extra frames, such // as utility functions. + options.trimHeadFrames += 1; var frames = this._prepareFrames(stack, options); + data.stacktrace = { // Sentry expects frames oldest to newest frames: frames.reverse() }; - } + } // Make sure that fingerprint is always wrapped in an array + - // Make sure that fingerprint is always wrapped in an array if (data.fingerprint) { - data.fingerprint = isArray$1(data.fingerprint) - ? data.fingerprint - : [data.fingerprint]; - } + data.fingerprint = isArray$1(data.fingerprint) ? data.fingerprint : [data.fingerprint]; + } // Fire away! + - // Fire away! this._send(data); return this; }, - - captureBreadcrumb: function(obj) { - var crumb = objectMerge$1( - { - timestamp: now() / 1000 - }, - obj - ); + captureBreadcrumb: function captureBreadcrumb(obj) { + var crumb = objectMerge$1({ + timestamp: now() / 1000 + }, obj); if (isFunction$1(this._globalOptions.breadcrumbCallback)) { var result = this._globalOptions.breadcrumbCallback(crumb); @@ -2407,16 +2472,20 @@ typeof navigator === "object" && (function () { } this._breadcrumbs.push(crumb); + if (this._breadcrumbs.length > this._globalOptions.maxBreadcrumbs) { this._breadcrumbs.shift(); } + return this; }, - - addPlugin: function(plugin /*arg1, arg2, ... argN*/) { + addPlugin: function addPlugin(plugin + /*arg1, arg2, ... argN*/ + ) { var pluginArgs = [].slice.call(arguments, 1); this._plugins.push([plugin, pluginArgs]); + if (this._isRavenInstalled) { this._drainPlugins(); } @@ -2430,10 +2499,9 @@ typeof navigator === "object" && (function () { * @param {object} user An object representing user data [optional] * @return {Raven} */ - setUserContext: function(user) { + setUserContext: function setUserContext(user) { // Intentionally do not merge here since that's an unexpected behavior. this._globalContext.user = user; - return this; }, @@ -2443,7 +2511,7 @@ typeof navigator === "object" && (function () { * @param {object} extra An object representing extra data [optional] * @return {Raven} */ - setExtraContext: function(extra) { + setExtraContext: function setExtraContext(extra) { this._mergeContext('extra', extra); return this; @@ -2455,7 +2523,7 @@ typeof navigator === "object" && (function () { * @param {object} tags An object representing tags [optional] * @return {Raven} */ - setTagsContext: function(tags) { + setTagsContext: function setTagsContext(tags) { this._mergeContext('tags', tags); return this; @@ -2466,9 +2534,8 @@ typeof navigator === "object" && (function () { * * @return {Raven} */ - clearContext: function() { + clearContext: function clearContext() { this._globalContext = {}; - return this; }, @@ -2477,7 +2544,7 @@ typeof navigator === "object" && (function () { * * @return {object} copy of context */ - getContext: function() { + getContext: function getContext() { // lol javascript return JSON.parse(stringify_1(this._globalContext)); }, @@ -2488,9 +2555,8 @@ typeof navigator === "object" && (function () { * @param {string} environment Typically something like 'production'. * @return {Raven} */ - setEnvironment: function(environment) { + setEnvironment: function setEnvironment(environment) { this._globalOptions.environment = environment; - return this; }, @@ -2500,9 +2566,8 @@ typeof navigator === "object" && (function () { * @param {string} release Typically something like a git SHA to identify version * @return {Raven} */ - setRelease: function(release) { + setRelease: function setRelease(release) { this._globalOptions.release = release; - return this; }, @@ -2513,7 +2578,7 @@ typeof navigator === "object" && (function () { * data blob to be mutated before sending * @return {Raven} */ - setDataCallback: function(callback) { + setDataCallback: function setDataCallback(callback) { var original = this._globalOptions.dataCallback; this._globalOptions.dataCallback = keepOriginalCallback(original, callback); return this; @@ -2526,7 +2591,7 @@ typeof navigator === "object" && (function () { * or mutating breadcrumbs * @return {Raven} */ - setBreadcrumbCallback: function(callback) { + setBreadcrumbCallback: function setBreadcrumbCallback(callback) { var original = this._globalOptions.breadcrumbCallback; this._globalOptions.breadcrumbCallback = keepOriginalCallback(original, callback); return this; @@ -2539,7 +2604,7 @@ typeof navigator === "object" && (function () { * introspecting the blob before sending * @return {Raven} */ - setShouldSendCallback: function(callback) { + setShouldSendCallback: function setShouldSendCallback(callback) { var original = this._globalOptions.shouldSendCallback; this._globalOptions.shouldSendCallback = keepOriginalCallback(original, callback); return this; @@ -2554,9 +2619,8 @@ typeof navigator === "object" && (function () { * * @return {Raven} */ - setTransport: function(transport) { + setTransport: function setTransport(transport) { this._globalOptions.transport = transport; - return this; }, @@ -2565,7 +2629,7 @@ typeof navigator === "object" && (function () { * * @return {error} */ - lastException: function() { + lastException: function lastException() { return this._lastCapturedException; }, @@ -2574,7 +2638,7 @@ typeof navigator === "object" && (function () { * * @return {string} */ - lastEventId: function() { + lastEventId: function lastEventId() { return this._lastEventId; }, @@ -2583,42 +2647,38 @@ typeof navigator === "object" && (function () { * * @return {boolean} */ - isSetup: function() { + isSetup: function isSetup() { if (!this._hasJSON) return false; // needs JSON support + if (!this._globalServer) { if (!this.ravenNotConfiguredError) { this.ravenNotConfiguredError = true; + this._logDebug('error', 'Error: Raven has not been configured.'); } + return false; } + return true; }, - - afterLoad: function() { + afterLoad: function afterLoad() { // TODO: remove window dependence? - // Attempt to initialize Raven on load var RavenConfig = _window$2.RavenConfig; + if (RavenConfig) { this.config(RavenConfig.dsn, RavenConfig.config).install(); } }, - - showReportDialog: function(options) { - if ( - !_document // doesn't work without a document (React native) - ) - return; - - options = objectMerge$1( - { - eventId: this.lastEventId(), - dsn: this._dsn, - user: this._globalContext.user || {} - }, - options - ); + showReportDialog: function showReportDialog(options) { + if (!_document // doesn't work without a document (React native) + ) return; + options = objectMerge$1({ + eventId: this.lastEventId(), + dsn: this._dsn, + user: this._globalContext.user || {} + }, options); if (!options.eventId) { throw new configError('Missing eventId'); @@ -2640,32 +2700,31 @@ typeof navigator === "object" && (function () { encodedOptions.push(encode(key) + '=' + encode(options[key])); } } + var globalServer = this._getGlobalServer(this._parseDSN(options.dsn)); var script = _document.createElement('script'); + script.async = true; script.src = globalServer + '/api/embed/error-page/?' + encodedOptions.join('&'); + (_document.head || _document.body).appendChild(script); }, /**** Private functions ****/ - _ignoreNextOnError: function() { + _ignoreNextOnError: function _ignoreNextOnError() { var self = this; this._ignoreOnError += 1; - setTimeout(function() { + setTimeout(function () { // onerror should trigger before setTimeout self._ignoreOnError -= 1; }); }, - - _triggerEvent: function(eventType, options) { + _triggerEvent: function _triggerEvent(eventType, options) { // NOTE: `event` is a native browser thing, so let's avoid conflicting wiht it var evt, key; - if (!this._hasDocument) return; - options = options || {}; - eventType = 'raven' + eventType.substr(0, 1).toUpperCase() + eventType.substr(1); if (_document.createEvent) { @@ -2676,10 +2735,11 @@ typeof navigator === "object" && (function () { evt.eventType = eventType; } - for (key in options) + for (key in options) { if (hasKey$1(options, key)) { evt[key] = options[key]; } + } if (_document.createEvent) { // IE9 if standards @@ -2689,8 +2749,7 @@ typeof navigator === "object" && (function () { // IE9 if quirks try { _document.fireEvent('on' + evt.eventType.toLowerCase(), evt); - } catch (e) { - // Do nothing + } catch (e) {// Do nothing } } }, @@ -2701,26 +2760,24 @@ typeof navigator === "object" && (function () { * @returns {Function} * @private */ - _breadcrumbEventHandler: function(evtName) { + _breadcrumbEventHandler: function _breadcrumbEventHandler(evtName) { var self = this; - return function(evt) { + return function (evt) { // reset keypress timeout; e.g. triggering a 'click' after // a 'keypress' will reset the keypress debounce so that a new // set of keypresses can be recorded - self._keypressTimeout = null; - - // It's possible this handler might trigger multiple times for the same + self._keypressTimeout = null; // It's possible this handler might trigger multiple times for the same // event (e.g. event propagation through node ancestors). Ignore if we've // already captured the event. - if (self._lastCapturedEvent === evt) return; - - self._lastCapturedEvent = evt; - // try/catch both: + if (self._lastCapturedEvent === evt) return; + self._lastCapturedEvent = evt; // try/catch both: // - accessing evt.target (see getsentry/raven-js#838, #768) // - `htmlTreeAsString` because it's complex, and just accessing the DOM incorrectly // can throw an exception in some circumstances. + var target; + try { target = htmlTreeAsString$1(evt.target); } catch (e) { @@ -2728,7 +2785,8 @@ typeof navigator === "object" && (function () { } self.captureBreadcrumb({ - category: 'ui.' + evtName, // e.g. ui.click, ui.input + category: 'ui.' + evtName, + // e.g. ui.click, ui.input message: target }); }; @@ -2739,15 +2797,16 @@ typeof navigator === "object" && (function () { * @returns {Function} * @private */ - _keypressEventHandler: function() { + _keypressEventHandler: function _keypressEventHandler() { var self = this, - debounceDuration = 1000; // milliseconds - + debounceDuration = 1000; // milliseconds // TODO: if somehow user switches keypress target before // debounce timeout is triggered, we will only capture // a single breadcrumb from the FIRST target (acceptable?) - return function(evt) { + + return function (evt) { var target; + try { target = evt.target; } catch (e) { @@ -2755,25 +2814,22 @@ typeof navigator === "object" && (function () { // see: https://github.com/getsentry/raven-js/issues/838 return; } - var tagName = target && target.tagName; - // only consider keypress events on actual input elements + var tagName = target && target.tagName; // only consider keypress events on actual input elements // this will disregard keypresses targeting body (e.g. tabbing // through elements, hotkeys, etc) - if ( - !tagName || - (tagName !== 'INPUT' && tagName !== 'TEXTAREA' && !target.isContentEditable) - ) - return; - // record first keypress in a series, but ignore subsequent + if (!tagName || tagName !== 'INPUT' && tagName !== 'TEXTAREA' && !target.isContentEditable) return; // record first keypress in a series, but ignore subsequent // keypresses until debounce clears + var timeout = self._keypressTimeout; + if (!timeout) { self._breadcrumbEventHandler('input')(evt); } + clearTimeout(timeout); - self._keypressTimeout = setTimeout(function() { + self._keypressTimeout = setTimeout(function () { self._keypressTimeout = null; }, debounceDuration); }; @@ -2785,23 +2841,18 @@ typeof navigator === "object" && (function () { * @param from the target URL * @private */ - _captureUrlChange: function(from, to) { + _captureUrlChange: function _captureUrlChange(from, to) { var parsedLoc = parseUrl$1(this._location.href); var parsedTo = parseUrl$1(to); - var parsedFrom = parseUrl$1(from); - - // because onpopstate only tells you the "new" (to) value of location.href, and + var parsedFrom = parseUrl$1(from); // because onpopstate only tells you the "new" (to) value of location.href, and // not the previous (from) value, we need to track the value of the current URL // state ourselves - this._lastHref = to; - // Use only the path component of the URL if the URL matches the current + this._lastHref = to; // Use only the path component of the URL if the URL matches the current // document (almost all the time when using pushState) - if (parsedLoc.protocol === parsedTo.protocol && parsedLoc.host === parsedTo.host) - to = parsedTo.relative; - if (parsedLoc.protocol === parsedFrom.protocol && parsedLoc.host === parsedFrom.host) - from = parsedFrom.relative; + if (parsedLoc.protocol === parsedTo.protocol && parsedLoc.host === parsedTo.host) to = parsedTo.relative; + if (parsedLoc.protocol === parsedFrom.protocol && parsedLoc.host === parsedFrom.host) from = parsedFrom.relative; this.captureBreadcrumb({ category: 'navigation', data: { @@ -2810,20 +2861,19 @@ typeof navigator === "object" && (function () { } }); }, - - _patchFunctionToString: function() { + _patchFunctionToString: function _patchFunctionToString() { var self = this; - self._originalFunctionToString = Function.prototype.toString; - // eslint-disable-next-line no-extend-native - Function.prototype.toString = function() { + self._originalFunctionToString = Function.prototype.toString; // eslint-disable-next-line no-extend-native + + Function.prototype.toString = function () { if (typeof this === 'function' && this.__raven__) { return self._originalFunctionToString.apply(this.__orig__, arguments); } + return self._originalFunctionToString.apply(this, arguments); }; }, - - _unpatchFunctionToString: function() { + _unpatchFunctionToString: function _unpatchFunctionToString() { if (this._originalFunctionToString) { // eslint-disable-next-line no-extend-native Function.prototype.toString = this._originalFunctionToString; @@ -2834,36 +2884,37 @@ typeof navigator === "object" && (function () { * Wrap timer functions and event targets to catch errors and provide * better metadata. */ - _instrumentTryCatch: function() { + _instrumentTryCatch: function _instrumentTryCatch() { var self = this; - var wrappedBuiltIns = self._wrappedBuiltIns; function wrapTimeFn(orig) { - return function(fn, t) { + return function (fn, t) { // preserve arity // Make a copy of the arguments to prevent deoptimization // https://github.com/petkaantonov/bluebird/wiki/Optimization-killers#32-leaking-arguments var args = new Array(arguments.length); + for (var i = 0; i < args.length; ++i) { args[i] = arguments[i]; } + var originalCallback = args[0]; + if (isFunction$1(originalCallback)) { - args[0] = self.wrap( - { - mechanism: { - type: 'instrument', - data: {function: orig.name || '<anonymous>'} + args[0] = self.wrap({ + mechanism: { + type: 'instrument', + data: { + function: orig.name || '<anonymous>' } - }, - originalCallback - ); - } - - // IE < 9 doesn't support .call/.apply on setInterval/setTimeout, but it + } + }, originalCallback); + } // IE < 9 doesn't support .call/.apply on setInterval/setTimeout, but it // also supports only two arguments and doesn't care what this is, so we // can just call the original function directly. + + if (orig.apply) { return orig.apply(this, args); } else { @@ -2876,167 +2927,104 @@ typeof navigator === "object" && (function () { function wrapEventTarget(global) { var proto = _window$2[global] && _window$2[global].prototype; - if (proto && proto.hasOwnProperty && proto.hasOwnProperty('addEventListener')) { - fill$1( - proto, - 'addEventListener', - function(orig) { - return function(evtName, fn, capture, secure) { - // preserve arity - try { - if (fn && fn.handleEvent) { - fn.handleEvent = self.wrap( - { - mechanism: { - type: 'instrument', - data: { - target: global, - function: 'handleEvent', - handler: (fn && fn.name) || '<anonymous>' - } - } - }, - fn.handleEvent - ); - } - } catch (err) { - // can sometimes get 'Permission denied to access property "handle Event' - } - // More breadcrumb DOM capture ... done here and not in `_instrumentBreadcrumbs` - // so that we don't have more than one wrapper function - var before, clickHandler, keypressHandler; - - if ( - autoBreadcrumbs && - autoBreadcrumbs.dom && - (global === 'EventTarget' || global === 'Node') - ) { - // NOTE: generating multiple handlers per addEventListener invocation, should - // revisit and verify we can just use one (almost certainly) - clickHandler = self._breadcrumbEventHandler('click'); - keypressHandler = self._keypressEventHandler(); - before = function(evt) { - // need to intercept every DOM event in `before` argument, in case that - // same wrapped method is re-used for different events (e.g. mousemove THEN click) - // see #724 - if (!evt) return; - - var eventType; - try { - eventType = evt.type; - } catch (e) { - // just accessing event properties can throw an exception in some rare circumstances - // see: https://github.com/getsentry/raven-js/issues/838 - return; + if (proto && proto.hasOwnProperty && proto.hasOwnProperty('addEventListener')) { + fill$1(proto, 'addEventListener', function (orig) { + return function (evtName, fn, capture, secure) { + // preserve arity + try { + if (fn && fn.handleEvent) { + fn.handleEvent = self.wrap({ + mechanism: { + type: 'instrument', + data: { + target: global, + function: 'handleEvent', + handler: fn && fn.name || '<anonymous>' + } } - if (eventType === 'click') return clickHandler(evt); - else if (eventType === 'keypress') return keypressHandler(evt); - }; + }, fn.handleEvent); } - return orig.call( - this, - evtName, - self.wrap( - { - mechanism: { - type: 'instrument', - data: { - target: global, - function: 'addEventListener', - handler: (fn && fn.name) || '<anonymous>' - } - } - }, - fn, - before - ), - capture, - secure - ); - }; - }, - wrappedBuiltIns - ); - fill$1( - proto, - 'removeEventListener', - function(orig) { - return function(evt, fn, capture, secure) { - try { - fn = fn && (fn.__raven_wrapper__ ? fn.__raven_wrapper__ : fn); - } catch (e) { - // ignore, accessing __raven_wrapper__ will throw in some Selenium environments + } catch (err) {} // can sometimes get 'Permission denied to access property "handle Event' + // More breadcrumb DOM capture ... done here and not in `_instrumentBreadcrumbs` + // so that we don't have more than one wrapper function + + + var before, clickHandler, keypressHandler; + + if (autoBreadcrumbs && autoBreadcrumbs.dom && (global === 'EventTarget' || global === 'Node')) { + // NOTE: generating multiple handlers per addEventListener invocation, should + // revisit and verify we can just use one (almost certainly) + clickHandler = self._breadcrumbEventHandler('click'); + keypressHandler = self._keypressEventHandler(); + + before = function before(evt) { + // need to intercept every DOM event in `before` argument, in case that + // same wrapped method is re-used for different events (e.g. mousemove THEN click) + // see #724 + if (!evt) return; + var eventType; + + try { + eventType = evt.type; + } catch (e) { + // just accessing event properties can throw an exception in some rare circumstances + // see: https://github.com/getsentry/raven-js/issues/838 + return; + } + + if (eventType === 'click') return clickHandler(evt);else if (eventType === 'keypress') return keypressHandler(evt); + }; + } + + return orig.call(this, evtName, self.wrap({ + mechanism: { + type: 'instrument', + data: { + target: global, + function: 'addEventListener', + handler: fn && fn.name || '<anonymous>' + } } - return orig.call(this, evt, fn, capture, secure); - }; - }, - wrappedBuiltIns - ); + }, fn, before), capture, secure); + }; + }, wrappedBuiltIns); + fill$1(proto, 'removeEventListener', function (orig) { + return function (evt, fn, capture, secure) { + try { + fn = fn && (fn.__raven_wrapper__ ? fn.__raven_wrapper__ : fn); + } catch (e) {// ignore, accessing __raven_wrapper__ will throw in some Selenium environments + } + + return orig.call(this, evt, fn, capture, secure); + }; + }, wrappedBuiltIns); } } fill$1(_window$2, 'setTimeout', wrapTimeFn, wrappedBuiltIns); fill$1(_window$2, 'setInterval', wrapTimeFn, wrappedBuiltIns); - if (_window$2.requestAnimationFrame) { - fill$1( - _window$2, - 'requestAnimationFrame', - function(orig) { - return function(cb) { - return orig( - self.wrap( - { - mechanism: { - type: 'instrument', - data: { - function: 'requestAnimationFrame', - handler: (orig && orig.name) || '<anonymous>' - } - } - }, - cb - ) - ); - }; - }, - wrappedBuiltIns - ); - } - // event targets borrowed from bugsnag-js: + if (_window$2.requestAnimationFrame) { + fill$1(_window$2, 'requestAnimationFrame', function (orig) { + return function (cb) { + return orig(self.wrap({ + mechanism: { + type: 'instrument', + data: { + function: 'requestAnimationFrame', + handler: orig && orig.name || '<anonymous>' + } + } + }, cb)); + }; + }, wrappedBuiltIns); + } // event targets borrowed from bugsnag-js: // https://github.com/bugsnag/bugsnag-js/blob/master/src/bugsnag.js#L666 - var eventTargets = [ - 'EventTarget', - 'Window', - 'Node', - 'ApplicationCache', - 'AudioTrackList', - 'ChannelMergerNode', - 'CryptoOperation', - 'EventSource', - 'FileReader', - 'HTMLUnknownElement', - 'IDBDatabase', - 'IDBRequest', - 'IDBTransaction', - 'KeyOperation', - 'MediaController', - 'MessagePort', - 'ModalWindow', - 'Notification', - 'SVGElementInstance', - 'Screen', - 'TextTrack', - 'TextTrackCue', - 'TextTrackList', - 'WebSocket', - 'WebSocketWorker', - 'Worker', - 'XMLHttpRequest', - 'XMLHttpRequestEventTarget', - 'XMLHttpRequestUpload' - ]; + + + var eventTargets = ['EventTarget', 'Window', 'Node', 'ApplicationCache', 'AudioTrackList', 'ChannelMergerNode', 'CryptoOperation', 'EventSource', 'FileReader', 'HTMLUnknownElement', 'IDBDatabase', 'IDBRequest', 'IDBTransaction', 'KeyOperation', 'MediaController', 'MessagePort', 'ModalWindow', 'Notification', 'SVGElementInstance', 'Screen', 'TextTrack', 'TextTrackCue', 'TextTrackList', 'WebSocket', 'WebSocketWorker', 'Worker', 'XMLHttpRequest', 'XMLHttpRequestEventTarget', 'XMLHttpRequestUpload']; + for (var i = 0; i < eventTargets.length; i++) { wrapEventTarget(eventTargets[i]); } @@ -3051,219 +3039,192 @@ typeof navigator === "object" && (function () { * * Can be disabled or individually configured via the `autoBreadcrumbs` config option */ - _instrumentBreadcrumbs: function() { + _instrumentBreadcrumbs: function _instrumentBreadcrumbs() { var self = this; var autoBreadcrumbs = this._globalOptions.autoBreadcrumbs; - var wrappedBuiltIns = self._wrappedBuiltIns; function wrapProp(prop, xhr) { if (prop in xhr && isFunction$1(xhr[prop])) { - fill$1(xhr, prop, function(orig) { - return self.wrap( - { - mechanism: { - type: 'instrument', - data: {function: prop, handler: (orig && orig.name) || '<anonymous>'} + fill$1(xhr, prop, function (orig) { + return self.wrap({ + mechanism: { + type: 'instrument', + data: { + function: prop, + handler: orig && orig.name || '<anonymous>' } - }, - orig - ); + } + }, orig); }); // intentionally don't track filled methods on XHR instances } } if (autoBreadcrumbs.xhr && 'XMLHttpRequest' in _window$2) { var xhrproto = _window$2.XMLHttpRequest && _window$2.XMLHttpRequest.prototype; - fill$1( - xhrproto, - 'open', - function(origOpen) { - return function(method, url) { - // preserve arity - - // if Sentry key appears in URL, don't capture - if (isString$1(url) && url.indexOf(self._globalKey) === -1) { - this.__raven_xhr = { - method: method, - url: url, - status_code: null - }; - } - - return origOpen.apply(this, arguments); - }; - }, - wrappedBuiltIns - ); - - fill$1( - xhrproto, - 'send', - function(origSend) { - return function() { - // preserve arity - var xhr = this; - - function onreadystatechangeHandler() { - if (xhr.__raven_xhr && xhr.readyState === 4) { - try { - // touching statusCode in some platforms throws - // an exception - xhr.__raven_xhr.status_code = xhr.status; - } catch (e) { - /* do nothing */ - } + fill$1(xhrproto, 'open', function (origOpen) { + return function (method, url) { + // preserve arity + // if Sentry key appears in URL, don't capture + if (isString$1(url) && url.indexOf(self._globalKey) === -1) { + this.__raven_xhr = { + method: method, + url: url, + status_code: null + }; + } - self.captureBreadcrumb({ - type: 'http', - category: 'xhr', - data: xhr.__raven_xhr - }); + return origOpen.apply(this, arguments); + }; + }, wrappedBuiltIns); + fill$1(xhrproto, 'send', function (origSend) { + return function () { + // preserve arity + var xhr = this; + + function onreadystatechangeHandler() { + if (xhr.__raven_xhr && xhr.readyState === 4) { + try { + // touching statusCode in some platforms throws + // an exception + xhr.__raven_xhr.status_code = xhr.status; + } catch (e) { + /* do nothing */ } - } - var props = ['onload', 'onerror', 'onprogress']; - for (var j = 0; j < props.length; j++) { - wrapProp(props[j], xhr); + self.captureBreadcrumb({ + type: 'http', + category: 'xhr', + data: xhr.__raven_xhr + }); } + } - if ('onreadystatechange' in xhr && isFunction$1(xhr.onreadystatechange)) { - fill$1( - xhr, - 'onreadystatechange', - function(orig) { - return self.wrap( - { - mechanism: { - type: 'instrument', - data: { - function: 'onreadystatechange', - handler: (orig && orig.name) || '<anonymous>' - } - } - }, - orig, - onreadystatechangeHandler - ); - } /* intentionally don't track this instrumentation */ - ); - } else { - // if onreadystatechange wasn't actually set by the page on this xhr, we - // are free to set our own and capture the breadcrumb - xhr.onreadystatechange = onreadystatechangeHandler; + var props = ['onload', 'onerror', 'onprogress']; + + for (var j = 0; j < props.length; j++) { + wrapProp(props[j], xhr); + } + + if ('onreadystatechange' in xhr && isFunction$1(xhr.onreadystatechange)) { + fill$1(xhr, 'onreadystatechange', function (orig) { + return self.wrap({ + mechanism: { + type: 'instrument', + data: { + function: 'onreadystatechange', + handler: orig && orig.name || '<anonymous>' + } + } + }, orig, onreadystatechangeHandler); } + /* intentionally don't track this instrumentation */ + ); + } else { + // if onreadystatechange wasn't actually set by the page on this xhr, we + // are free to set our own and capture the breadcrumb + xhr.onreadystatechange = onreadystatechangeHandler; + } - return origSend.apply(this, arguments); - }; - }, - wrappedBuiltIns - ); + return origSend.apply(this, arguments); + }; + }, wrappedBuiltIns); } if (autoBreadcrumbs.xhr && supportsFetch$1()) { - fill$1( - _window$2, - 'fetch', - function(origFetch) { - return function() { - // preserve arity - // Make a copy of the arguments to prevent deoptimization - // https://github.com/petkaantonov/bluebird/wiki/Optimization-killers#32-leaking-arguments - var args = new Array(arguments.length); - for (var i = 0; i < args.length; ++i) { - args[i] = arguments[i]; - } + fill$1(_window$2, 'fetch', function (origFetch) { + return function () { + // preserve arity + // Make a copy of the arguments to prevent deoptimization + // https://github.com/petkaantonov/bluebird/wiki/Optimization-killers#32-leaking-arguments + var args = new Array(arguments.length); + + for (var i = 0; i < args.length; ++i) { + args[i] = arguments[i]; + } - var fetchInput = args[0]; - var method = 'GET'; - var url; + var fetchInput = args[0]; + var method = 'GET'; + var url; - if (typeof fetchInput === 'string') { - url = fetchInput; - } else if ('Request' in _window$2 && fetchInput instanceof _window$2.Request) { - url = fetchInput.url; - if (fetchInput.method) { - method = fetchInput.method; - } - } else { - url = '' + fetchInput; - } + if (typeof fetchInput === 'string') { + url = fetchInput; + } else if ('Request' in _window$2 && fetchInput instanceof _window$2.Request) { + url = fetchInput.url; - // if Sentry key appears in URL, don't capture, as it's our own request - if (url.indexOf(self._globalKey) !== -1) { - return origFetch.apply(this, args); + if (fetchInput.method) { + method = fetchInput.method; } + } else { + url = '' + fetchInput; + } // if Sentry key appears in URL, don't capture, as it's our own request - if (args[1] && args[1].method) { - method = args[1].method; - } - var fetchData = { - method: method, - url: url, - status_code: null - }; + if (url.indexOf(self._globalKey) !== -1) { + return origFetch.apply(this, args); + } - return origFetch - .apply(this, args) - .then(function(response) { - fetchData.status_code = response.status; - - self.captureBreadcrumb({ - type: 'http', - category: 'fetch', - data: fetchData - }); - - return response; - }) - ['catch'](function(err) { - // if there is an error performing the request - self.captureBreadcrumb({ - type: 'http', - category: 'fetch', - data: fetchData, - level: 'error' - }); - - throw err; - }); - }; - }, - wrappedBuiltIns - ); - } + if (args[1] && args[1].method) { + method = args[1].method; + } - // Capture breadcrumbs from any click that is unhandled / bubbled up all the way + var fetchData = { + method: method, + url: url, + status_code: null + }; + return origFetch.apply(this, args).then(function (response) { + fetchData.status_code = response.status; + self.captureBreadcrumb({ + type: 'http', + category: 'fetch', + data: fetchData + }); + return response; + })['catch'](function (err) { + // if there is an error performing the request + self.captureBreadcrumb({ + type: 'http', + category: 'fetch', + data: fetchData, + level: 'error' + }); + throw err; + }); + }; + }, wrappedBuiltIns); + } // Capture breadcrumbs from any click that is unhandled / bubbled up all the way // to the document. Do this before we instrument addEventListener. + + if (autoBreadcrumbs.dom && this._hasDocument) { if (_document.addEventListener) { _document.addEventListener('click', self._breadcrumbEventHandler('click'), false); + _document.addEventListener('keypress', self._keypressEventHandler(), false); } else if (_document.attachEvent) { // IE8 Compatibility _document.attachEvent('onclick', self._breadcrumbEventHandler('click')); + _document.attachEvent('onkeypress', self._keypressEventHandler()); } - } - - // record navigation (URL) changes + } // record navigation (URL) changes // NOTE: in Chrome App environment, touching history.pushState, *even inside // a try/catch block*, will cause Chrome to output an error to console.error // borrowed from: https://github.com/angular/angular.js/pull/13945/files + + var chrome = _window$2.chrome; var isChromePackagedApp = chrome && chrome.app && chrome.app.runtime; - var hasPushAndReplaceState = - !isChromePackagedApp && - _window$2.history && - _window$2.history.pushState && - _window$2.history.replaceState; + var hasPushAndReplaceState = !isChromePackagedApp && _window$2.history && _window$2.history.pushState && _window$2.history.replaceState; + if (autoBreadcrumbs.location && hasPushAndReplaceState) { // TODO: remove onpopstate handler on uninstall() var oldOnPopState = _window$2.onpopstate; - _window$2.onpopstate = function() { + + _window$2.onpopstate = function () { var currentHref = self._location.href; + self._captureUrlChange(self._lastHref, currentHref); if (oldOnPopState) { @@ -3271,13 +3232,14 @@ typeof navigator === "object" && (function () { } }; - var historyReplacementFunction = function(origHistFunction) { + var historyReplacementFunction = function historyReplacementFunction(origHistFunction) { // note history.pushState.length is 0; intentionally not declaring // params to preserve 0 arity - return function(/* state, title, url */) { - var url = arguments.length > 2 ? arguments[2] : undefined; + return function () + /* state, title, url */ + { + var url = arguments.length > 2 ? arguments[2] : undefined; // url argument is optional - // url argument is optional if (url) { // coerce to string (this is what pushState does) self._captureUrlChange(self._lastHref, url + ''); @@ -3293,7 +3255,7 @@ typeof navigator === "object" && (function () { if (autoBreadcrumbs.console && 'console' in _window$2 && console.log) { // console - var consoleMethodCallback = function(msg, data) { + var consoleMethodCallback = function consoleMethodCallback(msg, data) { self.captureBreadcrumb({ message: msg, level: data.level, @@ -3301,88 +3263,79 @@ typeof navigator === "object" && (function () { }); }; - each$1(['debug', 'info', 'warn', 'error', 'log'], function(_, level) { + each$1(['debug', 'info', 'warn', 'error', 'log'], function (_, level) { wrapConsoleMethod(console, level, consoleMethodCallback); }); } }, - - _restoreBuiltIns: function() { + _restoreBuiltIns: function _restoreBuiltIns() { // restore any wrapped builtins var builtin; + while (this._wrappedBuiltIns.length) { builtin = this._wrappedBuiltIns.shift(); - var obj = builtin[0], - name = builtin[1], - orig = builtin[2]; - + name = builtin[1], + orig = builtin[2]; obj[name] = orig; } }, - - _restoreConsole: function() { + _restoreConsole: function _restoreConsole() { // eslint-disable-next-line guard-for-in for (var method in this._originalConsoleMethods) { this._originalConsole[method] = this._originalConsoleMethods[method]; } }, + _drainPlugins: function _drainPlugins() { + var self = this; // FIX ME TODO - _drainPlugins: function() { - var self = this; - - // FIX ME TODO - each$1(this._plugins, function(_, plugin) { + each$1(this._plugins, function (_, plugin) { var installer = plugin[0]; var args = plugin[1]; installer.apply(self, [self].concat(args)); }); }, - - _parseDSN: function(str) { + _parseDSN: function _parseDSN(str) { var m = dsnPattern.exec(str), - dsn = {}, - i = 7; + dsn = {}, + i = 7; try { - while (i--) dsn[dsnKeys[i]] = m[i] || ''; + while (i--) { + dsn[dsnKeys[i]] = m[i] || ''; + } } catch (e) { throw new configError('Invalid DSN: ' + str); } if (dsn.pass && !this._globalOptions.allowSecretKey) { - throw new configError( - 'Do not specify your secret key in the DSN. See: http://bit.ly/raven-secret-key' - ); + throw new configError('Do not specify your secret key in the DSN. See: http://bit.ly/raven-secret-key'); } return dsn; }, - - _getGlobalServer: function(uri) { + _getGlobalServer: function _getGlobalServer(uri) { // assemble the endpoint from the uri pieces var globalServer = '//' + uri.host + (uri.port ? ':' + uri.port : ''); if (uri.protocol) { globalServer = uri.protocol + ':' + globalServer; } + return globalServer; }, - - _handleOnErrorStackInfo: function(stackInfo, options) { + _handleOnErrorStackInfo: function _handleOnErrorStackInfo(stackInfo, options) { options = options || {}; options.mechanism = options.mechanism || { type: 'onerror', handled: false - }; + }; // if we are intentionally ignoring errors via onerror, bail out - // if we are intentionally ignoring errors via onerror, bail out if (!this._ignoreOnError) { this._handleStackInfo(stackInfo, options); } }, - - _handleStackInfo: function(stackInfo, options) { + _handleStackInfo: function _handleStackInfo(stackInfo, options) { var frames = this._prepareFrames(stackInfo, options); this._triggerEvent('handle', { @@ -3390,216 +3343,180 @@ typeof navigator === "object" && (function () { options: options }); - this._processException( - stackInfo.name, - stackInfo.message, - stackInfo.url, - stackInfo.lineno, - frames, - options - ); + this._processException(stackInfo.name, stackInfo.message, stackInfo.url, stackInfo.lineno, frames, options); }, - - _prepareFrames: function(stackInfo, options) { + _prepareFrames: function _prepareFrames(stackInfo, options) { var self = this; var frames = []; + if (stackInfo.stack && stackInfo.stack.length) { - each$1(stackInfo.stack, function(i, stack) { + each$1(stackInfo.stack, function (i, stack) { var frame = self._normalizeFrame(stack, stackInfo.url); + if (frame) { frames.push(frame); } - }); + }); // e.g. frames captured via captureMessage throw - // e.g. frames captured via captureMessage throw if (options && options.trimHeadFrames) { for (var j = 0; j < options.trimHeadFrames && j < frames.length; j++) { frames[j].in_app = false; } } } + frames = frames.slice(0, this._globalOptions.stackTraceLimit); return frames; }, - - _normalizeFrame: function(frame, stackInfoUrl) { + _normalizeFrame: function _normalizeFrame(frame, stackInfoUrl) { // normalize the frames data var normalized = { filename: frame.url, lineno: frame.line, colno: frame.column, function: frame.func || '?' - }; - - // Case when we don't have any information about the error + }; // Case when we don't have any information about the error // E.g. throwing a string or raw object, instead of an `Error` in Firefox // Generating synthetic error doesn't add any value here // // We should probably somehow let a user know that they should fix their code + if (!frame.url) { normalized.filename = stackInfoUrl; // fallback to whole stacks url from onerror handler } - normalized.in_app = !// determine if an exception came from outside of our app + normalized.in_app = !( // determine if an exception came from outside of our app // first we check the global includePaths list. - ( - (!!this._globalOptions.includePaths.test && - !this._globalOptions.includePaths.test(normalized.filename)) || - // Now we check for fun, if the function name is Raven or TraceKit - /(Raven|TraceKit)\./.test(normalized['function']) || - // finally, we do a last ditch effort and check for raven.min.js - /raven\.(min\.)?js$/.test(normalized.filename) - ); - + !!this._globalOptions.includePaths.test && !this._globalOptions.includePaths.test(normalized.filename) || // Now we check for fun, if the function name is Raven or TraceKit + /(Raven|TraceKit)\./.test(normalized['function']) || // finally, we do a last ditch effort and check for raven.min.js + /raven\.(min\.)?js$/.test(normalized.filename)); return normalized; }, - - _processException: function(type, message, fileurl, lineno, frames, options) { + _processException: function _processException(type, message, fileurl, lineno, frames, options) { var prefixedMessage = (type ? type + ': ' : '') + (message || ''); - if ( - !!this._globalOptions.ignoreErrors.test && - (this._globalOptions.ignoreErrors.test(message) || - this._globalOptions.ignoreErrors.test(prefixedMessage)) - ) { + + if (!!this._globalOptions.ignoreErrors.test && (this._globalOptions.ignoreErrors.test(message) || this._globalOptions.ignoreErrors.test(prefixedMessage))) { return; } var stacktrace; if (frames && frames.length) { - fileurl = frames[0].filename || fileurl; - // Sentry expects frames oldest to newest + fileurl = frames[0].filename || fileurl; // Sentry expects frames oldest to newest // and JS sends them as newest to oldest + frames.reverse(); - stacktrace = {frames: frames}; + stacktrace = { + frames: frames + }; } else if (fileurl) { stacktrace = { - frames: [ - { - filename: fileurl, - lineno: lineno, - in_app: true - } - ] + frames: [{ + filename: fileurl, + lineno: lineno, + in_app: true + }] }; } - if ( - !!this._globalOptions.ignoreUrls.test && - this._globalOptions.ignoreUrls.test(fileurl) - ) { + if (!!this._globalOptions.ignoreUrls.test && this._globalOptions.ignoreUrls.test(fileurl)) { return; } - if ( - !!this._globalOptions.whitelistUrls.test && - !this._globalOptions.whitelistUrls.test(fileurl) - ) { + if (!!this._globalOptions.whitelistUrls.test && !this._globalOptions.whitelistUrls.test(fileurl)) { return; } - var data = objectMerge$1( - { - // sentry.interfaces.Exception - exception: { - values: [ - { - type: type, - value: message, - stacktrace: stacktrace - } - ] - }, - transaction: fileurl + var data = objectMerge$1({ + // sentry.interfaces.Exception + exception: { + values: [{ + type: type, + value: message, + stacktrace: stacktrace + }] }, - options - ); - + transaction: fileurl + }, options); var ex = data.exception.values[0]; + if (ex.type == null && ex.value === '') { ex.value = 'Unrecoverable error caught'; - } - - // Move mechanism from options to exception interface + } // Move mechanism from options to exception interface // We do this, as requiring user to pass `{exception:{mechanism:{ ... }}}` would be // too much + + if (!data.exception.mechanism && data.mechanism) { data.exception.mechanism = data.mechanism; delete data.mechanism; } - data.exception.mechanism = objectMerge$1( - { - type: 'generic', - handled: true - }, - data.exception.mechanism || {} - ); + data.exception.mechanism = objectMerge$1({ + type: 'generic', + handled: true + }, data.exception.mechanism || {}); // Fire away! - // Fire away! this._send(data); }, - - _trimPacket: function(data) { + _trimPacket: function _trimPacket(data) { // For now, we only want to truncate the two different messages // but this could/should be expanded to just trim everything var max = this._globalOptions.maxMessageLength; + if (data.message) { data.message = truncate$1(data.message, max); } + if (data.exception) { var exception = data.exception.values[0]; exception.value = truncate$1(exception.value, max); } var request = data.request; + if (request) { if (request.url) { request.url = truncate$1(request.url, this._globalOptions.maxUrlLength); } + if (request.Referer) { request.Referer = truncate$1(request.Referer, this._globalOptions.maxUrlLength); } } - if (data.breadcrumbs && data.breadcrumbs.values) - this._trimBreadcrumbs(data.breadcrumbs); - + if (data.breadcrumbs && data.breadcrumbs.values) this._trimBreadcrumbs(data.breadcrumbs); return data; }, /** * Truncate breadcrumb values (right now just URLs) */ - _trimBreadcrumbs: function(breadcrumbs) { + _trimBreadcrumbs: function _trimBreadcrumbs(breadcrumbs) { // known breadcrumb properties with urls // TODO: also consider arbitrary prop values that start with (https?)?:// var urlProps = ['to', 'from', 'url'], - urlProp, - crumb, - data; + urlProp, + crumb, + data; for (var i = 0; i < breadcrumbs.values.length; ++i) { crumb = breadcrumbs.values[i]; - if ( - !crumb.hasOwnProperty('data') || - !isObject$1(crumb.data) || - objectFrozen$1(crumb.data) - ) - continue; - + if (!crumb.hasOwnProperty('data') || !isObject$1(crumb.data) || objectFrozen$1(crumb.data)) continue; data = objectMerge$1({}, crumb.data); + for (var j = 0; j < urlProps.length; ++j) { urlProp = urlProps[j]; + if (data.hasOwnProperty(urlProp) && data[urlProp]) { data[urlProp] = truncate$1(data[urlProp], this._globalOptions.maxUrlLength); } } + breadcrumbs.values[i].data = data; } }, - - _getHttpData: function() { + _getHttpData: function _getHttpData() { if (!this._hasNavigator && !this._hasDocument) return; var httpData = {}; @@ -3607,9 +3524,9 @@ typeof navigator === "object" && (function () { httpData.headers = { 'User-Agent': _navigator.userAgent }; - } + } // Check in `window` instead of `document`, as we may be in ServiceWorker environment + - // Check in `window` instead of `document`, as we may be in ServiceWorker environment if (_window$2.location && _window$2.location.href) { httpData.url = _window$2.location.href; } @@ -3621,13 +3538,11 @@ typeof navigator === "object" && (function () { return httpData; }, - - _resetBackoff: function() { + _resetBackoff: function _resetBackoff() { this._backoffDuration = 0; this._backoffStart = null; }, - - _shouldBackoff: function() { + _shouldBackoff: function _shouldBackoff() { return this._backoffDuration && now() - this._backoffStart < this._backoffDuration; }, @@ -3640,17 +3555,12 @@ typeof navigator === "object" && (function () { * other old browsers). This can take the form of an "exception" * data object with a single frame (derived from the onerror args). */ - _isRepeatData: function(current) { + _isRepeatData: function _isRepeatData(current) { var last = this._lastData; + if (!last || current.message !== last.message || // defined for captureMessage + current.transaction !== last.transaction // defined for captureException/onerror + ) return false; // Stacktrace interface (i.e. from captureMessage) - if ( - !last || - current.message !== last.message || // defined for captureMessage - current.transaction !== last.transaction // defined for captureException/onerror - ) - return false; - - // Stacktrace interface (i.e. from captureMessage) if (current.stacktrace || last.stacktrace) { return isSameStacktrace$1(current.stacktrace, last.stacktrace); } else if (current.exception || last.exception) { @@ -3660,21 +3570,19 @@ typeof navigator === "object" && (function () { return true; }, - - _setBackoffState: function(request) { + _setBackoffState: function _setBackoffState(request) { // If we are already in a backoff state, don't change anything if (this._shouldBackoff()) { return; } - var status = request.status; - - // 400 - project_id doesn't exist or some other fatal + var status = request.status; // 400 - project_id doesn't exist or some other fatal // 401 - invalid/revoked dsn // 429 - too many requests - if (!(status === 400 || status === 401 || status === 429)) return; + if (!(status === 400 || status === 401 || status === 429)) return; var retry; + try { // If Retry-After is not in Access-Control-Expose-Headers, most // browsers will throw an exception trying to access it @@ -3682,47 +3590,40 @@ typeof navigator === "object" && (function () { retry = request.headers.get('Retry-After'); } else { retry = request.getResponseHeader('Retry-After'); - } + } // Retry-After is returned in seconds + - // Retry-After is returned in seconds retry = parseInt(retry, 10) * 1000; } catch (e) { /* eslint no-empty:0 */ } - this._backoffDuration = retry - ? // If Sentry server returned a Retry-After value, use it - retry - : // Otherwise, double the last backoff duration (starts at 1 sec) - this._backoffDuration * 2 || 1000; - + this._backoffDuration = retry ? // If Sentry server returned a Retry-After value, use it + retry : // Otherwise, double the last backoff duration (starts at 1 sec) + this._backoffDuration * 2 || 1000; this._backoffStart = now(); }, - - _send: function(data) { + _send: function _send(data) { var globalOptions = this._globalOptions; var baseData = { - project: this._globalProject, - logger: globalOptions.logger, - platform: 'javascript' - }, - httpData = this._getHttpData(); + project: this._globalProject, + logger: globalOptions.logger, + platform: 'javascript' + }, + httpData = this._getHttpData(); if (httpData) { baseData.request = httpData; - } + } // HACK: delete `trimHeadFrames` to prevent from appearing in outbound payload - // HACK: delete `trimHeadFrames` to prevent from appearing in outbound payload - if (data.trimHeadFrames) delete data.trimHeadFrames; - data = objectMerge$1(baseData, data); + if (data.trimHeadFrames) delete data.trimHeadFrames; + data = objectMerge$1(baseData, data); // Merge in the tags and extra separately since objectMerge doesn't handle a deep merge - // Merge in the tags and extra separately since objectMerge doesn't handle a deep merge data.tags = objectMerge$1(objectMerge$1({}, this._globalContext.tags), data.tags); - data.extra = objectMerge$1(objectMerge$1({}, this._globalContext.extra), data.extra); + data.extra = objectMerge$1(objectMerge$1({}, this._globalContext.extra), data.extra); // Send along our own collected metadata with extra - // Send along our own collected metadata with extra data.extra['session:duration'] = now() - this._startTime; if (this._breadcrumbs && this._breadcrumbs.length > 0) { @@ -3736,21 +3637,17 @@ typeof navigator === "object" && (function () { if (this._globalContext.user) { // sentry.interfaces.User data.user = this._globalContext.user; - } + } // Include the environment if it's defined in globalOptions - // Include the environment if it's defined in globalOptions - if (globalOptions.environment) data.environment = globalOptions.environment; - // Include the release if it's defined in globalOptions - if (globalOptions.release) data.release = globalOptions.release; + if (globalOptions.environment) data.environment = globalOptions.environment; // Include the release if it's defined in globalOptions - // Include server_name if it's defined in globalOptions - if (globalOptions.serverName) data.server_name = globalOptions.serverName; + if (globalOptions.release) data.release = globalOptions.release; // Include server_name if it's defined in globalOptions - data = this._sanitizeData(data); + if (globalOptions.serverName) data.server_name = globalOptions.serverName; + data = this._sanitizeData(data); // Cleanup empty properties before sending them to the server - // Cleanup empty properties before sending them to the server - Object.keys(data).forEach(function(key) { + Object.keys(data).forEach(function (key) { if (data[key] == null || data[key] === '' || isEmptyObject$1(data[key])) { delete data[key]; } @@ -3758,25 +3655,23 @@ typeof navigator === "object" && (function () { if (isFunction$1(globalOptions.dataCallback)) { data = globalOptions.dataCallback(data) || data; - } + } // Why?????????? + - // Why?????????? if (!data || isEmptyObject$1(data)) { return; - } + } // Check if the request should be filtered or not - // Check if the request should be filtered or not - if ( - isFunction$1(globalOptions.shouldSendCallback) && - !globalOptions.shouldSendCallback(data) - ) { - return; - } - // Backoff state: Sentry server previously responded w/ an error (e.g. 429 - too many requests), + if (isFunction$1(globalOptions.shouldSendCallback) && !globalOptions.shouldSendCallback(data)) { + return; + } // Backoff state: Sentry server previously responded w/ an error (e.g. 429 - too many requests), // so drop requests until "cool-off" period has elapsed. + + if (this._shouldBackoff()) { this._logDebug('warn', 'Raven dropped error due to backoff: ', data); + return; } @@ -3788,38 +3683,32 @@ typeof navigator === "object" && (function () { this._sendProcessedPayload(data); } }, - - _sanitizeData: function(data) { + _sanitizeData: function _sanitizeData(data) { return sanitize$1(data, this._globalOptions.sanitizeKeys); }, - - _getUuid: function() { + _getUuid: function _getUuid() { return uuid4$1(); }, - - _sendProcessedPayload: function(data, callback) { + _sendProcessedPayload: function _sendProcessedPayload(data, callback) { var self = this; var globalOptions = this._globalOptions; + if (!this.isSetup()) return; // Try and clean up the packet before sending by truncating long values - if (!this.isSetup()) return; - - // Try and clean up the packet before sending by truncating long values - data = this._trimPacket(data); - - // ideally duplicate error testing should occur *before* dataCallback/shouldSendCallback, + data = this._trimPacket(data); // ideally duplicate error testing should occur *before* dataCallback/shouldSendCallback, // but this would require copying an un-truncated copy of the data packet, which can be // arbitrarily deep (extra_data) -- could be worthwhile? will revisit + if (!this._globalOptions.allowDuplicates && this._isRepeatData(data)) { this._logDebug('warn', 'Raven dropped repeat event: ', data); - return; - } - // Send along an event_id if not explicitly passed. + return; + } // Send along an event_id if not explicitly passed. // This event_id can be used to reference the error within Sentry itself. // Set lastEventId after we know the error should actually be sent - this._lastEventId = data.event_id || (data.event_id = this._getUuid()); - // Store outbound payload after trim + + this._lastEventId = data.event_id || (data.event_id = this._getUuid()); // Store outbound payload after trim + this._lastData = data; this._logDebug('debug', 'Raven about to send:', data); @@ -3834,24 +3723,20 @@ typeof navigator === "object" && (function () { auth.sentry_secret = this._globalSecret; } - var exception = data.exception && data.exception.values[0]; + var exception = data.exception && data.exception.values[0]; // only capture 'sentry' breadcrumb is autoBreadcrumbs is truthy - // only capture 'sentry' breadcrumb is autoBreadcrumbs is truthy - if ( - this._globalOptions.autoBreadcrumbs && - this._globalOptions.autoBreadcrumbs.sentry - ) { + if (this._globalOptions.autoBreadcrumbs && this._globalOptions.autoBreadcrumbs.sentry) { this.captureBreadcrumb({ category: 'sentry', - message: exception - ? (exception.type ? exception.type + ': ' : '') + exception.value - : data.message, + message: exception ? (exception.type ? exception.type + ': ' : '') + exception.value : data.message, event_id: data.event_id, level: data.level || 'error' // presume error unless specified + }); } var url = this._globalEndpoint; + (globalOptions.transport || this._makeRequest).call(this, { url: url, auth: auth, @@ -3864,6 +3749,7 @@ typeof navigator === "object" && (function () { data: data, src: url }); + callback && callback(); }, onError: function failure(error) { @@ -3877,16 +3763,15 @@ typeof navigator === "object" && (function () { data: data, src: url }); + error = error || new Error('Raven send failed (no additional details provided)'); callback && callback(error); } }); }, - - _makeRequest: function(opts) { + _makeRequest: function _makeRequest(opts) { // Auth is intentionally sent as part of query string (NOT as custom HTTP header) to avoid preflight CORS requests var url = opts.url + '?' + urlencode$1(opts.auth); - var evaluatedHeaders = null; var evaluatedFetchParameters = {}; @@ -3900,7 +3785,6 @@ typeof navigator === "object" && (function () { if (supportsFetch$1()) { evaluatedFetchParameters.body = stringify_1(opts.data); - var defaultFetchOptions = objectMerge$1({}, this._fetchDefaults); var fetchOptions = objectMerge$1(defaultFetchOptions, evaluatedFetchParameters); @@ -3908,35 +3792,29 @@ typeof navigator === "object" && (function () { fetchOptions.headers = evaluatedHeaders; } - return _window$2 - .fetch(url, fetchOptions) - .then(function(response) { - if (response.ok) { - opts.onSuccess && opts.onSuccess(); - } else { - var error = new Error('Sentry error code: ' + response.status); - // It's called request only to keep compatibility with XHR interface - // and not add more redundant checks in setBackoffState method - error.request = response; - opts.onError && opts.onError(error); - } - }) - ['catch'](function() { - opts.onError && - opts.onError(new Error('Sentry error code: network unavailable')); - }); + return _window$2.fetch(url, fetchOptions).then(function (response) { + if (response.ok) { + opts.onSuccess && opts.onSuccess(); + } else { + var error = new Error('Sentry error code: ' + response.status); // It's called request only to keep compatibility with XHR interface + // and not add more redundant checks in setBackoffState method + + error.request = response; + opts.onError && opts.onError(error); + } + })['catch'](function () { + opts.onError && opts.onError(new Error('Sentry error code: network unavailable')); + }); } var request = _window$2.XMLHttpRequest && new _window$2.XMLHttpRequest(); - if (!request) return; + if (!request) return; // if browser doesn't support CORS (e.g. IE7), we are out of luck - // if browser doesn't support CORS (e.g. IE7), we are out of luck var hasCORS = 'withCredentials' in request || typeof XDomainRequest !== 'undefined'; - if (!hasCORS) return; if ('withCredentials' in request) { - request.onreadystatechange = function() { + request.onreadystatechange = function () { if (request.readyState !== 4) { return; } else if (request.status === 200) { @@ -3948,17 +3826,17 @@ typeof navigator === "object" && (function () { } }; } else { - request = new XDomainRequest(); - // xdomainrequest cannot go http -> https (or vice versa), + request = new XDomainRequest(); // xdomainrequest cannot go http -> https (or vice versa), // so always use protocol relative - url = url.replace(/^https?:/, ''); - // onreadystatechange not supported by XDomainRequest + url = url.replace(/^https?:/, ''); // onreadystatechange not supported by XDomainRequest + if (opts.onSuccess) { request.onload = opts.onSuccess; } + if (opts.onError) { - request.onerror = function() { + request.onerror = function () { var err = new Error('Sentry error code: XDomainRequest'); err.request = request; opts.onError(err); @@ -3969,15 +3847,14 @@ typeof navigator === "object" && (function () { request.open('POST', url); if (evaluatedHeaders) { - each$1(evaluatedHeaders, function(key, value) { + each$1(evaluatedHeaders, function (key, value) { request.setRequestHeader(key, value); }); } request.send(stringify_1(opts.data)); }, - - _evaluateHash: function(hash) { + _evaluateHash: function _evaluateHash(hash) { var evaluated = {}; for (var key in hash) { @@ -3989,35 +3866,24 @@ typeof navigator === "object" && (function () { return evaluated; }, - - _logDebug: function(level) { + _logDebug: function _logDebug(level) { // We allow `Raven.debug` and `Raven.config(DSN, { debug: true })` to not make backward incompatible API change - if ( - this._originalConsoleMethods[level] && - (this.debug || this._globalOptions.debug) - ) { + if (this._originalConsoleMethods[level] && (this.debug || this._globalOptions.debug)) { // In IE<10 console methods do not have their own 'apply' method - Function.prototype.apply.call( - this._originalConsoleMethods[level], - this._originalConsole, - [].slice.call(arguments, 1) - ); + Function.prototype.apply.call(this._originalConsoleMethods[level], this._originalConsole, [].slice.call(arguments, 1)); } }, - - _mergeContext: function(key, context) { + _mergeContext: function _mergeContext(key, context) { if (isUndefined$1(context)) { delete this._globalContext[key]; } else { this._globalContext[key] = objectMerge$1(this._globalContext[key] || {}, context); } } - }; + }; // Deprecations - // Deprecations Raven.prototype.setUser = Raven.prototype.setUserContext; Raven.prototype.setReleaseContext = Raven.prototype.setRelease; - var raven = Raven; /** @@ -4025,33 +3891,26 @@ typeof navigator === "object" && (function () { * main entry point for Raven. If you are a consumer of the * Raven library, you SHOULD load this file (vs raven.js). **/ + // This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785) + var _window$3 = typeof window !== 'undefined' ? window : typeof commonjsGlobal !== 'undefined' ? commonjsGlobal : typeof self !== 'undefined' ? self : {}; - - // This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785) - var _window$3 = - typeof window !== 'undefined' - ? window - : typeof commonjsGlobal !== 'undefined' ? commonjsGlobal : typeof self !== 'undefined' ? self : {}; var _Raven = _window$3.Raven; - var Raven$1 = new raven(); - /* * Allow multiple versions of Raven to be installed. * Strip Raven from the global context and returns the instance. * * @return {Raven} */ - Raven$1.noConflict = function() { + + Raven$1.noConflict = function () { _window$3.Raven = _Raven; return Raven$1; }; Raven$1.afterLoad(); - var singleton = Raven$1; - /** * DISCLAIMER: * @@ -4086,9 +3945,8826 @@ typeof navigator === "object" && (function () { * * It should "just work". */ + var Client = raven; singleton.Client = Client; + var defaults = { + addCSS: true, + // Add CSS to the element to improve usability (required here or in your CSS!) + thumbWidth: 15, + // The width of the thumb handle + watch: true // Watch for new elements that match a string target + + }; + + // Element matches a selector + function matches(element, selector) { + + function match() { + return Array.from(document.querySelectorAll(selector)).includes(this); + } + + var matches = match; + return matches.call(element, selector); + } + + // Trigger event + function trigger(element, type) { + if (!element || !type) { + return; + } // Create and dispatch the event + + + var event = new Event(type); // Dispatch the event + + element.dispatchEvent(event); + } + + // ========================================================================== + // Type checking utils + // ========================================================================== + var getConstructor = function getConstructor(input) { + return input !== null && typeof input !== 'undefined' ? input.constructor : null; + }; + + var instanceOf = function instanceOf(input, constructor) { + return Boolean(input && constructor && input instanceof constructor); + }; + + var isNullOrUndefined = function isNullOrUndefined(input) { + return input === null || typeof input === 'undefined'; + }; + + var isObject$2 = function isObject(input) { + return getConstructor(input) === Object; + }; + + var isNumber = function isNumber(input) { + return getConstructor(input) === Number && !Number.isNaN(input); + }; + + var isString$2 = function isString(input) { + return getConstructor(input) === String; + }; + + var isBoolean = function isBoolean(input) { + return getConstructor(input) === Boolean; + }; + + var isFunction$2 = function isFunction(input) { + return getConstructor(input) === Function; + }; + + var isArray$2 = function isArray(input) { + return Array.isArray(input); + }; + + var isNodeList = function isNodeList(input) { + return instanceOf(input, NodeList); + }; + + var isElement = function isElement(input) { + return instanceOf(input, Element); + }; + + var isEvent = function isEvent(input) { + return instanceOf(input, Event); + }; + + var isEmpty = function isEmpty(input) { + return isNullOrUndefined(input) || (isString$2(input) || isArray$2(input) || isNodeList(input)) && !input.length || isObject$2(input) && !Object.keys(input).length; + }; + + var is = { + nullOrUndefined: isNullOrUndefined, + object: isObject$2, + number: isNumber, + string: isString$2, + boolean: isBoolean, + function: isFunction$2, + array: isArray$2, + nodeList: isNodeList, + element: isElement, + event: isEvent, + empty: isEmpty + }; + + // Get the number of decimal places + function getDecimalPlaces(value) { + var match = "".concat(value).match(/(?:\.(\d+))?(?:[eE]([+-]?\d+))?$/); + + if (!match) { + return 0; + } + + return Math.max(0, // Number of digits right of decimal point. + (match[1] ? match[1].length : 0) - ( // Adjust for scientific notation. + match[2] ? +match[2] : 0)); + } // Round to the nearest step + + function round(number, step) { + if (step < 1) { + var places = getDecimalPlaces(step); + return parseFloat(number.toFixed(places)); + } + + return Math.round(number / step) * step; + } + + var RangeTouch = + /*#__PURE__*/ + function () { + /** + * Setup a new instance + * @param {String|Element} target + * @param {Object} options + */ + function RangeTouch(target, options) { + _classCallCheck(this, RangeTouch); + + if (is.element(target)) { + // An Element is passed, use it directly + this.element = target; + } else if (is.string(target)) { + // A CSS Selector is passed, fetch it from the DOM + this.element = document.querySelector(target); + } + + if (!is.element(this.element) || !is.empty(this.element.rangeTouch)) { + return; + } + + this.config = Object.assign({}, defaults, options); + this.init(); + } + + _createClass(RangeTouch, [{ + key: "init", + value: function init() { + // Bail if not a touch enabled device + if (!RangeTouch.enabled) { + return; + } // Add useful CSS + + + if (this.config.addCSS) { + // TODO: Restore original values on destroy + this.element.style.userSelect = 'none'; + this.element.style.webKitUserSelect = 'none'; + this.element.style.touchAction = 'manipulation'; + } + + this.listeners(true); + this.element.rangeTouch = this; + } + }, { + key: "destroy", + value: function destroy() { + // Bail if not a touch enabled device + if (!RangeTouch.enabled) { + return; + } + + this.listeners(false); + this.element.rangeTouch = null; + } + }, { + key: "listeners", + value: function listeners(toggle) { + var _this = this; + + var method = toggle ? 'addEventListener' : 'removeEventListener'; // Listen for events + + ['touchstart', 'touchmove', 'touchend'].forEach(function (type) { + _this.element[method](type, function (event) { + return _this.set(event); + }, false); + }); + } + /** + * Get the value based on touch position + * @param {Event} event + */ + + }, { + key: "get", + value: function get(event) { + if (!RangeTouch.enabled || !is.event(event)) { + return null; + } + + var input = event.target; + var touch = event.changedTouches[0]; + var min = parseFloat(input.getAttribute('min')) || 0; + var max = parseFloat(input.getAttribute('max')) || 100; + var step = parseFloat(input.getAttribute('step')) || 1; + var delta = max - min; // Calculate percentage + + var percent; + var clientRect = input.getBoundingClientRect(); + var thumbWidth = 100 / clientRect.width * (this.config.thumbWidth / 2) / 100; // Determine left percentage + + percent = 100 / clientRect.width * (touch.clientX - clientRect.left); // Don't allow outside bounds + + if (percent < 0) { + percent = 0; + } else if (percent > 100) { + percent = 100; + } // Factor in the thumb offset + + + if (percent < 50) { + percent -= (100 - percent * 2) * thumbWidth; + } else if (percent > 50) { + percent += (percent - 50) * 2 * thumbWidth; + } // Find the closest step to the mouse position + + + return min + round(delta * (percent / 100), step); + } + /** + * Update range value based on position + * @param {Event} event + */ + + }, { + key: "set", + value: function set(event) { + if (!RangeTouch.enabled || !is.event(event) || event.target.disabled) { + return; + } // Prevent text highlight on iOS + + + event.preventDefault(); // Set value + + event.target.value = this.get(event); // Trigger event + + trigger(event.target, event.type === 'touchend' ? 'change' : 'input'); + } + }], [{ + key: "setup", + + /** + * Setup multiple instances + * @param {String|Element|NodeList|Array} target + * @param {Object} options + */ + value: function setup(target) { + var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var targets = null; + + if (is.empty(target) || is.string(target)) { + targets = Array.from(document.querySelectorAll(is.string(target) ? target : 'input[type="range"]')); + } else if (is.element(target)) { + targets = [target]; + } else if (is.nodeList(target)) { + targets = Array.from(target); + } else if (is.array(target)) { + targets = target.filter(is.element); + } + + if (is.empty(targets)) { + return null; + } + + var config = Object.assign({}, defaults, options); + + if (is.string(target) && config.watch) { + // Create an observer instance + var observer = new MutationObserver(function (mutations) { + Array.from(mutations).forEach(function (mutation) { + Array.from(mutation.addedNodes).forEach(function (node) { + if (!is.element(node) || !matches(node, target)) { + return; + } // eslint-disable-next-line no-unused-vars + + + var range = new RangeTouch(node, config); + }); + }); + }); // Pass in the target node, as well as the observer options + + observer.observe(document.body, { + childList: true, + subtree: true + }); + } + + return targets.map(function (t) { + return new RangeTouch(t, options); + }); + } + }, { + key: "enabled", + get: function get() { + return 'ontouchstart' in document.documentElement; + } + }]); + + return RangeTouch; + }(); + + // ========================================================================== + // Type checking utils + // ========================================================================== + var getConstructor$1 = function getConstructor(input) { + return input !== null && typeof input !== 'undefined' ? input.constructor : null; + }; + + var instanceOf$1 = function instanceOf(input, constructor) { + return Boolean(input && constructor && input instanceof constructor); + }; + + var isNullOrUndefined$1 = function isNullOrUndefined(input) { + return input === null || typeof input === 'undefined'; + }; + + var isObject$3 = function isObject(input) { + return getConstructor$1(input) === Object; + }; + + var isNumber$1 = function isNumber(input) { + return getConstructor$1(input) === Number && !Number.isNaN(input); + }; + + var isString$3 = function isString(input) { + return getConstructor$1(input) === String; + }; + + var isBoolean$1 = function isBoolean(input) { + return getConstructor$1(input) === Boolean; + }; + + var isFunction$3 = function isFunction(input) { + return getConstructor$1(input) === Function; + }; + + var isArray$3 = function isArray(input) { + return Array.isArray(input); + }; + + var isWeakMap = function isWeakMap(input) { + return instanceOf$1(input, WeakMap); + }; + + var isNodeList$1 = function isNodeList(input) { + return instanceOf$1(input, NodeList); + }; + + var isElement$1 = function isElement(input) { + return instanceOf$1(input, Element); + }; + + var isTextNode = function isTextNode(input) { + return getConstructor$1(input) === Text; + }; + + var isEvent$1 = function isEvent(input) { + return instanceOf$1(input, Event); + }; + + var isKeyboardEvent = function isKeyboardEvent(input) { + return instanceOf$1(input, KeyboardEvent); + }; + + var isCue = function isCue(input) { + return instanceOf$1(input, window.TextTrackCue) || instanceOf$1(input, window.VTTCue); + }; + + var isTrack = function isTrack(input) { + return instanceOf$1(input, TextTrack) || !isNullOrUndefined$1(input) && isString$3(input.kind); + }; + + var isPromise = function isPromise(input) { + return instanceOf$1(input, Promise); + }; + + var isEmpty$1 = function isEmpty(input) { + return isNullOrUndefined$1(input) || (isString$3(input) || isArray$3(input) || isNodeList$1(input)) && !input.length || isObject$3(input) && !Object.keys(input).length; + }; + + var isUrl = function isUrl(input) { + // Accept a URL object + if (instanceOf$1(input, window.URL)) { + return true; + } // Must be string from here + + + if (!isString$3(input)) { + return false; + } // Add the protocol if required + + + var string = input; + + if (!input.startsWith('http://') || !input.startsWith('https://')) { + string = "http://".concat(input); + } + + try { + return !isEmpty$1(new URL(string).hostname); + } catch (e) { + return false; + } + }; + + var is$1 = { + nullOrUndefined: isNullOrUndefined$1, + object: isObject$3, + number: isNumber$1, + string: isString$3, + boolean: isBoolean$1, + function: isFunction$3, + array: isArray$3, + weakMap: isWeakMap, + nodeList: isNodeList$1, + element: isElement$1, + textNode: isTextNode, + event: isEvent$1, + keyboardEvent: isKeyboardEvent, + cue: isCue, + track: isTrack, + promise: isPromise, + url: isUrl, + empty: isEmpty$1 + }; + + // ========================================================================== + // https://github.com/WICG/EventListenerOptions/blob/gh-pages/explainer.md + // https://www.youtube.com/watch?v=NPM6172J22g + + var supportsPassiveListeners = function () { + // Test via a getter in the options object to see if the passive property is accessed + var supported = false; + + try { + var options = Object.defineProperty({}, 'passive', { + get: function get() { + supported = true; + return null; + } + }); + window.addEventListener('test', null, options); + window.removeEventListener('test', null, options); + } catch (e) {// Do nothing + } + + return supported; + }(); // Toggle event listener + + + function toggleListener(element, event, callback) { + var _this = this; + + var toggle = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : false; + var passive = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : true; + var capture = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : false; + + // Bail if no element, event, or callback + if (!element || !('addEventListener' in element) || is$1.empty(event) || !is$1.function(callback)) { + return; + } // Allow multiple events + + + var events = event.split(' '); // Build options + // Default to just the capture boolean for browsers with no passive listener support + + var options = capture; // If passive events listeners are supported + + if (supportsPassiveListeners) { + options = { + // Whether the listener can be passive (i.e. default never prevented) + passive: passive, + // Whether the listener is a capturing listener or not + capture: capture + }; + } // If a single node is passed, bind the event listener + + + events.forEach(function (type) { + if (_this && _this.eventListeners && toggle) { + // Cache event listener + _this.eventListeners.push({ + element: element, + type: type, + callback: callback, + options: options + }); + } + + element[toggle ? 'addEventListener' : 'removeEventListener'](type, callback, options); + }); + } // Bind event handler + + function on(element) { + var events = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : ''; + var callback = arguments.length > 2 ? arguments[2] : undefined; + var passive = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : true; + var capture = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false; + toggleListener.call(this, element, events, callback, true, passive, capture); + } // Unbind event handler + + function off(element) { + var events = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : ''; + var callback = arguments.length > 2 ? arguments[2] : undefined; + var passive = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : true; + var capture = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false; + toggleListener.call(this, element, events, callback, false, passive, capture); + } // Bind once-only event handler + + function once(element) { + var _this2 = this; + + var events = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : ''; + var callback = arguments.length > 2 ? arguments[2] : undefined; + var passive = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : true; + var capture = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false; + + var onceCallback = function onceCallback() { + off(element, events, onceCallback, passive, capture); + + for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { + args[_key] = arguments[_key]; + } + + callback.apply(_this2, args); + }; + + toggleListener.call(this, element, events, onceCallback, true, passive, capture); + } // Trigger event + + function triggerEvent(element) { + var type = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : ''; + var bubbles = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; + var detail = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : {}; + + // Bail if no element + if (!is$1.element(element) || is$1.empty(type)) { + return; + } // Create and dispatch the event + + + var event = new CustomEvent(type, { + bubbles: bubbles, + detail: Object.assign({}, detail, { + plyr: this + }) + }); // Dispatch the event + + element.dispatchEvent(event); + } // Unbind all cached event listeners + + function unbindListeners() { + if (this && this.eventListeners) { + this.eventListeners.forEach(function (item) { + var element = item.element, + type = item.type, + callback = item.callback, + options = item.options; + element.removeEventListener(type, callback, options); + }); + this.eventListeners = []; + } + } // Run method when / if player is ready + + function ready() { + var _this3 = this; + + return new Promise(function (resolve) { + return _this3.ready ? setTimeout(resolve, 0) : on.call(_this3, _this3.elements.container, 'ready', resolve); + }).then(function () {}); + } + + function wrap(elements, wrapper) { + // Convert `elements` to an array, if necessary. + var targets = elements.length ? elements : [elements]; // Loops backwards to prevent having to clone the wrapper on the + // first element (see `child` below). + + Array.from(targets).reverse().forEach(function (element, index) { + var child = index > 0 ? wrapper.cloneNode(true) : wrapper; // Cache the current parent and sibling. + + var parent = element.parentNode; + var sibling = element.nextSibling; // Wrap the element (is automatically removed from its current + // parent). + + child.appendChild(element); // If the element had a sibling, insert the wrapper before + // the sibling to maintain the HTML structure; otherwise, just + // append it to the parent. + + if (sibling) { + parent.insertBefore(child, sibling); + } else { + parent.appendChild(child); + } + }); + } // Set attributes + + function setAttributes(element, attributes) { + if (!is$1.element(element) || is$1.empty(attributes)) { + return; + } // Assume null and undefined attributes should be left out, + // Setting them would otherwise convert them to "null" and "undefined" + + + Object.entries(attributes).filter(function (_ref) { + var _ref2 = _slicedToArray(_ref, 2), + value = _ref2[1]; + + return !is$1.nullOrUndefined(value); + }).forEach(function (_ref3) { + var _ref4 = _slicedToArray(_ref3, 2), + key = _ref4[0], + value = _ref4[1]; + + return element.setAttribute(key, value); + }); + } // Create a DocumentFragment + + function createElement(type, attributes, text) { + // Create a new <element> + var element = document.createElement(type); // Set all passed attributes + + if (is$1.object(attributes)) { + setAttributes(element, attributes); + } // Add text node + + + if (is$1.string(text)) { + element.innerText = text; + } // Return built element + + + return element; + } // Inaert an element after another + + function insertAfter(element, target) { + if (!is$1.element(element) || !is$1.element(target)) { + return; + } + + target.parentNode.insertBefore(element, target.nextSibling); + } // Insert a DocumentFragment + + function insertElement(type, parent, attributes, text) { + if (!is$1.element(parent)) { + return; + } + + parent.appendChild(createElement(type, attributes, text)); + } // Remove element(s) + + function removeElement(element) { + if (is$1.nodeList(element) || is$1.array(element)) { + Array.from(element).forEach(removeElement); + return; + } + + if (!is$1.element(element) || !is$1.element(element.parentNode)) { + return; + } + + element.parentNode.removeChild(element); + } // Remove all child elements + + function emptyElement(element) { + if (!is$1.element(element)) { + return; + } + + var length = element.childNodes.length; + + while (length > 0) { + element.removeChild(element.lastChild); + length -= 1; + } + } // Replace element + + function replaceElement(newChild, oldChild) { + if (!is$1.element(oldChild) || !is$1.element(oldChild.parentNode) || !is$1.element(newChild)) { + return null; + } + + oldChild.parentNode.replaceChild(newChild, oldChild); + return newChild; + } // Get an attribute object from a string selector + + function getAttributesFromSelector(sel, existingAttributes) { + // For example: + // '.test' to { class: 'test' } + // '#test' to { id: 'test' } + // '[data-test="test"]' to { 'data-test': 'test' } + if (!is$1.string(sel) || is$1.empty(sel)) { + return {}; + } + + var attributes = {}; + var existing = existingAttributes; + sel.split(',').forEach(function (s) { + // Remove whitespace + var selector = s.trim(); + var className = selector.replace('.', ''); + var stripped = selector.replace(/[[\]]/g, ''); // Get the parts and value + + var parts = stripped.split('='); + var key = parts[0]; + var value = parts.length > 1 ? parts[1].replace(/["']/g, '') : ''; // Get the first character + + var start = selector.charAt(0); + + switch (start) { + case '.': + // Add to existing classname + if (is$1.object(existing) && is$1.string(existing.class)) { + existing.class += " ".concat(className); + } + + attributes.class = className; + break; + + case '#': + // ID selector + attributes.id = selector.replace('#', ''); + break; + + case '[': + // Attribute selector + attributes[key] = value; + break; + + default: + break; + } + }); + return attributes; + } // Toggle hidden + + function toggleHidden(element, hidden) { + if (!is$1.element(element)) { + return; + } + + var hide = hidden; + + if (!is$1.boolean(hide)) { + hide = !element.hidden; + } + + if (hide) { + element.setAttribute('hidden', ''); + } else { + element.removeAttribute('hidden'); + } + } // Mirror Element.classList.toggle, with IE compatibility for "force" argument + + function toggleClass(element, className, force) { + if (is$1.nodeList(element)) { + return Array.from(element).map(function (e) { + return toggleClass(e, className, force); + }); + } + + if (is$1.element(element)) { + var method = 'toggle'; + + if (typeof force !== 'undefined') { + method = force ? 'add' : 'remove'; + } + + element.classList[method](className); + return element.classList.contains(className); + } + + return false; + } // Has class name + + function hasClass(element, className) { + return is$1.element(element) && element.classList.contains(className); + } // Element matches selector + + function matches$1(element, selector) { + + function match() { + return Array.from(document.querySelectorAll(selector)).includes(this); + } + + var matches = match; + return matches.call(element, selector); + } // Find all elements + + function getElements(selector) { + return this.elements.container.querySelectorAll(selector); + } // Find a single element + + function getElement(selector) { + return this.elements.container.querySelector(selector); + } // Trap focus inside container + + function trapFocus() { + var element = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null; + var toggle = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + if (!is$1.element(element)) { + return; + } + + var focusable = getElements.call(this, 'button:not(:disabled), input:not(:disabled), [tabindex]'); + var first = focusable[0]; + var last = focusable[focusable.length - 1]; + + var trap = function trap(event) { + // Bail if not tab key or not fullscreen + if (event.key !== 'Tab' || event.keyCode !== 9) { + return; + } // Get the current focused element + + + var focused = document.activeElement; + + if (focused === last && !event.shiftKey) { + // Move focus to first element that can be tabbed if Shift isn't used + first.focus(); + event.preventDefault(); + } else if (focused === first && event.shiftKey) { + // Move focus to last element that can be tabbed if Shift is used + last.focus(); + event.preventDefault(); + } + }; + + toggleListener.call(this, this.elements.container, 'keydown', trap, toggle, false); + } // Set focus and tab focus class + + function setFocus() { + var element = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null; + var tabFocus = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + if (!is$1.element(element)) { + return; + } // Set regular focus + + + element.focus({ + preventScroll: true + }); // If we want to mimic keyboard focus via tab + + if (tabFocus) { + toggleClass(element, this.config.classNames.tabFocus); + } + } + + // ========================================================================== + var transitionEndEvent = function () { + var element = document.createElement('span'); + var events = { + WebkitTransition: 'webkitTransitionEnd', + MozTransition: 'transitionend', + OTransition: 'oTransitionEnd otransitionend', + transition: 'transitionend' + }; + var type = Object.keys(events).find(function (event) { + return element.style[event] !== undefined; + }); + return is$1.string(type) ? events[type] : false; + }(); // Force repaint of element + + function repaint(element) { + setTimeout(function () { + try { + toggleHidden(element, true); + element.offsetHeight; // eslint-disable-line + + toggleHidden(element, false); + } catch (e) {// Do nothing + } + }, 0); + } + + // ========================================================================== + // Browser sniffing + // Unfortunately, due to mixed support, UA sniffing is required + // ========================================================================== + var browser = { + isIE: + /* @cc_on!@ */ + !!document.documentMode, + isEdge: window.navigator.userAgent.includes('Edge'), + isWebkit: 'WebkitAppearance' in document.documentElement.style && !/Edge/.test(navigator.userAgent), + isIPhone: /(iPhone|iPod)/gi.test(navigator.platform), + isIos: /(iPad|iPhone|iPod)/gi.test(navigator.platform) + }; + + var defaultCodecs = { + 'audio/ogg': 'vorbis', + 'audio/wav': '1', + 'video/webm': 'vp8, vorbis', + 'video/mp4': 'avc1.42E01E, mp4a.40.2', + 'video/ogg': 'theora' + }; // Check for feature support + + var support = { + // Basic support + audio: 'canPlayType' in document.createElement('audio'), + video: 'canPlayType' in document.createElement('video'), + // Check for support + // Basic functionality vs full UI + check: function check(type, provider, playsinline) { + var canPlayInline = browser.isIPhone && playsinline && support.playsinline; + var api = support[type] || provider !== 'html5'; + var ui = api && support.rangeInput && (type !== 'video' || !browser.isIPhone || canPlayInline); + return { + api: api, + ui: ui + }; + }, + // Picture-in-picture support + // Safari & Chrome only currently + pip: function () { + if (browser.isIPhone) { + return false; + } // Safari + // https://developer.apple.com/documentation/webkitjs/adding_picture_in_picture_to_your_safari_media_controls + + + if (is$1.function(createElement('video').webkitSetPresentationMode)) { + return true; + } // Chrome + // https://developers.google.com/web/updates/2018/10/watch-video-using-picture-in-picture + + + if (document.pictureInPictureEnabled && !createElement('video').disablePictureInPicture) { + return true; + } + + return false; + }(), + // Airplay support + // Safari only currently + airplay: is$1.function(window.WebKitPlaybackTargetAvailabilityEvent), + // Inline playback support + // https://webkit.org/blog/6784/new-video-policies-for-ios/ + playsinline: 'playsInline' in document.createElement('video'), + // Check for mime type support against a player instance + // Credits: http://diveintohtml5.info/everything.html + // Related: http://www.leanbackplayer.com/test/h5mt.html + mime: function mime(input) { + if (is$1.empty(input)) { + return false; + } + + var _input$split = input.split('/'), + _input$split2 = _slicedToArray(_input$split, 1), + mediaType = _input$split2[0]; + + var type = input; // Verify we're using HTML5 and there's no media type mismatch + + if (!this.isHTML5 || mediaType !== this.type) { + return false; + } // Add codec if required + + + if (Object.keys(defaultCodecs).includes(type)) { + type += "; codecs=\"".concat(defaultCodecs[input], "\""); + } + + try { + return Boolean(type && this.media.canPlayType(type).replace(/no/, '')); + } catch (e) { + return false; + } + }, + // Check for textTracks support + textTracks: 'textTracks' in document.createElement('video'), + // <input type="range"> Sliders + rangeInput: function () { + var range = document.createElement('input'); + range.type = 'range'; + return range.type === 'range'; + }(), + // Touch + // NOTE: Remember a device can be mouse + touch enabled so we check on first touch event + touch: 'ontouchstart' in document.documentElement, + // Detect transitions support + transitions: transitionEndEvent !== false, + // Reduced motion iOS & MacOS setting + // https://webkit.org/blog/7551/responsive-design-for-motion/ + reducedMotion: 'matchMedia' in window && window.matchMedia('(prefers-reduced-motion)').matches + }; + + // ========================================================================== + var html5 = { + getSources: function getSources() { + var _this = this; + + if (!this.isHTML5) { + return []; + } + + var sources = Array.from(this.media.querySelectorAll('source')); // Filter out unsupported sources (if type is specified) + + return sources.filter(function (source) { + var type = source.getAttribute('type'); + + if (is$1.empty(type)) { + return true; + } + + return support.mime.call(_this, type); + }); + }, + // Get quality levels + getQualityOptions: function getQualityOptions() { + // Get sizes from <source> elements + return html5.getSources.call(this).map(function (source) { + return Number(source.getAttribute('size')); + }).filter(Boolean); + }, + extend: function extend() { + if (!this.isHTML5) { + return; + } + + var player = this; // Quality + + Object.defineProperty(player.media, 'quality', { + get: function get() { + // Get sources + var sources = html5.getSources.call(player); + var source = sources.find(function (source) { + return source.getAttribute('src') === player.source; + }); // Return size, if match is found + + return source && Number(source.getAttribute('size')); + }, + set: function set(input) { + // Get sources + var sources = html5.getSources.call(player); // Get first match for requested size + + var source = sources.find(function (source) { + return Number(source.getAttribute('size')) === input; + }); // No matching source found + + if (!source) { + return; + } // Get current state + + + var _player$media = player.media, + currentTime = _player$media.currentTime, + paused = _player$media.paused, + preload = _player$media.preload, + readyState = _player$media.readyState; // Set new source + + player.media.src = source.getAttribute('src'); // Prevent loading if preload="none" and the current source isn't loaded (#1044) + + if (preload !== 'none' || readyState) { + // Restore time + player.once('loadedmetadata', function () { + player.currentTime = currentTime; // Resume playing + + if (!paused) { + player.play(); + } + }); // Load new source + + player.media.load(); + } // Trigger change event + + + triggerEvent.call(player, player.media, 'qualitychange', false, { + quality: input + }); + } + }); + }, + // Cancel current network requests + // See https://github.com/sampotts/plyr/issues/174 + cancelRequests: function cancelRequests() { + if (!this.isHTML5) { + return; + } // Remove child sources + + + removeElement(html5.getSources.call(this)); // Set blank video src attribute + // This is to prevent a MEDIA_ERR_SRC_NOT_SUPPORTED error + // Info: http://stackoverflow.com/questions/32231579/how-to-properly-dispose-of-an-html5-video-and-close-socket-or-connection + + this.media.setAttribute('src', this.config.blankVideo); // Load the new empty source + // This will cancel existing requests + // See https://github.com/sampotts/plyr/issues/174 + + this.media.load(); // Debugging + + this.debug.log('Cancelled network requests'); + } + }; + + // ========================================================================== + + function dedupe(array) { + if (!is$1.array(array)) { + return array; + } + + return array.filter(function (item, index) { + return array.indexOf(item) === index; + }); + } // Get the closest value in an array + + function closest(array, value) { + if (!is$1.array(array) || !array.length) { + return null; + } + + return array.reduce(function (prev, curr) { + return Math.abs(curr - value) < Math.abs(prev - value) ? curr : prev; + }); + } + + function cloneDeep(object) { + return JSON.parse(JSON.stringify(object)); + } // Get a nested value in an object + + function getDeep(object, path) { + return path.split('.').reduce(function (obj, key) { + return obj && obj[key]; + }, object); + } // Deep extend destination object with N more objects + + function extend() { + var target = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}; + + for (var _len = arguments.length, sources = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) { + sources[_key - 1] = arguments[_key]; + } + + if (!sources.length) { + return target; + } + + var source = sources.shift(); + + if (!is$1.object(source)) { + return target; + } + + Object.keys(source).forEach(function (key) { + if (is$1.object(source[key])) { + if (!Object.keys(target).includes(key)) { + Object.assign(target, _defineProperty({}, key, {})); + } + + extend(target[key], source[key]); + } else { + Object.assign(target, _defineProperty({}, key, source[key])); + } + }); + return extend.apply(void 0, [target].concat(sources)); + } + + // ========================================================================== + + function generateId(prefix) { + return "".concat(prefix, "-").concat(Math.floor(Math.random() * 10000)); + } // Format string + + function format(input) { + for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) { + args[_key - 1] = arguments[_key]; + } + + if (is$1.empty(input)) { + return input; + } + + return input.toString().replace(/{(\d+)}/g, function (match, i) { + return args[i].toString(); + }); + } // Get percentage + + function getPercentage(current, max) { + if (current === 0 || max === 0 || Number.isNaN(current) || Number.isNaN(max)) { + return 0; + } + + return (current / max * 100).toFixed(2); + } // Replace all occurances of a string in a string + + function replaceAll() { + var input = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : ''; + var find = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : ''; + var replace = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : ''; + return input.replace(new RegExp(find.toString().replace(/([.*+?^=!:${}()|[\]/\\])/g, '\\$1'), 'g'), replace.toString()); + } // Convert to title case + + function toTitleCase() { + var input = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : ''; + return input.toString().replace(/\w\S*/g, function (text) { + return text.charAt(0).toUpperCase() + text.substr(1).toLowerCase(); + }); + } // Convert string to pascalCase + + function toPascalCase() { + var input = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : ''; + var string = input.toString(); // Convert kebab case + + string = replaceAll(string, '-', ' '); // Convert snake case + + string = replaceAll(string, '_', ' '); // Convert to title case + + string = toTitleCase(string); // Convert to pascal case + + return replaceAll(string, ' ', ''); + } // Convert string to pascalCase + + function toCamelCase() { + var input = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : ''; + var string = input.toString(); // Convert to pascal case + + string = toPascalCase(string); // Convert first character to lowercase + + return string.charAt(0).toLowerCase() + string.slice(1); + } // Remove HTML from a string + + function stripHTML(source) { + var fragment = document.createDocumentFragment(); + var element = document.createElement('div'); + fragment.appendChild(element); + element.innerHTML = source; + return fragment.firstChild.innerText; + } // Like outerHTML, but also works for DocumentFragment + + function getHTML(element) { + var wrapper = document.createElement('div'); + wrapper.appendChild(element); + return wrapper.innerHTML; + } + + var resources = { + pip: 'PIP', + airplay: 'AirPlay', + html5: 'HTML5', + vimeo: 'Vimeo', + youtube: 'YouTube' + }; + var i18n = { + get: function get() { + var key = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : ''; + var config = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + + if (is$1.empty(key) || is$1.empty(config)) { + return ''; + } + + var string = getDeep(config.i18n, key); + + if (is$1.empty(string)) { + if (Object.keys(resources).includes(key)) { + return resources[key]; + } + + return ''; + } + + var replace = { + '{seektime}': config.seekTime, + '{title}': config.title + }; + Object.entries(replace).forEach(function (_ref) { + var _ref2 = _slicedToArray(_ref, 2), + key = _ref2[0], + value = _ref2[1]; + + string = replaceAll(string, key, value); + }); + return string; + } + }; + + var Storage = + /*#__PURE__*/ + function () { + function Storage(player) { + _classCallCheck(this, Storage); + + this.enabled = player.config.storage.enabled; + this.key = player.config.storage.key; + } // Check for actual support (see if we can use it) + + + _createClass(Storage, [{ + key: "get", + value: function get(key) { + if (!Storage.supported || !this.enabled) { + return null; + } + + var store = window.localStorage.getItem(this.key); + + if (is$1.empty(store)) { + return null; + } + + var json = JSON.parse(store); + return is$1.string(key) && key.length ? json[key] : json; + } + }, { + key: "set", + value: function set(object) { + // Bail if we don't have localStorage support or it's disabled + if (!Storage.supported || !this.enabled) { + return; + } // Can only store objectst + + + if (!is$1.object(object)) { + return; + } // Get current storage + + + var storage = this.get(); // Default to empty object + + if (is$1.empty(storage)) { + storage = {}; + } // Update the working copy of the values + + + extend(storage, object); // Update storage + + window.localStorage.setItem(this.key, JSON.stringify(storage)); + } + }], [{ + key: "supported", + get: function get() { + try { + if (!('localStorage' in window)) { + return false; + } + + var test = '___test'; // Try to use it (it might be disabled, e.g. user is in private mode) + // see: https://github.com/sampotts/plyr/issues/131 + + window.localStorage.setItem(test, test); + window.localStorage.removeItem(test); + return true; + } catch (e) { + return false; + } + } + }]); + + return Storage; + }(); + + // ========================================================================== + // Fetch wrapper + // Using XHR to avoid issues with older browsers + // ========================================================================== + function fetch(url) { + var responseType = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'text'; + return new Promise(function (resolve, reject) { + try { + var request = new XMLHttpRequest(); // Check for CORS support + + if (!('withCredentials' in request)) { + return; + } + + request.addEventListener('load', function () { + if (responseType === 'text') { + try { + resolve(JSON.parse(request.responseText)); + } catch (e) { + resolve(request.responseText); + } + } else { + resolve(request.response); + } + }); + request.addEventListener('error', function () { + throw new Error(request.status); + }); + request.open('GET', url, true); // Set the required response type + + request.responseType = responseType; + request.send(); + } catch (e) { + reject(e); + } + }); + } + + // ========================================================================== + + function loadSprite(url, id) { + if (!is$1.string(url)) { + return; + } + + var prefix = 'cache'; + var hasId = is$1.string(id); + var isCached = false; + + var exists = function exists() { + return document.getElementById(id) !== null; + }; + + var update = function update(container, data) { + container.innerHTML = data; // Check again incase of race condition + + if (hasId && exists()) { + return; + } // Inject the SVG to the body + + + document.body.insertAdjacentElement('afterbegin', container); + }; // Only load once if ID set + + + if (!hasId || !exists()) { + var useStorage = Storage.supported; // Create container + + var container = document.createElement('div'); + container.setAttribute('hidden', ''); + + if (hasId) { + container.setAttribute('id', id); + } // Check in cache + + + if (useStorage) { + var cached = window.localStorage.getItem("".concat(prefix, "-").concat(id)); + isCached = cached !== null; + + if (isCached) { + var data = JSON.parse(cached); + update(container, data.content); + } + } // Get the sprite + + + fetch(url).then(function (result) { + if (is$1.empty(result)) { + return; + } + + if (useStorage) { + window.localStorage.setItem("".concat(prefix, "-").concat(id), JSON.stringify({ + content: result + })); + } + + update(container, result); + }).catch(function () {}); + } + } + + // ========================================================================== + + var getHours = function getHours(value) { + return Math.trunc(value / 60 / 60 % 60, 10); + }; + var getMinutes = function getMinutes(value) { + return Math.trunc(value / 60 % 60, 10); + }; + var getSeconds = function getSeconds(value) { + return Math.trunc(value % 60, 10); + }; // Format time to UI friendly string + + function formatTime() { + var time = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0; + var displayHours = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + var inverted = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; + + // Bail if the value isn't a number + if (!is$1.number(time)) { + return formatTime(null, displayHours, inverted); + } // Format time component to add leading zero + + + var format = function format(value) { + return "0".concat(value).slice(-2); + }; // Breakdown to hours, mins, secs + + + var hours = getHours(time); + var mins = getMinutes(time); + var secs = getSeconds(time); // Do we need to display hours? + + if (displayHours || hours > 0) { + hours = "".concat(hours, ":"); + } else { + hours = ''; + } // Render + + + return "".concat(inverted && time > 0 ? '-' : '').concat(hours).concat(format(mins), ":").concat(format(secs)); + } + + var controls = { + // Get icon URL + getIconUrl: function getIconUrl() { + var url = new URL(this.config.iconUrl, window.location); + var cors = url.host !== window.location.host || browser.isIE && !window.svg4everybody; + return { + url: this.config.iconUrl, + cors: cors + }; + }, + // Find the UI controls + findElements: function findElements() { + try { + this.elements.controls = getElement.call(this, this.config.selectors.controls.wrapper); // Buttons + + this.elements.buttons = { + play: getElements.call(this, this.config.selectors.buttons.play), + pause: getElement.call(this, this.config.selectors.buttons.pause), + restart: getElement.call(this, this.config.selectors.buttons.restart), + rewind: getElement.call(this, this.config.selectors.buttons.rewind), + fastForward: getElement.call(this, this.config.selectors.buttons.fastForward), + mute: getElement.call(this, this.config.selectors.buttons.mute), + pip: getElement.call(this, this.config.selectors.buttons.pip), + airplay: getElement.call(this, this.config.selectors.buttons.airplay), + settings: getElement.call(this, this.config.selectors.buttons.settings), + captions: getElement.call(this, this.config.selectors.buttons.captions), + fullscreen: getElement.call(this, this.config.selectors.buttons.fullscreen) + }; // Progress + + this.elements.progress = getElement.call(this, this.config.selectors.progress); // Inputs + + this.elements.inputs = { + seek: getElement.call(this, this.config.selectors.inputs.seek), + volume: getElement.call(this, this.config.selectors.inputs.volume) + }; // Display + + this.elements.display = { + buffer: getElement.call(this, this.config.selectors.display.buffer), + currentTime: getElement.call(this, this.config.selectors.display.currentTime), + duration: getElement.call(this, this.config.selectors.display.duration) + }; // Seek tooltip + + if (is$1.element(this.elements.progress)) { + this.elements.display.seekTooltip = this.elements.progress.querySelector(".".concat(this.config.classNames.tooltip)); + } + + return true; + } catch (error) { + // Log it + this.debug.warn('It looks like there is a problem with your custom controls HTML', error); // Restore native video controls + + this.toggleNativeControls(true); + return false; + } + }, + // Create <svg> icon + createIcon: function createIcon(type, attributes) { + var namespace = 'http://www.w3.org/2000/svg'; + var iconUrl = controls.getIconUrl.call(this); + var iconPath = "".concat(!iconUrl.cors ? iconUrl.url : '', "#").concat(this.config.iconPrefix); // Create <svg> + + var icon = document.createElementNS(namespace, 'svg'); + setAttributes(icon, extend(attributes, { + role: 'presentation', + focusable: 'false' + })); // Create the <use> to reference sprite + + var use = document.createElementNS(namespace, 'use'); + var path = "".concat(iconPath, "-").concat(type); // Set `href` attributes + // https://github.com/sampotts/plyr/issues/460 + // https://developer.mozilla.org/en-US/docs/Web/SVG/Attribute/xlink:href + + if ('href' in use) { + use.setAttributeNS('http://www.w3.org/1999/xlink', 'href', path); + } // Always set the older attribute even though it's "deprecated" (it'll be around for ages) + + + use.setAttributeNS('http://www.w3.org/1999/xlink', 'xlink:href', path); // Add <use> to <svg> + + icon.appendChild(use); + return icon; + }, + // Create hidden text label + createLabel: function createLabel(key) { + var attr = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var text = i18n.get(key, this.config); + var attributes = Object.assign({}, attr, { + class: [attr.class, this.config.classNames.hidden].filter(Boolean).join(' ') + }); + return createElement('span', attributes, text); + }, + // Create a badge + createBadge: function createBadge(text) { + if (is$1.empty(text)) { + return null; + } + + var badge = createElement('span', { + class: this.config.classNames.menu.value + }); + badge.appendChild(createElement('span', { + class: this.config.classNames.menu.badge + }, text)); + return badge; + }, + // Create a <button> + createButton: function createButton(buttonType, attr) { + var attributes = Object.assign({}, attr); + var type = toCamelCase(buttonType); + var props = { + element: 'button', + toggle: false, + label: null, + icon: null, + labelPressed: null, + iconPressed: null + }; + ['element', 'icon', 'label'].forEach(function (key) { + if (Object.keys(attributes).includes(key)) { + props[key] = attributes[key]; + delete attributes[key]; + } + }); // Default to 'button' type to prevent form submission + + if (props.element === 'button' && !Object.keys(attributes).includes('type')) { + attributes.type = 'button'; + } // Set class name + + + if (Object.keys(attributes).includes('class')) { + if (!attributes.class.includes(this.config.classNames.control)) { + attributes.class += " ".concat(this.config.classNames.control); + } + } else { + attributes.class = this.config.classNames.control; + } // Large play button + + + switch (buttonType) { + case 'play': + props.toggle = true; + props.label = 'play'; + props.labelPressed = 'pause'; + props.icon = 'play'; + props.iconPressed = 'pause'; + break; + + case 'mute': + props.toggle = true; + props.label = 'mute'; + props.labelPressed = 'unmute'; + props.icon = 'volume'; + props.iconPressed = 'muted'; + break; + + case 'captions': + props.toggle = true; + props.label = 'enableCaptions'; + props.labelPressed = 'disableCaptions'; + props.icon = 'captions-off'; + props.iconPressed = 'captions-on'; + break; + + case 'fullscreen': + props.toggle = true; + props.label = 'enterFullscreen'; + props.labelPressed = 'exitFullscreen'; + props.icon = 'enter-fullscreen'; + props.iconPressed = 'exit-fullscreen'; + break; + + case 'play-large': + attributes.class += " ".concat(this.config.classNames.control, "--overlaid"); + type = 'play'; + props.label = 'play'; + props.icon = 'play'; + break; + + default: + if (is$1.empty(props.label)) { + props.label = type; + } + + if (is$1.empty(props.icon)) { + props.icon = buttonType; + } + + } + + var button = createElement(props.element); // Setup toggle icon and labels + + if (props.toggle) { + // Icon + button.appendChild(controls.createIcon.call(this, props.iconPressed, { + class: 'icon--pressed' + })); + button.appendChild(controls.createIcon.call(this, props.icon, { + class: 'icon--not-pressed' + })); // Label/Tooltip + + button.appendChild(controls.createLabel.call(this, props.labelPressed, { + class: 'label--pressed' + })); + button.appendChild(controls.createLabel.call(this, props.label, { + class: 'label--not-pressed' + })); + } else { + button.appendChild(controls.createIcon.call(this, props.icon)); + button.appendChild(controls.createLabel.call(this, props.label)); + } // Merge and set attributes + + + extend(attributes, getAttributesFromSelector(this.config.selectors.buttons[type], attributes)); + setAttributes(button, attributes); // We have multiple play buttons + + if (type === 'play') { + if (!is$1.array(this.elements.buttons[type])) { + this.elements.buttons[type] = []; + } + + this.elements.buttons[type].push(button); + } else { + this.elements.buttons[type] = button; + } + + return button; + }, + // Create an <input type='range'> + createRange: function createRange(type, attributes) { + // Seek input + var input = createElement('input', extend(getAttributesFromSelector(this.config.selectors.inputs[type]), { + type: 'range', + min: 0, + max: 100, + step: 0.01, + value: 0, + autocomplete: 'off', + // A11y fixes for https://github.com/sampotts/plyr/issues/905 + role: 'slider', + 'aria-label': i18n.get(type, this.config), + 'aria-valuemin': 0, + 'aria-valuemax': 100, + 'aria-valuenow': 0 + }, attributes)); + this.elements.inputs[type] = input; // Set the fill for webkit now + + controls.updateRangeFill.call(this, input); // Improve support on touch devices + + RangeTouch.setup(input); + return input; + }, + // Create a <progress> + createProgress: function createProgress(type, attributes) { + var progress = createElement('progress', extend(getAttributesFromSelector(this.config.selectors.display[type]), { + min: 0, + max: 100, + value: 0, + role: 'progressbar', + 'aria-hidden': true + }, attributes)); // Create the label inside + + if (type !== 'volume') { + progress.appendChild(createElement('span', null, '0')); + var suffixKey = { + played: 'played', + buffer: 'buffered' + }[type]; + var suffix = suffixKey ? i18n.get(suffixKey, this.config) : ''; + progress.innerText = "% ".concat(suffix.toLowerCase()); + } + + this.elements.display[type] = progress; + return progress; + }, + // Create time display + createTime: function createTime(type) { + var attributes = getAttributesFromSelector(this.config.selectors.display[type]); + var container = createElement('div', extend(attributes, { + class: "".concat(this.config.classNames.display.time, " ").concat(attributes.class ? attributes.class : '').trim(), + 'aria-label': i18n.get(type, this.config) + }), '00:00'); // Reference for updates + + this.elements.display[type] = container; + return container; + }, + // Bind keyboard shortcuts for a menu item + // We have to bind to keyup otherwise Firefox triggers a click when a keydown event handler shifts focus + // https://bugzilla.mozilla.org/show_bug.cgi?id=1220143 + bindMenuItemShortcuts: function bindMenuItemShortcuts(menuItem, type) { + var _this = this; + + // Navigate through menus via arrow keys and space + on(menuItem, 'keydown keyup', function (event) { + // We only care about space and ⬆️ ⬇️️ ➡️ + if (![32, 38, 39, 40].includes(event.which)) { + return; + } // Prevent play / seek + + + event.preventDefault(); + event.stopPropagation(); // We're just here to prevent the keydown bubbling + + if (event.type === 'keydown') { + return; + } + + var isRadioButton = matches$1(menuItem, '[role="menuitemradio"]'); // Show the respective menu + + if (!isRadioButton && [32, 39].includes(event.which)) { + controls.showMenuPanel.call(_this, type, true); + } else { + var target; + + if (event.which !== 32) { + if (event.which === 40 || isRadioButton && event.which === 39) { + target = menuItem.nextElementSibling; + + if (!is$1.element(target)) { + target = menuItem.parentNode.firstElementChild; + } + } else { + target = menuItem.previousElementSibling; + + if (!is$1.element(target)) { + target = menuItem.parentNode.lastElementChild; + } + } + + setFocus.call(_this, target, true); + } + } + }, false); // Enter will fire a `click` event but we still need to manage focus + // So we bind to keyup which fires after and set focus here + + on(menuItem, 'keyup', function (event) { + if (event.which !== 13) { + return; + } + + controls.focusFirstMenuItem.call(_this, null, true); + }); + }, + // Create a settings menu item + createMenuItem: function createMenuItem(_ref) { + var _this2 = this; + + var value = _ref.value, + list = _ref.list, + type = _ref.type, + title = _ref.title, + _ref$badge = _ref.badge, + badge = _ref$badge === void 0 ? null : _ref$badge, + _ref$checked = _ref.checked, + checked = _ref$checked === void 0 ? false : _ref$checked; + var attributes = getAttributesFromSelector(this.config.selectors.inputs[type]); + var menuItem = createElement('button', extend(attributes, { + type: 'button', + role: 'menuitemradio', + class: "".concat(this.config.classNames.control, " ").concat(attributes.class ? attributes.class : '').trim(), + 'aria-checked': checked, + value: value + })); + var flex = createElement('span'); // We have to set as HTML incase of special characters + + flex.innerHTML = title; + + if (is$1.element(badge)) { + flex.appendChild(badge); + } + + menuItem.appendChild(flex); // Replicate radio button behaviour + + Object.defineProperty(menuItem, 'checked', { + enumerable: true, + get: function get() { + return menuItem.getAttribute('aria-checked') === 'true'; + }, + set: function set(checked) { + // Ensure exclusivity + if (checked) { + Array.from(menuItem.parentNode.children).filter(function (node) { + return matches$1(node, '[role="menuitemradio"]'); + }).forEach(function (node) { + return node.setAttribute('aria-checked', 'false'); + }); + } + + menuItem.setAttribute('aria-checked', checked ? 'true' : 'false'); + } + }); + this.listeners.bind(menuItem, 'click keyup', function (event) { + if (is$1.keyboardEvent(event) && event.which !== 32) { + return; + } + + event.preventDefault(); + event.stopPropagation(); + menuItem.checked = true; + + switch (type) { + case 'language': + _this2.currentTrack = Number(value); + break; + + case 'quality': + _this2.quality = value; + break; + + case 'speed': + _this2.speed = parseFloat(value); + break; + + default: + break; + } + + controls.showMenuPanel.call(_this2, 'home', is$1.keyboardEvent(event)); + }, type, false); + controls.bindMenuItemShortcuts.call(this, menuItem, type); + list.appendChild(menuItem); + }, + // Format a time for display + formatTime: function formatTime$1() { + var time = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0; + var inverted = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + // Bail if the value isn't a number + if (!is$1.number(time)) { + return time; + } // Always display hours if duration is over an hour + + + var forceHours = getHours(this.duration) > 0; + return formatTime(time, forceHours, inverted); + }, + // Update the displayed time + updateTimeDisplay: function updateTimeDisplay() { + var target = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null; + var time = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0; + var inverted = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; + + // Bail if there's no element to display or the value isn't a number + if (!is$1.element(target) || !is$1.number(time)) { + return; + } // eslint-disable-next-line no-param-reassign + + + target.innerText = controls.formatTime(time, inverted); + }, + // Update volume UI and storage + updateVolume: function updateVolume() { + if (!this.supported.ui) { + return; + } // Update range + + + if (is$1.element(this.elements.inputs.volume)) { + controls.setRange.call(this, this.elements.inputs.volume, this.muted ? 0 : this.volume); + } // Update mute state + + + if (is$1.element(this.elements.buttons.mute)) { + this.elements.buttons.mute.pressed = this.muted || this.volume === 0; + } + }, + // Update seek value and lower fill + setRange: function setRange(target) { + var value = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0; + + if (!is$1.element(target)) { + return; + } // eslint-disable-next-line + + + target.value = value; // Webkit range fill + + controls.updateRangeFill.call(this, target); + }, + // Update <progress> elements + updateProgress: function updateProgress(event) { + var _this3 = this; + + if (!this.supported.ui || !is$1.event(event)) { + return; + } + + var value = 0; + + var setProgress = function setProgress(target, input) { + var value = is$1.number(input) ? input : 0; + var progress = is$1.element(target) ? target : _this3.elements.display.buffer; // Update value and label + + if (is$1.element(progress)) { + progress.value = value; // Update text label inside + + var label = progress.getElementsByTagName('span')[0]; + + if (is$1.element(label)) { + label.childNodes[0].nodeValue = value; + } + } + }; + + if (event) { + switch (event.type) { + // Video playing + case 'timeupdate': + case 'seeking': + case 'seeked': + value = getPercentage(this.currentTime, this.duration); // Set seek range value only if it's a 'natural' time event + + if (event.type === 'timeupdate') { + controls.setRange.call(this, this.elements.inputs.seek, value); + } + + break; + // Check buffer status + + case 'playing': + case 'progress': + setProgress(this.elements.display.buffer, this.buffered * 100); + break; + + default: + break; + } + } + }, + // Webkit polyfill for lower fill range + updateRangeFill: function updateRangeFill(target) { + // Get range from event if event passed + var range = is$1.event(target) ? target.target : target; // Needs to be a valid <input type='range'> + + if (!is$1.element(range) || range.getAttribute('type') !== 'range') { + return; + } // Set aria values for https://github.com/sampotts/plyr/issues/905 + + + if (matches$1(range, this.config.selectors.inputs.seek)) { + range.setAttribute('aria-valuenow', this.currentTime); + var currentTime = controls.formatTime(this.currentTime); + var duration = controls.formatTime(this.duration); + var format = i18n.get('seekLabel', this.config); + range.setAttribute('aria-valuetext', format.replace('{currentTime}', currentTime).replace('{duration}', duration)); + } else if (matches$1(range, this.config.selectors.inputs.volume)) { + var percent = range.value * 100; + range.setAttribute('aria-valuenow', percent); + range.setAttribute('aria-valuetext', "".concat(percent.toFixed(1), "%")); + } else { + range.setAttribute('aria-valuenow', range.value); + } // WebKit only + + + if (!browser.isWebkit) { + return; + } // Set CSS custom property + + + range.style.setProperty('--value', "".concat(range.value / range.max * 100, "%")); + }, + // Update hover tooltip for seeking + updateSeekTooltip: function updateSeekTooltip(event) { + var _this4 = this; + + // Bail if setting not true + if (!this.config.tooltips.seek || !is$1.element(this.elements.inputs.seek) || !is$1.element(this.elements.display.seekTooltip) || this.duration === 0) { + return; + } // Calculate percentage + + + var percent = 0; + var clientRect = this.elements.progress.getBoundingClientRect(); + var visible = "".concat(this.config.classNames.tooltip, "--visible"); + + var toggle = function toggle(_toggle) { + toggleClass(_this4.elements.display.seekTooltip, visible, _toggle); + }; // Hide on touch + + + if (this.touch) { + toggle(false); + return; + } // Determine percentage, if already visible + + + if (is$1.event(event)) { + percent = 100 / clientRect.width * (event.pageX - clientRect.left); + } else if (hasClass(this.elements.display.seekTooltip, visible)) { + percent = parseFloat(this.elements.display.seekTooltip.style.left, 10); + } else { + return; + } // Set bounds + + + if (percent < 0) { + percent = 0; + } else if (percent > 100) { + percent = 100; + } // Display the time a click would seek to + + + controls.updateTimeDisplay.call(this, this.elements.display.seekTooltip, this.duration / 100 * percent); // Set position + + this.elements.display.seekTooltip.style.left = "".concat(percent, "%"); // Show/hide the tooltip + // If the event is a moues in/out and percentage is inside bounds + + if (is$1.event(event) && ['mouseenter', 'mouseleave'].includes(event.type)) { + toggle(event.type === 'mouseenter'); + } + }, + // Handle time change event + timeUpdate: function timeUpdate(event) { + // Only invert if only one time element is displayed and used for both duration and currentTime + var invert = !is$1.element(this.elements.display.duration) && this.config.invertTime; // Duration + + controls.updateTimeDisplay.call(this, this.elements.display.currentTime, invert ? this.duration - this.currentTime : this.currentTime, invert); // Ignore updates while seeking + + if (event && event.type === 'timeupdate' && this.media.seeking) { + return; + } // Playing progress + + + controls.updateProgress.call(this, event); + }, + // Show the duration on metadataloaded or durationchange events + durationUpdate: function durationUpdate() { + // Bail if no UI or durationchange event triggered after playing/seek when invertTime is false + if (!this.supported.ui || !this.config.invertTime && this.currentTime) { + return; + } // If duration is the 2**32 (shaka), Infinity (HLS), DASH-IF (Number.MAX_SAFE_INTEGER || Number.MAX_VALUE) indicating live we hide the currentTime and progressbar. + // https://github.com/video-dev/hls.js/blob/5820d29d3c4c8a46e8b75f1e3afa3e68c1a9a2db/src/controller/buffer-controller.js#L415 + // https://github.com/google/shaka-player/blob/4d889054631f4e1cf0fbd80ddd2b71887c02e232/lib/media/streaming_engine.js#L1062 + // https://github.com/Dash-Industry-Forum/dash.js/blob/69859f51b969645b234666800d4cb596d89c602d/src/dash/models/DashManifestModel.js#L338 + + + if (this.duration >= Math.pow(2, 32)) { + toggleHidden(this.elements.display.currentTime, true); + toggleHidden(this.elements.progress, true); + return; + } // Update ARIA values + + + if (is$1.element(this.elements.inputs.seek)) { + this.elements.inputs.seek.setAttribute('aria-valuemax', this.duration); + } // If there's a spot to display duration + + + var hasDuration = is$1.element(this.elements.display.duration); // If there's only one time display, display duration there + + if (!hasDuration && this.config.displayDuration && this.paused) { + controls.updateTimeDisplay.call(this, this.elements.display.currentTime, this.duration); + } // If there's a duration element, update content + + + if (hasDuration) { + controls.updateTimeDisplay.call(this, this.elements.display.duration, this.duration); + } // Update the tooltip (if visible) + + + controls.updateSeekTooltip.call(this); + }, + // Hide/show a tab + toggleMenuButton: function toggleMenuButton(setting, toggle) { + toggleHidden(this.elements.settings.buttons[setting], !toggle); + }, + // Update the selected setting + updateSetting: function updateSetting(setting, container, input) { + var pane = this.elements.settings.panels[setting]; + var value = null; + var list = container; + + if (setting === 'captions') { + value = this.currentTrack; + } else { + value = !is$1.empty(input) ? input : this[setting]; // Get default + + if (is$1.empty(value)) { + value = this.config[setting].default; + } // Unsupported value + + + if (!is$1.empty(this.options[setting]) && !this.options[setting].includes(value)) { + this.debug.warn("Unsupported value of '".concat(value, "' for ").concat(setting)); + return; + } // Disabled value + + + if (!this.config[setting].options.includes(value)) { + this.debug.warn("Disabled value of '".concat(value, "' for ").concat(setting)); + return; + } + } // Get the list if we need to + + + if (!is$1.element(list)) { + list = pane && pane.querySelector('[role="menu"]'); + } // If there's no list it means it's not been rendered... + + + if (!is$1.element(list)) { + return; + } // Update the label + + + var label = this.elements.settings.buttons[setting].querySelector(".".concat(this.config.classNames.menu.value)); + label.innerHTML = controls.getLabel.call(this, setting, value); // Find the radio option and check it + + var target = list && list.querySelector("[value=\"".concat(value, "\"]")); + + if (is$1.element(target)) { + target.checked = true; + } + }, + // Translate a value into a nice label + getLabel: function getLabel(setting, value) { + switch (setting) { + case 'speed': + return value === 1 ? i18n.get('normal', this.config) : "".concat(value, "×"); + + case 'quality': + if (is$1.number(value)) { + var label = i18n.get("qualityLabel.".concat(value), this.config); + + if (!label.length) { + return "".concat(value, "p"); + } + + return label; + } + + return toTitleCase(value); + + case 'captions': + return captions.getLabel.call(this); + + default: + return null; + } + }, + // Set the quality menu + setQualityMenu: function setQualityMenu(options) { + var _this5 = this; + + // Menu required + if (!is$1.element(this.elements.settings.panels.quality)) { + return; + } + + var type = 'quality'; + var list = this.elements.settings.panels.quality.querySelector('[role="menu"]'); // Set options if passed and filter based on uniqueness and config + + if (is$1.array(options)) { + this.options.quality = dedupe(options).filter(function (quality) { + return _this5.config.quality.options.includes(quality); + }); + } // Toggle the pane and tab + + + var toggle = !is$1.empty(this.options.quality) && this.options.quality.length > 1; + controls.toggleMenuButton.call(this, type, toggle); // Empty the menu + + emptyElement(list); // Check if we need to toggle the parent + + controls.checkMenu.call(this); // If we're hiding, nothing more to do + + if (!toggle) { + return; + } // Get the badge HTML for HD, 4K etc + + + var getBadge = function getBadge(quality) { + var label = i18n.get("qualityBadge.".concat(quality), _this5.config); + + if (!label.length) { + return null; + } + + return controls.createBadge.call(_this5, label); + }; // Sort options by the config and then render options + + + this.options.quality.sort(function (a, b) { + var sorting = _this5.config.quality.options; + return sorting.indexOf(a) > sorting.indexOf(b) ? 1 : -1; + }).forEach(function (quality) { + controls.createMenuItem.call(_this5, { + value: quality, + list: list, + type: type, + title: controls.getLabel.call(_this5, 'quality', quality), + badge: getBadge(quality) + }); + }); + controls.updateSetting.call(this, type, list); + }, + // Set the looping options + + /* setLoopMenu() { + // Menu required + if (!is.element(this.elements.settings.panels.loop)) { + return; + } + const options = ['start', 'end', 'all', 'reset']; + const list = this.elements.settings.panels.loop.querySelector('[role="menu"]'); + // Show the pane and tab + toggleHidden(this.elements.settings.buttons.loop, false); + toggleHidden(this.elements.settings.panels.loop, false); + // Toggle the pane and tab + const toggle = !is.empty(this.loop.options); + controls.toggleMenuButton.call(this, 'loop', toggle); + // Empty the menu + emptyElement(list); + options.forEach(option => { + const item = createElement('li'); + const button = createElement( + 'button', + extend(getAttributesFromSelector(this.config.selectors.buttons.loop), { + type: 'button', + class: this.config.classNames.control, + 'data-plyr-loop-action': option, + }), + i18n.get(option, this.config) + ); + if (['start', 'end'].includes(option)) { + const badge = controls.createBadge.call(this, '00:00'); + button.appendChild(badge); + } + item.appendChild(button); + list.appendChild(item); + }); + }, */ + // Get current selected caption language + // TODO: rework this to user the getter in the API? + // Set a list of available captions languages + setCaptionsMenu: function setCaptionsMenu() { + var _this6 = this; + + // Menu required + if (!is$1.element(this.elements.settings.panels.captions)) { + return; + } // TODO: Captions or language? Currently it's mixed + + + var type = 'captions'; + var list = this.elements.settings.panels.captions.querySelector('[role="menu"]'); + var tracks = captions.getTracks.call(this); + var toggle = Boolean(tracks.length); // Toggle the pane and tab + + controls.toggleMenuButton.call(this, type, toggle); // Empty the menu + + emptyElement(list); // Check if we need to toggle the parent + + controls.checkMenu.call(this); // If there's no captions, bail + + if (!toggle) { + return; + } // Generate options data + + + var options = tracks.map(function (track, value) { + return { + value: value, + checked: _this6.captions.toggled && _this6.currentTrack === value, + title: captions.getLabel.call(_this6, track), + badge: track.language && controls.createBadge.call(_this6, track.language.toUpperCase()), + list: list, + type: 'language' + }; + }); // Add the "Disabled" option to turn off captions + + options.unshift({ + value: -1, + checked: !this.captions.toggled, + title: i18n.get('disabled', this.config), + list: list, + type: 'language' + }); // Generate options + + options.forEach(controls.createMenuItem.bind(this)); + controls.updateSetting.call(this, type, list); + }, + // Set a list of available captions languages + setSpeedMenu: function setSpeedMenu(options) { + var _this7 = this; + + // Menu required + if (!is$1.element(this.elements.settings.panels.speed)) { + return; + } + + var type = 'speed'; + var list = this.elements.settings.panels.speed.querySelector('[role="menu"]'); // Set the speed options + + if (is$1.array(options)) { + this.options.speed = options; + } else if (this.isHTML5 || this.isVimeo) { + this.options.speed = [0.5, 0.75, 1, 1.25, 1.5, 1.75, 2]; + } // Set options if passed and filter based on config + + + this.options.speed = this.options.speed.filter(function (speed) { + return _this7.config.speed.options.includes(speed); + }); // Toggle the pane and tab + + var toggle = !is$1.empty(this.options.speed) && this.options.speed.length > 1; + controls.toggleMenuButton.call(this, type, toggle); // Empty the menu + + emptyElement(list); // Check if we need to toggle the parent + + controls.checkMenu.call(this); // If we're hiding, nothing more to do + + if (!toggle) { + return; + } // Create items + + + this.options.speed.forEach(function (speed) { + controls.createMenuItem.call(_this7, { + value: speed, + list: list, + type: type, + title: controls.getLabel.call(_this7, 'speed', speed) + }); + }); + controls.updateSetting.call(this, type, list); + }, + // Check if we need to hide/show the settings menu + checkMenu: function checkMenu() { + var buttons = this.elements.settings.buttons; + var visible = !is$1.empty(buttons) && Object.values(buttons).some(function (button) { + return !button.hidden; + }); + toggleHidden(this.elements.settings.menu, !visible); + }, + // Focus the first menu item in a given (or visible) menu + focusFirstMenuItem: function focusFirstMenuItem(pane) { + var tabFocus = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + if (this.elements.settings.popup.hidden) { + return; + } + + var target = pane; + + if (!is$1.element(target)) { + target = Object.values(this.elements.settings.panels).find(function (pane) { + return !pane.hidden; + }); + } + + var firstItem = target.querySelector('[role^="menuitem"]'); + setFocus.call(this, firstItem, tabFocus); + }, + // Show/hide menu + toggleMenu: function toggleMenu(input) { + var popup = this.elements.settings.popup; + var button = this.elements.buttons.settings; // Menu and button are required + + if (!is$1.element(popup) || !is$1.element(button)) { + return; + } // True toggle by default + + + var hidden = popup.hidden; + var show = hidden; + + if (is$1.boolean(input)) { + show = input; + } else if (is$1.keyboardEvent(input) && input.which === 27) { + show = false; + } else if (is$1.event(input)) { + var isMenuItem = popup.contains(input.target); // If the click was inside the menu or if the click + // wasn't the button or menu item and we're trying to + // show the menu (a doc click shouldn't show the menu) + + if (isMenuItem || !isMenuItem && input.target !== button && show) { + return; + } + } // Set button attributes + + + button.setAttribute('aria-expanded', show); // Show the actual popup + + toggleHidden(popup, !show); // Add class hook + + toggleClass(this.elements.container, this.config.classNames.menu.open, show); // Focus the first item if key interaction + + if (show && is$1.keyboardEvent(input)) { + controls.focusFirstMenuItem.call(this, null, true); + } else if (!show && !hidden) { + // If closing, re-focus the button + setFocus.call(this, button, is$1.keyboardEvent(input)); + } + }, + // Get the natural size of a menu panel + getMenuSize: function getMenuSize(tab) { + var clone = tab.cloneNode(true); + clone.style.position = 'absolute'; + clone.style.opacity = 0; + clone.removeAttribute('hidden'); // Append to parent so we get the "real" size + + tab.parentNode.appendChild(clone); // Get the sizes before we remove + + var width = clone.scrollWidth; + var height = clone.scrollHeight; // Remove from the DOM + + removeElement(clone); + return { + width: width, + height: height + }; + }, + // Show a panel in the menu + showMenuPanel: function showMenuPanel() { + var _this8 = this; + + var type = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : ''; + var tabFocus = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + var target = document.getElementById("plyr-settings-".concat(this.id, "-").concat(type)); // Nothing to show, bail + + if (!is$1.element(target)) { + return; + } // Hide all other panels + + + var container = target.parentNode; + var current = Array.from(container.children).find(function (node) { + return !node.hidden; + }); // If we can do fancy animations, we'll animate the height/width + + if (support.transitions && !support.reducedMotion) { + // Set the current width as a base + container.style.width = "".concat(current.scrollWidth, "px"); + container.style.height = "".concat(current.scrollHeight, "px"); // Get potential sizes + + var size = controls.getMenuSize.call(this, target); // Restore auto height/width + + var restore = function restore(event) { + // We're only bothered about height and width on the container + if (event.target !== container || !['width', 'height'].includes(event.propertyName)) { + return; + } // Revert back to auto + + + container.style.width = ''; + container.style.height = ''; // Only listen once + + off.call(_this8, container, transitionEndEvent, restore); + }; // Listen for the transition finishing and restore auto height/width + + + on.call(this, container, transitionEndEvent, restore); // Set dimensions to target + + container.style.width = "".concat(size.width, "px"); + container.style.height = "".concat(size.height, "px"); + } // Set attributes on current tab + + + toggleHidden(current, true); // Set attributes on target + + toggleHidden(target, false); // Focus the first item + + controls.focusFirstMenuItem.call(this, target, tabFocus); + }, + // Set the download link + setDownloadLink: function setDownloadLink() { + var button = this.elements.buttons.download; // Bail if no button + + if (!is$1.element(button)) { + return; + } // Set download link + + + button.setAttribute('href', this.download); + }, + // Build the default HTML + // TODO: Set order based on order in the config.controls array? + create: function create(data) { + var _this9 = this; + + // Create the container + var container = createElement('div', getAttributesFromSelector(this.config.selectors.controls.wrapper)); // Restart button + + if (this.config.controls.includes('restart')) { + container.appendChild(controls.createButton.call(this, 'restart')); + } // Rewind button + + + if (this.config.controls.includes('rewind')) { + container.appendChild(controls.createButton.call(this, 'rewind')); + } // Play/Pause button + + + if (this.config.controls.includes('play')) { + container.appendChild(controls.createButton.call(this, 'play')); + } // Fast forward button + + + if (this.config.controls.includes('fast-forward')) { + container.appendChild(controls.createButton.call(this, 'fast-forward')); + } // Progress + + + if (this.config.controls.includes('progress')) { + var progress = createElement('div', getAttributesFromSelector(this.config.selectors.progress)); // Seek range slider + + progress.appendChild(controls.createRange.call(this, 'seek', { + id: "plyr-seek-".concat(data.id) + })); // Buffer progress + + progress.appendChild(controls.createProgress.call(this, 'buffer')); // TODO: Add loop display indicator + // Seek tooltip + + if (this.config.tooltips.seek) { + var tooltip = createElement('span', { + class: this.config.classNames.tooltip + }, '00:00'); + progress.appendChild(tooltip); + this.elements.display.seekTooltip = tooltip; + } + + this.elements.progress = progress; + container.appendChild(this.elements.progress); + } // Media current time display + + + if (this.config.controls.includes('current-time')) { + container.appendChild(controls.createTime.call(this, 'currentTime')); + } // Media duration display + + + if (this.config.controls.includes('duration')) { + container.appendChild(controls.createTime.call(this, 'duration')); + } // Volume controls + + + if (this.config.controls.includes('mute') || this.config.controls.includes('volume')) { + var volume = createElement('div', { + class: 'plyr__volume' + }); // Toggle mute button + + if (this.config.controls.includes('mute')) { + volume.appendChild(controls.createButton.call(this, 'mute')); + } // Volume range control + + + if (this.config.controls.includes('volume')) { + // Set the attributes + var attributes = { + max: 1, + step: 0.05, + value: this.config.volume + }; // Create the volume range slider + + volume.appendChild(controls.createRange.call(this, 'volume', extend(attributes, { + id: "plyr-volume-".concat(data.id) + }))); + this.elements.volume = volume; + } + + container.appendChild(volume); + } // Toggle captions button + + + if (this.config.controls.includes('captions')) { + container.appendChild(controls.createButton.call(this, 'captions')); + } // Settings button / menu + + + if (this.config.controls.includes('settings') && !is$1.empty(this.config.settings)) { + var control = createElement('div', { + class: 'plyr__menu', + hidden: '' + }); + control.appendChild(controls.createButton.call(this, 'settings', { + 'aria-haspopup': true, + 'aria-controls': "plyr-settings-".concat(data.id), + 'aria-expanded': false + })); + var popup = createElement('div', { + class: 'plyr__menu__container', + id: "plyr-settings-".concat(data.id), + hidden: '' + }); + var inner = createElement('div'); + var home = createElement('div', { + id: "plyr-settings-".concat(data.id, "-home") + }); // Create the menu + + var menu = createElement('div', { + role: 'menu' + }); + home.appendChild(menu); + inner.appendChild(home); + this.elements.settings.panels.home = home; // Build the menu items + + this.config.settings.forEach(function (type) { + // TODO: bundle this with the createMenuItem helper and bindings + var menuItem = createElement('button', extend(getAttributesFromSelector(_this9.config.selectors.buttons.settings), { + type: 'button', + class: "".concat(_this9.config.classNames.control, " ").concat(_this9.config.classNames.control, "--forward"), + role: 'menuitem', + 'aria-haspopup': true, + hidden: '' + })); // Bind menu shortcuts for keyboard users + + controls.bindMenuItemShortcuts.call(_this9, menuItem, type); // Show menu on click + + on(menuItem, 'click', function () { + controls.showMenuPanel.call(_this9, type, false); + }); + var flex = createElement('span', null, i18n.get(type, _this9.config)); + var value = createElement('span', { + class: _this9.config.classNames.menu.value + }); // Speed contains HTML entities + + value.innerHTML = data[type]; + flex.appendChild(value); + menuItem.appendChild(flex); + menu.appendChild(menuItem); // Build the panes + + var pane = createElement('div', { + id: "plyr-settings-".concat(data.id, "-").concat(type), + hidden: '' + }); // Back button + + var backButton = createElement('button', { + type: 'button', + class: "".concat(_this9.config.classNames.control, " ").concat(_this9.config.classNames.control, "--back") + }); // Visible label + + backButton.appendChild(createElement('span', { + 'aria-hidden': true + }, i18n.get(type, _this9.config))); // Screen reader label + + backButton.appendChild(createElement('span', { + class: _this9.config.classNames.hidden + }, i18n.get('menuBack', _this9.config))); // Go back via keyboard + + on(pane, 'keydown', function (event) { + // We only care about <- + if (event.which !== 37) { + return; + } // Prevent seek + + + event.preventDefault(); + event.stopPropagation(); // Show the respective menu + + controls.showMenuPanel.call(_this9, 'home', true); + }, false); // Go back via button click + + on(backButton, 'click', function () { + controls.showMenuPanel.call(_this9, 'home', false); + }); // Add to pane + + pane.appendChild(backButton); // Menu + + pane.appendChild(createElement('div', { + role: 'menu' + })); + inner.appendChild(pane); + _this9.elements.settings.buttons[type] = menuItem; + _this9.elements.settings.panels[type] = pane; + }); + popup.appendChild(inner); + control.appendChild(popup); + container.appendChild(control); + this.elements.settings.popup = popup; + this.elements.settings.menu = control; + } // Picture in picture button + + + if (this.config.controls.includes('pip') && support.pip) { + container.appendChild(controls.createButton.call(this, 'pip')); + } // Airplay button + + + if (this.config.controls.includes('airplay') && support.airplay) { + container.appendChild(controls.createButton.call(this, 'airplay')); + } // Download button + + + if (this.config.controls.includes('download')) { + var _attributes = { + element: 'a', + href: this.download, + target: '_blank' + }; + var download = this.config.urls.download; + + if (!is$1.url(download) && this.isEmbed) { + extend(_attributes, { + icon: "logo-".concat(this.provider), + label: this.provider + }); + } + + container.appendChild(controls.createButton.call(this, 'download', _attributes)); + } // Toggle fullscreen button + + + if (this.config.controls.includes('fullscreen')) { + container.appendChild(controls.createButton.call(this, 'fullscreen')); + } // Larger overlaid play button + + + if (this.config.controls.includes('play-large')) { + this.elements.container.appendChild(controls.createButton.call(this, 'play-large')); + } + + this.elements.controls = container; // Set available quality levels + + if (this.isHTML5) { + controls.setQualityMenu.call(this, html5.getQualityOptions.call(this)); + } + + controls.setSpeedMenu.call(this); + return container; + }, + // Insert controls + inject: function inject() { + var _this10 = this; + + // Sprite + if (this.config.loadSprite) { + var icon = controls.getIconUrl.call(this); // Only load external sprite using AJAX + + if (icon.cors) { + loadSprite(icon.url, 'sprite-plyr'); + } + } // Create a unique ID + + + this.id = Math.floor(Math.random() * 10000); // Null by default + + var container = null; + this.elements.controls = null; // Set template properties + + var props = { + id: this.id, + seektime: this.config.seekTime, + title: this.config.title + }; + var update = true; // If function, run it and use output + + if (is$1.function(this.config.controls)) { + this.config.controls = this.config.controls.call(this, props); + } // Convert falsy controls to empty array (primarily for empty strings) + + + if (!this.config.controls) { + this.config.controls = []; + } + + if (is$1.element(this.config.controls) || is$1.string(this.config.controls)) { + // HTMLElement or Non-empty string passed as the option + container = this.config.controls; + } else { + // Create controls + container = controls.create.call(this, { + id: this.id, + seektime: this.config.seekTime, + speed: this.speed, + quality: this.quality, + captions: captions.getLabel.call(this) // TODO: Looping + // loop: 'None', + + }); + update = false; + } // Replace props with their value + + + var replace = function replace(input) { + var result = input; + Object.entries(props).forEach(function (_ref2) { + var _ref3 = _slicedToArray(_ref2, 2), + key = _ref3[0], + value = _ref3[1]; + + result = replaceAll(result, "{".concat(key, "}"), value); + }); + return result; + }; // Update markup + + + if (update) { + if (is$1.string(this.config.controls)) { + container = replace(container); + } else if (is$1.element(container)) { + container.innerHTML = replace(container.innerHTML); + } + } // Controls container + + + var target; // Inject to custom location + + if (is$1.string(this.config.selectors.controls.container)) { + target = document.querySelector(this.config.selectors.controls.container); + } // Inject into the container by default + + + if (!is$1.element(target)) { + target = this.elements.container; + } // Inject controls HTML (needs to be before captions, hence "afterbegin") + + + var insertMethod = is$1.element(container) ? 'insertAdjacentElement' : 'insertAdjacentHTML'; + target[insertMethod]('afterbegin', container); // Find the elements if need be + + if (!is$1.element(this.elements.controls)) { + controls.findElements.call(this); + } // Add pressed property to buttons + + + if (!is$1.empty(this.elements.buttons)) { + var addProperty = function addProperty(button) { + var className = _this10.config.classNames.controlPressed; + Object.defineProperty(button, 'pressed', { + enumerable: true, + get: function get() { + return hasClass(button, className); + }, + set: function set() { + var pressed = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + toggleClass(button, className, pressed); + } + }); + }; // Toggle classname when pressed property is set + + + Object.values(this.elements.buttons).filter(Boolean).forEach(function (button) { + if (is$1.array(button) || is$1.nodeList(button)) { + Array.from(button).filter(Boolean).forEach(addProperty); + } else { + addProperty(button); + } + }); + } // Edge sometimes doesn't finish the paint so force a repaint + + + if (browser.isEdge) { + repaint(target); + } // Setup tooltips + + + if (this.config.tooltips.controls) { + var _this$config = this.config, + classNames = _this$config.classNames, + selectors = _this$config.selectors; + var selector = "".concat(selectors.controls.wrapper, " ").concat(selectors.labels, " .").concat(classNames.hidden); + var labels = getElements.call(this, selector); + Array.from(labels).forEach(function (label) { + toggleClass(label, _this10.config.classNames.hidden, false); + toggleClass(label, _this10.config.classNames.tooltip, true); + }); + } + } + }; + + /** + * Parse a string to a URL object + * @param {String} input - the URL to be parsed + * @param {Boolean} safe - failsafe parsing + */ + + function parseUrl$2(input) { + var safe = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true; + var url = input; + + if (safe) { + var parser = document.createElement('a'); + parser.href = url; + url = parser.href; + } + + try { + return new URL(url); + } catch (e) { + return null; + } + } // Convert object to URLSearchParams + + function buildUrlParams(input) { + var params = new URLSearchParams(); + + if (is$1.object(input)) { + Object.entries(input).forEach(function (_ref) { + var _ref2 = _slicedToArray(_ref, 2), + key = _ref2[0], + value = _ref2[1]; + + params.set(key, value); + }); + } + + return params; + } + + var captions = { + // Setup captions + setup: function setup() { + // Requires UI support + if (!this.supported.ui) { + return; + } // Only Vimeo and HTML5 video supported at this point + + + if (!this.isVideo || this.isYouTube || this.isHTML5 && !support.textTracks) { + // Clear menu and hide + if (is$1.array(this.config.controls) && this.config.controls.includes('settings') && this.config.settings.includes('captions')) { + controls.setCaptionsMenu.call(this); + } + + return; + } // Inject the container + + + if (!is$1.element(this.elements.captions)) { + this.elements.captions = createElement('div', getAttributesFromSelector(this.config.selectors.captions)); + insertAfter(this.elements.captions, this.elements.wrapper); + } // Fix IE captions if CORS is used + // Fetch captions and inject as blobs instead (data URIs not supported!) + + + if (browser.isIE && window.URL) { + var elements = this.media.querySelectorAll('track'); + Array.from(elements).forEach(function (track) { + var src = track.getAttribute('src'); + var url = parseUrl$2(src); + + if (url !== null && url.hostname !== window.location.href.hostname && ['http:', 'https:'].includes(url.protocol)) { + fetch(src, 'blob').then(function (blob) { + track.setAttribute('src', window.URL.createObjectURL(blob)); + }).catch(function () { + removeElement(track); + }); + } + }); + } // Get and set initial data + // The "preferred" options are not realized unless / until the wanted language has a match + // * languages: Array of user's browser languages. + // * language: The language preferred by user settings or config + // * active: The state preferred by user settings or config + // * toggled: The real captions state + + + var browserLanguages = navigator.languages || [navigator.language || navigator.userLanguage || 'en']; + var languages = dedupe(browserLanguages.map(function (language) { + return language.split('-')[0]; + })); + var language = (this.storage.get('language') || this.config.captions.language || 'auto').toLowerCase(); // Use first browser language when language is 'auto' + + if (language === 'auto') { + var _languages = _slicedToArray(languages, 1); + + language = _languages[0]; + } + + var active = this.storage.get('captions'); + + if (!is$1.boolean(active)) { + active = this.config.captions.active; + } + + Object.assign(this.captions, { + toggled: false, + active: active, + language: language, + languages: languages + }); // Watch changes to textTracks and update captions menu + + if (this.isHTML5) { + var trackEvents = this.config.captions.update ? 'addtrack removetrack' : 'removetrack'; + on.call(this, this.media.textTracks, trackEvents, captions.update.bind(this)); + } // Update available languages in list next tick (the event must not be triggered before the listeners) + + + setTimeout(captions.update.bind(this), 0); + }, + // Update available language options in settings based on tracks + update: function update() { + var _this = this; + + var tracks = captions.getTracks.call(this, true); // Get the wanted language + + var _this$captions = this.captions, + active = _this$captions.active, + language = _this$captions.language, + meta = _this$captions.meta, + currentTrackNode = _this$captions.currentTrackNode; + var languageExists = Boolean(tracks.find(function (track) { + return track.language === language; + })); // Handle tracks (add event listener and "pseudo"-default) + + if (this.isHTML5 && this.isVideo) { + tracks.filter(function (track) { + return !meta.get(track); + }).forEach(function (track) { + _this.debug.log('Track added', track); // Attempt to store if the original dom element was "default" + + + meta.set(track, { + default: track.mode === 'showing' + }); // Turn off native caption rendering to avoid double captions + + track.mode = 'hidden'; // Add event listener for cue changes + + on.call(_this, track, 'cuechange', function () { + return captions.updateCues.call(_this); + }); + }); + } // Update language first time it matches, or if the previous matching track was removed + + + if (languageExists && this.language !== language || !tracks.includes(currentTrackNode)) { + captions.setLanguage.call(this, language); + captions.toggle.call(this, active && languageExists); + } // Enable or disable captions based on track length + + + toggleClass(this.elements.container, this.config.classNames.captions.enabled, !is$1.empty(tracks)); // Update available languages in list + + if ((this.config.controls || []).includes('settings') && this.config.settings.includes('captions')) { + controls.setCaptionsMenu.call(this); + } + }, + // Toggle captions display + // Used internally for the toggleCaptions method, with the passive option forced to false + toggle: function toggle(input) { + var passive = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true; + + // If there's no full support + if (!this.supported.ui) { + return; + } + + var toggled = this.captions.toggled; // Current state + + var activeClass = this.config.classNames.captions.active; // Get the next state + // If the method is called without parameter, toggle based on current value + + var active = is$1.nullOrUndefined(input) ? !toggled : input; // Update state and trigger event + + if (active !== toggled) { + // When passive, don't override user preferences + if (!passive) { + this.captions.active = active; + this.storage.set({ + captions: active + }); + } // Force language if the call isn't passive and there is no matching language to toggle to + + + if (!this.language && active && !passive) { + var tracks = captions.getTracks.call(this); + var track = captions.findTrack.call(this, [this.captions.language].concat(_toConsumableArray(this.captions.languages)), true); // Override user preferences to avoid switching languages if a matching track is added + + this.captions.language = track.language; // Set caption, but don't store in localStorage as user preference + + captions.set.call(this, tracks.indexOf(track)); + return; + } // Toggle button if it's enabled + + + if (this.elements.buttons.captions) { + this.elements.buttons.captions.pressed = active; + } // Add class hook + + + toggleClass(this.elements.container, activeClass, active); + this.captions.toggled = active; // Update settings menu + + controls.updateSetting.call(this, 'captions'); // Trigger event (not used internally) + + triggerEvent.call(this, this.media, active ? 'captionsenabled' : 'captionsdisabled'); + } + }, + // Set captions by track index + // Used internally for the currentTrack setter with the passive option forced to false + set: function set(index) { + var passive = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true; + var tracks = captions.getTracks.call(this); // Disable captions if setting to -1 + + if (index === -1) { + captions.toggle.call(this, false, passive); + return; + } + + if (!is$1.number(index)) { + this.debug.warn('Invalid caption argument', index); + return; + } + + if (!(index in tracks)) { + this.debug.warn('Track not found', index); + return; + } + + if (this.captions.currentTrack !== index) { + this.captions.currentTrack = index; + var track = tracks[index]; + + var _ref = track || {}, + language = _ref.language; // Store reference to node for invalidation on remove + + + this.captions.currentTrackNode = track; // Update settings menu + + controls.updateSetting.call(this, 'captions'); // When passive, don't override user preferences + + if (!passive) { + this.captions.language = language; + this.storage.set({ + language: language + }); + } // Handle Vimeo captions + + + if (this.isVimeo) { + this.embed.enableTextTrack(language); + } // Trigger event + + + triggerEvent.call(this, this.media, 'languagechange'); + } // Show captions + + + captions.toggle.call(this, true, passive); + + if (this.isHTML5 && this.isVideo) { + // If we change the active track while a cue is already displayed we need to update it + captions.updateCues.call(this); + } + }, + // Set captions by language + // Used internally for the language setter with the passive option forced to false + setLanguage: function setLanguage(input) { + var passive = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true; + + if (!is$1.string(input)) { + this.debug.warn('Invalid language argument', input); + return; + } // Normalize + + + var language = input.toLowerCase(); + this.captions.language = language; // Set currentTrack + + var tracks = captions.getTracks.call(this); + var track = captions.findTrack.call(this, [language]); + captions.set.call(this, tracks.indexOf(track), passive); + }, + // Get current valid caption tracks + // If update is false it will also ignore tracks without metadata + // This is used to "freeze" the language options when captions.update is false + getTracks: function getTracks() { + var _this2 = this; + + var update = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + // Handle media or textTracks missing or null + var tracks = Array.from((this.media || {}).textTracks || []); // For HTML5, use cache instead of current tracks when it exists (if captions.update is false) + // Filter out removed tracks and tracks that aren't captions/subtitles (for example metadata) + + return tracks.filter(function (track) { + return !_this2.isHTML5 || update || _this2.captions.meta.has(track); + }).filter(function (track) { + return ['captions', 'subtitles'].includes(track.kind); + }); + }, + // Match tracks based on languages and get the first + findTrack: function findTrack(languages) { + var _this3 = this; + + var force = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + var tracks = captions.getTracks.call(this); + + var sortIsDefault = function sortIsDefault(track) { + return Number((_this3.captions.meta.get(track) || {}).default); + }; + + var sorted = Array.from(tracks).sort(function (a, b) { + return sortIsDefault(b) - sortIsDefault(a); + }); + var track; + languages.every(function (language) { + track = sorted.find(function (track) { + return track.language === language; + }); + return !track; // Break iteration if there is a match + }); // If no match is found but is required, get first + + return track || (force ? sorted[0] : undefined); + }, + // Get the current track + getCurrentTrack: function getCurrentTrack() { + return captions.getTracks.call(this)[this.currentTrack]; + }, + // Get UI label for track + getLabel: function getLabel(track) { + var currentTrack = track; + + if (!is$1.track(currentTrack) && support.textTracks && this.captions.toggled) { + currentTrack = captions.getCurrentTrack.call(this); + } + + if (is$1.track(currentTrack)) { + if (!is$1.empty(currentTrack.label)) { + return currentTrack.label; + } + + if (!is$1.empty(currentTrack.language)) { + return track.language.toUpperCase(); + } + + return i18n.get('enabled', this.config); + } + + return i18n.get('disabled', this.config); + }, + // Update captions using current track's active cues + // Also optional array argument in case there isn't any track (ex: vimeo) + updateCues: function updateCues(input) { + // Requires UI + if (!this.supported.ui) { + return; + } + + if (!is$1.element(this.elements.captions)) { + this.debug.warn('No captions element to render to'); + return; + } // Only accept array or empty input + + + if (!is$1.nullOrUndefined(input) && !Array.isArray(input)) { + this.debug.warn('updateCues: Invalid input', input); + return; + } + + var cues = input; // Get cues from track + + if (!cues) { + var track = captions.getCurrentTrack.call(this); + cues = Array.from((track || {}).activeCues || []).map(function (cue) { + return cue.getCueAsHTML(); + }).map(getHTML); + } // Set new caption text + + + var content = cues.map(function (cueText) { + return cueText.trim(); + }).join('\n'); + var changed = content !== this.elements.captions.innerHTML; + + if (changed) { + // Empty the container and create a new child element + emptyElement(this.elements.captions); + var caption = createElement('span', getAttributesFromSelector(this.config.selectors.caption)); + caption.innerHTML = content; + this.elements.captions.appendChild(caption); // Trigger event + + triggerEvent.call(this, this.media, 'cuechange'); + } + } + }; + + // ========================================================================== + // Plyr default config + // ========================================================================== + var defaults$1 = { + // Disable + enabled: true, + // Custom media title + title: '', + // Logging to console + debug: false, + // Auto play (if supported) + autoplay: false, + // Only allow one media playing at once (vimeo only) + autopause: true, + // Allow inline playback on iOS (this effects YouTube/Vimeo - HTML5 requires the attribute present) + // TODO: Remove iosNative fullscreen option in favour of this (logic needs work) + playsinline: true, + // Default time to skip when rewind/fast forward + seekTime: 10, + // Default volume + volume: 1, + muted: false, + // Pass a custom duration + duration: null, + // Display the media duration on load in the current time position + // If you have opted to display both duration and currentTime, this is ignored + displayDuration: true, + // Invert the current time to be a countdown + invertTime: true, + // Clicking the currentTime inverts it's value to show time left rather than elapsed + toggleInvert: true, + // Aspect ratio (for embeds) + ratio: '16:9', + // Click video container to play/pause + clickToPlay: true, + // Auto hide the controls + hideControls: true, + // Reset to start when playback ended + resetOnEnd: false, + // Disable the standard context menu + disableContextMenu: true, + // Sprite (for icons) + loadSprite: true, + iconPrefix: 'plyr', + iconUrl: 'https://cdn.plyr.io/3.5.2/plyr.svg', + // Blank video (used to prevent errors on source change) + blankVideo: 'https://cdn.plyr.io/static/blank.mp4', + // Quality default + quality: { + default: 576, + options: [4320, 2880, 2160, 1440, 1080, 720, 576, 480, 360, 240] + }, + // Set loops + loop: { + active: false // start: null, + // end: null, + + }, + // Speed default and options to display + speed: { + selected: 1, + options: [0.5, 0.75, 1, 1.25, 1.5, 1.75, 2] + }, + // Keyboard shortcut settings + keyboard: { + focused: true, + global: false + }, + // Display tooltips + tooltips: { + controls: false, + seek: true + }, + // Captions settings + captions: { + active: false, + language: 'auto', + // Listen to new tracks added after Plyr is initialized. + // This is needed for streaming captions, but may result in unselectable options + update: false + }, + // Fullscreen settings + fullscreen: { + enabled: true, + // Allow fullscreen? + fallback: true, + // Fallback using full viewport/window + iosNative: false // Use the native fullscreen in iOS (disables custom controls) + + }, + // Local storage + storage: { + enabled: true, + key: 'plyr' + }, + // Default controls + controls: ['play-large', // 'restart', + // 'rewind', + 'play', // 'fast-forward', + 'progress', 'current-time', 'mute', 'volume', 'captions', 'settings', 'pip', 'airplay', // 'download', + 'fullscreen'], + settings: ['captions', 'quality', 'speed'], + // Localisation + i18n: { + restart: 'Restart', + rewind: 'Rewind {seektime}s', + play: 'Play', + pause: 'Pause', + fastForward: 'Forward {seektime}s', + seek: 'Seek', + seekLabel: '{currentTime} of {duration}', + played: 'Played', + buffered: 'Buffered', + currentTime: 'Current time', + duration: 'Duration', + volume: 'Volume', + mute: 'Mute', + unmute: 'Unmute', + enableCaptions: 'Enable captions', + disableCaptions: 'Disable captions', + download: 'Download', + enterFullscreen: 'Enter fullscreen', + exitFullscreen: 'Exit fullscreen', + frameTitle: 'Player for {title}', + captions: 'Captions', + settings: 'Settings', + menuBack: 'Go back to previous menu', + speed: 'Speed', + normal: 'Normal', + quality: 'Quality', + loop: 'Loop', + start: 'Start', + end: 'End', + all: 'All', + reset: 'Reset', + disabled: 'Disabled', + enabled: 'Enabled', + advertisement: 'Ad', + qualityBadge: { + 2160: '4K', + 1440: 'HD', + 1080: 'HD', + 720: 'HD', + 576: 'SD', + 480: 'SD' + } + }, + // URLs + urls: { + download: null, + vimeo: { + sdk: 'https://player.vimeo.com/api/player.js', + iframe: 'https://player.vimeo.com/video/{0}?{1}', + api: 'https://vimeo.com/api/v2/video/{0}.json' + }, + youtube: { + sdk: 'https://www.youtube.com/iframe_api', + api: 'https://www.googleapis.com/youtube/v3/videos?id={0}&key={1}&fields=items(snippet(title))&part=snippet' + }, + googleIMA: { + sdk: 'https://imasdk.googleapis.com/js/sdkloader/ima3.js' + } + }, + // Custom control listeners + listeners: { + seek: null, + play: null, + pause: null, + restart: null, + rewind: null, + fastForward: null, + mute: null, + volume: null, + captions: null, + download: null, + fullscreen: null, + pip: null, + airplay: null, + speed: null, + quality: null, + loop: null, + language: null + }, + // Events to watch and bubble + events: [// Events to watch on HTML5 media elements and bubble + // https://developer.mozilla.org/en/docs/Web/Guide/Events/Media_events + 'ended', 'progress', 'stalled', 'playing', 'waiting', 'canplay', 'canplaythrough', 'loadstart', 'loadeddata', 'loadedmetadata', 'timeupdate', 'volumechange', 'play', 'pause', 'error', 'seeking', 'seeked', 'emptied', 'ratechange', 'cuechange', // Custom events + 'download', 'enterfullscreen', 'exitfullscreen', 'captionsenabled', 'captionsdisabled', 'languagechange', 'controlshidden', 'controlsshown', 'ready', // YouTube + 'statechange', // Quality + 'qualitychange', // Ads + 'adsloaded', 'adscontentpause', 'adscontentresume', 'adstarted', 'adsmidpoint', 'adscomplete', 'adsallcomplete', 'adsimpression', 'adsclick'], + // Selectors + // Change these to match your template if using custom HTML + selectors: { + editable: 'input, textarea, select, [contenteditable]', + container: '.plyr', + controls: { + container: null, + wrapper: '.plyr__controls' + }, + labels: '[data-plyr]', + buttons: { + play: '[data-plyr="play"]', + pause: '[data-plyr="pause"]', + restart: '[data-plyr="restart"]', + rewind: '[data-plyr="rewind"]', + fastForward: '[data-plyr="fast-forward"]', + mute: '[data-plyr="mute"]', + captions: '[data-plyr="captions"]', + download: '[data-plyr="download"]', + fullscreen: '[data-plyr="fullscreen"]', + pip: '[data-plyr="pip"]', + airplay: '[data-plyr="airplay"]', + settings: '[data-plyr="settings"]', + loop: '[data-plyr="loop"]' + }, + inputs: { + seek: '[data-plyr="seek"]', + volume: '[data-plyr="volume"]', + speed: '[data-plyr="speed"]', + language: '[data-plyr="language"]', + quality: '[data-plyr="quality"]' + }, + display: { + currentTime: '.plyr__time--current', + duration: '.plyr__time--duration', + buffer: '.plyr__progress__buffer', + loop: '.plyr__progress__loop', + // Used later + volume: '.plyr__volume--display' + }, + progress: '.plyr__progress', + captions: '.plyr__captions', + caption: '.plyr__caption', + menu: { + quality: '.js-plyr__menu__list--quality' + } + }, + // Class hooks added to the player in different states + classNames: { + type: 'plyr--{0}', + provider: 'plyr--{0}', + video: 'plyr__video-wrapper', + embed: 'plyr__video-embed', + embedContainer: 'plyr__video-embed__container', + poster: 'plyr__poster', + posterEnabled: 'plyr__poster-enabled', + ads: 'plyr__ads', + control: 'plyr__control', + controlPressed: 'plyr__control--pressed', + playing: 'plyr--playing', + paused: 'plyr--paused', + stopped: 'plyr--stopped', + loading: 'plyr--loading', + hover: 'plyr--hover', + tooltip: 'plyr__tooltip', + cues: 'plyr__cues', + hidden: 'plyr__sr-only', + hideControls: 'plyr--hide-controls', + isIos: 'plyr--is-ios', + isTouch: 'plyr--is-touch', + uiSupported: 'plyr--full-ui', + noTransition: 'plyr--no-transition', + display: { + time: 'plyr__time' + }, + menu: { + value: 'plyr__menu__value', + badge: 'plyr__badge', + open: 'plyr--menu-open' + }, + captions: { + enabled: 'plyr--captions-enabled', + active: 'plyr--captions-active' + }, + fullscreen: { + enabled: 'plyr--fullscreen-enabled', + fallback: 'plyr--fullscreen-fallback' + }, + pip: { + supported: 'plyr--pip-supported', + active: 'plyr--pip-active' + }, + airplay: { + supported: 'plyr--airplay-supported', + active: 'plyr--airplay-active' + }, + tabFocus: 'plyr__tab-focus', + previewThumbnails: { + // Tooltip thumbs + thumbContainer: 'plyr__preview-thumb', + thumbContainerShown: 'plyr__preview-thumb--is-shown', + imageContainer: 'plyr__preview-thumb__image-container', + timeContainer: 'plyr__preview-thumb__time-container', + // Scrubbing + scrubbingContainer: 'plyr__preview-scrubbing', + scrubbingContainerShown: 'plyr__preview-scrubbing--is-shown' + } + }, + // Embed attributes + attributes: { + embed: { + provider: 'data-plyr-provider', + id: 'data-plyr-embed-id' + } + }, + // API keys + keys: { + google: null + }, + // Advertisements plugin + // Register for an account here: http://vi.ai/publisher-video-monetization/?aid=plyrio + ads: { + enabled: false, + publisherId: '', + tagUrl: '' + }, + // Preview Thumbnails plugin + previewThumbnails: { + enabled: false, + src: '' + }, + // Vimeo plugin + vimeo: { + byline: false, + portrait: false, + title: false, + speed: true, + transparent: false + }, + // YouTube plugin + youtube: { + noCookie: false, + // Whether to use an alternative version of YouTube without cookies + rel: 0, + // No related vids + showinfo: 0, + // Hide info + iv_load_policy: 3, + // Hide annotations + modestbranding: 1 // Hide logos as much as possible (they still show one in the corner when paused) + + } + }; + + // ========================================================================== + // Plyr states + // ========================================================================== + var pip = { + active: 'picture-in-picture', + inactive: 'inline' + }; + + // ========================================================================== + // Plyr supported types and providers + // ========================================================================== + var providers = { + html5: 'html5', + youtube: 'youtube', + vimeo: 'vimeo' + }; + var types = { + audio: 'audio', + video: 'video' + }; + /** + * Get provider by URL + * @param {String} url + */ + + function getProviderByUrl(url) { + // YouTube + if (/^(https?:\/\/)?(www\.)?(youtube\.com|youtube-nocookie\.com|youtu\.?be)\/.+$/.test(url)) { + return providers.youtube; + } // Vimeo + + + if (/^https?:\/\/player.vimeo.com\/video\/\d{0,9}(?=\b|\/)/.test(url)) { + return providers.vimeo; + } + + return null; + } + + // ========================================================================== + // Console wrapper + // ========================================================================== + var noop = function noop() {}; + + var Console = + /*#__PURE__*/ + function () { + function Console() { + var enabled = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + + _classCallCheck(this, Console); + + this.enabled = window.console && enabled; + + if (this.enabled) { + this.log('Debugging enabled'); + } + } + + _createClass(Console, [{ + key: "log", + get: function get() { + // eslint-disable-next-line no-console + return this.enabled ? Function.prototype.bind.call(console.log, console) : noop; + } + }, { + key: "warn", + get: function get() { + // eslint-disable-next-line no-console + return this.enabled ? Function.prototype.bind.call(console.warn, console) : noop; + } + }, { + key: "error", + get: function get() { + // eslint-disable-next-line no-console + return this.enabled ? Function.prototype.bind.call(console.error, console) : noop; + } + }]); + + return Console; + }(); + + function onChange() { + if (!this.enabled) { + return; + } // Update toggle button + + + var button = this.player.elements.buttons.fullscreen; + + if (is$1.element(button)) { + button.pressed = this.active; + } // Trigger an event + + + triggerEvent.call(this.player, this.target, this.active ? 'enterfullscreen' : 'exitfullscreen', true); // Trap focus in container + + if (!browser.isIos) { + trapFocus.call(this.player, this.target, this.active); + } + } + + function toggleFallback() { + var _this = this; + + var toggle = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + + // Store or restore scroll position + if (toggle) { + this.scrollPosition = { + x: window.scrollX || 0, + y: window.scrollY || 0 + }; + } else { + window.scrollTo(this.scrollPosition.x, this.scrollPosition.y); + } // Toggle scroll + + + document.body.style.overflow = toggle ? 'hidden' : ''; // Toggle class hook + + toggleClass(this.target, this.player.config.classNames.fullscreen.fallback, toggle); // Force full viewport on iPhone X+ + + if (browser.isIos) { + var viewport = document.head.querySelector('meta[name="viewport"]'); + var property = 'viewport-fit=cover'; // Inject the viewport meta if required + + if (!viewport) { + viewport = document.createElement('meta'); + viewport.setAttribute('name', 'viewport'); + } // Check if the property already exists + + + var hasProperty = is$1.string(viewport.content) && viewport.content.includes(property); + + if (toggle) { + this.cleanupViewport = !hasProperty; + + if (!hasProperty) { + viewport.content += ",".concat(property); + } + } else if (this.cleanupViewport) { + viewport.content = viewport.content.split(',').filter(function (part) { + return part.trim() !== property; + }).join(','); + } // Force a repaint as sometimes Safari doesn't want to fill the screen + + + setTimeout(function () { + return repaint(_this.target); + }, 100); + } // Toggle button and fire events + + + onChange.call(this); + } + + var Fullscreen = + /*#__PURE__*/ + function () { + function Fullscreen(player) { + var _this2 = this; + + _classCallCheck(this, Fullscreen); + + // Keep reference to parent + this.player = player; // Get prefix + + this.prefix = Fullscreen.prefix; + this.property = Fullscreen.property; // Scroll position + + this.scrollPosition = { + x: 0, + y: 0 + }; // Force the use of 'full window/browser' rather than fullscreen + + this.forceFallback = player.config.fullscreen.fallback === 'force'; // Register event listeners + // Handle event (incase user presses escape etc) + + on.call(this.player, document, this.prefix === 'ms' ? 'MSFullscreenChange' : "".concat(this.prefix, "fullscreenchange"), function () { + // TODO: Filter for target?? + onChange.call(_this2); + }); // Fullscreen toggle on double click + + on.call(this.player, this.player.elements.container, 'dblclick', function (event) { + // Ignore double click in controls + if (is$1.element(_this2.player.elements.controls) && _this2.player.elements.controls.contains(event.target)) { + return; + } + + _this2.toggle(); + }); // Update the UI + + this.update(); + } // Determine if native supported + + + _createClass(Fullscreen, [{ + key: "update", + // Update UI + value: function update() { + if (this.enabled) { + var mode; + + if (this.forceFallback) { + mode = 'Fallback (forced)'; + } else if (Fullscreen.native) { + mode = 'Native'; + } else { + mode = 'Fallback'; + } + + this.player.debug.log("".concat(mode, " fullscreen enabled")); + } else { + this.player.debug.log('Fullscreen not supported and fallback disabled'); + } // Add styling hook to show button + + + toggleClass(this.player.elements.container, this.player.config.classNames.fullscreen.enabled, this.enabled); + } // Make an element fullscreen + + }, { + key: "enter", + value: function enter() { + if (!this.enabled) { + return; + } // iOS native fullscreen doesn't need the request step + + + if (browser.isIos && this.player.config.fullscreen.iosNative) { + this.target.webkitEnterFullscreen(); + } else if (!Fullscreen.native || this.forceFallback) { + toggleFallback.call(this, true); + } else if (!this.prefix) { + this.target.requestFullscreen(); + } else if (!is$1.empty(this.prefix)) { + this.target["".concat(this.prefix, "Request").concat(this.property)](); + } + } // Bail from fullscreen + + }, { + key: "exit", + value: function exit() { + if (!this.enabled) { + return; + } // iOS native fullscreen + + + if (browser.isIos && this.player.config.fullscreen.iosNative) { + this.target.webkitExitFullscreen(); + this.player.play(); + } else if (!Fullscreen.native || this.forceFallback) { + toggleFallback.call(this, false); + } else if (!this.prefix) { + (document.cancelFullScreen || document.exitFullscreen).call(document); + } else if (!is$1.empty(this.prefix)) { + var action = this.prefix === 'moz' ? 'Cancel' : 'Exit'; + document["".concat(this.prefix).concat(action).concat(this.property)](); + } + } // Toggle state + + }, { + key: "toggle", + value: function toggle() { + if (!this.active) { + this.enter(); + } else { + this.exit(); + } + } + }, { + key: "usingNative", + // If we're actually using native + get: function get() { + return Fullscreen.native && !this.forceFallback; + } // Get the prefix for handlers + + }, { + key: "enabled", + // Determine if fullscreen is enabled + get: function get() { + return (Fullscreen.native || this.player.config.fullscreen.fallback) && this.player.config.fullscreen.enabled && this.player.supported.ui && this.player.isVideo; + } // Get active state + + }, { + key: "active", + get: function get() { + if (!this.enabled) { + return false; + } // Fallback using classname + + + if (!Fullscreen.native || this.forceFallback) { + return hasClass(this.target, this.player.config.classNames.fullscreen.fallback); + } + + var element = !this.prefix ? document.fullscreenElement : document["".concat(this.prefix).concat(this.property, "Element")]; + return element === this.target; + } // Get target element + + }, { + key: "target", + get: function get() { + return browser.isIos && this.player.config.fullscreen.iosNative ? this.player.media : this.player.elements.container; + } + }], [{ + key: "native", + get: function get() { + return !!(document.fullscreenEnabled || document.webkitFullscreenEnabled || document.mozFullScreenEnabled || document.msFullscreenEnabled); + } + }, { + key: "prefix", + get: function get() { + // No prefix + if (is$1.function(document.exitFullscreen)) { + return ''; + } // Check for fullscreen support by vendor prefix + + + var value = ''; + var prefixes = ['webkit', 'moz', 'ms']; + prefixes.some(function (pre) { + if (is$1.function(document["".concat(pre, "ExitFullscreen")]) || is$1.function(document["".concat(pre, "CancelFullScreen")])) { + value = pre; + return true; + } + + return false; + }); + return value; + } + }, { + key: "property", + get: function get() { + return this.prefix === 'moz' ? 'FullScreen' : 'Fullscreen'; + } + }]); + + return Fullscreen; + }(); + + // ========================================================================== + // Load image avoiding xhr/fetch CORS issues + // Server status can't be obtained this way unfortunately, so this uses "naturalWidth" to determine if the image has loaded + // By default it checks if it is at least 1px, but you can add a second argument to change this + // ========================================================================== + function loadImage(src) { + var minWidth = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 1; + return new Promise(function (resolve, reject) { + var image = new Image(); + + var handler = function handler() { + delete image.onload; + delete image.onerror; + (image.naturalWidth >= minWidth ? resolve : reject)(image); + }; + + Object.assign(image, { + onload: handler, + onerror: handler, + src: src + }); + }); + } + + // ========================================================================== + var ui = { + addStyleHook: function addStyleHook() { + toggleClass(this.elements.container, this.config.selectors.container.replace('.', ''), true); + toggleClass(this.elements.container, this.config.classNames.uiSupported, this.supported.ui); + }, + // Toggle native HTML5 media controls + toggleNativeControls: function toggleNativeControls() { + var toggle = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + + if (toggle && this.isHTML5) { + this.media.setAttribute('controls', ''); + } else { + this.media.removeAttribute('controls'); + } + }, + // Setup the UI + build: function build() { + var _this = this; + + // Re-attach media element listeners + // TODO: Use event bubbling? + this.listeners.media(); // Don't setup interface if no support + + if (!this.supported.ui) { + this.debug.warn("Basic support only for ".concat(this.provider, " ").concat(this.type)); // Restore native controls + + ui.toggleNativeControls.call(this, true); // Bail + + return; + } // Inject custom controls if not present + + + if (!is$1.element(this.elements.controls)) { + // Inject custom controls + controls.inject.call(this); // Re-attach control listeners + + this.listeners.controls(); + } // Remove native controls + + + ui.toggleNativeControls.call(this); // Setup captions for HTML5 + + if (this.isHTML5) { + captions.setup.call(this); + } // Reset volume + + + this.volume = null; // Reset mute state + + this.muted = null; // Reset speed + + this.speed = null; // Reset loop state + + this.loop = null; // Reset quality setting + + this.quality = null; // Reset volume display + + controls.updateVolume.call(this); // Reset time display + + controls.timeUpdate.call(this); // Update the UI + + ui.checkPlaying.call(this); // Check for picture-in-picture support + + toggleClass(this.elements.container, this.config.classNames.pip.supported, support.pip && this.isHTML5 && this.isVideo); // Check for airplay support + + toggleClass(this.elements.container, this.config.classNames.airplay.supported, support.airplay && this.isHTML5); // Add iOS class + + toggleClass(this.elements.container, this.config.classNames.isIos, browser.isIos); // Add touch class + + toggleClass(this.elements.container, this.config.classNames.isTouch, this.touch); // Ready for API calls + + this.ready = true; // Ready event at end of execution stack + + setTimeout(function () { + triggerEvent.call(_this, _this.media, 'ready'); + }, 0); // Set the title + + ui.setTitle.call(this); // Assure the poster image is set, if the property was added before the element was created + + if (this.poster) { + ui.setPoster.call(this, this.poster, false).catch(function () {}); + } // Manually set the duration if user has overridden it. + // The event listeners for it doesn't get called if preload is disabled (#701) + + + if (this.config.duration) { + controls.durationUpdate.call(this); + } + }, + // Setup aria attribute for play and iframe title + setTitle: function setTitle() { + // Find the current text + var label = i18n.get('play', this.config); // If there's a media title set, use that for the label + + if (is$1.string(this.config.title) && !is$1.empty(this.config.title)) { + label += ", ".concat(this.config.title); + } // If there's a play button, set label + + + Array.from(this.elements.buttons.play || []).forEach(function (button) { + button.setAttribute('aria-label', label); + }); // Set iframe title + // https://github.com/sampotts/plyr/issues/124 + + if (this.isEmbed) { + var iframe = getElement.call(this, 'iframe'); + + if (!is$1.element(iframe)) { + return; + } // Default to media type + + + var title = !is$1.empty(this.config.title) ? this.config.title : 'video'; + var format = i18n.get('frameTitle', this.config); + iframe.setAttribute('title', format.replace('{title}', title)); + } + }, + // Toggle poster + togglePoster: function togglePoster(enable) { + toggleClass(this.elements.container, this.config.classNames.posterEnabled, enable); + }, + // Set the poster image (async) + // Used internally for the poster setter, with the passive option forced to false + setPoster: function setPoster(poster) { + var _this2 = this; + + var passive = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true; + + // Don't override if call is passive + if (passive && this.poster) { + return Promise.reject(new Error('Poster already set')); + } // Set property synchronously to respect the call order + + + this.media.setAttribute('poster', poster); // Wait until ui is ready + + return ready.call(this) // Load image + .then(function () { + return loadImage(poster); + }).catch(function (err) { + // Hide poster on error unless it's been set by another call + if (poster === _this2.poster) { + ui.togglePoster.call(_this2, false); + } // Rethrow + + + throw err; + }).then(function () { + // Prevent race conditions + if (poster !== _this2.poster) { + throw new Error('setPoster cancelled by later call to setPoster'); + } + }).then(function () { + Object.assign(_this2.elements.poster.style, { + backgroundImage: "url('".concat(poster, "')"), + // Reset backgroundSize as well (since it can be set to "cover" for padded thumbnails for youtube) + backgroundSize: '' + }); + ui.togglePoster.call(_this2, true); + return poster; + }); + }, + // Check playing state + checkPlaying: function checkPlaying(event) { + var _this3 = this; + + // Class hooks + toggleClass(this.elements.container, this.config.classNames.playing, this.playing); + toggleClass(this.elements.container, this.config.classNames.paused, this.paused); + toggleClass(this.elements.container, this.config.classNames.stopped, this.stopped); // Set state + + Array.from(this.elements.buttons.play || []).forEach(function (target) { + target.pressed = _this3.playing; + }); // Only update controls on non timeupdate events + + if (is$1.event(event) && event.type === 'timeupdate') { + return; + } // Toggle controls + + + ui.toggleControls.call(this); + }, + // Check if media is loading + checkLoading: function checkLoading(event) { + var _this4 = this; + + this.loading = ['stalled', 'waiting'].includes(event.type); // Clear timer + + clearTimeout(this.timers.loading); // Timer to prevent flicker when seeking + + this.timers.loading = setTimeout(function () { + // Update progress bar loading class state + toggleClass(_this4.elements.container, _this4.config.classNames.loading, _this4.loading); // Update controls visibility + + ui.toggleControls.call(_this4); + }, this.loading ? 250 : 0); + }, + // Toggle controls based on state and `force` argument + toggleControls: function toggleControls(force) { + var controls = this.elements.controls; + + if (controls && this.config.hideControls) { + // Don't hide controls if a touch-device user recently seeked. (Must be limited to touch devices, or it occasionally prevents desktop controls from hiding.) + var recentTouchSeek = this.touch && this.lastSeekTime + 2000 > Date.now(); // Show controls if force, loading, paused, button interaction, or recent seek, otherwise hide + + this.toggleControls(Boolean(force || this.loading || this.paused || controls.pressed || controls.hover || recentTouchSeek)); + } + } + }; + + /* function reduceAspectRatio(width, height) { + const getRatio = (w, h) => (h === 0 ? w : getRatio(h, w % h)); + const ratio = getRatio(width, height); + return `${width / ratio}:${height / ratio}`; + } */ + // Set aspect ratio for responsive container + + function setAspectRatio(input) { + var ratio = input; + + if (!is$1.string(ratio) && !is$1.nullOrUndefined(this.embed)) { + ratio = this.embed.ratio; + } + + if (!is$1.string(ratio)) { + ratio = this.config.ratio; + } + + var _ratio$split$map = ratio.split(':').map(Number), + _ratio$split$map2 = _slicedToArray(_ratio$split$map, 2), + x = _ratio$split$map2[0], + y = _ratio$split$map2[1]; + + var padding = 100 / x * y; + this.elements.wrapper.style.paddingBottom = "".concat(padding, "%"); // For Vimeo we have an extra <div> to hide the standard controls and UI + + if (this.isVimeo && this.supported.ui) { + var height = 240; + var offset = (height - padding) / (height / 50); + this.media.style.transform = "translateY(-".concat(offset, "%)"); + } + + return { + padding: padding, + ratio: ratio + }; + } + + var Listeners = + /*#__PURE__*/ + function () { + function Listeners(player) { + _classCallCheck(this, Listeners); + + this.player = player; + this.lastKey = null; + this.focusTimer = null; + this.lastKeyDown = null; + this.handleKey = this.handleKey.bind(this); + this.toggleMenu = this.toggleMenu.bind(this); + this.setTabFocus = this.setTabFocus.bind(this); + this.firstTouch = this.firstTouch.bind(this); + } // Handle key presses + + + _createClass(Listeners, [{ + key: "handleKey", + value: function handleKey(event) { + var player = this.player; + var elements = player.elements; + var code = event.keyCode ? event.keyCode : event.which; + var pressed = event.type === 'keydown'; + var repeat = pressed && code === this.lastKey; // Bail if a modifier key is set + + if (event.altKey || event.ctrlKey || event.metaKey || event.shiftKey) { + return; + } // If the event is bubbled from the media element + // Firefox doesn't get the keycode for whatever reason + + + if (!is$1.number(code)) { + return; + } // Seek by the number keys + + + var seekByKey = function seekByKey() { + // Divide the max duration into 10th's and times by the number value + player.currentTime = player.duration / 10 * (code - 48); + }; // Handle the key on keydown + // Reset on keyup + + + if (pressed) { + // Check focused element + // and if the focused element is not editable (e.g. text input) + // and any that accept key input http://webaim.org/techniques/keyboard/ + var focused = document.activeElement; + + if (is$1.element(focused)) { + var editable = player.config.selectors.editable; + var seek = elements.inputs.seek; + + if (focused !== seek && matches$1(focused, editable)) { + return; + } + + if (event.which === 32 && matches$1(focused, 'button, [role^="menuitem"]')) { + return; + } + } // Which keycodes should we prevent default + + + var preventDefault = [32, 37, 38, 39, 40, 48, 49, 50, 51, 52, 53, 54, 56, 57, 67, 70, 73, 75, 76, 77, 79]; // If the code is found prevent default (e.g. prevent scrolling for arrows) + + if (preventDefault.includes(code)) { + event.preventDefault(); + event.stopPropagation(); + } + + switch (code) { + case 48: + case 49: + case 50: + case 51: + case 52: + case 53: + case 54: + case 55: + case 56: + case 57: + // 0-9 + if (!repeat) { + seekByKey(); + } + + break; + + case 32: + case 75: + // Space and K key + if (!repeat) { + player.togglePlay(); + } + + break; + + case 38: + // Arrow up + player.increaseVolume(0.1); + break; + + case 40: + // Arrow down + player.decreaseVolume(0.1); + break; + + case 77: + // M key + if (!repeat) { + player.muted = !player.muted; + } + + break; + + case 39: + // Arrow forward + player.forward(); + break; + + case 37: + // Arrow back + player.rewind(); + break; + + case 70: + // F key + player.fullscreen.toggle(); + break; + + case 67: + // C key + if (!repeat) { + player.toggleCaptions(); + } + + break; + + case 76: + // L key + player.loop = !player.loop; + break; + + /* case 73: + this.setLoop('start'); + break; + case 76: + this.setLoop(); + break; + case 79: + this.setLoop('end'); + break; */ + + default: + break; + } // Escape is handle natively when in full screen + // So we only need to worry about non native + + + if (code === 27 && !player.fullscreen.usingNative && player.fullscreen.active) { + player.fullscreen.toggle(); + } // Store last code for next cycle + + + this.lastKey = code; + } else { + this.lastKey = null; + } + } // Toggle menu + + }, { + key: "toggleMenu", + value: function toggleMenu(event) { + controls.toggleMenu.call(this.player, event); + } // Device is touch enabled + + }, { + key: "firstTouch", + value: function firstTouch() { + var player = this.player; + var elements = player.elements; + player.touch = true; // Add touch class + + toggleClass(elements.container, player.config.classNames.isTouch, true); + } + }, { + key: "setTabFocus", + value: function setTabFocus(event) { + var player = this.player; + var elements = player.elements; + clearTimeout(this.focusTimer); // Ignore any key other than tab + + if (event.type === 'keydown' && event.which !== 9) { + return; + } // Store reference to event timeStamp + + + if (event.type === 'keydown') { + this.lastKeyDown = event.timeStamp; + } // Remove current classes + + + var removeCurrent = function removeCurrent() { + var className = player.config.classNames.tabFocus; + var current = getElements.call(player, ".".concat(className)); + toggleClass(current, className, false); + }; // Determine if a key was pressed to trigger this event + + + var wasKeyDown = event.timeStamp - this.lastKeyDown <= 20; // Ignore focus events if a key was pressed prior + + if (event.type === 'focus' && !wasKeyDown) { + return; + } // Remove all current + + + removeCurrent(); // Delay the adding of classname until the focus has changed + // This event fires before the focusin event + + this.focusTimer = setTimeout(function () { + var focused = document.activeElement; // Ignore if current focus element isn't inside the player + + if (!elements.container.contains(focused)) { + return; + } + + toggleClass(document.activeElement, player.config.classNames.tabFocus, true); + }, 10); + } // Global window & document listeners + + }, { + key: "global", + value: function global() { + var toggle = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : true; + var player = this.player; // Keyboard shortcuts + + if (player.config.keyboard.global) { + toggleListener.call(player, window, 'keydown keyup', this.handleKey, toggle, false); + } // Click anywhere closes menu + + + toggleListener.call(player, document.body, 'click', this.toggleMenu, toggle); // Detect touch by events + + once.call(player, document.body, 'touchstart', this.firstTouch); // Tab focus detection + + toggleListener.call(player, document.body, 'keydown focus blur', this.setTabFocus, toggle, false, true); + } // Container listeners + + }, { + key: "container", + value: function container() { + var player = this.player; + var config = player.config, + elements = player.elements, + timers = player.timers; // Keyboard shortcuts + + if (!config.keyboard.global && config.keyboard.focused) { + on.call(player, elements.container, 'keydown keyup', this.handleKey, false); + } // Toggle controls on mouse events and entering fullscreen + + + on.call(player, elements.container, 'mousemove mouseleave touchstart touchmove enterfullscreen exitfullscreen', function (event) { + var controls = elements.controls; // Remove button states for fullscreen + + if (controls && event.type === 'enterfullscreen') { + controls.pressed = false; + controls.hover = false; + } // Show, then hide after a timeout unless another control event occurs + + + var show = ['touchstart', 'touchmove', 'mousemove'].includes(event.type); + var delay = 0; + + if (show) { + ui.toggleControls.call(player, true); // Use longer timeout for touch devices + + delay = player.touch ? 3000 : 2000; + } // Clear timer + + + clearTimeout(timers.controls); // Set new timer to prevent flicker when seeking + + timers.controls = setTimeout(function () { + return ui.toggleControls.call(player, false); + }, delay); + }); // Force edge to repaint on exit fullscreen + // TODO: Fix weird bug where Edge doesn't re-draw when exiting fullscreen + + /* if (browser.isEdge) { + on.call(player, elements.container, 'exitfullscreen', () => { + setTimeout(() => repaint(elements.container), 100); + }); + } */ + // Set a gutter for Vimeo + + var setGutter = function setGutter(ratio, padding, toggle) { + if (!player.isVimeo) { + return; + } + + var target = player.elements.wrapper.firstChild; + + var _ratio$split$map = ratio.split(':').map(Number), + _ratio$split$map2 = _slicedToArray(_ratio$split$map, 2), + height = _ratio$split$map2[1]; + + var _player$embed$ratio$s = player.embed.ratio.split(':').map(Number), + _player$embed$ratio$s2 = _slicedToArray(_player$embed$ratio$s, 2), + videoWidth = _player$embed$ratio$s2[0], + videoHeight = _player$embed$ratio$s2[1]; + + target.style.maxWidth = toggle ? "".concat(height / videoHeight * videoWidth, "px") : null; + target.style.margin = toggle ? '0 auto' : null; + }; // Resize on fullscreen change + + + var setPlayerSize = function setPlayerSize(measure) { + // If we don't need to measure the viewport + if (!measure) { + return setAspectRatio.call(player); + } + + var rect = elements.container.getBoundingClientRect(); + var width = rect.width, + height = rect.height; + return setAspectRatio.call(player, "".concat(width, ":").concat(height)); + }; + + var resized = function resized() { + window.clearTimeout(timers.resized); + timers.resized = window.setTimeout(setPlayerSize, 50); + }; + + on.call(player, elements.container, 'enterfullscreen exitfullscreen', function (event) { + var _player$fullscreen = player.fullscreen, + target = _player$fullscreen.target, + usingNative = _player$fullscreen.usingNative; // Ignore for iOS native + + if (!player.isEmbed || target !== elements.container) { + return; + } + + var isEnter = event.type === 'enterfullscreen'; // Set the player size when entering fullscreen to viewport size + + var _setPlayerSize = setPlayerSize(isEnter), + padding = _setPlayerSize.padding, + ratio = _setPlayerSize.ratio; // Set Vimeo gutter + + + setGutter(ratio, padding, isEnter); // If not using native fullscreen, we need to check for resizes of viewport + + if (!usingNative) { + if (isEnter) { + on.call(player, window, 'resize', resized); + } else { + off.call(player, window, 'resize', resized); + } + } + }); + } // Listen for media events + + }, { + key: "media", + value: function media() { + var _this = this; + + var player = this.player; + var elements = player.elements; // Time change on media + + on.call(player, player.media, 'timeupdate seeking seeked', function (event) { + return controls.timeUpdate.call(player, event); + }); // Display duration + + on.call(player, player.media, 'durationchange loadeddata loadedmetadata', function (event) { + return controls.durationUpdate.call(player, event); + }); // Check for audio tracks on load + // We can't use `loadedmetadata` as it doesn't seem to have audio tracks at that point + + on.call(player, player.media, 'canplay loadeddata', function () { + toggleHidden(elements.volume, !player.hasAudio); + toggleHidden(elements.buttons.mute, !player.hasAudio); + }); // Handle the media finishing + + on.call(player, player.media, 'ended', function () { + // Show poster on end + if (player.isHTML5 && player.isVideo && player.config.resetOnEnd) { + // Restart + player.restart(); + } + }); // Check for buffer progress + + on.call(player, player.media, 'progress playing seeking seeked', function (event) { + return controls.updateProgress.call(player, event); + }); // Handle volume changes + + on.call(player, player.media, 'volumechange', function (event) { + return controls.updateVolume.call(player, event); + }); // Handle play/pause + + on.call(player, player.media, 'playing play pause ended emptied timeupdate', function (event) { + return ui.checkPlaying.call(player, event); + }); // Loading state + + on.call(player, player.media, 'waiting canplay seeked playing', function (event) { + return ui.checkLoading.call(player, event); + }); // Click video + + if (player.supported.ui && player.config.clickToPlay && !player.isAudio) { + // Re-fetch the wrapper + var wrapper = getElement.call(player, ".".concat(player.config.classNames.video)); // Bail if there's no wrapper (this should never happen) + + if (!is$1.element(wrapper)) { + return; + } // On click play, pause or restart + + + on.call(player, elements.container, 'click', function (event) { + var targets = [elements.container, wrapper]; // Ignore if click if not container or in video wrapper + + if (!targets.includes(event.target) && !wrapper.contains(event.target)) { + return; + } // Touch devices will just show controls (if hidden) + + + if (player.touch && player.config.hideControls) { + return; + } + + if (player.ended) { + _this.proxy(event, player.restart, 'restart'); + + _this.proxy(event, player.play, 'play'); + } else { + _this.proxy(event, player.togglePlay, 'play'); + } + }); + } // Disable right click + + + if (player.supported.ui && player.config.disableContextMenu) { + on.call(player, elements.wrapper, 'contextmenu', function (event) { + event.preventDefault(); + }, false); + } // Volume change + + + on.call(player, player.media, 'volumechange', function () { + // Save to storage + player.storage.set({ + volume: player.volume, + muted: player.muted + }); + }); // Speed change + + on.call(player, player.media, 'ratechange', function () { + // Update UI + controls.updateSetting.call(player, 'speed'); // Save to storage + + + player.storage.set({ + speed: player.speed + }); + }); // Quality change + + on.call(player, player.media, 'qualitychange', function (event) { + // Update UI + controls.updateSetting.call(player, 'quality', null, event.detail.quality); + }); // Update download link when ready and if quality changes + + on.call(player, player.media, 'ready qualitychange', function () { + controls.setDownloadLink.call(player); + }); // Proxy events to container + // Bubble up key events for Edge + + var proxyEvents = player.config.events.concat(['keyup', 'keydown']).join(' '); + on.call(player, player.media, proxyEvents, function (event) { + var _event$detail = event.detail, + detail = _event$detail === void 0 ? {} : _event$detail; // Get error details from media + + if (event.type === 'error') { + detail = player.media.error; + } + + triggerEvent.call(player, elements.container, event.type, true, detail); + }); + } // Run default and custom handlers + + }, { + key: "proxy", + value: function proxy(event, defaultHandler, customHandlerKey) { + var player = this.player; + var customHandler = player.config.listeners[customHandlerKey]; + var hasCustomHandler = is$1.function(customHandler); + var returned = true; // Execute custom handler + + if (hasCustomHandler) { + returned = customHandler.call(player, event); + } // Only call default handler if not prevented in custom handler + + + if (returned && is$1.function(defaultHandler)) { + defaultHandler.call(player, event); + } + } // Trigger custom and default handlers + + }, { + key: "bind", + value: function bind(element, type, defaultHandler, customHandlerKey) { + var _this2 = this; + + var passive = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : true; + var player = this.player; + var customHandler = player.config.listeners[customHandlerKey]; + var hasCustomHandler = is$1.function(customHandler); + on.call(player, element, type, function (event) { + return _this2.proxy(event, defaultHandler, customHandlerKey); + }, passive && !hasCustomHandler); + } // Listen for control events + + }, { + key: "controls", + value: function controls$1() { + var _this3 = this; + + var player = this.player; + var elements = player.elements; // IE doesn't support input event, so we fallback to change + + var inputEvent = browser.isIE ? 'change' : 'input'; // Play/pause toggle + + if (elements.buttons.play) { + Array.from(elements.buttons.play).forEach(function (button) { + _this3.bind(button, 'click', player.togglePlay, 'play'); + }); + } // Pause + + + this.bind(elements.buttons.restart, 'click', player.restart, 'restart'); // Rewind + + this.bind(elements.buttons.rewind, 'click', player.rewind, 'rewind'); // Rewind + + this.bind(elements.buttons.fastForward, 'click', player.forward, 'fastForward'); // Mute toggle + + this.bind(elements.buttons.mute, 'click', function () { + player.muted = !player.muted; + }, 'mute'); // Captions toggle + + this.bind(elements.buttons.captions, 'click', function () { + return player.toggleCaptions(); + }); // Download + + this.bind(elements.buttons.download, 'click', function () { + triggerEvent.call(player, player.media, 'download'); + }, 'download'); // Fullscreen toggle + + this.bind(elements.buttons.fullscreen, 'click', function () { + player.fullscreen.toggle(); + }, 'fullscreen'); // Picture-in-Picture + + this.bind(elements.buttons.pip, 'click', function () { + player.pip = 'toggle'; + }, 'pip'); // Airplay + + this.bind(elements.buttons.airplay, 'click', player.airplay, 'airplay'); // Settings menu - click toggle + + this.bind(elements.buttons.settings, 'click', function (event) { + // Prevent the document click listener closing the menu + event.stopPropagation(); + + controls.toggleMenu.call(player, event); + }); // Settings menu - keyboard toggle + // We have to bind to keyup otherwise Firefox triggers a click when a keydown event handler shifts focus + // https://bugzilla.mozilla.org/show_bug.cgi?id=1220143 + + this.bind(elements.buttons.settings, 'keyup', function (event) { + var code = event.which; // We only care about space and return + + if (![13, 32].includes(code)) { + return; + } // Because return triggers a click anyway, all we need to do is set focus + + + if (code === 13) { + controls.focusFirstMenuItem.call(player, null, true); + + return; + } // Prevent scroll + + + event.preventDefault(); // Prevent playing video (Firefox) + + event.stopPropagation(); // Toggle menu + + controls.toggleMenu.call(player, event); + }, null, false // Can't be passive as we're preventing default + ); // Escape closes menu + + this.bind(elements.settings.menu, 'keydown', function (event) { + if (event.which === 27) { + controls.toggleMenu.call(player, event); + } + }); // Set range input alternative "value", which matches the tooltip time (#954) + + this.bind(elements.inputs.seek, 'mousedown mousemove', function (event) { + var rect = elements.progress.getBoundingClientRect(); + var percent = 100 / rect.width * (event.pageX - rect.left); + event.currentTarget.setAttribute('seek-value', percent); + }); // Pause while seeking + + this.bind(elements.inputs.seek, 'mousedown mouseup keydown keyup touchstart touchend', function (event) { + var seek = event.currentTarget; + var code = event.keyCode ? event.keyCode : event.which; + var attribute = 'play-on-seeked'; + + if (is$1.keyboardEvent(event) && code !== 39 && code !== 37) { + return; + } // Record seek time so we can prevent hiding controls for a few seconds after seek + + + player.lastSeekTime = Date.now(); // Was playing before? + + var play = seek.hasAttribute(attribute); // Done seeking + + var done = ['mouseup', 'touchend', 'keyup'].includes(event.type); // If we're done seeking and it was playing, resume playback + + if (play && done) { + seek.removeAttribute(attribute); + player.play(); + } else if (!done && player.playing) { + seek.setAttribute(attribute, ''); + player.pause(); + } + }); // Fix range inputs on iOS + // Super weird iOS bug where after you interact with an <input type="range">, + // it takes over further interactions on the page. This is a hack + + if (browser.isIos) { + var inputs = getElements.call(player, 'input[type="range"]'); + Array.from(inputs).forEach(function (input) { + return _this3.bind(input, inputEvent, function (event) { + return repaint(event.target); + }); + }); + } // Seek + + + this.bind(elements.inputs.seek, inputEvent, function (event) { + var seek = event.currentTarget; // If it exists, use seek-value instead of "value" for consistency with tooltip time (#954) + + var seekTo = seek.getAttribute('seek-value'); + + if (is$1.empty(seekTo)) { + seekTo = seek.value; + } + + seek.removeAttribute('seek-value'); + player.currentTime = seekTo / seek.max * player.duration; + }, 'seek'); // Seek tooltip + + this.bind(elements.progress, 'mouseenter mouseleave mousemove', function (event) { + return controls.updateSeekTooltip.call(player, event); + }); // Preview thumbnails plugin + // TODO: Really need to work on some sort of plug-in wide event bus or pub-sub for this + + this.bind(elements.progress, 'mousemove touchmove', function (event) { + var previewThumbnails = player.previewThumbnails; + + if (previewThumbnails && previewThumbnails.loaded) { + previewThumbnails.startMove(event); + } + }); // Hide thumbnail preview - on mouse click, mouse leave, and video play/seek. All four are required, e.g., for buffering + + this.bind(elements.progress, 'mouseleave click', function () { + var previewThumbnails = player.previewThumbnails; + + if (previewThumbnails && previewThumbnails.loaded) { + previewThumbnails.endMove(false, true); + } + }); // Show scrubbing preview + + this.bind(elements.progress, 'mousedown touchstart', function (event) { + var previewThumbnails = player.previewThumbnails; + + if (previewThumbnails && previewThumbnails.loaded) { + previewThumbnails.startScrubbing(event); + } + }); + this.bind(elements.progress, 'mouseup touchend', function (event) { + var previewThumbnails = player.previewThumbnails; + + if (previewThumbnails && previewThumbnails.loaded) { + previewThumbnails.endScrubbing(event); + } + }); // Polyfill for lower fill in <input type="range"> for webkit + + if (browser.isWebkit) { + Array.from(getElements.call(player, 'input[type="range"]')).forEach(function (element) { + _this3.bind(element, 'input', function (event) { + return controls.updateRangeFill.call(player, event.target); + }); + }); + } // Current time invert + // Only if one time element is used for both currentTime and duration + + + if (player.config.toggleInvert && !is$1.element(elements.display.duration)) { + this.bind(elements.display.currentTime, 'click', function () { + // Do nothing if we're at the start + if (player.currentTime === 0) { + return; + } + + player.config.invertTime = !player.config.invertTime; + + controls.timeUpdate.call(player); + }); + } // Volume + + + this.bind(elements.inputs.volume, inputEvent, function (event) { + player.volume = event.target.value; + }, 'volume'); // Update controls.hover state (used for ui.toggleControls to avoid hiding when interacting) + + this.bind(elements.controls, 'mouseenter mouseleave', function (event) { + elements.controls.hover = !player.touch && event.type === 'mouseenter'; + }); // Update controls.pressed state (used for ui.toggleControls to avoid hiding when interacting) + + this.bind(elements.controls, 'mousedown mouseup touchstart touchend touchcancel', function (event) { + elements.controls.pressed = ['mousedown', 'touchstart'].includes(event.type); + }); // Show controls when they receive focus (e.g., when using keyboard tab key) + + this.bind(elements.controls, 'focusin', function () { + var config = player.config, + elements = player.elements, + timers = player.timers; // Skip transition to prevent focus from scrolling the parent element + + toggleClass(elements.controls, config.classNames.noTransition, true); // Toggle + + ui.toggleControls.call(player, true); // Restore transition + + setTimeout(function () { + toggleClass(elements.controls, config.classNames.noTransition, false); + }, 0); // Delay a little more for mouse users + + var delay = _this3.touch ? 3000 : 4000; // Clear timer + + clearTimeout(timers.controls); // Hide again after delay + + timers.controls = setTimeout(function () { + return ui.toggleControls.call(player, false); + }, delay); + }); // Mouse wheel for volume + + this.bind(elements.inputs.volume, 'wheel', function (event) { + // Detect "natural" scroll - suppored on OS X Safari only + // Other browsers on OS X will be inverted until support improves + var inverted = event.webkitDirectionInvertedFromDevice; // Get delta from event. Invert if `inverted` is true + + var _map = [event.deltaX, -event.deltaY].map(function (value) { + return inverted ? -value : value; + }), + _map2 = _slicedToArray(_map, 2), + x = _map2[0], + y = _map2[1]; // Using the biggest delta, normalize to 1 or -1 (or 0 if no delta) + + + var direction = Math.sign(Math.abs(x) > Math.abs(y) ? x : y); // Change the volume by 2% + + player.increaseVolume(direction / 50); // Don't break page scrolling at max and min + + var volume = player.media.volume; + + if (direction === 1 && volume < 1 || direction === -1 && volume > 0) { + event.preventDefault(); + } + }, 'volume', false); + } + }]); + + return Listeners; + }(); + + var loadjs_umd = createCommonjsModule(function (module, exports) { + (function (root, factory) { + { + module.exports = factory(); + } + })(commonjsGlobal, function () { + /** + * Global dependencies. + * @global {Object} document - DOM + */ + var devnull = function devnull() {}, + bundleIdCache = {}, + bundleResultCache = {}, + bundleCallbackQueue = {}; + /** + * Subscribe to bundle load event. + * @param {string[]} bundleIds - Bundle ids + * @param {Function} callbackFn - The callback function + */ + + + function subscribe(bundleIds, callbackFn) { + // listify + bundleIds = bundleIds.push ? bundleIds : [bundleIds]; + var depsNotFound = [], + i = bundleIds.length, + numWaiting = i, + fn, + bundleId, + r, + q; // define callback function + + fn = function fn(bundleId, pathsNotFound) { + if (pathsNotFound.length) depsNotFound.push(bundleId); + numWaiting--; + if (!numWaiting) callbackFn(depsNotFound); + }; // register callback + + + while (i--) { + bundleId = bundleIds[i]; // execute callback if in result cache + + r = bundleResultCache[bundleId]; + + if (r) { + fn(bundleId, r); + continue; + } // add to callback queue + + + q = bundleCallbackQueue[bundleId] = bundleCallbackQueue[bundleId] || []; + q.push(fn); + } + } + /** + * Publish bundle load event. + * @param {string} bundleId - Bundle id + * @param {string[]} pathsNotFound - List of files not found + */ + + + function publish(bundleId, pathsNotFound) { + // exit if id isn't defined + if (!bundleId) return; + var q = bundleCallbackQueue[bundleId]; // cache result + + bundleResultCache[bundleId] = pathsNotFound; // exit if queue is empty + + if (!q) return; // empty callback queue + + while (q.length) { + q[0](bundleId, pathsNotFound); + q.splice(0, 1); + } + } + /** + * Execute callbacks. + * @param {Object or Function} args - The callback args + * @param {string[]} depsNotFound - List of dependencies not found + */ + + + function executeCallbacks(args, depsNotFound) { + // accept function as argument + if (args.call) args = { + success: args + }; // success and error callbacks + + if (depsNotFound.length) (args.error || devnull)(depsNotFound);else (args.success || devnull)(args); + } + /** + * Load individual file. + * @param {string} path - The file path + * @param {Function} callbackFn - The callback function + */ + + + function loadFile(path, callbackFn, args, numTries) { + var doc = document, + async = args.async, + maxTries = (args.numRetries || 0) + 1, + beforeCallbackFn = args.before || devnull, + pathStripped = path.replace(/^(css|img)!/, ''), + isLegacyIECss, + e; + numTries = numTries || 0; + + if (/(^css!|\.css$)/.test(path)) { + // css + e = doc.createElement('link'); + e.rel = 'stylesheet'; + e.href = pathStripped; // tag IE9+ + + isLegacyIECss = 'hideFocus' in e; // use preload in IE Edge (to detect load errors) + + if (isLegacyIECss && e.relList) { + isLegacyIECss = 0; + e.rel = 'preload'; + e.as = 'style'; + } + } else if (/(^img!|\.(png|gif|jpg|svg)$)/.test(path)) { + // image + e = doc.createElement('img'); + e.src = pathStripped; + } else { + // javascript + e = doc.createElement('script'); + e.src = path; + e.async = async === undefined ? true : async; + } + + e.onload = e.onerror = e.onbeforeload = function (ev) { + var result = ev.type[0]; // treat empty stylesheets as failures to get around lack of onerror + // support in IE9-11 + + if (isLegacyIECss) { + try { + if (!e.sheet.cssText.length) result = 'e'; + } catch (x) { + // sheets objects created from load errors don't allow access to + // `cssText` (unless error is Code:18 SecurityError) + if (x.code != 18) result = 'e'; + } + } // handle retries in case of load failure + + + if (result == 'e') { + // increment counter + numTries += 1; // exit function and try again + + if (numTries < maxTries) { + return loadFile(path, callbackFn, args, numTries); + } + } else if (e.rel == 'preload' && e.as == 'style') { + // activate preloaded stylesheets + return e.rel = 'stylesheet'; // jshint ignore:line + } // execute callback + + + callbackFn(path, result, ev.defaultPrevented); + }; // add to document (unless callback returns `false`) + + + if (beforeCallbackFn(path, e) !== false) doc.head.appendChild(e); + } + /** + * Load multiple files. + * @param {string[]} paths - The file paths + * @param {Function} callbackFn - The callback function + */ + + + function loadFiles(paths, callbackFn, args) { + // listify paths + paths = paths.push ? paths : [paths]; + var numWaiting = paths.length, + x = numWaiting, + pathsNotFound = [], + fn, + i; // define callback function + + fn = function fn(path, result, defaultPrevented) { + // handle error + if (result == 'e') pathsNotFound.push(path); // handle beforeload event. If defaultPrevented then that means the load + // will be blocked (ex. Ghostery/ABP on Safari) + + if (result == 'b') { + if (defaultPrevented) pathsNotFound.push(path);else return; + } + + numWaiting--; + if (!numWaiting) callbackFn(pathsNotFound); + }; // load scripts + + + for (i = 0; i < x; i++) { + loadFile(paths[i], fn, args); + } + } + /** + * Initiate script load and register bundle. + * @param {(string|string[])} paths - The file paths + * @param {(string|Function)} [arg1] - The bundleId or success callback + * @param {Function} [arg2] - The success or error callback + * @param {Function} [arg3] - The error callback + */ + + + function loadjs(paths, arg1, arg2) { + var bundleId, args; // bundleId (if string) + + if (arg1 && arg1.trim) bundleId = arg1; // args (default is {}) + + args = (bundleId ? arg2 : arg1) || {}; // throw error if bundle is already defined + + if (bundleId) { + if (bundleId in bundleIdCache) { + throw "LoadJS"; + } else { + bundleIdCache[bundleId] = true; + } + } + + function loadFn(resolve, reject) { + loadFiles(paths, function (pathsNotFound) { + // execute callbacks + executeCallbacks(args, pathsNotFound); // resolve Promise + + if (resolve) { + executeCallbacks({ + success: resolve, + error: reject + }, pathsNotFound); + } // publish bundle load event + + + publish(bundleId, pathsNotFound); + }, args); + } + + if (args.returnPromise) return new Promise(loadFn);else loadFn(); + } + /** + * Execute callbacks when dependencies have been satisfied. + * @param {(string|string[])} deps - List of bundle ids + * @param {Object} args - success/error arguments + */ + + + loadjs.ready = function ready(deps, args) { + // subscribe to bundle load event + subscribe(deps, function (depsNotFound) { + // execute callbacks + executeCallbacks(args, depsNotFound); + }); + return loadjs; + }; + /** + * Manually satisfy bundle dependencies. + * @param {string} bundleId - The bundle id + */ + + + loadjs.done = function done(bundleId) { + publish(bundleId, []); + }; + /** + * Reset loadjs dependencies statuses + */ + + + loadjs.reset = function reset() { + bundleIdCache = {}; + bundleResultCache = {}; + bundleCallbackQueue = {}; + }; + /** + * Determine if bundle has already been defined + * @param String} bundleId - The bundle id + */ + + + loadjs.isDefined = function isDefined(bundleId) { + return bundleId in bundleIdCache; + }; // export + + + return loadjs; + }); + }); + + // ========================================================================== + function loadScript(url) { + return new Promise(function (resolve, reject) { + loadjs_umd(url, { + success: resolve, + error: reject + }); + }); + } + + function parseId(url) { + if (is$1.empty(url)) { + return null; + } + + if (is$1.number(Number(url))) { + return url; + } + + var regex = /^.*(vimeo.com\/|video\/)(\d+).*/; + return url.match(regex) ? RegExp.$2 : url; + } // Set playback state and trigger change (only on actual change) + + + function assurePlaybackState(play) { + if (play && !this.embed.hasPlayed) { + this.embed.hasPlayed = true; + } + + if (this.media.paused === play) { + this.media.paused = !play; + triggerEvent.call(this, this.media, play ? 'play' : 'pause'); + } + } + + var vimeo = { + setup: function setup() { + var _this = this; + + // Add embed class for responsive + toggleClass(this.elements.wrapper, this.config.classNames.embed, true); // Set intial ratio + + setAspectRatio.call(this); // Load the API if not already + + if (!is$1.object(window.Vimeo)) { + loadScript(this.config.urls.vimeo.sdk).then(function () { + vimeo.ready.call(_this); + }).catch(function (error) { + _this.debug.warn('Vimeo API failed to load', error); + }); + } else { + vimeo.ready.call(this); + } + }, + // API Ready + ready: function ready() { + var _this2 = this; + + var player = this; + var config = player.config.vimeo; // Get Vimeo params for the iframe + + var params = buildUrlParams(extend({}, { + loop: player.config.loop.active, + autoplay: player.autoplay, + muted: player.muted, + gesture: 'media', + playsinline: !this.config.fullscreen.iosNative + }, config)); // Get the source URL or ID + + var source = player.media.getAttribute('src'); // Get from <div> if needed + + if (is$1.empty(source)) { + source = player.media.getAttribute(player.config.attributes.embed.id); + } + + var id = parseId(source); // Build an iframe + + var iframe = createElement('iframe'); + var src = format(player.config.urls.vimeo.iframe, id, params); + iframe.setAttribute('src', src); + iframe.setAttribute('allowfullscreen', ''); + iframe.setAttribute('allowtransparency', ''); + iframe.setAttribute('allow', 'autoplay'); // Get poster, if already set + + var poster = player.poster; // Inject the package + + var wrapper = createElement('div', { + poster: poster, + class: player.config.classNames.embedContainer + }); + wrapper.appendChild(iframe); + player.media = replaceElement(wrapper, player.media); // Get poster image + + fetch(format(player.config.urls.vimeo.api, id), 'json').then(function (response) { + if (is$1.empty(response)) { + return; + } // Get the URL for thumbnail + + + var url = new URL(response[0].thumbnail_large); // Get original image + + url.pathname = "".concat(url.pathname.split('_')[0], ".jpg"); // Set and show poster + + ui.setPoster.call(player, url.href).catch(function () {}); + }); // Setup instance + // https://github.com/vimeo/player.js + + player.embed = new window.Vimeo.Player(iframe, { + autopause: player.config.autopause, + muted: player.muted + }); + player.media.paused = true; + player.media.currentTime = 0; // Disable native text track rendering + + if (player.supported.ui) { + player.embed.disableTextTrack(); + } // Create a faux HTML5 API using the Vimeo API + + + player.media.play = function () { + assurePlaybackState.call(player, true); + return player.embed.play(); + }; + + player.media.pause = function () { + assurePlaybackState.call(player, false); + return player.embed.pause(); + }; + + player.media.stop = function () { + player.pause(); + player.currentTime = 0; + }; // Seeking + + + var currentTime = player.media.currentTime; + Object.defineProperty(player.media, 'currentTime', { + get: function get() { + return currentTime; + }, + set: function set(time) { + // Vimeo will automatically play on seek if the video hasn't been played before + // Get current paused state and volume etc + var embed = player.embed, + media = player.media, + paused = player.paused, + volume = player.volume; + var restorePause = paused && !embed.hasPlayed; // Set seeking state and trigger event + + media.seeking = true; + triggerEvent.call(player, media, 'seeking'); // If paused, mute until seek is complete + + Promise.resolve(restorePause && embed.setVolume(0)) // Seek + .then(function () { + return embed.setCurrentTime(time); + }) // Restore paused + .then(function () { + return restorePause && embed.pause(); + }) // Restore volume + .then(function () { + return restorePause && embed.setVolume(volume); + }).catch(function () {// Do nothing + }); + } + }); // Playback speed + + var speed = player.config.speed.selected; + Object.defineProperty(player.media, 'playbackRate', { + get: function get() { + return speed; + }, + set: function set(input) { + player.embed.setPlaybackRate(input).then(function () { + speed = input; + triggerEvent.call(player, player.media, 'ratechange'); + }).catch(function (error) { + // Hide menu item (and menu if empty) + if (error.name === 'Error') { + controls.setSpeedMenu.call(player, []); + } + }); + } + }); // Volume + + var volume = player.config.volume; + Object.defineProperty(player.media, 'volume', { + get: function get() { + return volume; + }, + set: function set(input) { + player.embed.setVolume(input).then(function () { + volume = input; + triggerEvent.call(player, player.media, 'volumechange'); + }); + } + }); // Muted + + var muted = player.config.muted; + Object.defineProperty(player.media, 'muted', { + get: function get() { + return muted; + }, + set: function set(input) { + var toggle = is$1.boolean(input) ? input : false; + player.embed.setVolume(toggle ? 0 : player.config.volume).then(function () { + muted = toggle; + triggerEvent.call(player, player.media, 'volumechange'); + }); + } + }); // Loop + + var loop = player.config.loop; + Object.defineProperty(player.media, 'loop', { + get: function get() { + return loop; + }, + set: function set(input) { + var toggle = is$1.boolean(input) ? input : player.config.loop.active; + player.embed.setLoop(toggle).then(function () { + loop = toggle; + }); + } + }); // Source + + var currentSrc; + player.embed.getVideoUrl().then(function (value) { + currentSrc = value; + controls.setDownloadLink.call(player); + }).catch(function (error) { + _this2.debug.warn(error); + }); + Object.defineProperty(player.media, 'currentSrc', { + get: function get() { + return currentSrc; + } + }); // Ended + + Object.defineProperty(player.media, 'ended', { + get: function get() { + return player.currentTime === player.duration; + } + }); // Set aspect ratio based on video size + + Promise.all([player.embed.getVideoWidth(), player.embed.getVideoHeight()]).then(function (dimensions) { + var _dimensions = _slicedToArray(dimensions, 2), + width = _dimensions[0], + height = _dimensions[1]; + + player.embed.ratio = "".concat(width, ":").concat(height); + setAspectRatio.call(_this2, player.embed.ratio); + }); // Set autopause + + player.embed.setAutopause(player.config.autopause).then(function (state) { + player.config.autopause = state; + }); // Get title + + player.embed.getVideoTitle().then(function (title) { + player.config.title = title; + ui.setTitle.call(_this2); + }); // Get current time + + player.embed.getCurrentTime().then(function (value) { + currentTime = value; + triggerEvent.call(player, player.media, 'timeupdate'); + }); // Get duration + + player.embed.getDuration().then(function (value) { + player.media.duration = value; + triggerEvent.call(player, player.media, 'durationchange'); + }); // Get captions + + player.embed.getTextTracks().then(function (tracks) { + player.media.textTracks = tracks; + captions.setup.call(player); + }); + player.embed.on('cuechange', function (_ref) { + var _ref$cues = _ref.cues, + cues = _ref$cues === void 0 ? [] : _ref$cues; + var strippedCues = cues.map(function (cue) { + return stripHTML(cue.text); + }); + captions.updateCues.call(player, strippedCues); + }); + player.embed.on('loaded', function () { + // Assure state and events are updated on autoplay + player.embed.getPaused().then(function (paused) { + assurePlaybackState.call(player, !paused); + + if (!paused) { + triggerEvent.call(player, player.media, 'playing'); + } + }); + + if (is$1.element(player.embed.element) && player.supported.ui) { + var frame = player.embed.element; // Fix keyboard focus issues + // https://github.com/sampotts/plyr/issues/317 + + frame.setAttribute('tabindex', -1); + } + }); + player.embed.on('play', function () { + assurePlaybackState.call(player, true); + triggerEvent.call(player, player.media, 'playing'); + }); + player.embed.on('pause', function () { + assurePlaybackState.call(player, false); + }); + player.embed.on('timeupdate', function (data) { + player.media.seeking = false; + currentTime = data.seconds; + triggerEvent.call(player, player.media, 'timeupdate'); + }); + player.embed.on('progress', function (data) { + player.media.buffered = data.percent; + triggerEvent.call(player, player.media, 'progress'); // Check all loaded + + if (parseInt(data.percent, 10) === 1) { + triggerEvent.call(player, player.media, 'canplaythrough'); + } // Get duration as if we do it before load, it gives an incorrect value + // https://github.com/sampotts/plyr/issues/891 + + + player.embed.getDuration().then(function (value) { + if (value !== player.media.duration) { + player.media.duration = value; + triggerEvent.call(player, player.media, 'durationchange'); + } + }); + }); + player.embed.on('seeked', function () { + player.media.seeking = false; + triggerEvent.call(player, player.media, 'seeked'); + }); + player.embed.on('ended', function () { + player.media.paused = true; + triggerEvent.call(player, player.media, 'ended'); + }); + player.embed.on('error', function (detail) { + player.media.error = detail; + triggerEvent.call(player, player.media, 'error'); + }); // Rebuild UI + + setTimeout(function () { + return ui.build.call(player); + }, 0); + } + }; + + // ========================================================================== + + function parseId$1(url) { + if (is$1.empty(url)) { + return null; + } + + var regex = /^.*(youtu.be\/|v\/|u\/\w\/|embed\/|watch\?v=|&v=)([^#&?]*).*/; + return url.match(regex) ? RegExp.$2 : url; + } // Set playback state and trigger change (only on actual change) + + + function assurePlaybackState$1(play) { + if (play && !this.embed.hasPlayed) { + this.embed.hasPlayed = true; + } + + if (this.media.paused === play) { + this.media.paused = !play; + triggerEvent.call(this, this.media, play ? 'play' : 'pause'); + } + } + + var youtube = { + setup: function setup() { + var _this = this; + + // Add embed class for responsive + toggleClass(this.elements.wrapper, this.config.classNames.embed, true); // Set aspect ratio + + setAspectRatio.call(this); // Setup API + + if (is$1.object(window.YT) && is$1.function(window.YT.Player)) { + youtube.ready.call(this); + } else { + // Load the API + loadScript(this.config.urls.youtube.sdk).catch(function (error) { + _this.debug.warn('YouTube API failed to load', error); + }); // Setup callback for the API + // YouTube has it's own system of course... + + window.onYouTubeReadyCallbacks = window.onYouTubeReadyCallbacks || []; // Add to queue + + window.onYouTubeReadyCallbacks.push(function () { + youtube.ready.call(_this); + }); // Set callback to process queue + + window.onYouTubeIframeAPIReady = function () { + window.onYouTubeReadyCallbacks.forEach(function (callback) { + callback(); + }); + }; + } + }, + // Get the media title + getTitle: function getTitle(videoId) { + var _this2 = this; + + // Try via undocumented API method first + // This method disappears now and then though... + // https://github.com/sampotts/plyr/issues/709 + if (is$1.function(this.embed.getVideoData)) { + var _this$embed$getVideoD = this.embed.getVideoData(), + title = _this$embed$getVideoD.title; + + if (is$1.empty(title)) { + this.config.title = title; + ui.setTitle.call(this); + return; + } + } // Or via Google API + + + var key = this.config.keys.google; + + if (is$1.string(key) && !is$1.empty(key)) { + var url = format(this.config.urls.youtube.api, videoId, key); + fetch(url).then(function (result) { + if (is$1.object(result)) { + _this2.config.title = result.items[0].snippet.title; + ui.setTitle.call(_this2); + } + }).catch(function () {}); + } + }, + // API ready + ready: function ready() { + var player = this; // Ignore already setup (race condition) + + var currentId = player.media.getAttribute('id'); + + if (!is$1.empty(currentId) && currentId.startsWith('youtube-')) { + return; + } // Get the source URL or ID + + + var source = player.media.getAttribute('src'); // Get from <div> if needed + + if (is$1.empty(source)) { + source = player.media.getAttribute(this.config.attributes.embed.id); + } // Replace the <iframe> with a <div> due to YouTube API issues + + + var videoId = parseId$1(source); + var id = generateId(player.provider); // Get poster, if already set + + var poster = player.poster; // Replace media element + + var container = createElement('div', { + id: id, + poster: poster + }); + player.media = replaceElement(container, player.media); // Id to poster wrapper + + var posterSrc = function posterSrc(format) { + return "https://i.ytimg.com/vi/".concat(videoId, "/").concat(format, "default.jpg"); + }; // Check thumbnail images in order of quality, but reject fallback thumbnails (120px wide) + + + loadImage(posterSrc('maxres'), 121) // Higest quality and unpadded + .catch(function () { + return loadImage(posterSrc('sd'), 121); + }) // 480p padded 4:3 + .catch(function () { + return loadImage(posterSrc('hq')); + }) // 360p padded 4:3. Always exists + .then(function (image) { + return ui.setPoster.call(player, image.src); + }).then(function (posterSrc) { + // If the image is padded, use background-size "cover" instead (like youtube does too with their posters) + if (!posterSrc.includes('maxres')) { + player.elements.poster.style.backgroundSize = 'cover'; + } + }).catch(function () {}); + var config = player.config.youtube; // Setup instance + // https://developers.google.com/youtube/iframe_api_reference + + player.embed = new window.YT.Player(id, { + videoId: videoId, + host: config.noCookie ? 'https://www.youtube-nocookie.com' : undefined, + playerVars: extend({}, { + autoplay: player.config.autoplay ? 1 : 0, + // Autoplay + hl: player.config.hl, + // iframe interface language + controls: player.supported.ui ? 0 : 1, + // Only show controls if not fully supported + disablekb: 1, + // Disable keyboard as we handle it + playsinline: !player.config.fullscreen.iosNative ? 1 : 0, + // Allow iOS inline playback + // Captions are flaky on YouTube + cc_load_policy: player.captions.active ? 1 : 0, + cc_lang_pref: player.config.captions.language, + // Tracking for stats + widget_referrer: window ? window.location.href : null + }, config), + events: { + onError: function onError(event) { + // YouTube may fire onError twice, so only handle it once + if (!player.media.error) { + var code = event.data; // Messages copied from https://developers.google.com/youtube/iframe_api_reference#onError + + var message = { + 2: 'The request contains an invalid parameter value. For example, this error occurs if you specify a video ID that does not have 11 characters, or if the video ID contains invalid characters, such as exclamation points or asterisks.', + 5: 'The requested content cannot be played in an HTML5 player or another error related to the HTML5 player has occurred.', + 100: 'The video requested was not found. This error occurs when a video has been removed (for any reason) or has been marked as private.', + 101: 'The owner of the requested video does not allow it to be played in embedded players.', + 150: 'The owner of the requested video does not allow it to be played in embedded players.' + }[code] || 'An unknown error occured'; + player.media.error = { + code: code, + message: message + }; + triggerEvent.call(player, player.media, 'error'); + } + }, + onPlaybackRateChange: function onPlaybackRateChange(event) { + // Get the instance + var instance = event.target; // Get current speed + + player.media.playbackRate = instance.getPlaybackRate(); + triggerEvent.call(player, player.media, 'ratechange'); + }, + onReady: function onReady(event) { + // Bail if onReady has already been called. See issue #1108 + if (is$1.function(player.media.play)) { + return; + } // Get the instance + + + var instance = event.target; // Get the title + + youtube.getTitle.call(player, videoId); // Create a faux HTML5 API using the YouTube API + + player.media.play = function () { + assurePlaybackState$1.call(player, true); + instance.playVideo(); + }; + + player.media.pause = function () { + assurePlaybackState$1.call(player, false); + instance.pauseVideo(); + }; + + player.media.stop = function () { + instance.stopVideo(); + }; + + player.media.duration = instance.getDuration(); + player.media.paused = true; // Seeking + + player.media.currentTime = 0; + Object.defineProperty(player.media, 'currentTime', { + get: function get() { + return Number(instance.getCurrentTime()); + }, + set: function set(time) { + // If paused and never played, mute audio preventively (YouTube starts playing on seek if the video hasn't been played yet). + if (player.paused && !player.embed.hasPlayed) { + player.embed.mute(); + } // Set seeking state and trigger event + + + player.media.seeking = true; + triggerEvent.call(player, player.media, 'seeking'); // Seek after events sent + + instance.seekTo(time); + } + }); // Playback speed + + Object.defineProperty(player.media, 'playbackRate', { + get: function get() { + return instance.getPlaybackRate(); + }, + set: function set(input) { + instance.setPlaybackRate(input); + } + }); // Volume + + var volume = player.config.volume; + Object.defineProperty(player.media, 'volume', { + get: function get() { + return volume; + }, + set: function set(input) { + volume = input; + instance.setVolume(volume * 100); + triggerEvent.call(player, player.media, 'volumechange'); + } + }); // Muted + + var muted = player.config.muted; + Object.defineProperty(player.media, 'muted', { + get: function get() { + return muted; + }, + set: function set(input) { + var toggle = is$1.boolean(input) ? input : muted; + muted = toggle; + instance[toggle ? 'mute' : 'unMute'](); + triggerEvent.call(player, player.media, 'volumechange'); + } + }); // Source + + Object.defineProperty(player.media, 'currentSrc', { + get: function get() { + return instance.getVideoUrl(); + } + }); // Ended + + Object.defineProperty(player.media, 'ended', { + get: function get() { + return player.currentTime === player.duration; + } + }); // Get available speeds + + player.options.speed = instance.getAvailablePlaybackRates(); // Set the tabindex to avoid focus entering iframe + + if (player.supported.ui) { + player.media.setAttribute('tabindex', -1); + } + + triggerEvent.call(player, player.media, 'timeupdate'); + triggerEvent.call(player, player.media, 'durationchange'); // Reset timer + + clearInterval(player.timers.buffering); // Setup buffering + + player.timers.buffering = setInterval(function () { + // Get loaded % from YouTube + player.media.buffered = instance.getVideoLoadedFraction(); // Trigger progress only when we actually buffer something + + if (player.media.lastBuffered === null || player.media.lastBuffered < player.media.buffered) { + triggerEvent.call(player, player.media, 'progress'); + } // Set last buffer point + + + player.media.lastBuffered = player.media.buffered; // Bail if we're at 100% + + if (player.media.buffered === 1) { + clearInterval(player.timers.buffering); // Trigger event + + triggerEvent.call(player, player.media, 'canplaythrough'); + } + }, 200); // Rebuild UI + + setTimeout(function () { + return ui.build.call(player); + }, 50); + }, + onStateChange: function onStateChange(event) { + // Get the instance + var instance = event.target; // Reset timer + + clearInterval(player.timers.playing); + var seeked = player.media.seeking && [1, 2].includes(event.data); + + if (seeked) { + // Unset seeking and fire seeked event + player.media.seeking = false; + triggerEvent.call(player, player.media, 'seeked'); + } // Handle events + // -1 Unstarted + // 0 Ended + // 1 Playing + // 2 Paused + // 3 Buffering + // 5 Video cued + + + switch (event.data) { + case -1: + // Update scrubber + triggerEvent.call(player, player.media, 'timeupdate'); // Get loaded % from YouTube + + player.media.buffered = instance.getVideoLoadedFraction(); + triggerEvent.call(player, player.media, 'progress'); + break; + + case 0: + assurePlaybackState$1.call(player, false); // YouTube doesn't support loop for a single video, so mimick it. + + if (player.media.loop) { + // YouTube needs a call to `stopVideo` before playing again + instance.stopVideo(); + instance.playVideo(); + } else { + triggerEvent.call(player, player.media, 'ended'); + } + + break; + + case 1: + // Restore paused state (YouTube starts playing on seek if the video hasn't been played yet) + if (player.media.paused && !player.embed.hasPlayed) { + player.media.pause(); + } else { + assurePlaybackState$1.call(player, true); + triggerEvent.call(player, player.media, 'playing'); // Poll to get playback progress + + player.timers.playing = setInterval(function () { + triggerEvent.call(player, player.media, 'timeupdate'); + }, 50); // Check duration again due to YouTube bug + // https://github.com/sampotts/plyr/issues/374 + // https://code.google.com/p/gdata-issues/issues/detail?id=8690 + + if (player.media.duration !== instance.getDuration()) { + player.media.duration = instance.getDuration(); + triggerEvent.call(player, player.media, 'durationchange'); + } + } + + break; + + case 2: + // Restore audio (YouTube starts playing on seek if the video hasn't been played yet) + if (!player.muted) { + player.embed.unMute(); + } + + assurePlaybackState$1.call(player, false); + break; + + default: + break; + } + + triggerEvent.call(player, player.elements.container, 'statechange', false, { + code: event.data + }); + } + } + }); + } + }; + + // ========================================================================== + var media = { + // Setup media + setup: function setup() { + // If there's no media, bail + if (!this.media) { + this.debug.warn('No media element found!'); + return; + } // Add type class + + + toggleClass(this.elements.container, this.config.classNames.type.replace('{0}', this.type), true); // Add provider class + + toggleClass(this.elements.container, this.config.classNames.provider.replace('{0}', this.provider), true); // Add video class for embeds + // This will require changes if audio embeds are added + + if (this.isEmbed) { + toggleClass(this.elements.container, this.config.classNames.type.replace('{0}', 'video'), true); + } // Inject the player wrapper + + + if (this.isVideo) { + // Create the wrapper div + this.elements.wrapper = createElement('div', { + class: this.config.classNames.video + }); // Wrap the video in a container + + wrap(this.media, this.elements.wrapper); // Faux poster container + + this.elements.poster = createElement('div', { + class: this.config.classNames.poster + }); + this.elements.wrapper.appendChild(this.elements.poster); + } + + if (this.isHTML5) { + html5.extend.call(this); + } else if (this.isYouTube) { + youtube.setup.call(this); + } else if (this.isVimeo) { + vimeo.setup.call(this); + } + } + }; + + var Ads = + /*#__PURE__*/ + function () { + /** + * Ads constructor. + * @param {Object} player + * @return {Ads} + */ + function Ads(player) { + var _this = this; + + _classCallCheck(this, Ads); + + this.player = player; + this.config = player.config.ads; + this.playing = false; + this.initialized = false; + this.elements = { + container: null, + displayContainer: null + }; + this.manager = null; + this.loader = null; + this.cuePoints = null; + this.events = {}; + this.safetyTimer = null; + this.countdownTimer = null; // Setup a promise to resolve when the IMA manager is ready + + this.managerPromise = new Promise(function (resolve, reject) { + // The ad is loaded and ready + _this.on('loaded', resolve); // Ads failed + + + _this.on('error', reject); + }); + this.load(); + } + + _createClass(Ads, [{ + key: "load", + + /** + * Load the IMA SDK + */ + value: function load() { + var _this2 = this; + + if (this.enabled) { + // Check if the Google IMA3 SDK is loaded or load it ourselves + if (!is$1.object(window.google) || !is$1.object(window.google.ima)) { + loadScript(this.player.config.urls.googleIMA.sdk).then(function () { + _this2.ready(); + }).catch(function () { + // Script failed to load or is blocked + _this2.trigger('error', new Error('Google IMA SDK failed to load')); + }); + } else { + this.ready(); + } + } + } + /** + * Get the ads instance ready + */ + + }, { + key: "ready", + value: function ready() { + var _this3 = this; + + // Start ticking our safety timer. If the whole advertisement + // thing doesn't resolve within our set time; we bail + this.startSafetyTimer(12000, 'ready()'); // Clear the safety timer + + this.managerPromise.then(function () { + _this3.clearSafetyTimer('onAdsManagerLoaded()'); + }); // Set listeners on the Plyr instance + + this.listeners(); // Setup the IMA SDK + + this.setupIMA(); + } // Build the tag URL + + }, { + key: "setupIMA", + + /** + * In order for the SDK to display ads for our video, we need to tell it where to put them, + * so here we define our ad container. This div is set up to render on top of the video player. + * Using the code below, we tell the SDK to render ads within that div. We also provide a + * handle to the content video player - the SDK will poll the current time of our player to + * properly place mid-rolls. After we create the ad display container, we initialize it. On + * mobile devices, this initialization is done as the result of a user action. + */ + value: function setupIMA() { + // Create the container for our advertisements + this.elements.container = createElement('div', { + class: this.player.config.classNames.ads + }); + this.player.elements.container.appendChild(this.elements.container); // So we can run VPAID2 + + google.ima.settings.setVpaidMode(google.ima.ImaSdkSettings.VpaidMode.ENABLED); // Set language + + google.ima.settings.setLocale(this.player.config.ads.language); // Set playback for iOS10+ + + google.ima.settings.setDisableCustomPlaybackForIOS10Plus(this.player.config.playsinline); // We assume the adContainer is the video container of the plyr element that will house the ads + + this.elements.displayContainer = new google.ima.AdDisplayContainer(this.elements.container, this.player.media); // Request video ads to be pre-loaded + + this.requestAds(); + } + /** + * Request advertisements + */ + + }, { + key: "requestAds", + value: function requestAds() { + var _this4 = this; + + var container = this.player.elements.container; + + try { + // Create ads loader + this.loader = new google.ima.AdsLoader(this.elements.displayContainer); // Listen and respond to ads loaded and error events + + this.loader.addEventListener(google.ima.AdsManagerLoadedEvent.Type.ADS_MANAGER_LOADED, function (event) { + return _this4.onAdsManagerLoaded(event); + }, false); + this.loader.addEventListener(google.ima.AdErrorEvent.Type.AD_ERROR, function (error) { + return _this4.onAdError(error); + }, false); // Request video ads + + var request = new google.ima.AdsRequest(); + request.adTagUrl = this.tagUrl; // Specify the linear and nonlinear slot sizes. This helps the SDK + // to select the correct creative if multiple are returned + + request.linearAdSlotWidth = container.offsetWidth; + request.linearAdSlotHeight = container.offsetHeight; + request.nonLinearAdSlotWidth = container.offsetWidth; + request.nonLinearAdSlotHeight = container.offsetHeight; // We only overlay ads as we only support video. + + request.forceNonLinearFullSlot = false; // Mute based on current state + + request.setAdWillPlayMuted(!this.player.muted); + this.loader.requestAds(request); + } catch (e) { + this.onAdError(e); + } + } + /** + * Update the ad countdown + * @param {Boolean} start + */ + + }, { + key: "pollCountdown", + value: function pollCountdown() { + var _this5 = this; + + var start = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + + if (!start) { + clearInterval(this.countdownTimer); + this.elements.container.removeAttribute('data-badge-text'); + return; + } + + var update = function update() { + var time = formatTime(Math.max(_this5.manager.getRemainingTime(), 0)); + var label = "".concat(i18n.get('advertisement', _this5.player.config), " - ").concat(time); + + _this5.elements.container.setAttribute('data-badge-text', label); + }; + + this.countdownTimer = setInterval(update, 100); + } + /** + * This method is called whenever the ads are ready inside the AdDisplayContainer + * @param {Event} adsManagerLoadedEvent + */ + + }, { + key: "onAdsManagerLoaded", + value: function onAdsManagerLoaded(event) { + var _this6 = this; + + // Load could occur after a source change (race condition) + if (!this.enabled) { + return; + } // Get the ads manager + + + var settings = new google.ima.AdsRenderingSettings(); // Tell the SDK to save and restore content video state on our behalf + + settings.restoreCustomPlaybackStateOnAdBreakComplete = true; + settings.enablePreloading = true; // The SDK is polling currentTime on the contentPlayback. And needs a duration + // so it can determine when to start the mid- and post-roll + + this.manager = event.getAdsManager(this.player, settings); // Get the cue points for any mid-rolls by filtering out the pre- and post-roll + + this.cuePoints = this.manager.getCuePoints(); // Set volume to match player + + this.manager.setVolume(this.player.volume); // Add listeners to the required events + // Advertisement error events + + this.manager.addEventListener(google.ima.AdErrorEvent.Type.AD_ERROR, function (error) { + return _this6.onAdError(error); + }); // Advertisement regular events + + Object.keys(google.ima.AdEvent.Type).forEach(function (type) { + _this6.manager.addEventListener(google.ima.AdEvent.Type[type], function (event) { + return _this6.onAdEvent(event); + }); + }); // Resolve our adsManager + + this.trigger('loaded'); + } + }, { + key: "addCuePoints", + value: function addCuePoints() { + var _this7 = this; + + // Add advertisement cue's within the time line if available + if (!is$1.empty(this.cuePoints)) { + this.cuePoints.forEach(function (cuePoint) { + if (cuePoint !== 0 && cuePoint !== -1 && cuePoint < _this7.player.duration) { + var seekElement = _this7.player.elements.progress; + + if (is$1.element(seekElement)) { + var cuePercentage = 100 / _this7.player.duration * cuePoint; + var cue = createElement('span', { + class: _this7.player.config.classNames.cues + }); + cue.style.left = "".concat(cuePercentage.toString(), "%"); + seekElement.appendChild(cue); + } + } + }); + } + } + /** + * This is where all the event handling takes place. Retrieve the ad from the event. Some + * events (e.g. ALL_ADS_COMPLETED) don't have the ad object associated + * https://developers.google.com/interactive-media-ads/docs/sdks/html5/v3/apis#ima.AdEvent.Type + * @param {Event} event + */ + + }, { + key: "onAdEvent", + value: function onAdEvent(event) { + var _this8 = this; + + var container = this.player.elements.container; // Retrieve the ad from the event. Some events (e.g. ALL_ADS_COMPLETED) + // don't have ad object associated + + var ad = event.getAd(); + var adData = event.getAdData(); // Proxy event + + var dispatchEvent = function dispatchEvent(type) { + var event = "ads".concat(type.replace(/_/g, '').toLowerCase()); + triggerEvent.call(_this8.player, _this8.player.media, event); + }; + + switch (event.type) { + case google.ima.AdEvent.Type.LOADED: + // This is the first event sent for an ad - it is possible to determine whether the + // ad is a video ad or an overlay + this.trigger('loaded'); // Bubble event + + dispatchEvent(event.type); // Start countdown + + this.pollCountdown(true); + + if (!ad.isLinear()) { + // Position AdDisplayContainer correctly for overlay + ad.width = container.offsetWidth; + ad.height = container.offsetHeight; + } // console.info('Ad type: ' + event.getAd().getAdPodInfo().getPodIndex()); + // console.info('Ad time: ' + event.getAd().getAdPodInfo().getTimeOffset()); + + + break; + + case google.ima.AdEvent.Type.ALL_ADS_COMPLETED: + // All ads for the current videos are done. We can now request new advertisements + // in case the video is re-played + // Fire event + dispatchEvent(event.type); // TODO: Example for what happens when a next video in a playlist would be loaded. + // So here we load a new video when all ads are done. + // Then we load new ads within a new adsManager. When the video + // Is started - after - the ads are loaded, then we get ads. + // You can also easily test cancelling and reloading by running + // player.ads.cancel() and player.ads.play from the console I guess. + // this.player.source = { + // type: 'video', + // title: 'View From A Blue Moon', + // sources: [{ + // src: + // 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.mp4', type: + // 'video/mp4', }], poster: + // 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.jpg', tracks: + // [ { kind: 'captions', label: 'English', srclang: 'en', src: + // 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.en.vtt', + // default: true, }, { kind: 'captions', label: 'French', srclang: 'fr', src: + // 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.fr.vtt', }, ], + // }; + // TODO: So there is still this thing where a video should only be allowed to start + // playing when the IMA SDK is ready or has failed + + this.loadAds(); + break; + + case google.ima.AdEvent.Type.CONTENT_PAUSE_REQUESTED: + // This event indicates the ad has started - the video player can adjust the UI, + // for example display a pause button and remaining time. Fired when content should + // be paused. This usually happens right before an ad is about to cover the content + dispatchEvent(event.type); + this.pauseContent(); + break; + + case google.ima.AdEvent.Type.CONTENT_RESUME_REQUESTED: + // This event indicates the ad has finished - the video player can perform + // appropriate UI actions, such as removing the timer for remaining time detection. + // Fired when content should be resumed. This usually happens when an ad finishes + // or collapses + dispatchEvent(event.type); + this.pollCountdown(); + this.resumeContent(); + break; + + case google.ima.AdEvent.Type.STARTED: + case google.ima.AdEvent.Type.MIDPOINT: + case google.ima.AdEvent.Type.COMPLETE: + case google.ima.AdEvent.Type.IMPRESSION: + case google.ima.AdEvent.Type.CLICK: + dispatchEvent(event.type); + break; + + case google.ima.AdEvent.Type.LOG: + if (adData.adError) { + this.player.debug.warn("Non-fatal ad error: ".concat(adData.adError.getMessage())); + } + + break; + + default: + break; + } + } + /** + * Any ad error handling comes through here + * @param {Event} event + */ + + }, { + key: "onAdError", + value: function onAdError(event) { + this.cancel(); + this.player.debug.warn('Ads error', event); + } + /** + * Setup hooks for Plyr and window events. This ensures + * the mid- and post-roll launch at the correct time. And + * resize the advertisement when the player resizes + */ + + }, { + key: "listeners", + value: function listeners() { + var _this9 = this; + + var container = this.player.elements.container; + var time; + this.player.on('canplay', function () { + _this9.addCuePoints(); + }); + this.player.on('ended', function () { + _this9.loader.contentComplete(); + }); + this.player.on('timeupdate', function () { + time = _this9.player.currentTime; + }); + this.player.on('seeked', function () { + var seekedTime = _this9.player.currentTime; + + if (is$1.empty(_this9.cuePoints)) { + return; + } + + _this9.cuePoints.forEach(function (cuePoint, index) { + if (time < cuePoint && cuePoint < seekedTime) { + _this9.manager.discardAdBreak(); + + _this9.cuePoints.splice(index, 1); + } + }); + }); // Listen to the resizing of the window. And resize ad accordingly + // TODO: eventually implement ResizeObserver + + window.addEventListener('resize', function () { + if (_this9.manager) { + _this9.manager.resize(container.offsetWidth, container.offsetHeight, google.ima.ViewMode.NORMAL); + } + }); + } + /** + * Initialize the adsManager and start playing advertisements + */ + + }, { + key: "play", + value: function play() { + var _this10 = this; + + var container = this.player.elements.container; + + if (!this.managerPromise) { + this.resumeContent(); + } // Play the requested advertisement whenever the adsManager is ready + + + this.managerPromise.then(function () { + // Initialize the container. Must be done via a user action on mobile devices + _this10.elements.displayContainer.initialize(); + + try { + if (!_this10.initialized) { + // Initialize the ads manager. Ad rules playlist will start at this time + _this10.manager.init(container.offsetWidth, container.offsetHeight, google.ima.ViewMode.NORMAL); // Call play to start showing the ad. Single video and overlay ads will + // start at this time; the call will be ignored for ad rules + + + _this10.manager.start(); + } + + _this10.initialized = true; + } catch (adError) { + // An error may be thrown if there was a problem with the + // VAST response + _this10.onAdError(adError); + } + }).catch(function () {}); + } + /** + * Resume our video + */ + + }, { + key: "resumeContent", + value: function resumeContent() { + // Hide the advertisement container + this.elements.container.style.zIndex = ''; // Ad is stopped + + this.playing = false; // Play video + + this.player.media.play(); + } + /** + * Pause our video + */ + + }, { + key: "pauseContent", + value: function pauseContent() { + // Show the advertisement container + this.elements.container.style.zIndex = 3; // Ad is playing + + this.playing = true; // Pause our video. + + this.player.media.pause(); + } + /** + * Destroy the adsManager so we can grab new ads after this. If we don't then we're not + * allowed to call new ads based on google policies, as they interpret this as an accidental + * video requests. https://developers.google.com/interactive- + * media-ads/docs/sdks/android/faq#8 + */ + + }, { + key: "cancel", + value: function cancel() { + // Pause our video + if (this.initialized) { + this.resumeContent(); + } // Tell our instance that we're done for now + + + this.trigger('error'); // Re-create our adsManager + + this.loadAds(); + } + /** + * Re-create our adsManager + */ + + }, { + key: "loadAds", + value: function loadAds() { + var _this11 = this; + + // Tell our adsManager to go bye bye + this.managerPromise.then(function () { + // Destroy our adsManager + if (_this11.manager) { + _this11.manager.destroy(); + } // Re-set our adsManager promises + + + _this11.managerPromise = new Promise(function (resolve) { + _this11.on('loaded', resolve); + + _this11.player.debug.log(_this11.manager); + }); // Now request some new advertisements + + _this11.requestAds(); + }).catch(function () {}); + } + /** + * Handles callbacks after an ad event was invoked + * @param {String} event - Event type + */ + + }, { + key: "trigger", + value: function trigger(event) { + var _this12 = this; + + for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) { + args[_key - 1] = arguments[_key]; + } + + var handlers = this.events[event]; + + if (is$1.array(handlers)) { + handlers.forEach(function (handler) { + if (is$1.function(handler)) { + handler.apply(_this12, args); + } + }); + } + } + /** + * Add event listeners + * @param {String} event - Event type + * @param {Function} callback - Callback for when event occurs + * @return {Ads} + */ + + }, { + key: "on", + value: function on(event, callback) { + if (!is$1.array(this.events[event])) { + this.events[event] = []; + } + + this.events[event].push(callback); + return this; + } + /** + * Setup a safety timer for when the ad network doesn't respond for whatever reason. + * The advertisement has 12 seconds to get its things together. We stop this timer when the + * advertisement is playing, or when a user action is required to start, then we clear the + * timer on ad ready + * @param {Number} time + * @param {String} from + */ + + }, { + key: "startSafetyTimer", + value: function startSafetyTimer(time, from) { + var _this13 = this; + + this.player.debug.log("Safety timer invoked from: ".concat(from)); + this.safetyTimer = setTimeout(function () { + _this13.cancel(); + + _this13.clearSafetyTimer('startSafetyTimer()'); + }, time); + } + /** + * Clear our safety timer(s) + * @param {String} from + */ + + }, { + key: "clearSafetyTimer", + value: function clearSafetyTimer(from) { + if (!is$1.nullOrUndefined(this.safetyTimer)) { + this.player.debug.log("Safety timer cleared from: ".concat(from)); + clearTimeout(this.safetyTimer); + this.safetyTimer = null; + } + } + }, { + key: "enabled", + get: function get() { + var config = this.config; + return this.player.isHTML5 && this.player.isVideo && config.enabled && (!is$1.empty(config.publisherId) || is$1.url(config.tagUrl)); + } + }, { + key: "tagUrl", + get: function get() { + var config = this.config; + + if (is$1.url(config.tagUrl)) { + return config.tagUrl; + } + + var params = { + AV_PUBLISHERID: '58c25bb0073ef448b1087ad6', + AV_CHANNELID: '5a0458dc28a06145e4519d21', + AV_URL: window.location.hostname, + cb: Date.now(), + AV_WIDTH: 640, + AV_HEIGHT: 480, + AV_CDIM2: this.publisherId + }; + var base = 'https://go.aniview.com/api/adserver6/vast/'; + return "".concat(base, "?").concat(buildUrlParams(params)); + } + }]); + + return Ads; + }(); + + var parseVtt = function parseVtt(vttDataString) { + var processedList = []; + var frames = vttDataString.split(/\r\n\r\n|\n\n|\r\r/); + frames.forEach(function (frame) { + var result = {}; + var lines = frame.split(/\r\n|\n|\r/); + lines.forEach(function (line) { + if (!is$1.number(result.startTime)) { + // The line with start and end times on it is the first line of interest + var matchTimes = line.match(/([0-9]{2}):([0-9]{2}):([0-9]{2}).([0-9]{2,3})( ?--> ?)([0-9]{2}):([0-9]{2}):([0-9]{2}).([0-9]{2,3})/); // Note that this currently ignores caption formatting directives that are optionally on the end of this line - fine for non-captions VTT + + if (matchTimes) { + result.startTime = Number(matchTimes[1]) * 60 * 60 + Number(matchTimes[2]) * 60 + Number(matchTimes[3]) + Number("0.".concat(matchTimes[4])); + result.endTime = Number(matchTimes[6]) * 60 * 60 + Number(matchTimes[7]) * 60 + Number(matchTimes[8]) + Number("0.".concat(matchTimes[9])); + } + } else if (!is$1.empty(line.trim()) && is$1.empty(result.text)) { + // If we already have the startTime, then we're definitely up to the text line(s) + var lineSplit = line.trim().split('#xywh='); + + var _lineSplit = _slicedToArray(lineSplit, 1); + + result.text = _lineSplit[0]; + + // If there's content in lineSplit[1], then we have sprites. If not, then it's just one frame per image + if (lineSplit[1]) { + var _lineSplit$1$split = lineSplit[1].split(','); + + var _lineSplit$1$split2 = _slicedToArray(_lineSplit$1$split, 4); + + result.x = _lineSplit$1$split2[0]; + result.y = _lineSplit$1$split2[1]; + result.w = _lineSplit$1$split2[2]; + result.h = _lineSplit$1$split2[3]; + } + } + }); + + if (result.text) { + processedList.push(result); + } + }); + return processedList; + }; + /** + * Preview thumbnails for seek hover and scrubbing + * Seeking: Hover over the seek bar (desktop only): shows a small preview container above the seek bar + * Scrubbing: Click and drag the seek bar (desktop and mobile): shows the preview image over the entire video, as if the video is scrubbing at very high speed + * + * Notes: + * - Thumbs are set via JS settings on Plyr init, not HTML5 'track' property. Using the track property would be a bit gross, because it doesn't support custom 'kinds'. kind=metadata might be used for something else, and we want to allow multiple thumbnails tracks. Tracks must have a unique combination of 'kind' and 'label'. We would have to do something like kind=metadata,label=thumbnails1 / kind=metadata,label=thumbnails2. Square peg, round hole + * - VTT info: the image URL is relative to the VTT, not the current document. But if the url starts with a slash, it will naturally be relative to the current domain. https://support.jwplayer.com/articles/how-to-add-preview-thumbnails + * - This implementation uses multiple separate img elements. Other implementations use background-image on one element. This would be nice and simple, but Firefox and Safari have flickering issues with replacing backgrounds of larger images. It seems that YouTube perhaps only avoids this because they don't have the option for high-res previews (even the fullscreen ones, when mousedown/seeking). Images appear over the top of each other, and previous ones are discarded once the new ones have been rendered + */ + + + var PreviewThumbnails = + /*#__PURE__*/ + function () { + /** + * PreviewThumbnails constructor. + * @param {Plyr} player + * @return {PreviewThumbnails} + */ + function PreviewThumbnails(player) { + _classCallCheck(this, PreviewThumbnails); + + this.player = player; + this.thumbnails = []; + this.loaded = false; + this.lastMouseMoveTime = Date.now(); + this.mouseDown = false; + this.loadedImages = []; + this.elements = { + thumb: {}, + scrubbing: {} + }; + this.load(); + } + + _createClass(PreviewThumbnails, [{ + key: "load", + value: function load() { + var _this = this; + + // Togglethe regular seek tooltip + if (this.player.elements.display.seekTooltip) { + this.player.elements.display.seekTooltip.hidden = this.enabled; + } + + if (!this.enabled) { + return; + } + + this.getThumbnails().then(function () { + // Render DOM elements + _this.render(); // Check to see if thumb container size was specified manually in CSS + + + _this.determineContainerAutoSizing(); + + _this.loaded = true; + }); + } // Download VTT files and parse them + + }, { + key: "getThumbnails", + value: function getThumbnails() { + var _this2 = this; + + return new Promise(function (resolve) { + var src = _this2.player.config.previewThumbnails.src; + + if (is$1.empty(src)) { + throw new Error('Missing previewThumbnails.src config attribute'); + } // If string, convert into single-element list + + + var urls = is$1.string(src) ? [src] : src; // Loop through each src URL. Download and process the VTT file, storing the resulting data in this.thumbnails + + var promises = urls.map(function (u) { + return _this2.getThumbnail(u); + }); + Promise.all(promises).then(function () { + // Sort smallest to biggest (e.g., [120p, 480p, 1080p]) + _this2.thumbnails.sort(function (x, y) { + return x.height - y.height; + }); + + _this2.player.debug.log('Preview thumbnails', _this2.thumbnails); + + resolve(); + }); + }); + } // Process individual VTT file + + }, { + key: "getThumbnail", + value: function getThumbnail(url) { + var _this3 = this; + + return new Promise(function (resolve) { + fetch(url).then(function (response) { + var thumbnail = { + frames: parseVtt(response), + height: null, + urlPrefix: '' + }; // If the URLs don't start with '/', then we need to set their relative path to be the location of the VTT file + // If the URLs do start with '/', then they obviously don't need a prefix, so it will remain blank + + if (!thumbnail.frames[0].text.startsWith('/')) { + thumbnail.urlPrefix = url.substring(0, url.lastIndexOf('/') + 1); + } // Download the first frame, so that we can determine/set the height of this thumbnailsDef + + + var tempImage = new Image(); + + tempImage.onload = function () { + thumbnail.height = tempImage.naturalHeight; + thumbnail.width = tempImage.naturalWidth; + + _this3.thumbnails.push(thumbnail); + + resolve(); + }; + + tempImage.src = thumbnail.urlPrefix + thumbnail.frames[0].text; + }); + }); + } + }, { + key: "startMove", + value: function startMove(event) { + if (!this.loaded) { + return; + } + + if (!is$1.event(event) || !['touchmove', 'mousemove'].includes(event.type)) { + return; + } // Wait until media has a duration + + + if (!this.player.media.duration) { + return; + } + + if (event.type === 'touchmove') { + // Calculate seek hover position as approx video seconds + this.seekTime = this.player.media.duration * (this.player.elements.inputs.seek.value / 100); + } else { + // Calculate seek hover position as approx video seconds + var clientRect = this.player.elements.progress.getBoundingClientRect(); + var percentage = 100 / clientRect.width * (event.pageX - clientRect.left); + this.seekTime = this.player.media.duration * (percentage / 100); + + if (this.seekTime < 0) { + // The mousemove fires for 10+px out to the left + this.seekTime = 0; + } + + if (this.seekTime > this.player.media.duration - 1) { + // Took 1 second off the duration for safety, because different players can disagree on the real duration of a video + this.seekTime = this.player.media.duration - 1; + } + + this.mousePosX = event.pageX; // Set time text inside image container + + this.elements.thumb.time.innerText = formatTime(this.seekTime); + } // Download and show image + + + this.showImageAtCurrentTime(); + } + }, { + key: "endMove", + value: function endMove() { + this.toggleThumbContainer(false, true); + } + }, { + key: "startScrubbing", + value: function startScrubbing(event) { + // Only act on left mouse button (0), or touch device (event.button is false) + if (event.button === false || event.button === 0) { + this.mouseDown = true; // Wait until media has a duration + + if (this.player.media.duration) { + this.toggleScrubbingContainer(true); + this.toggleThumbContainer(false, true); // Download and show image + + this.showImageAtCurrentTime(); + } + } + } + }, { + key: "endScrubbing", + value: function endScrubbing() { + var _this4 = this; + + this.mouseDown = false; // Hide scrubbing preview. But wait until the video has successfully seeked before hiding the scrubbing preview + + if (Math.ceil(this.lastTime) === Math.ceil(this.player.media.currentTime)) { + // The video was already seeked/loaded at the chosen time - hide immediately + this.toggleScrubbingContainer(false); + } else { + // The video hasn't seeked yet. Wait for that + once.call(this.player, this.player.media, 'timeupdate', function () { + // Re-check mousedown - we might have already started scrubbing again + if (!_this4.mouseDown) { + _this4.toggleScrubbingContainer(false); + } + }); + } + } + /** + * Setup hooks for Plyr and window events + */ + + }, { + key: "listeners", + value: function listeners() { + var _this5 = this; + + // Hide thumbnail preview - on mouse click, mouse leave (in listeners.js for now), and video play/seek. All four are required, e.g., for buffering + this.player.on('play', function () { + _this5.toggleThumbContainer(false, true); + }); + this.player.on('seeked', function () { + _this5.toggleThumbContainer(false); + }); + this.player.on('timeupdate', function () { + _this5.lastTime = _this5.player.media.currentTime; + }); + } + /** + * Create HTML elements for image containers + */ + + }, { + key: "render", + value: function render() { + // Create HTML element: plyr__preview-thumbnail-container + this.elements.thumb.container = createElement('div', { + class: this.player.config.classNames.previewThumbnails.thumbContainer + }); // Wrapper for the image for styling + + this.elements.thumb.imageContainer = createElement('div', { + class: this.player.config.classNames.previewThumbnails.imageContainer + }); + this.elements.thumb.container.appendChild(this.elements.thumb.imageContainer); // Create HTML element, parent+span: time text (e.g., 01:32:00) + + var timeContainer = createElement('div', { + class: this.player.config.classNames.previewThumbnails.timeContainer + }); + this.elements.thumb.time = createElement('span', {}, '00:00'); + timeContainer.appendChild(this.elements.thumb.time); + this.elements.thumb.container.appendChild(timeContainer); // Inject the whole thumb + + this.player.elements.progress.appendChild(this.elements.thumb.container); // Create HTML element: plyr__preview-scrubbing-container + + this.elements.scrubbing.container = createElement('div', { + class: this.player.config.classNames.previewThumbnails.scrubbingContainer + }); + this.player.elements.wrapper.appendChild(this.elements.scrubbing.container); + } + }, { + key: "showImageAtCurrentTime", + value: function showImageAtCurrentTime() { + var _this6 = this; + + if (this.mouseDown) { + this.setScrubbingContainerSize(); + } else { + this.setThumbContainerSizeAndPos(); + } // Find the desired thumbnail index + // TODO: Handle a video longer than the thumbs where thumbNum is null + + + var thumbNum = this.thumbnails[0].frames.findIndex(function (frame) { + return _this6.seekTime >= frame.startTime && _this6.seekTime <= frame.endTime; + }); + var hasThumb = thumbNum >= 0; + var qualityIndex = 0; // Show the thumb container if we're not scrubbing + + if (!this.mouseDown) { + this.toggleThumbContainer(hasThumb); + } // No matching thumb found + + + if (!hasThumb) { + return; + } // Check to see if we've already downloaded higher quality versions of this image + + + this.thumbnails.forEach(function (thumbnail, index) { + if (_this6.loadedImages.includes(thumbnail.frames[thumbNum].text)) { + qualityIndex = index; + } + }); // Only proceed if either thumbnum or thumbfilename has changed + + if (thumbNum !== this.showingThumb) { + this.showingThumb = thumbNum; + this.loadImage(qualityIndex); + } + } // Show the image that's currently specified in this.showingThumb + + }, { + key: "loadImage", + value: function loadImage() { + var _this7 = this; + + var qualityIndex = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 0; + var thumbNum = this.showingThumb; + var thumbnail = this.thumbnails[qualityIndex]; + var urlPrefix = thumbnail.urlPrefix; + var frame = thumbnail.frames[thumbNum]; + var thumbFilename = thumbnail.frames[thumbNum].text; + var thumbUrl = urlPrefix + thumbFilename; + + if (!this.currentImageElement || this.currentImageElement.dataset.filename !== thumbFilename) { + // If we're already loading a previous image, remove its onload handler - we don't want it to load after this one + // Only do this if not using sprites. Without sprites we really want to show as many images as possible, as a best-effort + if (this.loadingImage && this.usingSprites) { + this.loadingImage.onload = null; + } // We're building and adding a new image. In other implementations of similar functionality (YouTube), background image + // is instead used. But this causes issues with larger images in Firefox and Safari - switching between background + // images causes a flicker. Putting a new image over the top does not + + + var previewImage = new Image(); + previewImage.src = thumbUrl; + previewImage.dataset.index = thumbNum; + previewImage.dataset.filename = thumbFilename; + this.showingThumbFilename = thumbFilename; + this.player.debug.log("Loading image: ".concat(thumbUrl)); // For some reason, passing the named function directly causes it to execute immediately. So I've wrapped it in an anonymous function... + + previewImage.onload = function () { + return _this7.showImage(previewImage, frame, qualityIndex, thumbNum, thumbFilename, true); + }; + + this.loadingImage = previewImage; + this.removeOldImages(previewImage); + } else { + // Update the existing image + this.showImage(this.currentImageElement, frame, qualityIndex, thumbNum, thumbFilename, false); + this.currentImageElement.dataset.index = thumbNum; + this.removeOldImages(this.currentImageElement); + } + } + }, { + key: "showImage", + value: function showImage(previewImage, frame, qualityIndex, thumbNum, thumbFilename) { + var newImage = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : true; + this.player.debug.log("Showing thumb: ".concat(thumbFilename, ". num: ").concat(thumbNum, ". qual: ").concat(qualityIndex, ". newimg: ").concat(newImage)); + this.setImageSizeAndOffset(previewImage, frame); + + if (newImage) { + this.currentImageContainer.appendChild(previewImage); + this.currentImageElement = previewImage; + + if (!this.loadedImages.includes(thumbFilename)) { + this.loadedImages.push(thumbFilename); + } + } // Preload images before and after the current one + // Show higher quality of the same frame + // Each step here has a short time delay, and only continues if still hovering/seeking the same spot. This is to protect slow connections from overloading + + + this.preloadNearby(thumbNum, true).then(this.preloadNearby(thumbNum, false)).then(this.getHigherQuality(qualityIndex, previewImage, frame, thumbFilename)); + } // Remove all preview images that aren't the designated current image + + }, { + key: "removeOldImages", + value: function removeOldImages(currentImage) { + var _this8 = this; + + // Get a list of all images, convert it from a DOM list to an array + Array.from(this.currentImageContainer.children).forEach(function (image) { + if (image.tagName.toLowerCase() !== 'img') { + return; + } + + var removeDelay = _this8.usingSprites ? 500 : 1000; + + if (image.dataset.index !== currentImage.dataset.index && !image.dataset.deleting) { + // Wait 200ms, as the new image can take some time to show on certain browsers (even though it was downloaded before showing). This will prevent flicker, and show some generosity towards slower clients + // First set attribute 'deleting' to prevent multi-handling of this on repeat firing of this function + image.dataset.deleting = true; // This has to be set before the timeout - to prevent issues switching between hover and scrub + + var currentImageContainer = _this8.currentImageContainer; + setTimeout(function () { + currentImageContainer.removeChild(image); + + _this8.player.debug.log("Removing thumb: ".concat(image.dataset.filename)); + }, removeDelay); + } + }); + } // Preload images before and after the current one. Only if the user is still hovering/seeking the same frame + // This will only preload the lowest quality + + }, { + key: "preloadNearby", + value: function preloadNearby(thumbNum) { + var _this9 = this; + + var forward = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true; + return new Promise(function (resolve) { + setTimeout(function () { + var oldThumbFilename = _this9.thumbnails[0].frames[thumbNum].text; + + if (_this9.showingThumbFilename === oldThumbFilename) { + // Find the nearest thumbs with different filenames. Sometimes it'll be the next index, but in the case of sprites, it might be 100+ away + var thumbnailsClone; + + if (forward) { + thumbnailsClone = _this9.thumbnails[0].frames.slice(thumbNum); + } else { + thumbnailsClone = _this9.thumbnails[0].frames.slice(0, thumbNum).reverse(); + } + + var foundOne = false; + thumbnailsClone.forEach(function (frame) { + var newThumbFilename = frame.text; + + if (newThumbFilename !== oldThumbFilename) { + // Found one with a different filename. Make sure it hasn't already been loaded on this page visit + if (!_this9.loadedImages.includes(newThumbFilename)) { + foundOne = true; + + _this9.player.debug.log("Preloading thumb filename: ".concat(newThumbFilename)); + + var urlPrefix = _this9.thumbnails[0].urlPrefix; + var thumbURL = urlPrefix + newThumbFilename; + var previewImage = new Image(); + previewImage.src = thumbURL; + + previewImage.onload = function () { + _this9.player.debug.log("Preloaded thumb filename: ".concat(newThumbFilename)); + + if (!_this9.loadedImages.includes(newThumbFilename)) _this9.loadedImages.push(newThumbFilename); // We don't resolve until the thumb is loaded + + resolve(); + }; + } + } + }); // If there are none to preload then we want to resolve immediately + + if (!foundOne) { + resolve(); + } + } + }, 300); + }); + } // If user has been hovering current image for half a second, look for a higher quality one + + }, { + key: "getHigherQuality", + value: function getHigherQuality(currentQualityIndex, previewImage, frame, thumbFilename) { + var _this10 = this; + + if (currentQualityIndex < this.thumbnails.length - 1) { + // Only use the higher quality version if it's going to look any better - if the current thumb is of a lower pixel density than the thumbnail container + var previewImageHeight = previewImage.naturalHeight; + + if (this.usingSprites) { + previewImageHeight = frame.h; + } + + if (previewImageHeight < this.thumbContainerHeight) { + // Recurse back to the loadImage function - show a higher quality one, but only if the viewer is on this frame for a while + setTimeout(function () { + // Make sure the mouse hasn't already moved on and started hovering at another image + if (_this10.showingThumbFilename === thumbFilename) { + _this10.player.debug.log("Showing higher quality thumb for: ".concat(thumbFilename)); + + _this10.loadImage(currentQualityIndex + 1); + } + }, 300); + } + } + } + }, { + key: "toggleThumbContainer", + value: function toggleThumbContainer() { + var toggle = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + var clearShowing = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + var className = this.player.config.classNames.previewThumbnails.thumbContainerShown; + this.elements.thumb.container.classList.toggle(className, toggle); + + if (!toggle && clearShowing) { + this.showingThumb = null; + this.showingThumbFilename = null; + } + } + }, { + key: "toggleScrubbingContainer", + value: function toggleScrubbingContainer() { + var toggle = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false; + var className = this.player.config.classNames.previewThumbnails.scrubbingContainerShown; + this.elements.scrubbing.container.classList.toggle(className, toggle); + + if (!toggle) { + this.showingThumb = null; + this.showingThumbFilename = null; + } + } + }, { + key: "determineContainerAutoSizing", + value: function determineContainerAutoSizing() { + if (this.elements.thumb.imageContainer.clientHeight > 20) { + // This will prevent auto sizing in this.setThumbContainerSizeAndPos() + this.sizeSpecifiedInCSS = true; + } + } // Set the size to be about a quarter of the size of video. Unless option dynamicSize === false, in which case it needs to be set in CSS + + }, { + key: "setThumbContainerSizeAndPos", + value: function setThumbContainerSizeAndPos() { + if (!this.sizeSpecifiedInCSS) { + var thumbWidth = Math.floor(this.thumbContainerHeight * this.thumbAspectRatio); + this.elements.thumb.imageContainer.style.height = "".concat(this.thumbContainerHeight, "px"); + this.elements.thumb.imageContainer.style.width = "".concat(thumbWidth, "px"); + } + + this.setThumbContainerPos(); + } + }, { + key: "setThumbContainerPos", + value: function setThumbContainerPos() { + var seekbarRect = this.player.elements.progress.getBoundingClientRect(); + var plyrRect = this.player.elements.container.getBoundingClientRect(); + var container = this.elements.thumb.container; // Find the lowest and highest desired left-position, so we don't slide out the side of the video container + + var minVal = plyrRect.left - seekbarRect.left + 10; + var maxVal = plyrRect.right - seekbarRect.left - container.clientWidth - 10; // Set preview container position to: mousepos, minus seekbar.left, minus half of previewContainer.clientWidth + + var previewPos = this.mousePosX - seekbarRect.left - container.clientWidth / 2; + + if (previewPos < minVal) { + previewPos = minVal; + } + + if (previewPos > maxVal) { + previewPos = maxVal; + } + + container.style.left = "".concat(previewPos, "px"); + } // Can't use 100% width, in case the video is a different aspect ratio to the video container + + }, { + key: "setScrubbingContainerSize", + value: function setScrubbingContainerSize() { + this.elements.scrubbing.container.style.width = "".concat(this.player.media.clientWidth, "px"); // Can't use media.clientHeight - html5 video goes big and does black bars above and below + + this.elements.scrubbing.container.style.height = "".concat(this.player.media.clientWidth / this.thumbAspectRatio, "px"); + } // Sprites need to be offset to the correct location + + }, { + key: "setImageSizeAndOffset", + value: function setImageSizeAndOffset(previewImage, frame) { + if (!this.usingSprites) { + return; + } // Find difference between height and preview container height + + + var multiplier = this.thumbContainerHeight / frame.h; + previewImage.style.height = "".concat(Math.floor(previewImage.naturalHeight * multiplier), "px"); + previewImage.style.width = "".concat(Math.floor(previewImage.naturalWidth * multiplier), "px"); + previewImage.style.left = "-".concat(frame.x * multiplier, "px"); + previewImage.style.top = "-".concat(frame.y * multiplier, "px"); + } + }, { + key: "enabled", + get: function get() { + return this.player.isHTML5 && this.player.isVideo && this.player.config.previewThumbnails.enabled; + } + }, { + key: "currentImageContainer", + get: function get() { + if (this.mouseDown) { + return this.elements.scrubbing.container; + } + + return this.elements.thumb.imageContainer; + } + }, { + key: "usingSprites", + get: function get() { + return Object.keys(this.thumbnails[0].frames[0]).includes('w'); + } + }, { + key: "thumbAspectRatio", + get: function get() { + if (this.usingSprites) { + return this.thumbnails[0].frames[0].w / this.thumbnails[0].frames[0].h; + } + + return this.thumbnails[0].width / this.thumbnails[0].height; + } + }, { + key: "thumbContainerHeight", + get: function get() { + if (this.mouseDown) { + // Can't use media.clientHeight - HTML5 video goes big and does black bars above and below + return Math.floor(this.player.media.clientWidth / this.thumbAspectRatio); + } + + return Math.floor(this.player.media.clientWidth / this.thumbAspectRatio / 4); + } + }, { + key: "currentImageElement", + get: function get() { + if (this.mouseDown) { + return this.currentScrubbingImageElement; + } + + return this.currentThumbnailImageElement; + }, + set: function set(element) { + if (this.mouseDown) { + this.currentScrubbingImageElement = element; + } else { + this.currentThumbnailImageElement = element; + } + } + }]); + + return PreviewThumbnails; + }(); + + var source = { + // Add elements to HTML5 media (source, tracks, etc) + insertElements: function insertElements(type, attributes) { + var _this = this; + + if (is$1.string(attributes)) { + insertElement(type, this.media, { + src: attributes + }); + } else if (is$1.array(attributes)) { + attributes.forEach(function (attribute) { + insertElement(type, _this.media, attribute); + }); + } + }, + // Update source + // Sources are not checked for support so be careful + change: function change(input) { + var _this2 = this; + + if (!getDeep(input, 'sources.length')) { + this.debug.warn('Invalid source format'); + return; + } // Cancel current network requests + + + html5.cancelRequests.call(this); // Destroy instance and re-setup + + this.destroy.call(this, function () { + // Reset quality options + _this2.options.quality = []; // Remove elements + + removeElement(_this2.media); + _this2.media = null; // Reset class name + + if (is$1.element(_this2.elements.container)) { + _this2.elements.container.removeAttribute('class'); + } // Set the type and provider + + + var sources = input.sources, + type = input.type; + + var _sources = _slicedToArray(sources, 1), + _sources$ = _sources[0], + _sources$$provider = _sources$.provider, + provider = _sources$$provider === void 0 ? providers.html5 : _sources$$provider, + src = _sources$.src; + + var tagName = provider === 'html5' ? type : 'div'; + var attributes = provider === 'html5' ? {} : { + src: src + }; + Object.assign(_this2, { + provider: provider, + type: type, + // Check for support + supported: support.check(type, provider, _this2.config.playsinline), + // Create new element + media: createElement(tagName, attributes) + }); // Inject the new element + + _this2.elements.container.appendChild(_this2.media); // Autoplay the new source? + + + if (is$1.boolean(input.autoplay)) { + _this2.config.autoplay = input.autoplay; + } // Set attributes for audio and video + + + if (_this2.isHTML5) { + if (_this2.config.crossorigin) { + _this2.media.setAttribute('crossorigin', ''); + } + + if (_this2.config.autoplay) { + _this2.media.setAttribute('autoplay', ''); + } + + if (!is$1.empty(input.poster)) { + _this2.poster = input.poster; + } + + if (_this2.config.loop.active) { + _this2.media.setAttribute('loop', ''); + } + + if (_this2.config.muted) { + _this2.media.setAttribute('muted', ''); + } + + if (_this2.config.playsinline) { + _this2.media.setAttribute('playsinline', ''); + } + } // Restore class hook + + + ui.addStyleHook.call(_this2); // Set new sources for html5 + + if (_this2.isHTML5) { + source.insertElements.call(_this2, 'source', sources); + } // Set video title + + + _this2.config.title = input.title; // Set up from scratch + + media.setup.call(_this2); // HTML5 stuff + + if (_this2.isHTML5) { + // Setup captions + if (Object.keys(input).includes('tracks')) { + source.insertElements.call(_this2, 'track', input.tracks); + } + } // If HTML5 or embed but not fully supported, setupInterface and call ready now + + + if (_this2.isHTML5 || _this2.isEmbed && !_this2.supported.ui) { + // Setup interface + ui.build.call(_this2); + } // Load HTML5 sources + + + if (_this2.isHTML5) { + _this2.media.load(); + } // Reload thumbnails + + + if (_this2.previewThumbnails) { + _this2.previewThumbnails.load(); + } // Update the fullscreen support + + + _this2.fullscreen.update(); + }, true); + } + }; + + // TODO: Use a WeakMap for private globals + // const globals = new WeakMap(); + // Plyr instance + + var Plyr = + /*#__PURE__*/ + function () { + function Plyr(target, options) { + var _this = this; + + _classCallCheck(this, Plyr); + + this.timers = {}; // State + + this.ready = false; + this.loading = false; + this.failed = false; // Touch device + + this.touch = support.touch; // Set the media element + + this.media = target; // String selector passed + + if (is$1.string(this.media)) { + this.media = document.querySelectorAll(this.media); + } // jQuery, NodeList or Array passed, use first element + + + if (window.jQuery && this.media instanceof jQuery || is$1.nodeList(this.media) || is$1.array(this.media)) { + // eslint-disable-next-line + this.media = this.media[0]; + } // Set config + + + this.config = extend({}, defaults$1, Plyr.defaults, options || {}, function () { + try { + return JSON.parse(_this.media.getAttribute('data-plyr-config')); + } catch (e) { + return {}; + } + }()); // Elements cache + + this.elements = { + container: null, + captions: null, + buttons: {}, + display: {}, + progress: {}, + inputs: {}, + settings: { + popup: null, + menu: null, + panels: {}, + buttons: {} + } + }; // Captions + + this.captions = { + active: null, + currentTrack: -1, + meta: new WeakMap() + }; // Fullscreen + + this.fullscreen = { + active: false + }; // Options + + this.options = { + speed: [], + quality: [] + }; // Debugging + // TODO: move to globals + + this.debug = new Console(this.config.debug); // Log config options and support + + this.debug.log('Config', this.config); + this.debug.log('Support', support); // We need an element to setup + + if (is$1.nullOrUndefined(this.media) || !is$1.element(this.media)) { + this.debug.error('Setup failed: no suitable element passed'); + return; + } // Bail if the element is initialized + + + if (this.media.plyr) { + this.debug.warn('Target already setup'); + return; + } // Bail if not enabled + + + if (!this.config.enabled) { + this.debug.error('Setup failed: disabled by config'); + return; + } // Bail if disabled or no basic support + // You may want to disable certain UAs etc + + + if (!support.check().api) { + this.debug.error('Setup failed: no support'); + return; + } // Cache original element state for .destroy() + + + var clone = this.media.cloneNode(true); + clone.autoplay = false; + this.elements.original = clone; // Set media type based on tag or data attribute + // Supported: video, audio, vimeo, youtube + + var type = this.media.tagName.toLowerCase(); // Embed properties + + var iframe = null; + var url = null; // Different setup based on type + + switch (type) { + case 'div': + // Find the frame + iframe = this.media.querySelector('iframe'); // <iframe> type + + if (is$1.element(iframe)) { + // Detect provider + url = parseUrl$2(iframe.getAttribute('src')); + this.provider = getProviderByUrl(url.toString()); // Rework elements + + this.elements.container = this.media; + this.media = iframe; // Reset classname + + this.elements.container.className = ''; // Get attributes from URL and set config + + if (url.search.length) { + var truthy = ['1', 'true']; + + if (truthy.includes(url.searchParams.get('autoplay'))) { + this.config.autoplay = true; + } + + if (truthy.includes(url.searchParams.get('loop'))) { + this.config.loop.active = true; + } // TODO: replace fullscreen.iosNative with this playsinline config option + // YouTube requires the playsinline in the URL + + + if (this.isYouTube) { + this.config.playsinline = truthy.includes(url.searchParams.get('playsinline')); + this.config.youtube.hl = url.searchParams.get('hl'); // TODO: Should this be setting language? + } else { + this.config.playsinline = true; + } + } + } else { + // <div> with attributes + this.provider = this.media.getAttribute(this.config.attributes.embed.provider); // Remove attribute + + this.media.removeAttribute(this.config.attributes.embed.provider); + } // Unsupported or missing provider + + + if (is$1.empty(this.provider) || !Object.keys(providers).includes(this.provider)) { + this.debug.error('Setup failed: Invalid provider'); + return; + } // Audio will come later for external providers + + + this.type = types.video; + break; + + case 'video': + case 'audio': + this.type = type; + this.provider = providers.html5; // Get config from attributes + + if (this.media.hasAttribute('crossorigin')) { + this.config.crossorigin = true; + } + + if (this.media.hasAttribute('autoplay')) { + this.config.autoplay = true; + } + + if (this.media.hasAttribute('playsinline') || this.media.hasAttribute('webkit-playsinline')) { + this.config.playsinline = true; + } + + if (this.media.hasAttribute('muted')) { + this.config.muted = true; + } + + if (this.media.hasAttribute('loop')) { + this.config.loop.active = true; + } + + break; + + default: + this.debug.error('Setup failed: unsupported type'); + return; + } // Check for support again but with type + + + this.supported = support.check(this.type, this.provider, this.config.playsinline); // If no support for even API, bail + + if (!this.supported.api) { + this.debug.error('Setup failed: no support'); + return; + } + + this.eventListeners = []; // Create listeners + + this.listeners = new Listeners(this); // Setup local storage for user settings + + this.storage = new Storage(this); // Store reference + + this.media.plyr = this; // Wrap media + + if (!is$1.element(this.elements.container)) { + this.elements.container = createElement('div', { + tabindex: 0 + }); + wrap(this.media, this.elements.container); + } // Add style hook + + + ui.addStyleHook.call(this); // Setup media + + media.setup.call(this); // Listen for events if debugging + + if (this.config.debug) { + on.call(this, this.elements.container, this.config.events.join(' '), function (event) { + _this.debug.log("event: ".concat(event.type)); + }); + } // Setup interface + // If embed but not fully supported, build interface now to avoid flash of controls + + + if (this.isHTML5 || this.isEmbed && !this.supported.ui) { + ui.build.call(this); + } // Container listeners + + + this.listeners.container(); // Global listeners + + this.listeners.global(); // Setup fullscreen + + this.fullscreen = new Fullscreen(this); // Setup ads if provided + + if (this.config.ads.enabled) { + this.ads = new Ads(this); + } // Autoplay if required + + + if (this.config.autoplay) { + this.play(); + } // Seek time will be recorded (in listeners.js) so we can prevent hiding controls for a few seconds after seek + + + this.lastSeekTime = 0; // Setup preview thumbnails if enabled + + if (this.config.previewThumbnails.enabled) { + this.previewThumbnails = new PreviewThumbnails(this); + } + } // --------------------------------------- + // API + // --------------------------------------- + + /** + * Types and provider helpers + */ + + + _createClass(Plyr, [{ + key: "play", + + /** + * Play the media, or play the advertisement (if they are not blocked) + */ + value: function play() { + var _this2 = this; + + if (!is$1.function(this.media.play)) { + return null; + } // Intecept play with ads + + + if (this.ads && this.ads.enabled) { + this.ads.managerPromise.then(function () { + return _this2.ads.play(); + }).catch(function () { + return _this2.media.play(); + }); + } // Return the promise (for HTML5) + + + return this.media.play(); + } + /** + * Pause the media + */ + + }, { + key: "pause", + value: function pause() { + if (!this.playing || !is$1.function(this.media.pause)) { + return; + } + + this.media.pause(); + } + /** + * Get playing state + */ + + }, { + key: "togglePlay", + + /** + * Toggle playback based on current status + * @param {Boolean} input + */ + value: function togglePlay(input) { + // Toggle based on current state if nothing passed + var toggle = is$1.boolean(input) ? input : !this.playing; + + if (toggle) { + this.play(); + } else { + this.pause(); + } + } + /** + * Stop playback + */ + + }, { + key: "stop", + value: function stop() { + if (this.isHTML5) { + this.pause(); + this.restart(); + } else if (is$1.function(this.media.stop)) { + this.media.stop(); + } + } + /** + * Restart playback + */ + + }, { + key: "restart", + value: function restart() { + this.currentTime = 0; + } + /** + * Rewind + * @param {Number} seekTime - how far to rewind in seconds. Defaults to the config.seekTime + */ + + }, { + key: "rewind", + value: function rewind(seekTime) { + this.currentTime = this.currentTime - (is$1.number(seekTime) ? seekTime : this.config.seekTime); + } + /** + * Fast forward + * @param {Number} seekTime - how far to fast forward in seconds. Defaults to the config.seekTime + */ + + }, { + key: "forward", + value: function forward(seekTime) { + this.currentTime = this.currentTime + (is$1.number(seekTime) ? seekTime : this.config.seekTime); + } + /** + * Seek to a time + * @param {Number} input - where to seek to in seconds. Defaults to 0 (the start) + */ + + }, { + key: "increaseVolume", + + /** + * Increase volume + * @param {Boolean} step - How much to decrease by (between 0 and 1) + */ + value: function increaseVolume(step) { + var volume = this.media.muted ? 0 : this.volume; + this.volume = volume + (is$1.number(step) ? step : 0); + } + /** + * Decrease volume + * @param {Boolean} step - How much to decrease by (between 0 and 1) + */ + + }, { + key: "decreaseVolume", + value: function decreaseVolume(step) { + this.increaseVolume(-step); + } + /** + * Set muted state + * @param {Boolean} mute + */ + + }, { + key: "toggleCaptions", + + /** + * Toggle captions + * @param {Boolean} input - Whether to enable captions + */ + value: function toggleCaptions(input) { + captions.toggle.call(this, input, false); + } + /** + * Set the caption track by index + * @param {Number} - Caption index + */ + + }, { + key: "airplay", + + /** + * Trigger the airplay dialog + * TODO: update player with state, support, enabled + */ + value: function airplay() { + // Show dialog if supported + if (support.airplay) { + this.media.webkitShowPlaybackTargetPicker(); + } + } + /** + * Toggle the player controls + * @param {Boolean} [toggle] - Whether to show the controls + */ + + }, { + key: "toggleControls", + value: function toggleControls(toggle) { + // Don't toggle if missing UI support or if it's audio + if (this.supported.ui && !this.isAudio) { + // Get state before change + var isHidden = hasClass(this.elements.container, this.config.classNames.hideControls); // Negate the argument if not undefined since adding the class to hides the controls + + var force = typeof toggle === 'undefined' ? undefined : !toggle; // Apply and get updated state + + var hiding = toggleClass(this.elements.container, this.config.classNames.hideControls, force); // Close menu + + if (hiding && this.config.controls.includes('settings') && !is$1.empty(this.config.settings)) { + controls.toggleMenu.call(this, false); + } // Trigger event on change + + + if (hiding !== isHidden) { + var eventName = hiding ? 'controlshidden' : 'controlsshown'; + triggerEvent.call(this, this.media, eventName); + } + + return !hiding; + } + + return false; + } + /** + * Add event listeners + * @param {String} event - Event type + * @param {Function} callback - Callback for when event occurs + */ + + }, { + key: "on", + value: function on$1(event, callback) { + on.call(this, this.elements.container, event, callback); + } + /** + * Add event listeners once + * @param {String} event - Event type + * @param {Function} callback - Callback for when event occurs + */ + + }, { + key: "once", + value: function once$1(event, callback) { + once.call(this, this.elements.container, event, callback); + } + /** + * Remove event listeners + * @param {String} event - Event type + * @param {Function} callback - Callback for when event occurs + */ + + }, { + key: "off", + value: function off$1(event, callback) { + off(this.elements.container, event, callback); + } + /** + * Destroy an instance + * Event listeners are removed when elements are removed + * http://stackoverflow.com/questions/12528049/if-a-dom-element-is-removed-are-its-listeners-also-removed-from-memory + * @param {Function} callback - Callback for when destroy is complete + * @param {Boolean} soft - Whether it's a soft destroy (for source changes etc) + */ + + }, { + key: "destroy", + value: function destroy(callback) { + var _this3 = this; + + var soft = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + if (!this.ready) { + return; + } + + var done = function done() { + // Reset overflow (incase destroyed while in fullscreen) + document.body.style.overflow = ''; // GC for embed + + _this3.embed = null; // If it's a soft destroy, make minimal changes + + if (soft) { + if (Object.keys(_this3.elements).length) { + // Remove elements + removeElement(_this3.elements.buttons.play); + removeElement(_this3.elements.captions); + removeElement(_this3.elements.controls); + removeElement(_this3.elements.wrapper); // Clear for GC + + _this3.elements.buttons.play = null; + _this3.elements.captions = null; + _this3.elements.controls = null; + _this3.elements.wrapper = null; + } // Callback + + + if (is$1.function(callback)) { + callback(); + } + } else { + // Unbind listeners + unbindListeners.call(_this3); // Replace the container with the original element provided + + replaceElement(_this3.elements.original, _this3.elements.container); // Event + + triggerEvent.call(_this3, _this3.elements.original, 'destroyed', true); // Callback + + if (is$1.function(callback)) { + callback.call(_this3.elements.original); + } // Reset state + + + _this3.ready = false; // Clear for garbage collection + + setTimeout(function () { + _this3.elements = null; + _this3.media = null; + }, 200); + } + }; // Stop playback + + + this.stop(); // Provider specific stuff + + if (this.isHTML5) { + // Clear timeout + clearTimeout(this.timers.loading); // Restore native video controls + + ui.toggleNativeControls.call(this, true); // Clean up + + done(); + } else if (this.isYouTube) { + // Clear timers + clearInterval(this.timers.buffering); + clearInterval(this.timers.playing); // Destroy YouTube API + + if (this.embed !== null && is$1.function(this.embed.destroy)) { + this.embed.destroy(); + } // Clean up + + + done(); + } else if (this.isVimeo) { + // Destroy Vimeo API + // then clean up (wait, to prevent postmessage errors) + if (this.embed !== null) { + this.embed.unload().then(done); + } // Vimeo does not always return + + + setTimeout(done, 200); + } + } + /** + * Check for support for a mime type (HTML5 only) + * @param {String} type - Mime type + */ + + }, { + key: "supports", + value: function supports(type) { + return support.mime.call(this, type); + } + /** + * Check for support + * @param {String} type - Player type (audio/video) + * @param {String} provider - Provider (html5/youtube/vimeo) + * @param {Boolean} inline - Where player has `playsinline` sttribute + */ + + }, { + key: "isHTML5", + get: function get() { + return Boolean(this.provider === providers.html5); + } + }, { + key: "isEmbed", + get: function get() { + return Boolean(this.isYouTube || this.isVimeo); + } + }, { + key: "isYouTube", + get: function get() { + return Boolean(this.provider === providers.youtube); + } + }, { + key: "isVimeo", + get: function get() { + return Boolean(this.provider === providers.vimeo); + } + }, { + key: "isVideo", + get: function get() { + return Boolean(this.type === types.video); + } + }, { + key: "isAudio", + get: function get() { + return Boolean(this.type === types.audio); + } + }, { + key: "playing", + get: function get() { + return Boolean(this.ready && !this.paused && !this.ended); + } + /** + * Get paused state + */ + + }, { + key: "paused", + get: function get() { + return Boolean(this.media.paused); + } + /** + * Get stopped state + */ + + }, { + key: "stopped", + get: function get() { + return Boolean(this.paused && this.currentTime === 0); + } + /** + * Get ended state + */ + + }, { + key: "ended", + get: function get() { + return Boolean(this.media.ended); + } + }, { + key: "currentTime", + set: function set(input) { + // Bail if media duration isn't available yet + if (!this.duration) { + return; + } // Validate input + + + var inputIsValid = is$1.number(input) && input > 0; // Set + + this.media.currentTime = inputIsValid ? Math.min(input, this.duration) : 0; // Logging + + this.debug.log("Seeking to ".concat(this.currentTime, " seconds")); + } + /** + * Get current time + */ + , + get: function get() { + return Number(this.media.currentTime); + } + /** + * Get buffered + */ + + }, { + key: "buffered", + get: function get() { + var buffered = this.media.buffered; // YouTube / Vimeo return a float between 0-1 + + if (is$1.number(buffered)) { + return buffered; + } // HTML5 + // TODO: Handle buffered chunks of the media + // (i.e. seek to another section buffers only that section) + + + if (buffered && buffered.length && this.duration > 0) { + return buffered.end(0) / this.duration; + } + + return 0; + } + /** + * Get seeking status + */ + + }, { + key: "seeking", + get: function get() { + return Boolean(this.media.seeking); + } + /** + * Get the duration of the current media + */ + + }, { + key: "duration", + get: function get() { + // Faux duration set via config + var fauxDuration = parseFloat(this.config.duration); // Media duration can be NaN or Infinity before the media has loaded + + var realDuration = (this.media || {}).duration; + var duration = !is$1.number(realDuration) || realDuration === Infinity ? 0 : realDuration; // If config duration is funky, use regular duration + + return fauxDuration || duration; + } + /** + * Set the player volume + * @param {Number} value - must be between 0 and 1. Defaults to the value from local storage and config.volume if not set in storage + */ + + }, { + key: "volume", + set: function set(value) { + var volume = value; + var max = 1; + var min = 0; + + if (is$1.string(volume)) { + volume = Number(volume); + } // Load volume from storage if no value specified + + + if (!is$1.number(volume)) { + volume = this.storage.get('volume'); + } // Use config if all else fails + + + if (!is$1.number(volume)) { + volume = this.config.volume; + } // Maximum is volumeMax + + + if (volume > max) { + volume = max; + } // Minimum is volumeMin + + + if (volume < min) { + volume = min; + } // Update config + + + this.config.volume = volume; // Set the player volume + + this.media.volume = volume; // If muted, and we're increasing volume manually, reset muted state + + if (!is$1.empty(value) && this.muted && volume > 0) { + this.muted = false; + } + } + /** + * Get the current player volume + */ + , + get: function get() { + return Number(this.media.volume); + } + }, { + key: "muted", + set: function set(mute) { + var toggle = mute; // Load muted state from storage + + if (!is$1.boolean(toggle)) { + toggle = this.storage.get('muted'); + } // Use config if all else fails + + + if (!is$1.boolean(toggle)) { + toggle = this.config.muted; + } // Update config + + + this.config.muted = toggle; // Set mute on the player + + this.media.muted = toggle; + } + /** + * Get current muted state + */ + , + get: function get() { + return Boolean(this.media.muted); + } + /** + * Check if the media has audio + */ + + }, { + key: "hasAudio", + get: function get() { + // Assume yes for all non HTML5 (as we can't tell...) + if (!this.isHTML5) { + return true; + } + + if (this.isAudio) { + return true; + } // Get audio tracks + + + return Boolean(this.media.mozHasAudio) || Boolean(this.media.webkitAudioDecodedByteCount) || Boolean(this.media.audioTracks && this.media.audioTracks.length); + } + /** + * Set playback speed + * @param {Number} speed - the speed of playback (0.5-2.0) + */ + + }, { + key: "speed", + set: function set(input) { + var speed = null; + + if (is$1.number(input)) { + speed = input; + } + + if (!is$1.number(speed)) { + speed = this.storage.get('speed'); + } + + if (!is$1.number(speed)) { + speed = this.config.speed.selected; + } // Set min/max + + + if (speed < 0.1) { + speed = 0.1; + } + + if (speed > 2.0) { + speed = 2.0; + } + + if (!this.config.speed.options.includes(speed)) { + this.debug.warn("Unsupported speed (".concat(speed, ")")); + return; + } // Update config + + + this.config.speed.selected = speed; // Set media speed + + this.media.playbackRate = speed; + } + /** + * Get current playback speed + */ + , + get: function get() { + return Number(this.media.playbackRate); + } + /** + * Set playback quality + * Currently HTML5 & YouTube only + * @param {Number} input - Quality level + */ + + }, { + key: "quality", + set: function set(input) { + var config = this.config.quality; + var options = this.options.quality; + + if (!options.length) { + return; + } + + var quality = [!is$1.empty(input) && Number(input), this.storage.get('quality'), config.selected, config.default].find(is$1.number); + var updateStorage = true; + + if (!options.includes(quality)) { + var value = closest(options, quality); + this.debug.warn("Unsupported quality option: ".concat(quality, ", using ").concat(value, " instead")); + quality = value; // Don't update storage if quality is not supported + + updateStorage = false; + } // Update config + + + config.selected = quality; // Set quality + + this.media.quality = quality; // Save to storage + + if (updateStorage) { + this.storage.set({ + quality: quality + }); + } + } + /** + * Get current quality level + */ + , + get: function get() { + return this.media.quality; + } + /** + * Toggle loop + * TODO: Finish fancy new logic. Set the indicator on load as user may pass loop as config + * @param {Boolean} input - Whether to loop or not + */ + + }, { + key: "loop", + set: function set(input) { + var toggle = is$1.boolean(input) ? input : this.config.loop.active; + this.config.loop.active = toggle; + this.media.loop = toggle; // Set default to be a true toggle + + /* const type = ['start', 'end', 'all', 'none', 'toggle'].includes(input) ? input : 'toggle'; + switch (type) { + case 'start': + if (this.config.loop.end && this.config.loop.end <= this.currentTime) { + this.config.loop.end = null; + } + this.config.loop.start = this.currentTime; + // this.config.loop.indicator.start = this.elements.display.played.value; + break; + case 'end': + if (this.config.loop.start >= this.currentTime) { + return this; + } + this.config.loop.end = this.currentTime; + // this.config.loop.indicator.end = this.elements.display.played.value; + break; + case 'all': + this.config.loop.start = 0; + this.config.loop.end = this.duration - 2; + this.config.loop.indicator.start = 0; + this.config.loop.indicator.end = 100; + break; + case 'toggle': + if (this.config.loop.active) { + this.config.loop.start = 0; + this.config.loop.end = null; + } else { + this.config.loop.start = 0; + this.config.loop.end = this.duration - 2; + } + break; + default: + this.config.loop.start = 0; + this.config.loop.end = null; + break; + } */ + } + /** + * Get current loop state + */ + , + get: function get() { + return Boolean(this.media.loop); + } + /** + * Set new media source + * @param {Object} input - The new source object (see docs) + */ + + }, { + key: "source", + set: function set(input) { + source.change.call(this, input); + } + /** + * Get current source + */ + , + get: function get() { + return this.media.currentSrc; + } + /** + * Get a download URL (either source or custom) + */ + + }, { + key: "download", + get: function get() { + var download = this.config.urls.download; + return is$1.url(download) ? download : this.source; + } + /** + * Set the poster image for a video + * @param {String} input - the URL for the new poster image + */ + + }, { + key: "poster", + set: function set(input) { + if (!this.isVideo) { + this.debug.warn('Poster can only be set for video'); + return; + } + + ui.setPoster.call(this, input, false).catch(function () {}); + } + /** + * Get the current poster image + */ + , + get: function get() { + if (!this.isVideo) { + return null; + } + + return this.media.getAttribute('poster'); + } + /** + * Set the autoplay state + * @param {Boolean} input - Whether to autoplay or not + */ + + }, { + key: "autoplay", + set: function set(input) { + var toggle = is$1.boolean(input) ? input : this.config.autoplay; + this.config.autoplay = toggle; + } + /** + * Get the current autoplay state + */ + , + get: function get() { + return Boolean(this.config.autoplay); + } + }, { + key: "currentTrack", + set: function set(input) { + captions.set.call(this, input, false); + } + /** + * Get the current caption track index (-1 if disabled) + */ + , + get: function get() { + var _this$captions = this.captions, + toggled = _this$captions.toggled, + currentTrack = _this$captions.currentTrack; + return toggled ? currentTrack : -1; + } + /** + * Set the wanted language for captions + * Since tracks can be added later it won't update the actual caption track until there is a matching track + * @param {String} - Two character ISO language code (e.g. EN, FR, PT, etc) + */ + + }, { + key: "language", + set: function set(input) { + captions.setLanguage.call(this, input, false); + } + /** + * Get the current track's language + */ + , + get: function get() { + return (captions.getCurrentTrack.call(this) || {}).language; + } + /** + * Toggle picture-in-picture playback on WebKit/MacOS + * TODO: update player with state, support, enabled + * TODO: detect outside changes + */ + + }, { + key: "pip", + set: function set(input) { + // Bail if no support + if (!support.pip) { + return; + } // Toggle based on current state if not passed + + + var toggle = is$1.boolean(input) ? input : !this.pip; // Toggle based on current state + // Safari + + if (is$1.function(this.media.webkitSetPresentationMode)) { + this.media.webkitSetPresentationMode(toggle ? pip.active : pip.inactive); + } // Chrome + + + if (is$1.function(this.media.requestPictureInPicture)) { + if (!this.pip && toggle) { + this.media.requestPictureInPicture(); + } else if (this.pip && !toggle) { + document.exitPictureInPicture(); + } + } + } + /** + * Get the current picture-in-picture state + */ + , + get: function get() { + if (!support.pip) { + return null; + } // Safari + + + if (!is$1.empty(this.media.webkitPresentationMode)) { + return this.media.webkitPresentationMode === pip.active; + } // Chrome + + + return this.media === document.pictureInPictureElement; + } + }], [{ + key: "supported", + value: function supported(type, provider, inline) { + return support.check(type, provider, inline); + } + /** + * Load an SVG sprite into the page + * @param {String} url - URL for the SVG sprite + * @param {String} [id] - Unique ID + */ + + }, { + key: "loadSprite", + value: function loadSprite$1(url, id) { + return loadSprite(url, id); + } + /** + * Setup multiple instances + * @param {*} selector + * @param {Object} options + */ + + }, { + key: "setup", + value: function setup(selector) { + var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; + var targets = null; + + if (is$1.string(selector)) { + targets = Array.from(document.querySelectorAll(selector)); + } else if (is$1.nodeList(selector)) { + targets = Array.from(selector); + } else if (is$1.array(selector)) { + targets = selector.filter(is$1.element); + } + + if (is$1.empty(targets)) { + return null; + } + + return targets.map(function (t) { + return new Plyr(t, options); + }); + } + }]); + + return Plyr; + }(); + + Plyr.defaults = cloneDeep(defaults$1); + // ========================================================================== (function () { @@ -4102,8 +12778,8 @@ typeof navigator === "object" && (function () { var selector = '#player'; var container = document.getElementById('container'); - if (window.shr) { - window.shr.setup({ + if (window.Shr) { + window.Shr.setup('.js-shr-button', { count: { classname: 'button__count' } @@ -4142,7 +12818,7 @@ typeof navigator === "object" && (function () { var player = new Plyr(selector, { debug: true, title: 'View From A Blue Moon', - iconUrl: '../dist/plyr.svg', + iconUrl: 'dist/demo.svg', keyboard: { global: true }, @@ -4158,6 +12834,10 @@ typeof navigator === "object" && (function () { ads: { enabled: env.prod || env.dev, publisherId: '918848828995742' + }, + previewThumbnails: { + enabled: true, + src: ['https://cdn.plyr.io/static/demo/thumbs/100p.vtt', 'https://cdn.plyr.io/static/demo/thumbs/240p.vtt'] } }); // Expose for tinkering in the console @@ -4322,35 +13002,7 @@ typeof navigator === "object" && (function () { if (env.prod) { singleton.config('https://d4ad9866ad834437a4754e23937071e4@sentry.io/305555').install(); - } // Google analytics - // For demo site (https://plyr.io) only - - /* eslint-disable */ - - - if (env.prod) { - (function (i, s, o, g, r, a, m) { - i.GoogleAnalyticsObject = r; - - i[r] = i[r] || function () { - (i[r].q = i[r].q || []).push(arguments); - }; - - i[r].l = 1 * new Date(); - a = s.createElement(o); - m = s.getElementsByTagName(o)[0]; - a.async = 1; - a.src = g; - m.parentNode.insertBefore(a, m); - })(window, document, 'script', 'https://www.google-analytics.com/analytics.js', 'ga'); - - window.ga('create', 'UA-40881672-11', 'auto'); - window.ga('send', 'pageview'); } - /* eslint-enable */ - })(); }()); - -//# sourceMappingURL=demo.js.map diff --git a/demo/dist/demo.js.map b/demo/dist/demo.js.map deleted file mode 100644 index b3de0dea..00000000 --- a/demo/dist/demo.js.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"sources":["node_modules/raven-js/vendor/json-stringify-safe/stringify.js","node_modules/raven-js/src/utils.js","node_modules/raven-js/vendor/TraceKit/tracekit.js","node_modules/raven-js/vendor/md5/md5.js","node_modules/raven-js/src/configError.js","node_modules/raven-js/src/console.js","node_modules/raven-js/src/raven.js","node_modules/raven-js/src/singleton.js","demo/src/js/demo.js"],"names":["global","stringify","_window","isErrorEvent","isDOMError","isDOMException","isError","isObject","isPlainObject","isUndefined","isFunction","isString","isArray","isEmptyObject","each","objectMerge","truncate","objectFrozen","hasKey","joinRegExp","urlencode","uuid4","htmlTreeAsString","isSameException","isSameStacktrace","parseUrl","fill","supportsFetch","supportsReferrerPolicy","serializeKeysForMessage","serializeException","sanitize","require$$0","TraceKit","md5","RavenConfigError","Raven","RavenConstructor","host","window","location","env","prod","dev","document","addEventListener","context","selector","container","getElementById","shr","setup","count","classname","tabClassName","event","target","classList","contains","remove","keyCode","setTimeout","focused","activeElement","add","player","Plyr","debug","title","iconUrl","keyboard","tooltips","controls","captions","active","keys","google","ads","enabled","publisherId","buttons","querySelectorAll","types","video","audio","youtube","vimeo","currentType","hash","replace","historySupport","history","pushState","toggleClass","element","className","state","newSource","type","init","length","source","sources","src","size","poster","tracks","kind","label","srclang","default","provider","Array","from","forEach","button","parentElement","querySelector","cite","setAttribute","removeAttribute","getAttribute","replaceState","config","install","i","s","o","g","r","a","m","GoogleAnalyticsObject","q","push","arguments","l","Date","createElement","getElementsByTagName","async","parentNode","insertBefore","ga"],"mappings":";;;;;;;;;;CAAA;;;;;;;;;;;CAWA,OAAO,GAAG,cAAc,GAAG,SAAS,CAAC;CACrC,oBAAoB,GAAG,UAAU,CAAC;;CAElC,SAAS,OAAO,CAAC,QAAQ,EAAE,MAAM,EAAE;GACjC,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,QAAQ,CAAC,MAAM,EAAE,EAAE,CAAC,EAAE;KACxC,IAAI,QAAQ,CAAC,CAAC,CAAC,KAAK,MAAM,EAAE,OAAO,CAAC,CAAC;IACtC;GACD,OAAO,CAAC,CAAC,CAAC;EACX;;CAED,SAAS,SAAS,CAAC,GAAG,EAAE,QAAQ,EAAE,MAAM,EAAE,aAAa,EAAE;GACvD,OAAO,IAAI,CAAC,SAAS,CAAC,GAAG,EAAE,UAAU,CAAC,QAAQ,EAAE,aAAa,CAAC,EAAE,MAAM,CAAC,CAAC;EACzE;;;CAGD,SAAS,cAAc,CAAC,KAAK,EAAE;GAC7B,IAAI,GAAG,GAAG;;KAER,KAAK,EAAE,KAAK,CAAC,KAAK;KAClB,OAAO,EAAE,KAAK,CAAC,OAAO;KACtB,IAAI,EAAE,KAAK,CAAC,IAAI;IACjB,CAAC;;GAEF,KAAK,IAAI,CAAC,IAAI,KAAK,EAAE;KACnB,IAAI,MAAM,CAAC,SAAS,CAAC,cAAc,CAAC,IAAI,CAAC,KAAK,EAAE,CAAC,CAAC,EAAE;OAClD,GAAG,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC,CAAC,CAAC,CAAC;MACnB;IACF;;GAED,OAAO,GAAG,CAAC;EACZ;;CAED,SAAS,UAAU,CAAC,QAAQ,EAAE,aAAa,EAAE;GAC3C,IAAI,KAAK,GAAG,EAAE,CAAC;GACf,IAAI,IAAI,GAAG,EAAE,CAAC;;GAEd,IAAI,aAAa,IAAI,IAAI,EAAE;KACzB,aAAa,GAAG,SAAS,GAAG,EAAE,KAAK,EAAE;OACnC,IAAI,KAAK,CAAC,CAAC,CAAC,KAAK,KAAK,EAAE;SACtB,OAAO,cAAc,CAAC;QACvB;OACD,OAAO,cAAc,GAAG,IAAI,CAAC,KAAK,CAAC,CAAC,EAAE,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC,CAAC,CAAC,IAAI,CAAC,GAAG,CAAC,GAAG,GAAG,CAAC;MAC9E,CAAC;IACH;;GAED,OAAO,SAAS,GAAG,EAAE,KAAK,EAAE;KAC1B,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,EAAE;OACpB,IAAI,OAAO,GAAG,OAAO,CAAC,KAAK,EAAE,IAAI,CAAC,CAAC;OACnC,CAAC,OAAO,GAAG,KAAK,CAAC,MAAM,CAAC,OAAO,GAAG,CAAC,CAAC,GAAG,KAAK,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;OACxD,CAAC,OAAO,GAAG,IAAI,CAAC,MAAM,CAAC,OAAO,EAAE,QAAQ,EAAE,GAAG,CAAC,GAAG,IAAI,CAAC,IAAI,CAAC,GAAG,CAAC,CAAC;;OAEhE,IAAI,CAAC,OAAO,CAAC,KAAK,EAAE,KAAK,CAAC,EAAE;SAC1B,KAAK,GAAG,aAAa,CAAC,IAAI,CAAC,IAAI,EAAE,GAAG,EAAE,KAAK,CAAC,CAAC;QAC9C;MACF,MAAM;OACL,KAAK,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC;MACnB;;KAED,OAAO,QAAQ,IAAI,IAAI;SACnB,KAAK,YAAY,KAAK,GAAG,cAAc,CAAC,KAAK,CAAC,GAAG,KAAK;SACtD,QAAQ,CAAC,IAAI,CAAC,IAAI,EAAE,GAAG,EAAE,KAAK,CAAC,CAAC;IACrC,CAAC;EACH;;;;CCvED,IAAI,OAAO;GACT,OAAO,MAAM,KAAK,WAAW;OACzB,MAAM;OACN,OAAOA,cAAM,KAAK,WAAW;SAC3BA,cAAM;SACN,OAAO,IAAI,KAAK,WAAW;WACzB,IAAI;WACJ,EAAE,CAAC;;CAEb,SAAS,QAAQ,CAAC,IAAI,EAAE;GACtB,OAAO,OAAO,IAAI,KAAK,QAAQ,IAAI,IAAI,KAAK,IAAI,CAAC;EAClD;;;;CAID,SAAS,OAAO,CAAC,KAAK,EAAE;GACtB,QAAQ,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,KAAK,CAAC;KAC3C,KAAK,gBAAgB;OACnB,OAAO,IAAI,CAAC;KACd,KAAK,oBAAoB;OACvB,OAAO,IAAI,CAAC;KACd,KAAK,uBAAuB;OAC1B,OAAO,IAAI,CAAC;KACd;OACE,OAAO,KAAK,YAAY,KAAK,CAAC;IACjC;EACF;;CAED,SAAS,YAAY,CAAC,KAAK,EAAE;GAC3B,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,KAAK,CAAC,KAAK,qBAAqB,CAAC;EACxE;;CAED,SAAS,UAAU,CAAC,KAAK,EAAE;GACzB,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,KAAK,CAAC,KAAK,mBAAmB,CAAC;EACtE;;CAED,SAAS,cAAc,CAAC,KAAK,EAAE;GAC7B,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,KAAK,CAAC,KAAK,uBAAuB,CAAC;EAC1E;;CAED,SAAS,WAAW,CAAC,IAAI,EAAE;GACzB,OAAO,IAAI,KAAK,KAAK,CAAC,CAAC;EACxB;;CAED,SAAS,UAAU,CAAC,IAAI,EAAE;GACxB,OAAO,OAAO,IAAI,KAAK,UAAU,CAAC;EACnC;;CAED,SAAS,aAAa,CAAC,IAAI,EAAE;GAC3B,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,IAAI,CAAC,KAAK,iBAAiB,CAAC;EACnE;;CAED,SAAS,QAAQ,CAAC,IAAI,EAAE;GACtB,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,IAAI,CAAC,KAAK,iBAAiB,CAAC;EACnE;;CAED,SAAS,OAAO,CAAC,IAAI,EAAE;GACrB,OAAO,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,IAAI,CAAC,KAAK,gBAAgB,CAAC;EAClE;;CAED,SAAS,aAAa,CAAC,IAAI,EAAE;GAC3B,IAAI,CAAC,aAAa,CAAC,IAAI,CAAC,EAAE,OAAO,KAAK,CAAC;;GAEvC,KAAK,IAAI,CAAC,IAAI,IAAI,EAAE;KAClB,IAAI,IAAI,CAAC,cAAc,CAAC,CAAC,CAAC,EAAE;OAC1B,OAAO,KAAK,CAAC;MACd;IACF;GACD,OAAO,IAAI,CAAC;EACb;;CAED,SAAS,kBAAkB,GAAG;GAC5B,IAAI;KACF,IAAI,UAAU,CAAC,EAAE,CAAC,CAAC;KACnB,OAAO,IAAI,CAAC;IACb,CAAC,OAAO,CAAC,EAAE;KACV,OAAO,KAAK,CAAC;IACd;EACF;;CAED,SAAS,gBAAgB,GAAG;GAC1B,IAAI;KACF,IAAI,QAAQ,CAAC,EAAE,CAAC,CAAC;KACjB,OAAO,IAAI,CAAC;IACb,CAAC,OAAO,CAAC,EAAE;KACV,OAAO,KAAK,CAAC;IACd;EACF;;CAED,SAAS,oBAAoB,GAAG;GAC9B,IAAI;KACF,IAAI,YAAY,CAAC,EAAE,CAAC,CAAC;KACrB,OAAO,IAAI,CAAC;IACb,CAAC,OAAO,CAAC,EAAE;KACV,OAAO,KAAK,CAAC;IACd;EACF;;CAED,SAAS,aAAa,GAAG;GACvB,IAAI,EAAE,OAAO,IAAI,OAAO,CAAC,EAAE,OAAO,KAAK,CAAC;;GAExC,IAAI;KACF,IAAI,OAAO,EAAE,CAAC;KACd,IAAI,OAAO,CAAC,EAAE,CAAC,CAAC;KAChB,IAAI,QAAQ,EAAE,CAAC;KACf,OAAO,IAAI,CAAC;IACb,CAAC,OAAO,CAAC,EAAE;KACV,OAAO,KAAK,CAAC;IACd;EACF;;;;;;CAMD,SAAS,sBAAsB,GAAG;GAChC,IAAI,CAAC,aAAa,EAAE,EAAE,OAAO,KAAK,CAAC;;GAEnC,IAAI;;KAEF,IAAI,OAAO,CAAC,YAAY,EAAE;OACxB,cAAc,EAAE,QAAQ;MACzB,CAAC,CAAC;KACH,OAAO,IAAI,CAAC;IACb,CAAC,OAAO,CAAC,EAAE;KACV,OAAO,KAAK,CAAC;IACd;EACF;;CAED,SAAS,6BAA6B,GAAG;GACvC,OAAO,OAAO,qBAAqB,KAAK,UAAU,CAAC;EACpD;;CAED,SAAS,eAAe,CAAC,QAAQ,EAAE;GACjC,SAAS,YAAY,CAAC,IAAI,EAAE,QAAQ,EAAE;KACpC,IAAI,cAAc,GAAG,QAAQ,CAAC,IAAI,CAAC,IAAI,IAAI,CAAC;KAC5C,IAAI,QAAQ,EAAE;OACZ,OAAO,QAAQ,CAAC,cAAc,CAAC,IAAI,cAAc,CAAC;MACnD;KACD,OAAO,cAAc,CAAC;IACvB;;GAED,OAAO,YAAY,CAAC;EACrB;;CAED,SAAS,IAAI,CAAC,GAAG,EAAE,QAAQ,EAAE;GAC3B,IAAI,CAAC,EAAE,CAAC,CAAC;;GAET,IAAI,WAAW,CAAC,GAAG,CAAC,MAAM,CAAC,EAAE;KAC3B,KAAK,CAAC,IAAI,GAAG,EAAE;OACb,IAAI,MAAM,CAAC,GAAG,EAAE,CAAC,CAAC,EAAE;SAClB,QAAQ,CAAC,IAAI,CAAC,IAAI,EAAE,CAAC,EAAE,GAAG,CAAC,CAAC,CAAC,CAAC,CAAC;QAChC;MACF;IACF,MAAM;KACL,CAAC,GAAG,GAAG,CAAC,MAAM,CAAC;KACf,IAAI,CAAC,EAAE;OACL,KAAK,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,CAAC,EAAE,CAAC,EAAE,EAAE;SACtB,QAAQ,CAAC,IAAI,CAAC,IAAI,EAAE,CAAC,EAAE,GAAG,CAAC,CAAC,CAAC,CAAC,CAAC;QAChC;MACF;IACF;EACF;;CAED,SAAS,WAAW,CAAC,IAAI,EAAE,IAAI,EAAE;GAC/B,IAAI,CAAC,IAAI,EAAE;KACT,OAAO,IAAI,CAAC;IACb;GACD,IAAI,CAAC,IAAI,EAAE,SAAS,GAAG,EAAE,KAAK,EAAE;KAC9B,IAAI,CAAC,GAAG,CAAC,GAAG,KAAK,CAAC;IACnB,CAAC,CAAC;GACH,OAAO,IAAI,CAAC;EACb;;;;;;;;;;CAUD,SAAS,YAAY,CAAC,GAAG,EAAE;GACzB,IAAI,CAAC,MAAM,CAAC,QAAQ,EAAE;KACpB,OAAO,KAAK,CAAC;IACd;GACD,OAAO,MAAM,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC;EAC7B;;CAED,SAAS,QAAQ,CAAC,GAAG,EAAE,GAAG,EAAE;GAC1B,IAAI,OAAO,GAAG,KAAK,QAAQ,EAAE;KAC3B,MAAM,IAAI,KAAK,CAAC,wDAAwD,CAAC,CAAC;IAC3E;GACD,IAAI,OAAO,GAAG,KAAK,QAAQ,IAAI,GAAG,KAAK,CAAC,EAAE;KACxC,OAAO,GAAG,CAAC;IACZ;GACD,OAAO,GAAG,CAAC,MAAM,IAAI,GAAG,GAAG,GAAG,GAAG,GAAG,CAAC,MAAM,CAAC,CAAC,EAAE,GAAG,CAAC,GAAG,QAAQ,CAAC;EAChE;;;;;;;;;CASD,SAAS,MAAM,CAAC,MAAM,EAAE,GAAG,EAAE;GAC3B,OAAO,MAAM,CAAC,SAAS,CAAC,cAAc,CAAC,IAAI,CAAC,MAAM,EAAE,GAAG,CAAC,CAAC;EAC1D;;CAED,SAAS,UAAU,CAAC,QAAQ,EAAE;;;GAG5B,IAAI,OAAO,GAAG,EAAE;KACd,CAAC,GAAG,CAAC;KACL,GAAG,GAAG,QAAQ,CAAC,MAAM;KACrB,OAAO,CAAC;;GAEV,OAAO,CAAC,GAAG,GAAG,EAAE,CAAC,EAAE,EAAE;KACnB,OAAO,GAAG,QAAQ,CAAC,CAAC,CAAC,CAAC;KACtB,IAAI,QAAQ,CAAC,OAAO,CAAC,EAAE;;;OAGrB,OAAO,CAAC,IAAI,CAAC,OAAO,CAAC,OAAO,CAAC,6BAA6B,EAAE,MAAM,CAAC,CAAC,CAAC;MACtE,MAAM,IAAI,OAAO,IAAI,OAAO,CAAC,MAAM,EAAE;;OAEpC,OAAO,CAAC,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,CAAC;MAC9B;;IAEF;GACD,OAAO,IAAI,MAAM,CAAC,OAAO,CAAC,IAAI,CAAC,GAAG,CAAC,EAAE,GAAG,CAAC,CAAC;EAC3C;;CAED,SAAS,SAAS,CAAC,CAAC,EAAE;GACpB,IAAI,KAAK,GAAG,EAAE,CAAC;GACf,IAAI,CAAC,CAAC,EAAE,SAAS,GAAG,EAAE,KAAK,EAAE;KAC3B,KAAK,CAAC,IAAI,CAAC,kBAAkB,CAAC,GAAG,CAAC,GAAG,GAAG,GAAG,kBAAkB,CAAC,KAAK,CAAC,CAAC,CAAC;IACvE,CAAC,CAAC;GACH,OAAO,KAAK,CAAC,IAAI,CAAC,GAAG,CAAC,CAAC;EACxB;;;;;CAKD,SAAS,QAAQ,CAAC,GAAG,EAAE;GACrB,IAAI,OAAO,GAAG,KAAK,QAAQ,EAAE,OAAO,EAAE,CAAC;GACvC,IAAI,KAAK,GAAG,GAAG,CAAC,KAAK,CAAC,gEAAgE,CAAC,CAAC;;;GAGxF,IAAI,KAAK,GAAG,KAAK,CAAC,CAAC,CAAC,IAAI,EAAE,CAAC;GAC3B,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC,CAAC,IAAI,EAAE,CAAC;GAC9B,OAAO;KACL,QAAQ,EAAE,KAAK,CAAC,CAAC,CAAC;KAClB,IAAI,EAAE,KAAK,CAAC,CAAC,CAAC;KACd,IAAI,EAAE,KAAK,CAAC,CAAC,CAAC;KACd,QAAQ,EAAE,KAAK,CAAC,CAAC,CAAC,GAAG,KAAK,GAAG,QAAQ;IACtC,CAAC;EACH;CACD,SAAS,KAAK,GAAG;GACf,IAAI,MAAM,GAAG,OAAO,CAAC,MAAM,IAAI,OAAO,CAAC,QAAQ,CAAC;;GAEhD,IAAI,CAAC,WAAW,CAAC,MAAM,CAAC,IAAI,MAAM,CAAC,eAAe,EAAE;;;KAGlD,IAAI,GAAG,GAAG,IAAI,WAAW,CAAC,CAAC,CAAC,CAAC;KAC7B,MAAM,CAAC,eAAe,CAAC,GAAG,CAAC,CAAC;;;KAG5B,GAAG,CAAC,CAAC,CAAC,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,GAAG,KAAK,IAAI,MAAM,CAAC;;KAEnC,GAAG,CAAC,CAAC,CAAC,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,GAAG,MAAM,IAAI,MAAM,CAAC;;KAEpC,IAAI,GAAG,GAAG,SAAS,GAAG,EAAE;OACtB,IAAI,CAAC,GAAG,GAAG,CAAC,QAAQ,CAAC,EAAE,CAAC,CAAC;OACzB,OAAO,CAAC,CAAC,MAAM,GAAG,CAAC,EAAE;SACnB,CAAC,GAAG,GAAG,GAAG,CAAC,CAAC;QACb;OACD,OAAO,CAAC,CAAC;MACV,CAAC;;KAEF;OACE,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;OACX,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;OACX,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;OACX,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;OACX,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;OACX,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;OACX,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;OACX,GAAG,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;OACX;IACH,MAAM;;KAEL,OAAO,kCAAkC,CAAC,OAAO,CAAC,OAAO,EAAE,SAAS,CAAC,EAAE;OACrE,IAAI,CAAC,GAAG,CAAC,IAAI,CAAC,MAAM,EAAE,GAAG,EAAE,IAAI,CAAC;SAC9B,CAAC,GAAG,CAAC,KAAK,GAAG,GAAG,CAAC,GAAG,CAAC,CAAC,GAAG,GAAG,IAAI,GAAG,CAAC;OACtC,OAAO,CAAC,CAAC,QAAQ,CAAC,EAAE,CAAC,CAAC;MACvB,CAAC,CAAC;IACJ;EACF;;;;;;;;;CASD,SAAS,gBAAgB,CAAC,IAAI,EAAE;;GAE9B,IAAI,mBAAmB,GAAG,CAAC;KACzB,cAAc,GAAG,EAAE;KACnB,GAAG,GAAG,EAAE;KACR,MAAM,GAAG,CAAC;KACV,GAAG,GAAG,CAAC;KACP,SAAS,GAAG,KAAK;KACjB,SAAS,GAAG,SAAS,CAAC,MAAM;KAC5B,OAAO,CAAC;;GAEV,OAAO,IAAI,IAAI,MAAM,EAAE,GAAG,mBAAmB,EAAE;KAC7C,OAAO,GAAG,mBAAmB,CAAC,IAAI,CAAC,CAAC;;;;;KAKpC;OACE,OAAO,KAAK,MAAM;QACjB,MAAM,GAAG,CAAC,IAAI,GAAG,GAAG,GAAG,CAAC,MAAM,GAAG,SAAS,GAAG,OAAO,CAAC,MAAM,IAAI,cAAc,CAAC;OAC/E;OACA,MAAM;MACP;;KAED,GAAG,CAAC,IAAI,CAAC,OAAO,CAAC,CAAC;;KAElB,GAAG,IAAI,OAAO,CAAC,MAAM,CAAC;KACtB,IAAI,GAAG,IAAI,CAAC,UAAU,CAAC;IACxB;;GAED,OAAO,GAAG,CAAC,OAAO,EAAE,CAAC,IAAI,CAAC,SAAS,CAAC,CAAC;EACtC;;;;;;;;CAQD,SAAS,mBAAmB,CAAC,IAAI,EAAE;GACjC,IAAI,GAAG,GAAG,EAAE;KACV,SAAS;KACT,OAAO;KACP,GAAG;KACH,IAAI;KACJ,CAAC,CAAC;;GAEJ,IAAI,CAAC,IAAI,IAAI,CAAC,IAAI,CAAC,OAAO,EAAE;KAC1B,OAAO,EAAE,CAAC;IACX;;GAED,GAAG,CAAC,IAAI,CAAC,IAAI,CAAC,OAAO,CAAC,WAAW,EAAE,CAAC,CAAC;GACrC,IAAI,IAAI,CAAC,EAAE,EAAE;KACX,GAAG,CAAC,IAAI,CAAC,GAAG,GAAG,IAAI,CAAC,EAAE,CAAC,CAAC;IACzB;;GAED,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC;GAC3B,IAAI,SAAS,IAAI,QAAQ,CAAC,SAAS,CAAC,EAAE;KACpC,OAAO,GAAG,SAAS,CAAC,KAAK,CAAC,KAAK,CAAC,CAAC;KACjC,KAAK,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,OAAO,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;OACnC,GAAG,CAAC,IAAI,CAAC,GAAG,GAAG,OAAO,CAAC,CAAC,CAAC,CAAC,CAAC;MAC5B;IACF;GACD,IAAI,aAAa,GAAG,CAAC,MAAM,EAAE,MAAM,EAAE,OAAO,EAAE,KAAK,CAAC,CAAC;GACrD,KAAK,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,aAAa,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;KACzC,GAAG,GAAG,aAAa,CAAC,CAAC,CAAC,CAAC;KACvB,IAAI,GAAG,IAAI,CAAC,YAAY,CAAC,GAAG,CAAC,CAAC;KAC9B,IAAI,IAAI,EAAE;OACR,GAAG,CAAC,IAAI,CAAC,GAAG,GAAG,GAAG,GAAG,IAAI,GAAG,IAAI,GAAG,IAAI,CAAC,CAAC;MAC1C;IACF;GACD,OAAO,GAAG,CAAC,IAAI,CAAC,EAAE,CAAC,CAAC;EACrB;;;;;CAKD,SAAS,eAAe,CAAC,CAAC,EAAE,CAAC,EAAE;GAC7B,OAAO,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC,CAAC;EACtB;;;;;CAKD,SAAS,eAAe,CAAC,CAAC,EAAE,CAAC,EAAE;GAC7B,OAAO,WAAW,CAAC,CAAC,CAAC,IAAI,WAAW,CAAC,CAAC,CAAC,CAAC;EACzC;;;;;CAKD,SAAS,eAAe,CAAC,GAAG,EAAE,GAAG,EAAE;GACjC,IAAI,eAAe,CAAC,GAAG,EAAE,GAAG,CAAC,EAAE,OAAO,KAAK,CAAC;;GAE5C,GAAG,GAAG,GAAG,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC;GACpB,GAAG,GAAG,GAAG,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC;;GAEpB,IAAI,GAAG,CAAC,IAAI,KAAK,GAAG,CAAC,IAAI,IAAI,GAAG,CAAC,KAAK,KAAK,GAAG,CAAC,KAAK,EAAE,OAAO,KAAK,CAAC;;;GAGnE,IAAI,eAAe,CAAC,GAAG,CAAC,UAAU,EAAE,GAAG,CAAC,UAAU,CAAC,EAAE,OAAO,KAAK,CAAC;;GAElE,OAAO,gBAAgB,CAAC,GAAG,CAAC,UAAU,EAAE,GAAG,CAAC,UAAU,CAAC,CAAC;EACzD;;;;;CAKD,SAAS,gBAAgB,CAAC,MAAM,EAAE,MAAM,EAAE;GACxC,IAAI,eAAe,CAAC,MAAM,EAAE,MAAM,CAAC,EAAE,OAAO,KAAK,CAAC;;GAElD,IAAI,OAAO,GAAG,MAAM,CAAC,MAAM,CAAC;GAC5B,IAAI,OAAO,GAAG,MAAM,CAAC,MAAM,CAAC;;;GAG5B,IAAI,OAAO,KAAK,SAAS,IAAI,OAAO,KAAK,SAAS,EAAE,OAAO,KAAK,CAAC;;;GAGjE,IAAI,OAAO,CAAC,MAAM,KAAK,OAAO,CAAC,MAAM,EAAE,OAAO,KAAK,CAAC;;;GAGpD,IAAI,CAAC,EAAE,CAAC,CAAC;GACT,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,OAAO,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;KACvC,CAAC,GAAG,OAAO,CAAC,CAAC,CAAC,CAAC;KACf,CAAC,GAAG,OAAO,CAAC,CAAC,CAAC,CAAC;KACf;OACE,CAAC,CAAC,QAAQ,KAAK,CAAC,CAAC,QAAQ;OACzB,CAAC,CAAC,MAAM,KAAK,CAAC,CAAC,MAAM;OACrB,CAAC,CAAC,KAAK,KAAK,CAAC,CAAC,KAAK;OACnB,CAAC,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC,UAAU,CAAC;;OAE/B,OAAO,KAAK,CAAC;IAChB;GACD,OAAO,IAAI,CAAC;EACb;;;;;;;;;CASD,SAAS,IAAI,CAAC,GAAG,EAAE,IAAI,EAAE,WAAW,EAAE,KAAK,EAAE;GAC3C,IAAI,GAAG,IAAI,IAAI,EAAE,OAAO;GACxB,IAAI,IAAI,GAAG,GAAG,CAAC,IAAI,CAAC,CAAC;GACrB,GAAG,CAAC,IAAI,CAAC,GAAG,WAAW,CAAC,IAAI,CAAC,CAAC;GAC9B,GAAG,CAAC,IAAI,CAAC,CAAC,SAAS,GAAG,IAAI,CAAC;GAC3B,GAAG,CAAC,IAAI,CAAC,CAAC,QAAQ,GAAG,IAAI,CAAC;GAC1B,IAAI,KAAK,EAAE;KACT,KAAK,CAAC,IAAI,CAAC,CAAC,GAAG,EAAE,IAAI,EAAE,IAAI,CAAC,CAAC,CAAC;IAC/B;EACF;;;;;;;;CAQD,SAAS,QAAQ,CAAC,KAAK,EAAE,SAAS,EAAE;GAClC,IAAI,CAAC,OAAO,CAAC,KAAK,CAAC,EAAE,OAAO,EAAE,CAAC;;GAE/B,IAAI,MAAM,GAAG,EAAE,CAAC;;GAEhB,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;KACrC,IAAI;OACF,MAAM,CAAC,IAAI,CAAC,MAAM,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,CAAC,CAAC;MAC/B,CAAC,OAAO,CAAC,EAAE;OACV,MAAM,CAAC,IAAI,CAAC,8BAA8B,CAAC,CAAC;MAC7C;IACF;;GAED,OAAO,MAAM,CAAC,IAAI,CAAC,SAAS,CAAC,CAAC;EAC/B;;;CAGD,IAAI,6BAA6B,GAAG,CAAC,CAAC;;CAEtC,IAAI,4BAA4B,GAAG,EAAE,GAAG,IAAI,CAAC;CAC7C,IAAI,yBAAyB,GAAG,EAAE,CAAC;;CAEnC,SAAS,UAAU,CAAC,KAAK,EAAE;GACzB,OAAO,CAAC,CAAC,SAAS,CAAC,KAAK,CAAC,CAAC,KAAK,CAAC,OAAO,CAAC,CAAC,MAAM,CAAC;EACjD;;CAED,SAAS,QAAQ,CAAC,KAAK,EAAE;GACvB,OAAO,UAAU,CAAC,IAAI,CAAC,SAAS,CAAC,KAAK,CAAC,CAAC,CAAC;EAC1C;;CAED,SAAS,cAAc,CAAC,KAAK,EAAE;GAC7B,IAAI,OAAO,KAAK,KAAK,QAAQ,EAAE;KAC7B,IAAI,SAAS,GAAG,EAAE,CAAC;KACnB,OAAO,QAAQ,CAAC,KAAK,EAAE,SAAS,CAAC,CAAC;IACnC,MAAM;KACL,OAAO,KAAK,KAAK,QAAQ;KACzB,OAAO,KAAK,KAAK,SAAS;KAC1B,OAAO,KAAK,KAAK,WAAW;KAC5B;KACA,OAAO,KAAK,CAAC;IACd;;GAED,IAAI,IAAI,GAAG,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC;;;GAGjD,IAAI,IAAI,KAAK,iBAAiB,EAAE,OAAO,UAAU,CAAC;GAClD,IAAI,IAAI,KAAK,gBAAgB,EAAE,OAAO,SAAS,CAAC;GAChD,IAAI,IAAI,KAAK,mBAAmB;KAC9B,OAAO,KAAK,CAAC,IAAI,GAAG,aAAa,GAAG,KAAK,CAAC,IAAI,GAAG,GAAG,GAAG,YAAY,CAAC;;GAEtE,OAAO,KAAK,CAAC;EACd;;CAED,SAAS,eAAe,CAAC,KAAK,EAAE,KAAK,EAAE;GACrC,IAAI,KAAK,KAAK,CAAC,EAAE,OAAO,cAAc,CAAC,KAAK,CAAC,CAAC;;GAE9C,IAAI,aAAa,CAAC,KAAK,CAAC,EAAE;KACxB,OAAO,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,MAAM,CAAC,SAAS,GAAG,EAAE,GAAG,EAAE;OAClD,GAAG,CAAC,GAAG,CAAC,GAAG,eAAe,CAAC,KAAK,CAAC,GAAG,CAAC,EAAE,KAAK,GAAG,CAAC,CAAC,CAAC;OAClD,OAAO,GAAG,CAAC;MACZ,EAAE,EAAE,CAAC,CAAC;IACR,MAAM,IAAI,KAAK,CAAC,OAAO,CAAC,KAAK,CAAC,EAAE;KAC/B,OAAO,KAAK,CAAC,GAAG,CAAC,SAAS,GAAG,EAAE;OAC7B,OAAO,eAAe,CAAC,GAAG,EAAE,KAAK,GAAG,CAAC,CAAC,CAAC;MACxC,CAAC,CAAC;IACJ;;GAED,OAAO,cAAc,CAAC,KAAK,CAAC,CAAC;EAC9B;;CAED,SAAS,kBAAkB,CAAC,EAAE,EAAE,KAAK,EAAE,OAAO,EAAE;GAC9C,IAAI,CAAC,aAAa,CAAC,EAAE,CAAC,EAAE,OAAO,EAAE,CAAC;;GAElC,KAAK,GAAG,OAAO,KAAK,KAAK,QAAQ,GAAG,6BAA6B,GAAG,KAAK,CAAC;GAC1E,OAAO,GAAG,OAAO,KAAK,KAAK,QAAQ,GAAG,4BAA4B,GAAG,OAAO,CAAC;;GAE7E,IAAI,UAAU,GAAG,eAAe,CAAC,EAAE,EAAE,KAAK,CAAC,CAAC;;GAE5C,IAAI,QAAQ,CAACC,WAAS,CAAC,UAAU,CAAC,CAAC,GAAG,OAAO,EAAE;KAC7C,OAAO,kBAAkB,CAAC,EAAE,EAAE,KAAK,GAAG,CAAC,CAAC,CAAC;IAC1C;;GAED,OAAO,UAAU,CAAC;EACnB;;CAED,SAAS,uBAAuB,CAAC,IAAI,EAAE,SAAS,EAAE;GAChD,IAAI,OAAO,IAAI,KAAK,QAAQ,IAAI,OAAO,IAAI,KAAK,QAAQ,EAAE,OAAO,IAAI,CAAC,QAAQ,EAAE,CAAC;GACjF,IAAI,CAAC,KAAK,CAAC,OAAO,CAAC,IAAI,CAAC,EAAE,OAAO,EAAE,CAAC;;GAEpC,IAAI,GAAG,IAAI,CAAC,MAAM,CAAC,SAAS,GAAG,EAAE;KAC/B,OAAO,OAAO,GAAG,KAAK,QAAQ,CAAC;IAChC,CAAC,CAAC;GACH,IAAI,IAAI,CAAC,MAAM,KAAK,CAAC,EAAE,OAAO,sBAAsB,CAAC;;GAErD,SAAS,GAAG,OAAO,SAAS,KAAK,QAAQ,GAAG,yBAAyB,GAAG,SAAS,CAAC;GAClF,IAAI,IAAI,CAAC,CAAC,CAAC,CAAC,MAAM,IAAI,SAAS,EAAE,OAAO,IAAI,CAAC,CAAC,CAAC,CAAC;;GAEhD,KAAK,IAAI,QAAQ,GAAG,IAAI,CAAC,MAAM,EAAE,QAAQ,GAAG,CAAC,EAAE,QAAQ,EAAE,EAAE;KACzD,IAAI,UAAU,GAAG,IAAI,CAAC,KAAK,CAAC,CAAC,EAAE,QAAQ,CAAC,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;KACpD,IAAI,UAAU,CAAC,MAAM,GAAG,SAAS,EAAE,SAAS;KAC5C,IAAI,QAAQ,KAAK,IAAI,CAAC,MAAM,EAAE,OAAO,UAAU,CAAC;KAChD,OAAO,UAAU,GAAG,QAAQ,CAAC;IAC9B;;GAED,OAAO,EAAE,CAAC;EACX;;CAED,SAAS,QAAQ,CAAC,KAAK,EAAE,YAAY,EAAE;GACrC,IAAI,CAAC,OAAO,CAAC,YAAY,CAAC,KAAK,OAAO,CAAC,YAAY,CAAC,IAAI,YAAY,CAAC,MAAM,KAAK,CAAC,CAAC;KAChF,OAAO,KAAK,CAAC;;GAEf,IAAI,cAAc,GAAG,UAAU,CAAC,YAAY,CAAC,CAAC;GAC9C,IAAI,YAAY,GAAG,UAAU,CAAC;GAC9B,IAAI,SAAS,CAAC;;GAEd,IAAI;KACF,SAAS,GAAG,IAAI,CAAC,KAAK,CAACA,WAAS,CAAC,KAAK,CAAC,CAAC,CAAC;IAC1C,CAAC,OAAO,GAAG,EAAE;KACZ,OAAO,KAAK,CAAC;IACd;;GAED,SAAS,cAAc,CAAC,WAAW,EAAE;KACnC,IAAI,OAAO,CAAC,WAAW,CAAC,EAAE;OACxB,OAAO,WAAW,CAAC,GAAG,CAAC,SAAS,GAAG,EAAE;SACnC,OAAO,cAAc,CAAC,GAAG,CAAC,CAAC;QAC5B,CAAC,CAAC;MACJ;;KAED,IAAI,aAAa,CAAC,WAAW,CAAC,EAAE;OAC9B,OAAO,MAAM,CAAC,IAAI,CAAC,WAAW,CAAC,CAAC,MAAM,CAAC,SAAS,GAAG,EAAE,CAAC,EAAE;SACtD,IAAI,cAAc,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE;WAC1B,GAAG,CAAC,CAAC,CAAC,GAAG,YAAY,CAAC;UACvB,MAAM;WACL,GAAG,CAAC,CAAC,CAAC,GAAG,cAAc,CAAC,WAAW,CAAC,CAAC,CAAC,CAAC,CAAC;UACzC;SACD,OAAO,GAAG,CAAC;QACZ,EAAE,EAAE,CAAC,CAAC;MACR;;KAED,OAAO,WAAW,CAAC;IACpB;;GAED,OAAO,cAAc,CAAC,SAAS,CAAC,CAAC;EAClC;;CAED,SAAc,GAAG;GACf,QAAQ,EAAE,QAAQ;GAClB,OAAO,EAAE,OAAO;GAChB,YAAY,EAAE,YAAY;GAC1B,UAAU,EAAE,UAAU;GACtB,cAAc,EAAE,cAAc;GAC9B,WAAW,EAAE,WAAW;GACxB,UAAU,EAAE,UAAU;GACtB,aAAa,EAAE,aAAa;GAC5B,QAAQ,EAAE,QAAQ;GAClB,OAAO,EAAE,OAAO;GAChB,aAAa,EAAE,aAAa;GAC5B,kBAAkB,EAAE,kBAAkB;GACtC,gBAAgB,EAAE,gBAAgB;GAClC,oBAAoB,EAAE,oBAAoB;GAC1C,aAAa,EAAE,aAAa;GAC5B,sBAAsB,EAAE,sBAAsB;GAC9C,6BAA6B,EAAE,6BAA6B;GAC5D,eAAe,EAAE,eAAe;GAChC,IAAI,EAAE,IAAI;GACV,WAAW,EAAE,WAAW;GACxB,QAAQ,EAAE,QAAQ;GAClB,YAAY,EAAE,YAAY;GAC1B,MAAM,EAAE,MAAM;GACd,UAAU,EAAE,UAAU;GACtB,SAAS,EAAE,SAAS;GACpB,KAAK,EAAE,KAAK;GACZ,gBAAgB,EAAE,gBAAgB;GAClC,mBAAmB,EAAE,mBAAmB;GACxC,eAAe,EAAE,eAAe;GAChC,gBAAgB,EAAE,gBAAgB;GAClC,QAAQ,EAAE,QAAQ;GAClB,IAAI,EAAE,IAAI;GACV,QAAQ,EAAE,QAAQ;GAClB,kBAAkB,EAAE,kBAAkB;GACtC,uBAAuB,EAAE,uBAAuB;GAChD,QAAQ,EAAE,QAAQ;EACnB,CAAC;;CCzoBF;;;;;;;;;;CAUA,IAAI,QAAQ,GAAG;GACb,mBAAmB,EAAE,IAAI;GACzB,KAAK,EAAE,KAAK;EACb,CAAC;;;CAGF,IAAIC,SAAO;GACT,OAAO,MAAM,KAAK,WAAW;OACzB,MAAM;OACN,OAAOF,cAAM,KAAK,WAAW,GAAGA,cAAM,GAAG,OAAO,IAAI,KAAK,WAAW,GAAG,IAAI,GAAG,EAAE,CAAC;;;CAGvF,IAAI,MAAM,GAAG,EAAE,CAAC,KAAK,CAAC;CACtB,IAAI,gBAAgB,GAAG,GAAG,CAAC;;;CAG3B,IAAI,cAAc,GAAG,yGAAyG,CAAC;;CAE/H,SAAS,eAAe,GAAG;GACzB,IAAI,OAAO,QAAQ,KAAK,WAAW,IAAI,QAAQ,CAAC,QAAQ,IAAI,IAAI,EAAE,OAAO,EAAE,CAAC;GAC5E,OAAO,QAAQ,CAAC,QAAQ,CAAC,IAAI,CAAC;EAC/B;;CAED,SAAS,iBAAiB,GAAG;GAC3B,IAAI,OAAO,QAAQ,KAAK,WAAW,IAAI,QAAQ,CAAC,QAAQ,IAAI,IAAI,EAAE,OAAO,EAAE,CAAC;;;GAG5E,IAAI,CAAC,QAAQ,CAAC,QAAQ,CAAC,MAAM,EAAE;KAC7B;OACE,QAAQ,CAAC,QAAQ,CAAC,QAAQ;OAC1B,IAAI;OACJ,QAAQ,CAAC,QAAQ,CAAC,QAAQ;QACzB,QAAQ,CAAC,QAAQ,CAAC,IAAI,GAAG,GAAG,GAAG,QAAQ,CAAC,QAAQ,CAAC,IAAI,GAAG,EAAE,CAAC;OAC5D;IACH;;GAED,OAAO,QAAQ,CAAC,QAAQ,CAAC,MAAM,CAAC;EACjC;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;CAyCD,QAAQ,CAAC,MAAM,GAAG,CAAC,SAAS,mBAAmB,GAAG;GAChD,IAAI,QAAQ,GAAG,EAAE;KACf,QAAQ,GAAG,IAAI;KACf,aAAa,GAAG,IAAI;KACpB,kBAAkB,GAAG,IAAI,CAAC;;;;;;GAM5B,SAAS,SAAS,CAAC,OAAO,EAAE;KAC1B,oBAAoB,EAAE,CAAC;KACvB,QAAQ,CAAC,IAAI,CAAC,OAAO,CAAC,CAAC;IACxB;;;;;;GAMD,SAAS,WAAW,CAAC,OAAO,EAAE;KAC5B,KAAK,IAAI,CAAC,GAAG,QAAQ,CAAC,MAAM,GAAG,CAAC,EAAE,CAAC,IAAI,CAAC,EAAE,EAAE,CAAC,EAAE;OAC7C,IAAI,QAAQ,CAAC,CAAC,CAAC,KAAK,OAAO,EAAE;SAC3B,QAAQ,CAAC,MAAM,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC;QACvB;MACF;IACF;;;;;GAKD,SAAS,cAAc,GAAG;KACxB,sBAAsB,EAAE,CAAC;KACzB,QAAQ,GAAG,EAAE,CAAC;IACf;;;;;;GAMD,SAAS,cAAc,CAAC,KAAK,EAAE,aAAa,EAAE;KAC5C,IAAI,SAAS,GAAG,IAAI,CAAC;KACrB,IAAI,aAAa,IAAI,CAAC,QAAQ,CAAC,mBAAmB,EAAE;OAClD,OAAO;MACR;KACD,KAAK,IAAI,CAAC,IAAI,QAAQ,EAAE;OACtB,IAAI,QAAQ,CAAC,cAAc,CAAC,CAAC,CAAC,EAAE;SAC9B,IAAI;WACF,QAAQ,CAAC,CAAC,CAAC,CAAC,KAAK,CAAC,IAAI,EAAE,CAAC,KAAK,CAAC,CAAC,MAAM,CAAC,MAAM,CAAC,IAAI,CAAC,SAAS,EAAE,CAAC,CAAC,CAAC,CAAC,CAAC;UACpE,CAAC,OAAO,KAAK,EAAE;WACd,SAAS,GAAG,KAAK,CAAC;UACnB;QACF;MACF;;KAED,IAAI,SAAS,EAAE;OACb,MAAM,SAAS,CAAC;MACjB;IACF;;GAED,IAAI,kBAAkB,EAAE,wBAAwB,CAAC;;;;;;;;;;;;;GAajD,SAAS,qBAAqB,CAAC,GAAG,EAAE,GAAG,EAAE,MAAM,EAAE,KAAK,EAAE,EAAE,EAAE;KAC1D,IAAI,KAAK,GAAG,IAAI,CAAC;;KAEjB,IAAI,SAAS,GAAG,KAAK,CAAC,YAAY,CAAC,EAAE,CAAC,GAAG,EAAE,CAAC,KAAK,GAAG,EAAE,CAAC;;KAEvD,IAAI,OAAO,GAAG,KAAK,CAAC,YAAY,CAAC,GAAG,CAAC,GAAG,GAAG,CAAC,OAAO,GAAG,GAAG,CAAC;;KAE1D,IAAI,kBAAkB,EAAE;OACtB,QAAQ,CAAC,iBAAiB,CAAC,mCAAmC;SAC5D,kBAAkB;SAClB,GAAG;SACH,MAAM;SACN,OAAO;QACR,CAAC;OACF,oBAAoB,EAAE,CAAC;MACxB,MAAM,IAAI,SAAS,IAAI,KAAK,CAAC,OAAO,CAAC,SAAS,CAAC,EAAE;;;;;;OAMhD,KAAK,GAAG,QAAQ,CAAC,iBAAiB,CAAC,SAAS,CAAC,CAAC;OAC9C,cAAc,CAAC,KAAK,EAAE,IAAI,CAAC,CAAC;MAC7B,MAAM;OACL,IAAI,QAAQ,GAAG;SACb,GAAG,EAAE,GAAG;SACR,IAAI,EAAE,MAAM;SACZ,MAAM,EAAE,KAAK;QACd,CAAC;;OAEF,IAAI,IAAI,GAAG,SAAS,CAAC;OACrB,IAAI,MAAM,CAAC;;OAEX,IAAI,EAAE,CAAC,QAAQ,CAAC,IAAI,CAAC,OAAO,CAAC,KAAK,iBAAiB,EAAE;SACnD,IAAI,MAAM,GAAG,OAAO,CAAC,KAAK,CAAC,cAAc,CAAC,CAAC;SAC3C,IAAI,MAAM,EAAE;WACV,IAAI,GAAG,MAAM,CAAC,CAAC,CAAC,CAAC;WACjB,OAAO,GAAG,MAAM,CAAC,CAAC,CAAC,CAAC;UACrB;QACF;;OAED,QAAQ,CAAC,IAAI,GAAG,gBAAgB,CAAC;;OAEjC,KAAK,GAAG;SACN,IAAI,EAAE,IAAI;SACV,OAAO,EAAE,OAAO;SAChB,GAAG,EAAE,eAAe,EAAE;SACtB,KAAK,EAAE,CAAC,QAAQ,CAAC;QAClB,CAAC;OACF,cAAc,CAAC,KAAK,EAAE,IAAI,CAAC,CAAC;MAC7B;;KAED,IAAI,kBAAkB,EAAE;OACtB,OAAO,kBAAkB,CAAC,KAAK,CAAC,IAAI,EAAE,SAAS,CAAC,CAAC;MAClD;;KAED,OAAO,KAAK,CAAC;IACd;;GAED,SAAS,oBAAoB,GAAG;KAC9B,IAAI,wBAAwB,EAAE;OAC5B,OAAO;MACR;KACD,kBAAkB,GAAGE,SAAO,CAAC,OAAO,CAAC;KACrCA,SAAO,CAAC,OAAO,GAAG,qBAAqB,CAAC;KACxC,wBAAwB,GAAG,IAAI,CAAC;IACjC;;GAED,SAAS,sBAAsB,GAAG;KAChC,IAAI,CAAC,wBAAwB,EAAE;OAC7B,OAAO;MACR;KACDA,SAAO,CAAC,OAAO,GAAG,kBAAkB,CAAC;KACrC,wBAAwB,GAAG,KAAK,CAAC;KACjC,kBAAkB,GAAG,SAAS,CAAC;IAChC;;GAED,SAAS,oBAAoB,GAAG;KAC9B,IAAI,mBAAmB,GAAG,kBAAkB;OAC1C,SAAS,GAAG,QAAQ,CAAC;KACvB,QAAQ,GAAG,IAAI,CAAC;KAChB,kBAAkB,GAAG,IAAI,CAAC;KAC1B,aAAa,GAAG,IAAI,CAAC;KACrB,cAAc,CAAC,KAAK,CAAC,IAAI,EAAE,CAAC,mBAAmB,EAAE,KAAK,CAAC,CAAC,MAAM,CAAC,SAAS,CAAC,CAAC,CAAC;IAC5E;;;;;;;;;GASD,SAAS,MAAM,CAAC,EAAE,EAAE,OAAO,EAAE;KAC3B,IAAI,IAAI,GAAG,MAAM,CAAC,IAAI,CAAC,SAAS,EAAE,CAAC,CAAC,CAAC;KACrC,IAAI,kBAAkB,EAAE;OACtB,IAAI,aAAa,KAAK,EAAE,EAAE;SACxB,OAAO;QACR,MAAM;SACL,oBAAoB,EAAE,CAAC;QACxB;MACF;;KAED,IAAI,KAAK,GAAG,QAAQ,CAAC,iBAAiB,CAAC,EAAE,CAAC,CAAC;KAC3C,kBAAkB,GAAG,KAAK,CAAC;KAC3B,aAAa,GAAG,EAAE,CAAC;KACnB,QAAQ,GAAG,IAAI,CAAC;;;;;;KAMhB,UAAU,CAAC,WAAW;OACpB,IAAI,aAAa,KAAK,EAAE,EAAE;SACxB,oBAAoB,EAAE,CAAC;QACxB;MACF,EAAE,KAAK,CAAC,UAAU,GAAG,IAAI,GAAG,CAAC,CAAC,CAAC;;KAEhC,IAAI,OAAO,KAAK,KAAK,EAAE;OACrB,MAAM,EAAE,CAAC;MACV;IACF;;GAED,MAAM,CAAC,SAAS,GAAG,SAAS,CAAC;GAC7B,MAAM,CAAC,WAAW,GAAG,WAAW,CAAC;GACjC,MAAM,CAAC,SAAS,GAAG,cAAc,CAAC;GAClC,OAAO,MAAM,CAAC;EACf,GAAG,CAAC;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;CAqDL,QAAQ,CAAC,iBAAiB,GAAG,CAAC,SAAS,wBAAwB,GAAG;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;GA4ChE,SAAS,8BAA8B,CAAC,EAAE,EAAE;KAC1C,IAAI,OAAO,EAAE,CAAC,KAAK,KAAK,WAAW,IAAI,CAAC,EAAE,CAAC,KAAK,EAAE,OAAO;;KAEzD,IAAI,MAAM,GAAG,yIAAyI,CAAC;KACvJ,IAAI,KAAK,GAAG,uHAAuH,CAAC;;;KAGpI,IAAI,KAAK,GAAG,4JAA4J,CAAC;;KAEzK,IAAI,SAAS,GAAG,+CAA+C,CAAC;KAChE,IAAI,UAAU,GAAG,+BAA+B,CAAC;KACjD,IAAI,KAAK,GAAG,EAAE,CAAC,KAAK,CAAC,KAAK,CAAC,IAAI,CAAC,CAAC;KACjC,IAAI,KAAK,GAAG,EAAE,CAAC;KACf,IAAI,QAAQ,CAAC;KACb,IAAI,KAAK,CAAC;KACV,IAAI,OAAO,CAAC;KACZ,IAAI,SAAS,GAAG,qBAAqB,CAAC,IAAI,CAAC,EAAE,CAAC,OAAO,CAAC,CAAC;;KAEvD,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,KAAK,CAAC,MAAM,EAAE,CAAC,GAAG,CAAC,EAAE,EAAE,CAAC,EAAE;OAC5C,KAAK,KAAK,GAAG,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,GAAG;SACnC,IAAI,QAAQ,GAAG,KAAK,CAAC,CAAC,CAAC,IAAI,KAAK,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,QAAQ,CAAC,KAAK,CAAC,CAAC;SAC5D,IAAI,MAAM,GAAG,KAAK,CAAC,CAAC,CAAC,IAAI,KAAK,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,MAAM,CAAC,KAAK,CAAC,CAAC;SACxD,IAAI,MAAM,KAAK,QAAQ,GAAG,UAAU,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,CAAC,EAAE;;WAEpD,KAAK,CAAC,CAAC,CAAC,GAAG,QAAQ,CAAC,CAAC,CAAC,CAAC;WACvB,KAAK,CAAC,CAAC,CAAC,GAAG,QAAQ,CAAC,CAAC,CAAC,CAAC;WACvB,KAAK,CAAC,CAAC,CAAC,GAAG,QAAQ,CAAC,CAAC,CAAC,CAAC;UACxB;SACD,OAAO,GAAG;WACR,GAAG,EAAE,CAAC,QAAQ,GAAG,KAAK,CAAC,CAAC,CAAC,GAAG,IAAI;WAChC,IAAI,EAAE,KAAK,CAAC,CAAC,CAAC,IAAI,gBAAgB;WAClC,IAAI,EAAE,QAAQ,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,GAAG,EAAE;WAChC,IAAI,EAAE,KAAK,CAAC,CAAC,CAAC,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,GAAG,IAAI;WACjC,MAAM,EAAE,KAAK,CAAC,CAAC,CAAC,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,GAAG,IAAI;UACpC,CAAC;QACH,MAAM,KAAK,KAAK,GAAG,KAAK,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,GAAG;SACzC,OAAO,GAAG;WACR,GAAG,EAAE,KAAK,CAAC,CAAC,CAAC;WACb,IAAI,EAAE,KAAK,CAAC,CAAC,CAAC,IAAI,gBAAgB;WAClC,IAAI,EAAE,EAAE;WACR,IAAI,EAAE,CAAC,KAAK,CAAC,CAAC,CAAC;WACf,MAAM,EAAE,KAAK,CAAC,CAAC,CAAC,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,GAAG,IAAI;UACpC,CAAC;QACH,MAAM,KAAK,KAAK,GAAG,KAAK,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,GAAG;SACzC,IAAI,MAAM,GAAG,KAAK,CAAC,CAAC,CAAC,IAAI,KAAK,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,SAAS,CAAC,GAAG,CAAC,CAAC,CAAC;SAC1D,IAAI,MAAM,KAAK,QAAQ,GAAG,SAAS,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,CAAC,EAAE;;WAEnD,KAAK,CAAC,CAAC,CAAC,GAAG,QAAQ,CAAC,CAAC,CAAC,CAAC;WACvB,KAAK,CAAC,CAAC,CAAC,GAAG,QAAQ,CAAC,CAAC,CAAC,CAAC;WACvB,KAAK,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC;UACjB,MAAM,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,CAAC,IAAI,OAAO,EAAE,CAAC,YAAY,KAAK,WAAW,EAAE;;;;;WAKzE,KAAK,CAAC,CAAC,CAAC,CAAC,MAAM,GAAG,EAAE,CAAC,YAAY,GAAG,CAAC,CAAC;UACvC;SACD,OAAO,GAAG;WACR,GAAG,EAAE,KAAK,CAAC,CAAC,CAAC;WACb,IAAI,EAAE,KAAK,CAAC,CAAC,CAAC,IAAI,gBAAgB;WAClC,IAAI,EAAE,KAAK,CAAC,CAAC,CAAC,GAAG,KAAK,CAAC,CAAC,CAAC,CAAC,KAAK,CAAC,GAAG,CAAC,GAAG,EAAE;WACzC,IAAI,EAAE,KAAK,CAAC,CAAC,CAAC,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,GAAG,IAAI;WACjC,MAAM,EAAE,KAAK,CAAC,CAAC,CAAC,GAAG,CAAC,KAAK,CAAC,CAAC,CAAC,GAAG,IAAI;UACpC,CAAC;QACH,MAAM;SACL,SAAS;QACV;;OAED,IAAI,CAAC,OAAO,CAAC,IAAI,IAAI,OAAO,CAAC,IAAI,EAAE;SACjC,OAAO,CAAC,IAAI,GAAG,gBAAgB,CAAC;QACjC;;OAED,IAAI,OAAO,CAAC,GAAG,IAAI,OAAO,CAAC,GAAG,CAAC,MAAM,CAAC,CAAC,EAAE,CAAC,CAAC,KAAK,OAAO,EAAE;;;;;;SAMvD,IAAI,GAAG,GAAG,IAAI,cAAc,EAAE,CAAC;SAC/B,GAAG,CAAC,IAAI,CAAC,KAAK,EAAE,OAAO,CAAC,GAAG,EAAE,KAAK,CAAC,CAAC;SACpC,GAAG,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;;;SAGf,IAAI,GAAG,CAAC,MAAM,KAAK,GAAG,EAAE;WACtB,IAAI,MAAM,GAAG,GAAG,CAAC,YAAY,IAAI,EAAE,CAAC;;;;WAIpC,MAAM,GAAG,MAAM,CAAC,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC;;;WAG5B,IAAI,UAAU,GAAG,MAAM,CAAC,KAAK,CAAC,8BAA8B,CAAC,CAAC;;;WAG9D,IAAI,UAAU,EAAE;aACd,IAAI,gBAAgB,GAAG,UAAU,CAAC,CAAC,CAAC,CAAC;;;;aAIrC,IAAI,gBAAgB,CAAC,MAAM,CAAC,CAAC,CAAC,KAAK,GAAG,EAAE;eACtC,gBAAgB,GAAG,iBAAiB,EAAE,GAAG,gBAAgB,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC;cACpE;;;;aAID,OAAO,CAAC,GAAG,GAAG,gBAAgB,CAAC,KAAK,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC;YAC7C;UACF;QACF;;OAED,KAAK,CAAC,IAAI,CAAC,OAAO,CAAC,CAAC;MACrB;;KAED,IAAI,CAAC,KAAK,CAAC,MAAM,EAAE;OACjB,OAAO,IAAI,CAAC;MACb;;KAED,OAAO;OACL,IAAI,EAAE,EAAE,CAAC,IAAI;OACb,OAAO,EAAE,EAAE,CAAC,OAAO;OACnB,GAAG,EAAE,eAAe,EAAE;OACtB,KAAK,EAAE,KAAK;MACb,CAAC;IACH;;;;;;;;;;;;;;;GAeD,SAAS,mCAAmC,CAAC,SAAS,EAAE,GAAG,EAAE,MAAM,EAAE,OAAO,EAAE;KAC5E,IAAI,OAAO,GAAG;OACZ,GAAG,EAAE,GAAG;OACR,IAAI,EAAE,MAAM;MACb,CAAC;;KAEF,IAAI,OAAO,CAAC,GAAG,IAAI,OAAO,CAAC,IAAI,EAAE;OAC/B,SAAS,CAAC,UAAU,GAAG,KAAK,CAAC;;OAE7B,IAAI,CAAC,OAAO,CAAC,IAAI,EAAE;SACjB,OAAO,CAAC,IAAI,GAAG,gBAAgB,CAAC;QACjC;;OAED,IAAI,SAAS,CAAC,KAAK,CAAC,MAAM,GAAG,CAAC,EAAE;SAC9B,IAAI,SAAS,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,GAAG,KAAK,OAAO,CAAC,GAAG,EAAE;WAC1C,IAAI,SAAS,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,IAAI,KAAK,OAAO,CAAC,IAAI,EAAE;aAC5C,OAAO,KAAK,CAAC;YACd,MAAM;aACL,CAAC,SAAS,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,IAAI;aACxB,SAAS,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,IAAI,KAAK,OAAO,CAAC,IAAI;aACxC;aACA,SAAS,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC,IAAI,GAAG,OAAO,CAAC,IAAI,CAAC;aACvC,OAAO,KAAK,CAAC;YACd;UACF;QACF;;OAED,SAAS,CAAC,KAAK,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;OACjC,SAAS,CAAC,OAAO,GAAG,IAAI,CAAC;OACzB,OAAO,IAAI,CAAC;MACb,MAAM;OACL,SAAS,CAAC,UAAU,GAAG,IAAI,CAAC;MAC7B;;KAED,OAAO,KAAK,CAAC;IACd;;;;;;;;;;;GAWD,SAAS,qCAAqC,CAAC,EAAE,EAAE,KAAK,EAAE;KACxD,IAAI,YAAY,GAAG,oEAAoE;OACrF,KAAK,GAAG,EAAE;OACV,KAAK,GAAG,EAAE;OACV,SAAS,GAAG,KAAK;OACjB,KAAK;OACL,IAAI,CACG;;KAET;OACE,IAAI,IAAI,GAAG,qCAAqC,CAAC,MAAM;OACvD,IAAI,IAAI,CAAC,SAAS;OAClB,IAAI,GAAG,IAAI,CAAC,MAAM;OAClB;OACA,IAAI,IAAI,KAAK,iBAAiB,IAAI,IAAI,KAAK,QAAQ,CAAC,MAAM,EAAE;;SAE1D,SAAS;QACV;;OAED,IAAI,GAAG;SACL,GAAG,EAAE,IAAI;SACT,IAAI,EAAE,gBAAgB;SACtB,IAAI,EAAE,IAAI;SACV,MAAM,EAAE,IAAI;QACb,CAAC;;OAEF,IAAI,IAAI,CAAC,IAAI,EAAE;SACb,IAAI,CAAC,IAAI,GAAG,IAAI,CAAC,IAAI,CAAC;QACvB,MAAM,KAAK,KAAK,GAAG,YAAY,CAAC,IAAI,CAAC,IAAI,CAAC,QAAQ,EAAE,CAAC,GAAG;SACvD,IAAI,CAAC,IAAI,GAAG,KAAK,CAAC,CAAC,CAAC,CAAC;QACtB;;OAED,IAAI,OAAO,IAAI,CAAC,IAAI,KAAK,WAAW,EAAE;SACpC,IAAI;WACF,IAAI,CAAC,IAAI,GAAG,KAAK,CAAC,KAAK,CAAC,SAAS,CAAC,CAAC,EAAE,KAAK,CAAC,KAAK,CAAC,OAAO,CAAC,GAAG,CAAC,CAAC,CAAC;UAChE,CAAC,OAAO,CAAC,EAAE,EAAE;QACf;;OAED,IAAI,KAAK,CAAC,EAAE,GAAG,IAAI,CAAC,EAAE;SACpB,SAAS,GAAG,IAAI,CAAC;QAClB,MAAM;SACL,KAAK,CAAC,EAAE,GAAG,IAAI,CAAC,GAAG,IAAI,CAAC;QACzB;;OAED,KAAK,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;MAClB;;KAED,IAAI,KAAK,EAAE;;;OAGT,KAAK,CAAC,MAAM,CAAC,CAAC,EAAE,KAAK,CAAC,CAAC;MACxB;;KAED,IAAI,MAAM,GAAG;OACX,IAAI,EAAE,EAAE,CAAC,IAAI;OACb,OAAO,EAAE,EAAE,CAAC,OAAO;OACnB,GAAG,EAAE,eAAe,EAAE;OACtB,KAAK,EAAE,KAAK;MACb,CAAC;KACF,mCAAmC;OACjC,MAAM;OACN,EAAE,CAAC,SAAS,IAAI,EAAE,CAAC,QAAQ;OAC3B,EAAE,CAAC,IAAI,IAAI,EAAE,CAAC,UAAU;OACxB,EAAE,CAAC,OAAO,IAAI,EAAE,CAAC,WAAW;MAC7B,CAAC;KACF,OAAO,MAAM,CAAC;IACf;;;;;;;GAOD,SAAS,iBAAiB,CAAC,EAAE,EAAE,KAAK,EAAE;KACpC,IAAI,KAAK,GAAG,IAAI,CAAC;KACjB,KAAK,GAAG,KAAK,IAAI,IAAI,GAAG,CAAC,GAAG,CAAC,KAAK,CAAC;;KAEnC,IAAI;OACF,KAAK,GAAG,8BAA8B,CAAC,EAAE,CAAC,CAAC;OAC3C,IAAI,KAAK,EAAE;SACT,OAAO,KAAK,CAAC;QACd;MACF,CAAC,OAAO,CAAC,EAAE;OACV,IAAI,QAAQ,CAAC,KAAK,EAAE;SAClB,MAAM,CAAC,CAAC;QACT;MACF;;KAED,IAAI;OACF,KAAK,GAAG,qCAAqC,CAAC,EAAE,EAAE,KAAK,GAAG,CAAC,CAAC,CAAC;OAC7D,IAAI,KAAK,EAAE;SACT,OAAO,KAAK,CAAC;QACd;MACF,CAAC,OAAO,CAAC,EAAE;OACV,IAAI,QAAQ,CAAC,KAAK,EAAE;SAClB,MAAM,CAAC,CAAC;QACT;MACF;KACD,OAAO;OACL,IAAI,EAAE,EAAE,CAAC,IAAI;OACb,OAAO,EAAE,EAAE,CAAC,OAAO;OACnB,GAAG,EAAE,eAAe,EAAE;MACvB,CAAC;IACH;;GAED,iBAAiB,CAAC,mCAAmC,GAAG,mCAAmC,CAAC;GAC5F,iBAAiB,CAAC,8BAA8B,GAAG,8BAA8B,CAAC;;GAElF,OAAO,iBAAiB,CAAC;EAC1B,GAAG,CAAC;;CAEL,YAAc,GAAG,QAAQ,CAAC;;CCzqB1B;;;;;;;;;;;;;;;;;;;;;;;CAuBA,SAAS,OAAO,CAAC,CAAC,EAAE,CAAC,EAAE;GACrB,IAAI,GAAG,GAAG,CAAC,CAAC,GAAG,MAAM,KAAK,CAAC,GAAG,MAAM,CAAC,CAAC;GACtC,IAAI,GAAG,GAAG,CAAC,CAAC,IAAI,EAAE,KAAK,CAAC,IAAI,EAAE,CAAC,IAAI,GAAG,IAAI,EAAE,CAAC,CAAC;GAC9C,OAAO,CAAC,GAAG,IAAI,EAAE,KAAK,GAAG,GAAG,MAAM,CAAC,CAAC;EACrC;;;;;CAKD,SAAS,aAAa,CAAC,GAAG,EAAE,GAAG,EAAE;GAC/B,OAAO,CAAC,GAAG,IAAI,GAAG,KAAK,GAAG,MAAM,EAAE,GAAG,GAAG,CAAC,CAAC,CAAC;EAC5C;;;;;CAKD,SAAS,MAAM,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE;GAChC,OAAO,OAAO,CAAC,aAAa,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC,EAAE,CAAC,CAAC,EAAE,OAAO,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC;EAC5E;CACD,SAAS,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE;GAClC,OAAO,MAAM,CAAC,CAAC,CAAC,GAAG,CAAC,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC;EAClD;CACD,SAAS,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE;GAClC,OAAO,MAAM,CAAC,CAAC,CAAC,GAAG,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC;EAClD;CACD,SAAS,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE;GAClC,OAAO,MAAM,CAAC,CAAC,GAAG,CAAC,GAAG,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC;EACzC;CACD,SAAS,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE;GAClC,OAAO,MAAM,CAAC,CAAC,IAAI,CAAC,GAAG,CAAC,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC;EAC5C;;;;;CAKD,SAAS,OAAO,CAAC,CAAC,EAAE,GAAG,EAAE;;GAEvB,CAAC,CAAC,GAAG,IAAI,CAAC,CAAC,IAAI,IAAI,KAAK,GAAG,GAAG,EAAE,CAAC,CAAC;GAClC,CAAC,CAAC,CAAC,CAAC,CAAC,GAAG,GAAG,EAAE,MAAM,CAAC,KAAK,CAAC,IAAI,EAAE,CAAC,GAAG,GAAG,CAAC;;GAExC,IAAI,CAAC,CAAC;GACN,IAAI,IAAI,CAAC;GACT,IAAI,IAAI,CAAC;GACT,IAAI,IAAI,CAAC;GACT,IAAI,IAAI,CAAC;GACT,IAAI,CAAC,GAAG,UAAU,CAAC;GACnB,IAAI,CAAC,GAAG,CAAC,SAAS,CAAC;GACnB,IAAI,CAAC,GAAG,CAAC,UAAU,CAAC;GACpB,IAAI,CAAC,GAAG,SAAS,CAAC;;GAElB,KAAK,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,CAAC,CAAC,MAAM,EAAE,CAAC,IAAI,EAAE,EAAE;KACjC,IAAI,GAAG,CAAC,CAAC;KACT,IAAI,GAAG,CAAC,CAAC;KACT,IAAI,GAAG,CAAC,CAAC;KACT,IAAI,GAAG,CAAC,CAAC;;KAET,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,SAAS,CAAC,CAAC;KAC3C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,SAAS,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,SAAS,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,UAAU,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,QAAQ,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,UAAU,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,KAAK,CAAC,CAAC;KAC7C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KAClD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,CAAC,EAAE,UAAU,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,QAAQ,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KAClD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,UAAU,CAAC,CAAC;;KAEjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,SAAS,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,UAAU,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,SAAS,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;KAC5C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,SAAS,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,CAAC,EAAE,QAAQ,CAAC,CAAC;KAC9C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,SAAS,CAAC,CAAC;KAC9C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,UAAU,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,QAAQ,CAAC,CAAC;KAC9C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,UAAU,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;;KAElD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,MAAM,CAAC,CAAC;KAC5C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,QAAQ,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,UAAU,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,UAAU,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KAClD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,CAAC,EAAE,SAAS,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;KAC5C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,QAAQ,CAAC,CAAC;KAC9C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,SAAS,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,SAAS,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;;KAEhD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,SAAS,CAAC,CAAC;KAC3C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,UAAU,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KAClD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,QAAQ,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,CAAC,EAAE,UAAU,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,OAAO,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,UAAU,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,QAAQ,CAAC,CAAC;KAChD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,UAAU,CAAC,CAAC;KACjD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,SAAS,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,UAAU,CAAC,CAAC;KAClD,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,SAAS,CAAC,CAAC;KAC/C,CAAC,GAAG,KAAK,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,EAAE,EAAE,EAAE,CAAC,SAAS,CAAC,CAAC;;KAEhD,CAAC,GAAG,OAAO,CAAC,CAAC,EAAE,IAAI,CAAC,CAAC;KACrB,CAAC,GAAG,OAAO,CAAC,CAAC,EAAE,IAAI,CAAC,CAAC;KACrB,CAAC,GAAG,OAAO,CAAC,CAAC,EAAE,IAAI,CAAC,CAAC;KACrB,CAAC,GAAG,OAAO,CAAC,CAAC,EAAE,IAAI,CAAC,CAAC;IACtB;GACD,OAAO,CAAC,CAAC,EAAE,CAAC,EAAE,CAAC,EAAE,CAAC,CAAC,CAAC;EACrB;;;;;CAKD,SAAS,SAAS,CAAC,KAAK,EAAE;GACxB,IAAI,CAAC,CAAC;GACN,IAAI,MAAM,GAAG,EAAE,CAAC;GAChB,IAAI,QAAQ,GAAG,KAAK,CAAC,MAAM,GAAG,EAAE,CAAC;GACjC,KAAK,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,QAAQ,EAAE,CAAC,IAAI,CAAC,EAAE;KAChC,MAAM,IAAI,MAAM,CAAC,YAAY,CAAC,CAAC,KAAK,CAAC,CAAC,IAAI,CAAC,CAAC,MAAM,CAAC,GAAG,EAAE,CAAC,IAAI,IAAI,CAAC,CAAC;IACpE;GACD,OAAO,MAAM,CAAC;EACf;;;;;;CAMD,SAAS,SAAS,CAAC,KAAK,EAAE;GACxB,IAAI,CAAC,CAAC;GACN,IAAI,MAAM,GAAG,EAAE,CAAC;GAChB,MAAM,CAAC,CAAC,KAAK,CAAC,MAAM,IAAI,CAAC,IAAI,CAAC,CAAC,GAAG,SAAS,CAAC;GAC5C,KAAK,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,MAAM,CAAC,MAAM,EAAE,CAAC,IAAI,CAAC,EAAE;KACrC,MAAM,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC;IACf;GACD,IAAI,OAAO,GAAG,KAAK,CAAC,MAAM,GAAG,CAAC,CAAC;GAC/B,KAAK,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,OAAO,EAAE,CAAC,IAAI,CAAC,EAAE;KAC/B,MAAM,CAAC,CAAC,IAAI,CAAC,CAAC,IAAI,CAAC,KAAK,CAAC,UAAU,CAAC,CAAC,GAAG,CAAC,CAAC,GAAG,IAAI,MAAM,CAAC,GAAG,EAAE,CAAC,CAAC;IAChE;GACD,OAAO,MAAM,CAAC;EACf;;;;;CAKD,SAAS,OAAO,CAAC,CAAC,EAAE;GAClB,OAAO,SAAS,CAAC,OAAO,CAAC,SAAS,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,MAAM,GAAG,CAAC,CAAC,CAAC,CAAC;EACvD;;;;;CAKD,SAAS,WAAW,CAAC,GAAG,EAAE,IAAI,EAAE;GAC9B,IAAI,CAAC,CAAC;GACN,IAAI,IAAI,GAAG,SAAS,CAAC,GAAG,CAAC,CAAC;GAC1B,IAAI,IAAI,GAAG,EAAE,CAAC;GACd,IAAI,IAAI,GAAG,EAAE,CAAC;GACd,IAAI,IAAI,CAAC;GACT,IAAI,CAAC,EAAE,CAAC,GAAG,IAAI,CAAC,EAAE,CAAC,GAAG,SAAS,CAAC;GAChC,IAAI,IAAI,CAAC,MAAM,GAAG,EAAE,EAAE;KACpB,IAAI,GAAG,OAAO,CAAC,IAAI,EAAE,GAAG,CAAC,MAAM,GAAG,CAAC,CAAC,CAAC;IACtC;GACD,KAAK,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,EAAE,EAAE,CAAC,IAAI,CAAC,EAAE;KAC1B,IAAI,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC,CAAC,CAAC,GAAG,UAAU,CAAC;KAC/B,IAAI,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC,CAAC,CAAC,GAAG,UAAU,CAAC;IAChC;GACD,IAAI,GAAG,OAAO,CAAC,IAAI,CAAC,MAAM,CAAC,SAAS,CAAC,IAAI,CAAC,CAAC,EAAE,GAAG,GAAG,IAAI,CAAC,MAAM,GAAG,CAAC,CAAC,CAAC;GACpE,OAAO,SAAS,CAAC,OAAO,CAAC,IAAI,CAAC,MAAM,CAAC,IAAI,CAAC,EAAE,GAAG,GAAG,GAAG,CAAC,CAAC,CAAC;EACzD;;;;;CAKD,SAAS,QAAQ,CAAC,KAAK,EAAE;GACvB,IAAI,MAAM,GAAG,kBAAkB,CAAC;GAChC,IAAI,MAAM,GAAG,EAAE,CAAC;GAChB,IAAI,CAAC,CAAC;GACN,IAAI,CAAC,CAAC;GACN,KAAK,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,KAAK,CAAC,MAAM,EAAE,CAAC,IAAI,CAAC,EAAE;KACpC,CAAC,GAAG,KAAK,CAAC,UAAU,CAAC,CAAC,CAAC,CAAC;KACxB,MAAM,IAAI,MAAM,CAAC,MAAM,CAAC,CAAC,CAAC,KAAK,CAAC,IAAI,IAAI,CAAC,GAAG,MAAM,CAAC,MAAM,CAAC,CAAC,GAAG,IAAI,CAAC,CAAC;IACrE;GACD,OAAO,MAAM,CAAC;EACf;;;;;CAKD,SAAS,YAAY,CAAC,KAAK,EAAE;GAC3B,OAAO,QAAQ,CAAC,kBAAkB,CAAC,KAAK,CAAC,CAAC,CAAC;EAC5C;;;;;CAKD,SAAS,MAAM,CAAC,CAAC,EAAE;GACjB,OAAO,OAAO,CAAC,YAAY,CAAC,CAAC,CAAC,CAAC,CAAC;EACjC;CACD,SAAS,MAAM,CAAC,CAAC,EAAE;GACjB,OAAO,QAAQ,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC,CAAC;EAC5B;CACD,SAAS,UAAU,CAAC,CAAC,EAAE,CAAC,EAAE;GACxB,OAAO,WAAW,CAAC,YAAY,CAAC,CAAC,CAAC,EAAE,YAAY,CAAC,CAAC,CAAC,CAAC,CAAC;EACtD;CACD,SAAS,UAAU,CAAC,CAAC,EAAE,CAAC,EAAE;GACxB,OAAO,QAAQ,CAAC,UAAU,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC;EACnC;;CAED,SAAS,GAAG,CAAC,MAAM,EAAE,GAAG,EAAE,GAAG,EAAE;GAC7B,IAAI,CAAC,GAAG,EAAE;KACR,IAAI,CAAC,GAAG,EAAE;OACR,OAAO,MAAM,CAAC,MAAM,CAAC,CAAC;MACvB;KACD,OAAO,MAAM,CAAC,MAAM,CAAC,CAAC;IACvB;GACD,IAAI,CAAC,GAAG,EAAE;KACR,OAAO,UAAU,CAAC,GAAG,EAAE,MAAM,CAAC,CAAC;IAChC;GACD,OAAO,UAAU,CAAC,GAAG,EAAE,MAAM,CAAC,CAAC;EAChC;;CAED,SAAc,GAAG,GAAG,CAAC;;CCzQrB,SAAS,gBAAgB,CAAC,OAAO,EAAE;GACjC,IAAI,CAAC,IAAI,GAAG,kBAAkB,CAAC;GAC/B,IAAI,CAAC,OAAO,GAAG,OAAO,CAAC;EACxB;CACD,gBAAgB,CAAC,SAAS,GAAG,IAAI,KAAK,EAAE,CAAC;CACzC,gBAAgB,CAAC,SAAS,CAAC,WAAW,GAAG,gBAAgB,CAAC;;CAE1D,eAAc,GAAG,gBAAgB,CAAC;;CCLlC,IAAI,UAAU,GAAG,SAAS,OAAO,EAAE,KAAK,EAAE,QAAQ,EAAE;GAClD,IAAI,oBAAoB,GAAG,OAAO,CAAC,KAAK,CAAC,CAAC;GAC1C,IAAI,eAAe,GAAG,OAAO,CAAC;;GAE9B,IAAI,EAAE,KAAK,IAAI,OAAO,CAAC,EAAE;KACvB,OAAO;IACR;;GAED,IAAI,WAAW,GAAG,KAAK,KAAK,MAAM,GAAG,SAAS,GAAG,KAAK,CAAC;;GAEvD,OAAO,CAAC,KAAK,CAAC,GAAG,WAAW;KAC1B,IAAI,IAAI,GAAG,EAAE,CAAC,KAAK,CAAC,IAAI,CAAC,SAAS,CAAC,CAAC;;KAEpC,IAAI,GAAG,GAAG,KAAK,CAAC,QAAQ,CAAC,IAAI,EAAE,GAAG,CAAC,CAAC;KACpC,IAAI,IAAI,GAAG,CAAC,KAAK,EAAE,WAAW,EAAE,MAAM,EAAE,SAAS,EAAE,KAAK,EAAE,CAAC,SAAS,EAAE,IAAI,CAAC,CAAC,CAAC;;KAE7E,IAAI,KAAK,KAAK,QAAQ,EAAE;OACtB,IAAI,IAAI,CAAC,CAAC,CAAC,KAAK,KAAK,EAAE;;SAErB,GAAG;WACD,oBAAoB,IAAI,KAAK,CAAC,QAAQ,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,CAAC,EAAE,GAAG,CAAC,IAAI,gBAAgB,CAAC,CAAC;SAClF,IAAI,CAAC,KAAK,CAAC,SAAS,GAAG,IAAI,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC;SACrC,QAAQ,IAAI,QAAQ,CAAC,GAAG,EAAE,IAAI,CAAC,CAAC;QACjC;MACF,MAAM;OACL,QAAQ,IAAI,QAAQ,CAAC,GAAG,EAAE,IAAI,CAAC,CAAC;MACjC;;;KAGD,IAAI,oBAAoB,EAAE;;;OAGxB,QAAQ,CAAC,SAAS,CAAC,KAAK,CAAC,IAAI,CAAC,oBAAoB,EAAE,eAAe,EAAE,IAAI,CAAC,CAAC;MAC5E;IACF,CAAC;EACH,CAAC;;CAEF,aAAc,GAAG;GACf,UAAU,EAAE,UAAU;EACvB,CAAC;;CCzCF;;;;;;;;CAQA,IAAIC,cAAY,GAAG,KAAK,CAAC,YAAY,CAAC;CACtC,IAAIC,YAAU,GAAG,KAAK,CAAC,UAAU,CAAC;CAClC,IAAIC,gBAAc,GAAG,KAAK,CAAC,cAAc,CAAC;CAC1C,IAAIC,SAAO,GAAG,KAAK,CAAC,OAAO,CAAC;CAC5B,IAAIC,UAAQ,GAAG,KAAK,CAAC,QAAQ,CAAC;CAC9B,IAAIC,eAAa,GAAG,KAAK,CAAC,aAAa,CAAC;CACxC,IAAIC,aAAW,GAAG,KAAK,CAAC,WAAW,CAAC;CACpC,IAAIC,YAAU,GAAG,KAAK,CAAC,UAAU,CAAC;CAClC,IAAIC,UAAQ,GAAG,KAAK,CAAC,QAAQ,CAAC;CAC9B,IAAIC,SAAO,GAAG,KAAK,CAAC,OAAO,CAAC;CAC5B,IAAIC,eAAa,GAAG,KAAK,CAAC,aAAa,CAAC;CACxC,IAAIC,MAAI,GAAG,KAAK,CAAC,IAAI,CAAC;CACtB,IAAIC,aAAW,GAAG,KAAK,CAAC,WAAW,CAAC;CACpC,IAAIC,UAAQ,GAAG,KAAK,CAAC,QAAQ,CAAC;CAC9B,IAAIC,cAAY,GAAG,KAAK,CAAC,YAAY,CAAC;CACtC,IAAIC,QAAM,GAAG,KAAK,CAAC,MAAM,CAAC;CAC1B,IAAIC,YAAU,GAAG,KAAK,CAAC,UAAU,CAAC;CAClC,IAAIC,WAAS,GAAG,KAAK,CAAC,SAAS,CAAC;CAChC,IAAIC,OAAK,GAAG,KAAK,CAAC,KAAK,CAAC;CACxB,IAAIC,kBAAgB,GAAG,KAAK,CAAC,gBAAgB,CAAC;CAC9C,IAAIC,iBAAe,GAAG,KAAK,CAAC,eAAe,CAAC;CAC5C,IAAIC,kBAAgB,GAAG,KAAK,CAAC,gBAAgB,CAAC;CAC9C,IAAIC,UAAQ,GAAG,KAAK,CAAC,QAAQ,CAAC;CAC9B,IAAIC,MAAI,GAAG,KAAK,CAAC,IAAI,CAAC;CACtB,IAAIC,eAAa,GAAG,KAAK,CAAC,aAAa,CAAC;CACxC,IAAIC,wBAAsB,GAAG,KAAK,CAAC,sBAAsB,CAAC;CAC1D,IAAIC,yBAAuB,GAAG,KAAK,CAAC,uBAAuB,CAAC;CAC5D,IAAIC,oBAAkB,GAAG,KAAK,CAAC,kBAAkB,CAAC;CAClD,IAAIC,UAAQ,GAAG,KAAK,CAAC,QAAQ,CAAC;;CAE9B,IAAI,iBAAiB,GAAGC,SAAoB,CAAC,UAAU,CAAC;;CAExD,IAAI,OAAO,GAAG,0CAA0C,CAAC,KAAK,CAAC,GAAG,CAAC;GACjE,UAAU,GAAG,+DAA+D,CAAC;;CAE/E,SAAS,GAAG,GAAG;GACb,OAAO,CAAC,IAAI,IAAI,EAAE,CAAC;EACpB;;;CAGD,IAAI9B,SAAO;GACT,OAAO,MAAM,KAAK,WAAW;OACzB,MAAM;OACN,OAAOF,cAAM,KAAK,WAAW,GAAGA,cAAM,GAAG,OAAO,IAAI,KAAK,WAAW,GAAG,IAAI,GAAG,EAAE,CAAC;CACvF,IAAI,SAAS,GAAGE,SAAO,CAAC,QAAQ,CAAC;CACjC,IAAI,UAAU,GAAGA,SAAO,CAAC,SAAS,CAAC;;CAEnC,SAAS,oBAAoB,CAAC,QAAQ,EAAE,QAAQ,EAAE;GAChD,OAAOQ,YAAU,CAAC,QAAQ,CAAC;OACvB,SAAS,IAAI,EAAE;SACb,OAAO,QAAQ,CAAC,IAAI,EAAE,QAAQ,CAAC,CAAC;QACjC;OACD,QAAQ,CAAC;EACd;;;;;CAKD,SAAS,KAAK,GAAG;GACf,IAAI,CAAC,QAAQ,GAAG,CAAC,EAAE,OAAO,IAAI,KAAK,QAAQ,IAAI,IAAI,CAAC,SAAS,CAAC,CAAC;;GAE/D,IAAI,CAAC,YAAY,GAAG,CAACD,aAAW,CAAC,SAAS,CAAC,CAAC;GAC5C,IAAI,CAAC,aAAa,GAAG,CAACA,aAAW,CAAC,UAAU,CAAC,CAAC;GAC9C,IAAI,CAAC,sBAAsB,GAAG,IAAI,CAAC;GACnC,IAAI,CAAC,SAAS,GAAG,IAAI,CAAC;GACtB,IAAI,CAAC,YAAY,GAAG,IAAI,CAAC;GACzB,IAAI,CAAC,aAAa,GAAG,IAAI,CAAC;GAC1B,IAAI,CAAC,UAAU,GAAG,IAAI,CAAC;GACvB,IAAI,CAAC,cAAc,GAAG,IAAI,CAAC;GAC3B,IAAI,CAAC,cAAc,GAAG,EAAE,CAAC;GACzB,IAAI,CAAC,cAAc,GAAG;;KAEpB,OAAO,EAAEP,SAAO,CAAC,cAAc,IAAIA,SAAO,CAAC,cAAc,CAAC,EAAE;KAC5D,MAAM,EAAE,YAAY;KACpB,YAAY,EAAE,EAAE;KAChB,UAAU,EAAE,EAAE;KACd,aAAa,EAAE,EAAE;KACjB,YAAY,EAAE,EAAE;KAChB,OAAO,EAAE,IAAI;KACb,mBAAmB,EAAE,IAAI;KACzB,0BAA0B,EAAE,IAAI;KAChC,gBAAgB,EAAE,CAAC;;KAEnB,YAAY,EAAE,GAAG;KACjB,eAAe,EAAE,EAAE;KACnB,eAAe,EAAE,IAAI;KACrB,UAAU,EAAE,IAAI;KAChB,UAAU,EAAE,CAAC;KACb,YAAY,EAAE,EAAE;IACjB,CAAC;GACF,IAAI,CAAC,cAAc,GAAG;KACpB,MAAM,EAAE,MAAM;;;;;KAKd,cAAc,EAAE0B,wBAAsB,EAAE,GAAG,QAAQ,GAAG,EAAE;IACzD,CAAC;GACF,IAAI,CAAC,cAAc,GAAG,CAAC,CAAC;GACxB,IAAI,CAAC,iBAAiB,GAAG,KAAK,CAAC;GAC/B,IAAI,CAAC,6BAA6B,GAAG,KAAK,CAAC,eAAe,CAAC;;;GAG3D,IAAI,CAAC,gBAAgB,GAAG1B,SAAO,CAAC,OAAO,IAAI,EAAE,CAAC;GAC9C,IAAI,CAAC,uBAAuB,GAAG,EAAE,CAAC;GAClC,IAAI,CAAC,QAAQ,GAAG,EAAE,CAAC;GACnB,IAAI,CAAC,UAAU,GAAG,GAAG,EAAE,CAAC;GACxB,IAAI,CAAC,gBAAgB,GAAG,EAAE,CAAC;GAC3B,IAAI,CAAC,YAAY,GAAG,EAAE,CAAC;GACvB,IAAI,CAAC,kBAAkB,GAAG,IAAI,CAAC;GAC/B,IAAI,CAAC,gBAAgB,CAAC;GACtB,IAAI,CAAC,SAAS,GAAGA,SAAO,CAAC,QAAQ,CAAC;GAClC,IAAI,CAAC,SAAS,GAAG,IAAI,CAAC,SAAS,IAAI,IAAI,CAAC,SAAS,CAAC,IAAI,CAAC;GACvD,IAAI,CAAC,aAAa,EAAE,CAAC;;;GAGrB,KAAK,IAAI,MAAM,IAAI,IAAI,CAAC,gBAAgB,EAAE;KACxC,IAAI,CAAC,uBAAuB,CAAC,MAAM,CAAC,GAAG,IAAI,CAAC,gBAAgB,CAAC,MAAM,CAAC,CAAC;IACtE;EACF;;;;;;;;CAQD,KAAK,CAAC,SAAS,GAAG;;;;;GAKhB,OAAO,EAAE,QAAQ;;GAEjB,KAAK,EAAE,KAAK;;GAEZ,QAAQ,EAAE+B,QAAQ;;;;;;;;;GASlB,MAAM,EAAE,SAAS,GAAG,EAAE,OAAO,EAAE;KAC7B,IAAI,IAAI,GAAG,IAAI,CAAC;;KAEhB,IAAI,IAAI,CAAC,aAAa,EAAE;OACtB,IAAI,CAAC,SAAS,CAAC,OAAO,EAAE,0CAA0C,CAAC,CAAC;OACpE,OAAO,IAAI,CAAC;MACb;KACD,IAAI,CAAC,GAAG,EAAE,OAAO,IAAI,CAAC;;KAEtB,IAAI,aAAa,GAAG,IAAI,CAAC,cAAc,CAAC;;;KAGxC,IAAI,OAAO,EAAE;OACXnB,MAAI,CAAC,OAAO,EAAE,SAAS,GAAG,EAAE,KAAK,EAAE;;SAEjC,IAAI,GAAG,KAAK,MAAM,IAAI,GAAG,KAAK,OAAO,IAAI,GAAG,KAAK,MAAM,EAAE;WACvD,IAAI,CAAC,cAAc,CAAC,GAAG,CAAC,GAAG,KAAK,CAAC;UAClC,MAAM;WACL,aAAa,CAAC,GAAG,CAAC,GAAG,KAAK,CAAC;UAC5B;QACF,CAAC,CAAC;MACJ;;KAED,IAAI,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC;;;;KAIjB,aAAa,CAAC,YAAY,CAAC,IAAI,CAAC,mBAAmB,CAAC,CAAC;KACrD,aAAa,CAAC,YAAY,CAAC,IAAI,CAAC,+CAA+C,CAAC,CAAC;;;KAGjF,aAAa,CAAC,YAAY,GAAGK,YAAU,CAAC,aAAa,CAAC,YAAY,CAAC,CAAC;KACpE,aAAa,CAAC,UAAU,GAAG,aAAa,CAAC,UAAU,CAAC,MAAM;SACtDA,YAAU,CAAC,aAAa,CAAC,UAAU,CAAC;SACpC,KAAK,CAAC;KACV,aAAa,CAAC,aAAa,GAAG,aAAa,CAAC,aAAa,CAAC,MAAM;SAC5DA,YAAU,CAAC,aAAa,CAAC,aAAa,CAAC;SACvC,KAAK,CAAC;KACV,aAAa,CAAC,YAAY,GAAGA,YAAU,CAAC,aAAa,CAAC,YAAY,CAAC,CAAC;KACpE,aAAa,CAAC,cAAc,GAAG,IAAI,CAAC,GAAG;OACrC,CAAC;OACD,IAAI,CAAC,GAAG,CAAC,aAAa,CAAC,cAAc,IAAI,GAAG,EAAE,GAAG,CAAC;MACnD,CAAC;;KAEF,IAAI,sBAAsB,GAAG;OAC3B,GAAG,EAAE,IAAI;OACT,OAAO,EAAE,IAAI;OACb,GAAG,EAAE,IAAI;OACT,QAAQ,EAAE,IAAI;OACd,MAAM,EAAE,IAAI;MACb,CAAC;;KAEF,IAAI,eAAe,GAAG,aAAa,CAAC,eAAe,CAAC;KACpD,IAAI,EAAE,CAAC,QAAQ,CAAC,IAAI,CAAC,eAAe,CAAC,KAAK,iBAAiB,EAAE;OAC3D,eAAe,GAAGJ,aAAW,CAAC,sBAAsB,EAAE,eAAe,CAAC,CAAC;MACxE,MAAM,IAAI,eAAe,KAAK,KAAK,EAAE;OACpC,eAAe,GAAG,sBAAsB,CAAC;MAC1C;KACD,aAAa,CAAC,eAAe,GAAG,eAAe,CAAC;;KAEhD,IAAI,kBAAkB,GAAG;OACvB,QAAQ,EAAE,IAAI;MACf,CAAC;;KAEF,IAAI,UAAU,GAAG,aAAa,CAAC,UAAU,CAAC;KAC1C,IAAI,EAAE,CAAC,QAAQ,CAAC,IAAI,CAAC,UAAU,CAAC,KAAK,iBAAiB,EAAE;OACtD,UAAU,GAAGA,aAAW,CAAC,kBAAkB,EAAE,UAAU,CAAC,CAAC;MAC1D,MAAM,IAAI,UAAU,KAAK,KAAK,EAAE;OAC/B,UAAU,GAAG,kBAAkB,CAAC;MACjC;KACD,aAAa,CAAC,UAAU,GAAG,UAAU,CAAC;;KAEtCkB,QAAQ,CAAC,mBAAmB,GAAG,CAAC,CAAC,aAAa,CAAC,mBAAmB,CAAC;;;KAGnE,OAAO,IAAI,CAAC;IACb;;;;;;;;;;GAUD,OAAO,EAAE,WAAW;KAClB,IAAI,IAAI,GAAG,IAAI,CAAC;KAChB,IAAI,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,IAAI,CAAC,iBAAiB,EAAE;OAC7CA,QAAQ,CAAC,MAAM,CAAC,SAAS,CAAC,WAAW;SACnC,IAAI,CAAC,uBAAuB,CAAC,KAAK,CAAC,IAAI,EAAE,SAAS,CAAC,CAAC;QACrD,CAAC,CAAC;;OAEH,IAAI,IAAI,CAAC,cAAc,CAAC,0BAA0B,EAAE;SAClD,IAAI,CAAC,8BAA8B,EAAE,CAAC;QACvC;;OAED,IAAI,CAAC,sBAAsB,EAAE,CAAC;;OAE9B,IAAI,IAAI,CAAC,cAAc,CAAC,UAAU,IAAI,IAAI,CAAC,cAAc,CAAC,UAAU,CAAC,QAAQ,EAAE;SAC7E,IAAI,CAAC,mBAAmB,EAAE,CAAC;QAC5B;;OAED,IAAI,IAAI,CAAC,cAAc,CAAC,eAAe,EAAE,IAAI,CAAC,sBAAsB,EAAE,CAAC;;;OAGvE,IAAI,CAAC,aAAa,EAAE,CAAC;;OAErB,IAAI,CAAC,iBAAiB,GAAG,IAAI,CAAC;MAC/B;;KAED,KAAK,CAAC,eAAe,GAAG,IAAI,CAAC,cAAc,CAAC,eAAe,CAAC;KAC5D,OAAO,IAAI,CAAC;IACb;;;;;;;GAOD,MAAM,EAAE,SAAS,GAAG,EAAE;KACpB,IAAI,IAAI,GAAG,IAAI;OACb,GAAG,GAAG,IAAI,CAAC,SAAS,CAAC,GAAG,CAAC;OACzB,SAAS,GAAG,GAAG,CAAC,IAAI,CAAC,WAAW,CAAC,GAAG,CAAC;OACrC,IAAI,GAAG,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC,EAAE,SAAS,CAAC,CAAC;;KAEvC,IAAI,CAAC,IAAI,GAAG,GAAG,CAAC;KAChB,IAAI,CAAC,UAAU,GAAG,GAAG,CAAC,IAAI,CAAC;KAC3B,IAAI,CAAC,aAAa,GAAG,GAAG,CAAC,IAAI,IAAI,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC;KACpD,IAAI,CAAC,cAAc,GAAG,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,SAAS,GAAG,CAAC,CAAC,CAAC;;KAErD,IAAI,CAAC,aAAa,GAAG,IAAI,CAAC,gBAAgB,CAAC,GAAG,CAAC,CAAC;;KAEhD,IAAI,CAAC,eAAe;OAClB,IAAI,CAAC,aAAa,GAAG,GAAG,GAAG,IAAI,GAAG,MAAM,GAAG,IAAI,CAAC,cAAc,GAAG,SAAS,CAAC;;;;KAI7E,IAAI,CAAC,aAAa,EAAE,CAAC;IACtB;;;;;;;;;;GAUD,OAAO,EAAE,SAAS,OAAO,EAAE,IAAI,EAAE,IAAI,EAAE;KACrC,IAAIvB,YAAU,CAAC,OAAO,CAAC,EAAE;OACvB,IAAI,GAAG,IAAI,IAAI,EAAE,CAAC;OAClB,IAAI,GAAG,OAAO,CAAC;OACf,OAAO,GAAG,EAAE,CAAC;MACd;;KAED,OAAO,IAAI,CAAC,IAAI,CAAC,OAAO,EAAE,IAAI,CAAC,CAAC,KAAK,CAAC,IAAI,EAAE,IAAI,CAAC,CAAC;IACnD;;;;;;;;;;GAUD,IAAI,EAAE,SAAS,OAAO,EAAE,IAAI,EAAE,OAAO,EAAE;KACrC,IAAI,IAAI,GAAG,IAAI,CAAC;;;KAGhB,IAAID,aAAW,CAAC,IAAI,CAAC,IAAI,CAACC,YAAU,CAAC,OAAO,CAAC,EAAE;OAC7C,OAAO,OAAO,CAAC;MAChB;;;KAGD,IAAIA,YAAU,CAAC,OAAO,CAAC,EAAE;OACvB,IAAI,GAAG,OAAO,CAAC;OACf,OAAO,GAAG,SAAS,CAAC;MACrB;;;;KAID,IAAI,CAACA,YAAU,CAAC,IAAI,CAAC,EAAE;OACrB,OAAO,IAAI,CAAC;MACb;;;KAGD,IAAI;OACF,IAAI,IAAI,CAAC,SAAS,EAAE;SAClB,OAAO,IAAI,CAAC;QACb;;;OAGD,IAAI,IAAI,CAAC,iBAAiB,EAAE;SAC1B,OAAO,IAAI,CAAC,iBAAiB,CAAC;QAC/B;MACF,CAAC,OAAO,CAAC,EAAE;;;;OAIV,OAAO,IAAI,CAAC;MACb;;KAED,SAAS,OAAO,GAAG;OACjB,IAAI,IAAI,GAAG,EAAE;SACX,CAAC,GAAG,SAAS,CAAC,MAAM;SACpB,IAAI,GAAG,CAAC,OAAO,KAAK,OAAO,IAAI,OAAO,CAAC,IAAI,KAAK,KAAK,CAAC,CAAC;;OAEzD,IAAI,OAAO,IAAIA,YAAU,CAAC,OAAO,CAAC,EAAE;SAClC,OAAO,CAAC,KAAK,CAAC,IAAI,EAAE,SAAS,CAAC,CAAC;QAChC;;;;OAID,OAAO,CAAC,EAAE,EAAE,IAAI,CAAC,CAAC,CAAC,GAAG,IAAI,GAAG,IAAI,CAAC,IAAI,CAAC,OAAO,EAAE,SAAS,CAAC,CAAC,CAAC,CAAC,GAAG,SAAS,CAAC,CAAC,CAAC,CAAC;;OAE7E,IAAI;;;;;SAKF,OAAO,IAAI,CAAC,KAAK,CAAC,IAAI,EAAE,IAAI,CAAC,CAAC;QAC/B,CAAC,OAAO,CAAC,EAAE;SACV,IAAI,CAAC,kBAAkB,EAAE,CAAC;SAC1B,IAAI,CAAC,gBAAgB,CAAC,CAAC,EAAE,OAAO,CAAC,CAAC;SAClC,MAAM,CAAC,CAAC;QACT;MACF;;;KAGD,KAAK,IAAI,QAAQ,IAAI,IAAI,EAAE;OACzB,IAAIQ,QAAM,CAAC,IAAI,EAAE,QAAQ,CAAC,EAAE;SAC1B,OAAO,CAAC,QAAQ,CAAC,GAAG,IAAI,CAAC,QAAQ,CAAC,CAAC;QACpC;MACF;KACD,OAAO,CAAC,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC;;KAEnC,IAAI,CAAC,iBAAiB,GAAG,OAAO,CAAC;;;KAGjC,OAAO,CAAC,SAAS,GAAG,IAAI,CAAC;KACzB,OAAO,CAAC,QAAQ,GAAG,IAAI,CAAC;;KAExB,OAAO,OAAO,CAAC;IAChB;;;;;;;GAOD,SAAS,EAAE,WAAW;KACpBe,QAAQ,CAAC,MAAM,CAAC,SAAS,EAAE,CAAC;;KAE5B,IAAI,CAAC,8BAA8B,EAAE,CAAC;KACtC,IAAI,CAAC,wBAAwB,EAAE,CAAC;KAChC,IAAI,CAAC,gBAAgB,EAAE,CAAC;KACxB,IAAI,CAAC,eAAe,EAAE,CAAC;;KAEvB,KAAK,CAAC,eAAe,GAAG,IAAI,CAAC,6BAA6B,CAAC;KAC3D,IAAI,CAAC,iBAAiB,GAAG,KAAK,CAAC;;KAE/B,OAAO,IAAI,CAAC;IACb;;;;;;;;;;GAUD,wBAAwB,EAAE,SAAS,KAAK,EAAE;KACxC,IAAI,CAAC,SAAS,CAAC,OAAO,EAAE,2CAA2C,EAAE,KAAK,CAAC,CAAC;KAC5E,IAAI,CAAC,gBAAgB,CAAC,KAAK,CAAC,MAAM,EAAE;OAClC,SAAS,EAAE;SACT,IAAI,EAAE,sBAAsB;SAC5B,OAAO,EAAE,KAAK;QACf;MACF,CAAC,CAAC;IACJ;;;;;;;GAOD,8BAA8B,EAAE,WAAW;KACzC,IAAI,CAAC,wBAAwB,GAAG,IAAI,CAAC,wBAAwB,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;KACzE/B,SAAO,CAAC,gBAAgB;OACtBA,SAAO,CAAC,gBAAgB,CAAC,oBAAoB,EAAE,IAAI,CAAC,wBAAwB,CAAC,CAAC;KAChF,OAAO,IAAI,CAAC;IACb;;;;;;;GAOD,8BAA8B,EAAE,WAAW;KACzCA,SAAO,CAAC,mBAAmB;OACzBA,SAAO,CAAC,mBAAmB,CAAC,oBAAoB,EAAE,IAAI,CAAC,wBAAwB,CAAC,CAAC;KACnF,OAAO,IAAI,CAAC;IACb;;;;;;;;;GASD,gBAAgB,EAAE,SAAS,EAAE,EAAE,OAAO,EAAE;KACtC,OAAO,GAAGa,aAAW,CAAC,CAAC,cAAc,EAAE,CAAC,CAAC,EAAE,OAAO,GAAG,OAAO,GAAG,EAAE,CAAC,CAAC;;KAEnE,IAAIZ,cAAY,CAAC,EAAE,CAAC,IAAI,EAAE,CAAC,KAAK,EAAE;;OAEhC,EAAE,GAAG,EAAE,CAAC,KAAK,CAAC;MACf,MAAM,IAAIC,YAAU,CAAC,EAAE,CAAC,IAAIC,gBAAc,CAAC,EAAE,CAAC,EAAE;;;;;OAK/C,IAAI,IAAI,GAAG,EAAE,CAAC,IAAI,KAAKD,YAAU,CAAC,EAAE,CAAC,GAAG,UAAU,GAAG,cAAc,CAAC,CAAC;OACrE,IAAI,OAAO,GAAG,EAAE,CAAC,OAAO,GAAG,IAAI,GAAG,IAAI,GAAG,EAAE,CAAC,OAAO,GAAG,IAAI,CAAC;;OAE3D,OAAO,IAAI,CAAC,cAAc;SACxB,OAAO;SACPW,aAAW,CAAC,OAAO,EAAE;;;WAGnB,UAAU,EAAE,IAAI;WAChB,cAAc,EAAE,OAAO,CAAC,cAAc,GAAG,CAAC;UAC3C,CAAC;QACH,CAAC;MACH,MAAM,IAAIT,SAAO,CAAC,EAAE,CAAC,EAAE;;OAEtB,EAAE,GAAG,EAAE,CAAC;MACT,MAAM,IAAIE,eAAa,CAAC,EAAE,CAAC,EAAE;;;;OAI5B,OAAO,GAAG,IAAI,CAAC,0CAA0C,CAAC,OAAO,EAAE,EAAE,CAAC,CAAC;OACvE,EAAE,GAAG,IAAI,KAAK,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;MACjC,MAAM;;;;;;;OAOL,OAAO,IAAI,CAAC,cAAc;SACxB,EAAE;SACFO,aAAW,CAAC,OAAO,EAAE;WACnB,UAAU,EAAE,IAAI;WAChB,cAAc,EAAE,OAAO,CAAC,cAAc,GAAG,CAAC;UAC3C,CAAC;QACH,CAAC;MACH;;;KAGD,IAAI,CAAC,sBAAsB,GAAG,EAAE,CAAC;;;;;;;KAOjC,IAAI;OACF,IAAI,KAAK,GAAGkB,QAAQ,CAAC,iBAAiB,CAAC,EAAE,CAAC,CAAC;OAC3C,IAAI,CAAC,gBAAgB,CAAC,KAAK,EAAE,OAAO,CAAC,CAAC;MACvC,CAAC,OAAO,GAAG,EAAE;OACZ,IAAI,EAAE,KAAK,GAAG,EAAE;SACd,MAAM,GAAG,CAAC;QACX;MACF;;KAED,OAAO,IAAI,CAAC;IACb;;GAED,0CAA0C,EAAE,SAAS,cAAc,EAAE,EAAE,EAAE;KACvE,IAAI,MAAM,GAAG,MAAM,CAAC,IAAI,CAAC,EAAE,CAAC,CAAC,IAAI,EAAE,CAAC;KACpC,IAAI,OAAO,GAAGlB,aAAW,CAAC,cAAc,EAAE;OACxC,OAAO;SACL,0CAA0C,GAAGc,yBAAuB,CAAC,MAAM,CAAC;OAC9E,WAAW,EAAE,CAACK,KAAG,CAAC,MAAM,CAAC,CAAC;OAC1B,KAAK,EAAE,cAAc,CAAC,KAAK,IAAI,EAAE;MAClC,CAAC,CAAC;KACH,OAAO,CAAC,KAAK,CAAC,cAAc,GAAGJ,oBAAkB,CAAC,EAAE,CAAC,CAAC;;KAEtD,OAAO,OAAO,CAAC;IAChB;;;;;;;;;GASD,cAAc,EAAE,SAAS,GAAG,EAAE,OAAO,EAAE;;;;KAIrC;OACE,CAAC,CAAC,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,IAAI;OACvC,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,IAAI,CAAC,GAAG,CAAC;OAC1C;OACA,OAAO;MACR;;KAED,OAAO,GAAG,OAAO,IAAI,EAAE,CAAC;KACxB,GAAG,GAAG,GAAG,GAAG,EAAE,CAAC;;KAEf,IAAI,IAAI,GAAGf,aAAW;OACpB;SACE,OAAO,EAAE,GAAG;QACb;OACD,OAAO;MACR,CAAC;;KAEF,IAAI,EAAE,CAAC;;;;;KAKP,IAAI;OACF,MAAM,IAAI,KAAK,CAAC,GAAG,CAAC,CAAC;MACtB,CAAC,OAAO,GAAG,EAAE;OACZ,EAAE,GAAG,GAAG,CAAC;MACV;;;KAGD,EAAE,CAAC,IAAI,GAAG,IAAI,CAAC;KACf,IAAI,KAAK,GAAGkB,QAAQ,CAAC,iBAAiB,CAAC,EAAE,CAAC,CAAC;;;KAG3C,IAAI,WAAW,GAAGrB,SAAO,CAAC,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC;;;;;KAKzD,IAAI,WAAW,IAAI,WAAW,CAAC,IAAI,KAAK,wBAAwB,EAAE;OAChE,WAAW,GAAG,KAAK,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC;MAC9B;;KAED,IAAI,OAAO,GAAG,CAAC,WAAW,IAAI,WAAW,CAAC,GAAG,KAAK,EAAE,CAAC;;KAErD;OACE,CAAC,CAAC,IAAI,CAAC,cAAc,CAAC,UAAU,CAAC,IAAI;OACrC,IAAI,CAAC,cAAc,CAAC,UAAU,CAAC,IAAI,CAAC,OAAO,CAAC;OAC5C;OACA,OAAO;MACR;;KAED;OACE,CAAC,CAAC,IAAI,CAAC,cAAc,CAAC,aAAa,CAAC,IAAI;OACxC,CAAC,IAAI,CAAC,cAAc,CAAC,aAAa,CAAC,IAAI,CAAC,OAAO,CAAC;OAChD;OACA,OAAO;MACR;;;;KAID,IAAI,IAAI,CAAC,cAAc,CAAC,UAAU,IAAI,OAAO,CAAC,UAAU,IAAI,IAAI,CAAC,OAAO,KAAK,EAAE,EAAE;;OAE/E,IAAI,CAAC,WAAW,GAAG,IAAI,CAAC,WAAW,IAAI,IAAI,GAAG,GAAG,GAAG,IAAI,CAAC,WAAW,CAAC;;OAErE,OAAO,GAAGG,aAAW;SACnB;WACE,cAAc,EAAE,CAAC;UAClB;SACD,OAAO;QACR,CAAC;;;;;OAKF,OAAO,CAAC,cAAc,IAAI,CAAC,CAAC;;OAE5B,IAAI,MAAM,GAAG,IAAI,CAAC,cAAc,CAAC,KAAK,EAAE,OAAO,CAAC,CAAC;OACjD,IAAI,CAAC,UAAU,GAAG;;SAEhB,MAAM,EAAE,MAAM,CAAC,OAAO,EAAE;QACzB,CAAC;MACH;;;KAGD,IAAI,IAAI,CAAC,WAAW,EAAE;OACpB,IAAI,CAAC,WAAW,GAAGH,SAAO,CAAC,IAAI,CAAC,WAAW,CAAC;WACxC,IAAI,CAAC,WAAW;WAChB,CAAC,IAAI,CAAC,WAAW,CAAC,CAAC;MACxB;;;KAGD,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,CAAC;;KAEjB,OAAO,IAAI,CAAC;IACb;;GAED,iBAAiB,EAAE,SAAS,GAAG,EAAE;KAC/B,IAAI,KAAK,GAAGG,aAAW;OACrB;SACE,SAAS,EAAE,GAAG,EAAE,GAAG,IAAI;QACxB;OACD,GAAG;MACJ,CAAC;;KAEF,IAAIL,YAAU,CAAC,IAAI,CAAC,cAAc,CAAC,kBAAkB,CAAC,EAAE;OACtD,IAAI,MAAM,GAAG,IAAI,CAAC,cAAc,CAAC,kBAAkB,CAAC,KAAK,CAAC,CAAC;;OAE3D,IAAIH,UAAQ,CAAC,MAAM,CAAC,IAAI,CAACM,eAAa,CAAC,MAAM,CAAC,EAAE;SAC9C,KAAK,GAAG,MAAM,CAAC;QAChB,MAAM,IAAI,MAAM,KAAK,KAAK,EAAE;SAC3B,OAAO,IAAI,CAAC;QACb;MACF;;KAED,IAAI,CAAC,YAAY,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC;KAC9B,IAAI,IAAI,CAAC,YAAY,CAAC,MAAM,GAAG,IAAI,CAAC,cAAc,CAAC,cAAc,EAAE;OACjE,IAAI,CAAC,YAAY,CAAC,KAAK,EAAE,CAAC;MAC3B;KACD,OAAO,IAAI,CAAC;IACb;;GAED,SAAS,EAAE,SAAS,MAAM,2BAA2B;KACnD,IAAI,UAAU,GAAG,EAAE,CAAC,KAAK,CAAC,IAAI,CAAC,SAAS,EAAE,CAAC,CAAC,CAAC;;KAE7C,IAAI,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC,MAAM,EAAE,UAAU,CAAC,CAAC,CAAC;KACzC,IAAI,IAAI,CAAC,iBAAiB,EAAE;OAC1B,IAAI,CAAC,aAAa,EAAE,CAAC;MACtB;;KAED,OAAO,IAAI,CAAC;IACb;;;;;;;;GAQD,cAAc,EAAE,SAAS,IAAI,EAAE;;KAE7B,IAAI,CAAC,cAAc,CAAC,IAAI,GAAG,IAAI,CAAC;;KAEhC,OAAO,IAAI,CAAC;IACb;;;;;;;;GAQD,eAAe,EAAE,SAAS,KAAK,EAAE;KAC/B,IAAI,CAAC,aAAa,CAAC,OAAO,EAAE,KAAK,CAAC,CAAC;;KAEnC,OAAO,IAAI,CAAC;IACb;;;;;;;;GAQD,cAAc,EAAE,SAAS,IAAI,EAAE;KAC7B,IAAI,CAAC,aAAa,CAAC,MAAM,EAAE,IAAI,CAAC,CAAC;;KAEjC,OAAO,IAAI,CAAC;IACb;;;;;;;GAOD,YAAY,EAAE,WAAW;KACvB,IAAI,CAAC,cAAc,GAAG,EAAE,CAAC;;KAEzB,OAAO,IAAI,CAAC;IACb;;;;;;;GAOD,UAAU,EAAE,WAAW;;KAErB,OAAO,IAAI,CAAC,KAAK,CAACZ,WAAS,CAAC,IAAI,CAAC,cAAc,CAAC,CAAC,CAAC;IACnD;;;;;;;;GAQD,cAAc,EAAE,SAAS,WAAW,EAAE;KACpC,IAAI,CAAC,cAAc,CAAC,WAAW,GAAG,WAAW,CAAC;;KAE9C,OAAO,IAAI,CAAC;IACb;;;;;;;;GAQD,UAAU,EAAE,SAAS,OAAO,EAAE;KAC5B,IAAI,CAAC,cAAc,CAAC,OAAO,GAAG,OAAO,CAAC;;KAEtC,OAAO,IAAI,CAAC;IACb;;;;;;;;;GASD,eAAe,EAAE,SAAS,QAAQ,EAAE;KAClC,IAAI,QAAQ,GAAG,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC;KAChD,IAAI,CAAC,cAAc,CAAC,YAAY,GAAG,oBAAoB,CAAC,QAAQ,EAAE,QAAQ,CAAC,CAAC;KAC5E,OAAO,IAAI,CAAC;IACb;;;;;;;;;GASD,qBAAqB,EAAE,SAAS,QAAQ,EAAE;KACxC,IAAI,QAAQ,GAAG,IAAI,CAAC,cAAc,CAAC,kBAAkB,CAAC;KACtD,IAAI,CAAC,cAAc,CAAC,kBAAkB,GAAG,oBAAoB,CAAC,QAAQ,EAAE,QAAQ,CAAC,CAAC;KAClF,OAAO,IAAI,CAAC;IACb;;;;;;;;;GASD,qBAAqB,EAAE,SAAS,QAAQ,EAAE;KACxC,IAAI,QAAQ,GAAG,IAAI,CAAC,cAAc,CAAC,kBAAkB,CAAC;KACtD,IAAI,CAAC,cAAc,CAAC,kBAAkB,GAAG,oBAAoB,CAAC,QAAQ,EAAE,QAAQ,CAAC,CAAC;KAClF,OAAO,IAAI,CAAC;IACb;;;;;;;;;;;GAWD,YAAY,EAAE,SAAS,SAAS,EAAE;KAChC,IAAI,CAAC,cAAc,CAAC,SAAS,GAAG,SAAS,CAAC;;KAE1C,OAAO,IAAI,CAAC;IACb;;;;;;;GAOD,aAAa,EAAE,WAAW;KACxB,OAAO,IAAI,CAAC,sBAAsB,CAAC;IACpC;;;;;;;GAOD,WAAW,EAAE,WAAW;KACtB,OAAO,IAAI,CAAC,YAAY,CAAC;IAC1B;;;;;;;GAOD,OAAO,EAAE,WAAW;KAClB,IAAI,CAAC,IAAI,CAAC,QAAQ,EAAE,OAAO,KAAK,CAAC;KACjC,IAAI,CAAC,IAAI,CAAC,aAAa,EAAE;OACvB,IAAI,CAAC,IAAI,CAAC,uBAAuB,EAAE;SACjC,IAAI,CAAC,uBAAuB,GAAG,IAAI,CAAC;SACpC,IAAI,CAAC,SAAS,CAAC,OAAO,EAAE,uCAAuC,CAAC,CAAC;QAClE;OACD,OAAO,KAAK,CAAC;MACd;KACD,OAAO,IAAI,CAAC;IACb;;GAED,SAAS,EAAE,WAAW;;;;KAIpB,IAAI,WAAW,GAAGC,SAAO,CAAC,WAAW,CAAC;KACtC,IAAI,WAAW,EAAE;OACf,IAAI,CAAC,MAAM,CAAC,WAAW,CAAC,GAAG,EAAE,WAAW,CAAC,MAAM,CAAC,CAAC,OAAO,EAAE,CAAC;MAC5D;IACF;;GAED,gBAAgB,EAAE,SAAS,OAAO,EAAE;KAClC;OACE,CAAC,SAAS;;OAEV,OAAO;;KAET,OAAO,GAAGa,aAAW;OACnB;SACE,OAAO,EAAE,IAAI,CAAC,WAAW,EAAE;SAC3B,GAAG,EAAE,IAAI,CAAC,IAAI;SACd,IAAI,EAAE,IAAI,CAAC,cAAc,CAAC,IAAI,IAAI,EAAE;QACrC;OACD,OAAO;MACR,CAAC;;KAEF,IAAI,CAAC,OAAO,CAAC,OAAO,EAAE;OACpB,MAAM,IAAIoB,WAAgB,CAAC,iBAAiB,CAAC,CAAC;MAC/C;;KAED,IAAI,CAAC,OAAO,CAAC,GAAG,EAAE;OAChB,MAAM,IAAIA,WAAgB,CAAC,aAAa,CAAC,CAAC;MAC3C;;KAED,IAAI,MAAM,GAAG,kBAAkB,CAAC;KAChC,IAAI,cAAc,GAAG,EAAE,CAAC;;KAExB,KAAK,IAAI,GAAG,IAAI,OAAO,EAAE;OACvB,IAAI,GAAG,KAAK,MAAM,EAAE;SAClB,IAAI,IAAI,GAAG,OAAO,CAAC,IAAI,CAAC;SACxB,IAAI,IAAI,CAAC,IAAI,EAAE,cAAc,CAAC,IAAI,CAAC,OAAO,GAAG,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC;SAChE,IAAI,IAAI,CAAC,KAAK,EAAE,cAAc,CAAC,IAAI,CAAC,QAAQ,GAAG,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,CAAC;QACpE,MAAM;SACL,cAAc,CAAC,IAAI,CAAC,MAAM,CAAC,GAAG,CAAC,GAAG,GAAG,GAAG,MAAM,CAAC,OAAO,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC;QAC/D;MACF;KACD,IAAI,YAAY,GAAG,IAAI,CAAC,gBAAgB,CAAC,IAAI,CAAC,SAAS,CAAC,OAAO,CAAC,GAAG,CAAC,CAAC,CAAC;;KAEtE,IAAI,MAAM,GAAG,SAAS,CAAC,aAAa,CAAC,QAAQ,CAAC,CAAC;KAC/C,MAAM,CAAC,KAAK,GAAG,IAAI,CAAC;KACpB,MAAM,CAAC,GAAG,GAAG,YAAY,GAAG,yBAAyB,GAAG,cAAc,CAAC,IAAI,CAAC,GAAG,CAAC,CAAC;KACjF,CAAC,SAAS,CAAC,IAAI,IAAI,SAAS,CAAC,IAAI,EAAE,WAAW,CAAC,MAAM,CAAC,CAAC;IACxD;;;GAGD,kBAAkB,EAAE,WAAW;KAC7B,IAAI,IAAI,GAAG,IAAI,CAAC;KAChB,IAAI,CAAC,cAAc,IAAI,CAAC,CAAC;KACzB,UAAU,CAAC,WAAW;;OAEpB,IAAI,CAAC,cAAc,IAAI,CAAC,CAAC;MAC1B,CAAC,CAAC;IACJ;;GAED,aAAa,EAAE,SAAS,SAAS,EAAE,OAAO,EAAE;;KAE1C,IAAI,GAAG,EAAE,GAAG,CAAC;;KAEb,IAAI,CAAC,IAAI,CAAC,YAAY,EAAE,OAAO;;KAE/B,OAAO,GAAG,OAAO,IAAI,EAAE,CAAC;;KAExB,SAAS,GAAG,OAAO,GAAG,SAAS,CAAC,MAAM,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,WAAW,EAAE,GAAG,SAAS,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC;;KAEjF,IAAI,SAAS,CAAC,WAAW,EAAE;OACzB,GAAG,GAAG,SAAS,CAAC,WAAW,CAAC,YAAY,CAAC,CAAC;OAC1C,GAAG,CAAC,SAAS,CAAC,SAAS,EAAE,IAAI,EAAE,IAAI,CAAC,CAAC;MACtC,MAAM;OACL,GAAG,GAAG,SAAS,CAAC,iBAAiB,EAAE,CAAC;OACpC,GAAG,CAAC,SAAS,GAAG,SAAS,CAAC;MAC3B;;KAED,KAAK,GAAG,IAAI,OAAO;OACjB,IAAIjB,QAAM,CAAC,OAAO,EAAE,GAAG,CAAC,EAAE;SACxB,GAAG,CAAC,GAAG,CAAC,GAAG,OAAO,CAAC,GAAG,CAAC,CAAC;QACzB;;KAEH,IAAI,SAAS,CAAC,WAAW,EAAE;;OAEzB,SAAS,CAAC,aAAa,CAAC,GAAG,CAAC,CAAC;MAC9B,MAAM;;;OAGL,IAAI;SACF,SAAS,CAAC,SAAS,CAAC,IAAI,GAAG,GAAG,CAAC,SAAS,CAAC,WAAW,EAAE,EAAE,GAAG,CAAC,CAAC;QAC9D,CAAC,OAAO,CAAC,EAAE;;QAEX;MACF;IACF;;;;;;;;GAQD,uBAAuB,EAAE,SAAS,OAAO,EAAE;KACzC,IAAI,IAAI,GAAG,IAAI,CAAC;KAChB,OAAO,SAAS,GAAG,EAAE;;;;OAInB,IAAI,CAAC,gBAAgB,GAAG,IAAI,CAAC;;;;;OAK7B,IAAI,IAAI,CAAC,kBAAkB,KAAK,GAAG,EAAE,OAAO;;OAE5C,IAAI,CAAC,kBAAkB,GAAG,GAAG,CAAC;;;;;;OAM9B,IAAI,MAAM,CAAC;OACX,IAAI;SACF,MAAM,GAAGI,kBAAgB,CAAC,GAAG,CAAC,MAAM,CAAC,CAAC;QACvC,CAAC,OAAO,CAAC,EAAE;SACV,MAAM,GAAG,WAAW,CAAC;QACtB;;OAED,IAAI,CAAC,iBAAiB,CAAC;SACrB,QAAQ,EAAE,KAAK,GAAG,OAAO;SACzB,OAAO,EAAE,MAAM;QAChB,CAAC,CAAC;MACJ,CAAC;IACH;;;;;;;GAOD,qBAAqB,EAAE,WAAW;KAChC,IAAI,IAAI,GAAG,IAAI;OACb,gBAAgB,GAAG,IAAI,CAAC;;;;;KAK1B,OAAO,SAAS,GAAG,EAAE;OACnB,IAAI,MAAM,CAAC;OACX,IAAI;SACF,MAAM,GAAG,GAAG,CAAC,MAAM,CAAC;QACrB,CAAC,OAAO,CAAC,EAAE;;;SAGV,OAAO;QACR;OACD,IAAI,OAAO,GAAG,MAAM,IAAI,MAAM,CAAC,OAAO,CAAC;;;;;OAKvC;SACE,CAAC,OAAO;UACP,OAAO,KAAK,OAAO,IAAI,OAAO,KAAK,UAAU,IAAI,CAAC,MAAM,CAAC,iBAAiB,CAAC;;SAE5E,OAAO;;;;OAIT,IAAI,OAAO,GAAG,IAAI,CAAC,gBAAgB,CAAC;OACpC,IAAI,CAAC,OAAO,EAAE;SACZ,IAAI,CAAC,uBAAuB,CAAC,OAAO,CAAC,CAAC,GAAG,CAAC,CAAC;QAC5C;OACD,YAAY,CAAC,OAAO,CAAC,CAAC;OACtB,IAAI,CAAC,gBAAgB,GAAG,UAAU,CAAC,WAAW;SAC5C,IAAI,CAAC,gBAAgB,GAAG,IAAI,CAAC;QAC9B,EAAE,gBAAgB,CAAC,CAAC;MACtB,CAAC;IACH;;;;;;;;GAQD,iBAAiB,EAAE,SAAS,IAAI,EAAE,EAAE,EAAE;KACpC,IAAI,SAAS,GAAGG,UAAQ,CAAC,IAAI,CAAC,SAAS,CAAC,IAAI,CAAC,CAAC;KAC9C,IAAI,QAAQ,GAAGA,UAAQ,CAAC,EAAE,CAAC,CAAC;KAC5B,IAAI,UAAU,GAAGA,UAAQ,CAAC,IAAI,CAAC,CAAC;;;;;KAKhC,IAAI,CAAC,SAAS,GAAG,EAAE,CAAC;;;;KAIpB,IAAI,SAAS,CAAC,QAAQ,KAAK,QAAQ,CAAC,QAAQ,IAAI,SAAS,CAAC,IAAI,KAAK,QAAQ,CAAC,IAAI;OAC9E,EAAE,GAAG,QAAQ,CAAC,QAAQ,CAAC;KACzB,IAAI,SAAS,CAAC,QAAQ,KAAK,UAAU,CAAC,QAAQ,IAAI,SAAS,CAAC,IAAI,KAAK,UAAU,CAAC,IAAI;OAClF,IAAI,GAAG,UAAU,CAAC,QAAQ,CAAC;;KAE7B,IAAI,CAAC,iBAAiB,CAAC;OACrB,QAAQ,EAAE,YAAY;OACtB,IAAI,EAAE;SACJ,EAAE,EAAE,EAAE;SACN,IAAI,EAAE,IAAI;QACX;MACF,CAAC,CAAC;IACJ;;GAED,sBAAsB,EAAE,WAAW;KACjC,IAAI,IAAI,GAAG,IAAI,CAAC;KAChB,IAAI,CAAC,yBAAyB,GAAG,QAAQ,CAAC,SAAS,CAAC,QAAQ,CAAC;;KAE7D,QAAQ,CAAC,SAAS,CAAC,QAAQ,GAAG,WAAW;OACvC,IAAI,OAAO,IAAI,KAAK,UAAU,IAAI,IAAI,CAAC,SAAS,EAAE;SAChD,OAAO,IAAI,CAAC,yBAAyB,CAAC,KAAK,CAAC,IAAI,CAAC,QAAQ,EAAE,SAAS,CAAC,CAAC;QACvE;OACD,OAAO,IAAI,CAAC,yBAAyB,CAAC,KAAK,CAAC,IAAI,EAAE,SAAS,CAAC,CAAC;MAC9D,CAAC;IACH;;GAED,wBAAwB,EAAE,WAAW;KACnC,IAAI,IAAI,CAAC,yBAAyB,EAAE;;OAElC,QAAQ,CAAC,SAAS,CAAC,QAAQ,GAAG,IAAI,CAAC,yBAAyB,CAAC;MAC9D;IACF;;;;;;GAMD,mBAAmB,EAAE,WAAW;KAC9B,IAAI,IAAI,GAAG,IAAI,CAAC;;KAEhB,IAAI,eAAe,GAAG,IAAI,CAAC,gBAAgB,CAAC;;KAE5C,SAAS,UAAU,CAAC,IAAI,EAAE;OACxB,OAAO,SAAS,EAAE,EAAE,CAAC,EAAE;;;;SAIrB,IAAI,IAAI,GAAG,IAAI,KAAK,CAAC,SAAS,CAAC,MAAM,CAAC,CAAC;SACvC,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,IAAI,CAAC,MAAM,EAAE,EAAE,CAAC,EAAE;WACpC,IAAI,CAAC,CAAC,CAAC,GAAG,SAAS,CAAC,CAAC,CAAC,CAAC;UACxB;SACD,IAAI,gBAAgB,GAAG,IAAI,CAAC,CAAC,CAAC,CAAC;SAC/B,IAAIf,YAAU,CAAC,gBAAgB,CAAC,EAAE;WAChC,IAAI,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC,IAAI;aACjB;eACE,SAAS,EAAE;iBACT,IAAI,EAAE,YAAY;iBAClB,IAAI,EAAE,CAAC,QAAQ,EAAE,IAAI,CAAC,IAAI,IAAI,aAAa,CAAC;gBAC7C;cACF;aACD,gBAAgB;YACjB,CAAC;UACH;;;;;SAKD,IAAI,IAAI,CAAC,KAAK,EAAE;WACd,OAAO,IAAI,CAAC,KAAK,CAAC,IAAI,EAAE,IAAI,CAAC,CAAC;UAC/B,MAAM;WACL,OAAO,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,IAAI,CAAC,CAAC,CAAC,CAAC,CAAC;UAC/B;QACF,CAAC;MACH;;KAED,IAAI,eAAe,GAAG,IAAI,CAAC,cAAc,CAAC,eAAe,CAAC;;KAE1D,SAAS,eAAe,CAAC,MAAM,EAAE;OAC/B,IAAI,KAAK,GAAGR,SAAO,CAAC,MAAM,CAAC,IAAIA,SAAO,CAAC,MAAM,CAAC,CAAC,SAAS,CAAC;OACzD,IAAI,KAAK,IAAI,KAAK,CAAC,cAAc,IAAI,KAAK,CAAC,cAAc,CAAC,kBAAkB,CAAC,EAAE;SAC7EwB,MAAI;WACF,KAAK;WACL,kBAAkB;WAClB,SAAS,IAAI,EAAE;aACb,OAAO,SAAS,OAAO,EAAE,EAAE,EAAE,OAAO,EAAE,MAAM,EAAE;;eAE5C,IAAI;iBACF,IAAI,EAAE,IAAI,EAAE,CAAC,WAAW,EAAE;mBACxB,EAAE,CAAC,WAAW,GAAG,IAAI,CAAC,IAAI;qBACxB;uBACE,SAAS,EAAE;yBACT,IAAI,EAAE,YAAY;yBAClB,IAAI,EAAE;2BACJ,MAAM,EAAE,MAAM;2BACd,QAAQ,EAAE,aAAa;2BACvB,OAAO,EAAE,CAAC,EAAE,IAAI,EAAE,CAAC,IAAI,KAAK,aAAa;0BAC1C;wBACF;sBACF;qBACD,EAAE,CAAC,WAAW;oBACf,CAAC;kBACH;gBACF,CAAC,OAAO,GAAG,EAAE;;gBAEb;;;;eAID,IAAI,MAAM,EAAE,YAAY,EAAE,eAAe,CAAC;;eAE1C;iBACE,eAAe;iBACf,eAAe,CAAC,GAAG;kBAClB,MAAM,KAAK,aAAa,IAAI,MAAM,KAAK,MAAM,CAAC;iBAC/C;;;iBAGA,YAAY,GAAG,IAAI,CAAC,uBAAuB,CAAC,OAAO,CAAC,CAAC;iBACrD,eAAe,GAAG,IAAI,CAAC,qBAAqB,EAAE,CAAC;iBAC/C,MAAM,GAAG,SAAS,GAAG,EAAE;;;;mBAIrB,IAAI,CAAC,GAAG,EAAE,OAAO;;mBAEjB,IAAI,SAAS,CAAC;mBACd,IAAI;qBACF,SAAS,GAAG,GAAG,CAAC,IAAI,CAAC;oBACtB,CAAC,OAAO,CAAC,EAAE;;;qBAGV,OAAO;oBACR;mBACD,IAAI,SAAS,KAAK,OAAO,EAAE,OAAO,YAAY,CAAC,GAAG,CAAC,CAAC;wBAC/C,IAAI,SAAS,KAAK,UAAU,EAAE,OAAO,eAAe,CAAC,GAAG,CAAC,CAAC;kBAChE,CAAC;gBACH;eACD,OAAO,IAAI,CAAC,IAAI;iBACd,IAAI;iBACJ,OAAO;iBACP,IAAI,CAAC,IAAI;mBACP;qBACE,SAAS,EAAE;uBACT,IAAI,EAAE,YAAY;uBAClB,IAAI,EAAE;yBACJ,MAAM,EAAE,MAAM;yBACd,QAAQ,EAAE,kBAAkB;yBAC5B,OAAO,EAAE,CAAC,EAAE,IAAI,EAAE,CAAC,IAAI,KAAK,aAAa;wBAC1C;sBACF;oBACF;mBACD,EAAE;mBACF,MAAM;kBACP;iBACD,OAAO;iBACP,MAAM;gBACP,CAAC;cACH,CAAC;YACH;WACD,eAAe;UAChB,CAAC;SACFA,MAAI;WACF,KAAK;WACL,qBAAqB;WACrB,SAAS,IAAI,EAAE;aACb,OAAO,SAAS,GAAG,EAAE,EAAE,EAAE,OAAO,EAAE,MAAM,EAAE;eACxC,IAAI;iBACF,EAAE,GAAG,EAAE,KAAK,EAAE,CAAC,iBAAiB,GAAG,EAAE,CAAC,iBAAiB,GAAG,EAAE,CAAC,CAAC;gBAC/D,CAAC,OAAO,CAAC,EAAE;;gBAEX;eACD,OAAO,IAAI,CAAC,IAAI,CAAC,IAAI,EAAE,GAAG,EAAE,EAAE,EAAE,OAAO,EAAE,MAAM,CAAC,CAAC;cAClD,CAAC;YACH;WACD,eAAe;UAChB,CAAC;QACH;MACF;;KAEDA,MAAI,CAACxB,SAAO,EAAE,YAAY,EAAE,UAAU,EAAE,eAAe,CAAC,CAAC;KACzDwB,MAAI,CAACxB,SAAO,EAAE,aAAa,EAAE,UAAU,EAAE,eAAe,CAAC,CAAC;KAC1D,IAAIA,SAAO,CAAC,qBAAqB,EAAE;OACjCwB,MAAI;SACFxB,SAAO;SACP,uBAAuB;SACvB,SAAS,IAAI,EAAE;WACb,OAAO,SAAS,EAAE,EAAE;aAClB,OAAO,IAAI;eACT,IAAI,CAAC,IAAI;iBACP;mBACE,SAAS,EAAE;qBACT,IAAI,EAAE,YAAY;qBAClB,IAAI,EAAE;uBACJ,QAAQ,EAAE,uBAAuB;uBACjC,OAAO,EAAE,CAAC,IAAI,IAAI,IAAI,CAAC,IAAI,KAAK,aAAa;sBAC9C;oBACF;kBACF;iBACD,EAAE;gBACH;cACF,CAAC;YACH,CAAC;UACH;SACD,eAAe;QAChB,CAAC;MACH;;;;KAID,IAAI,YAAY,GAAG;OACjB,aAAa;OACb,QAAQ;OACR,MAAM;OACN,kBAAkB;OAClB,gBAAgB;OAChB,mBAAmB;OACnB,iBAAiB;OACjB,aAAa;OACb,YAAY;OACZ,oBAAoB;OACpB,aAAa;OACb,YAAY;OACZ,gBAAgB;OAChB,cAAc;OACd,iBAAiB;OACjB,aAAa;OACb,aAAa;OACb,cAAc;OACd,oBAAoB;OACpB,QAAQ;OACR,WAAW;OACX,cAAc;OACd,eAAe;OACf,WAAW;OACX,iBAAiB;OACjB,QAAQ;OACR,gBAAgB;OAChB,2BAA2B;OAC3B,sBAAsB;MACvB,CAAC;KACF,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,YAAY,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;OAC5C,eAAe,CAAC,YAAY,CAAC,CAAC,CAAC,CAAC,CAAC;MAClC;IACF;;;;;;;;;;;GAWD,sBAAsB,EAAE,WAAW;KACjC,IAAI,IAAI,GAAG,IAAI,CAAC;KAChB,IAAI,eAAe,GAAG,IAAI,CAAC,cAAc,CAAC,eAAe,CAAC;;KAE1D,IAAI,eAAe,GAAG,IAAI,CAAC,gBAAgB,CAAC;;KAE5C,SAAS,QAAQ,CAAC,IAAI,EAAE,GAAG,EAAE;OAC3B,IAAI,IAAI,IAAI,GAAG,IAAIQ,YAAU,CAAC,GAAG,CAAC,IAAI,CAAC,CAAC,EAAE;SACxCgB,MAAI,CAAC,GAAG,EAAE,IAAI,EAAE,SAAS,IAAI,EAAE;WAC7B,OAAO,IAAI,CAAC,IAAI;aACd;eACE,SAAS,EAAE;iBACT,IAAI,EAAE,YAAY;iBAClB,IAAI,EAAE,CAAC,QAAQ,EAAE,IAAI,EAAE,OAAO,EAAE,CAAC,IAAI,IAAI,IAAI,CAAC,IAAI,KAAK,aAAa,CAAC;gBACtE;cACF;aACD,IAAI;YACL,CAAC;UACH,CAAC,CAAC;QACJ;MACF;;KAED,IAAI,eAAe,CAAC,GAAG,IAAI,gBAAgB,IAAIxB,SAAO,EAAE;OACtD,IAAI,QAAQ,GAAGA,SAAO,CAAC,cAAc,IAAIA,SAAO,CAAC,cAAc,CAAC,SAAS,CAAC;OAC1EwB,MAAI;SACF,QAAQ;SACR,MAAM;SACN,SAAS,QAAQ,EAAE;WACjB,OAAO,SAAS,MAAM,EAAE,GAAG,EAAE;;;;aAI3B,IAAIf,UAAQ,CAAC,GAAG,CAAC,IAAI,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC,EAAE;eACxD,IAAI,CAAC,WAAW,GAAG;iBACjB,MAAM,EAAE,MAAM;iBACd,GAAG,EAAE,GAAG;iBACR,WAAW,EAAE,IAAI;gBAClB,CAAC;cACH;;aAED,OAAO,QAAQ,CAAC,KAAK,CAAC,IAAI,EAAE,SAAS,CAAC,CAAC;YACxC,CAAC;UACH;SACD,eAAe;QAChB,CAAC;;OAEFe,MAAI;SACF,QAAQ;SACR,MAAM;SACN,SAAS,QAAQ,EAAE;WACjB,OAAO,WAAW;;aAEhB,IAAI,GAAG,GAAG,IAAI,CAAC;;aAEf,SAAS,yBAAyB,GAAG;eACnC,IAAI,GAAG,CAAC,WAAW,IAAI,GAAG,CAAC,UAAU,KAAK,CAAC,EAAE;iBAC3C,IAAI;;;mBAGF,GAAG,CAAC,WAAW,CAAC,WAAW,GAAG,GAAG,CAAC,MAAM,CAAC;kBAC1C,CAAC,OAAO,CAAC,EAAE;;kBAEX;;iBAED,IAAI,CAAC,iBAAiB,CAAC;mBACrB,IAAI,EAAE,MAAM;mBACZ,QAAQ,EAAE,KAAK;mBACf,IAAI,EAAE,GAAG,CAAC,WAAW;kBACtB,CAAC,CAAC;gBACJ;cACF;;aAED,IAAI,KAAK,GAAG,CAAC,QAAQ,EAAE,SAAS,EAAE,YAAY,CAAC,CAAC;aAChD,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,KAAK,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;eACrC,QAAQ,CAAC,KAAK,CAAC,CAAC,CAAC,EAAE,GAAG,CAAC,CAAC;cACzB;;aAED,IAAI,oBAAoB,IAAI,GAAG,IAAIhB,YAAU,CAAC,GAAG,CAAC,kBAAkB,CAAC,EAAE;eACrEgB,MAAI;iBACF,GAAG;iBACH,oBAAoB;iBACpB,SAAS,IAAI,EAAE;mBACb,OAAO,IAAI,CAAC,IAAI;qBACd;uBACE,SAAS,EAAE;yBACT,IAAI,EAAE,YAAY;yBAClB,IAAI,EAAE;2BACJ,QAAQ,EAAE,oBAAoB;2BAC9B,OAAO,EAAE,CAAC,IAAI,IAAI,IAAI,CAAC,IAAI,KAAK,aAAa;0BAC9C;wBACF;sBACF;qBACD,IAAI;qBACJ,yBAAyB;oBAC1B,CAAC;kBACH;gBACF,CAAC;cACH,MAAM;;;eAGL,GAAG,CAAC,kBAAkB,GAAG,yBAAyB,CAAC;cACpD;;aAED,OAAO,QAAQ,CAAC,KAAK,CAAC,IAAI,EAAE,SAAS,CAAC,CAAC;YACxC,CAAC;UACH;SACD,eAAe;QAChB,CAAC;MACH;;KAED,IAAI,eAAe,CAAC,GAAG,IAAIC,eAAa,EAAE,EAAE;OAC1CD,MAAI;SACFxB,SAAO;SACP,OAAO;SACP,SAAS,SAAS,EAAE;WAClB,OAAO,WAAW;;;;aAIhB,IAAI,IAAI,GAAG,IAAI,KAAK,CAAC,SAAS,CAAC,MAAM,CAAC,CAAC;aACvC,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,IAAI,CAAC,MAAM,EAAE,EAAE,CAAC,EAAE;eACpC,IAAI,CAAC,CAAC,CAAC,GAAG,SAAS,CAAC,CAAC,CAAC,CAAC;cACxB;;aAED,IAAI,UAAU,GAAG,IAAI,CAAC,CAAC,CAAC,CAAC;aACzB,IAAI,MAAM,GAAG,KAAK,CAAC;aACnB,IAAI,GAAG,CAAC;;aAER,IAAI,OAAO,UAAU,KAAK,QAAQ,EAAE;eAClC,GAAG,GAAG,UAAU,CAAC;cAClB,MAAM,IAAI,SAAS,IAAIA,SAAO,IAAI,UAAU,YAAYA,SAAO,CAAC,OAAO,EAAE;eACxE,GAAG,GAAG,UAAU,CAAC,GAAG,CAAC;eACrB,IAAI,UAAU,CAAC,MAAM,EAAE;iBACrB,MAAM,GAAG,UAAU,CAAC,MAAM,CAAC;gBAC5B;cACF,MAAM;eACL,GAAG,GAAG,EAAE,GAAG,UAAU,CAAC;cACvB;;;aAGD,IAAI,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,UAAU,CAAC,KAAK,CAAC,CAAC,EAAE;eACvC,OAAO,SAAS,CAAC,KAAK,CAAC,IAAI,EAAE,IAAI,CAAC,CAAC;cACpC;;aAED,IAAI,IAAI,CAAC,CAAC,CAAC,IAAI,IAAI,CAAC,CAAC,CAAC,CAAC,MAAM,EAAE;eAC7B,MAAM,GAAG,IAAI,CAAC,CAAC,CAAC,CAAC,MAAM,CAAC;cACzB;;aAED,IAAI,SAAS,GAAG;eACd,MAAM,EAAE,MAAM;eACd,GAAG,EAAE,GAAG;eACR,WAAW,EAAE,IAAI;cAClB,CAAC;;aAEF,OAAO,SAAS;gBACb,KAAK,CAAC,IAAI,EAAE,IAAI,CAAC;gBACjB,IAAI,CAAC,SAAS,QAAQ,EAAE;iBACvB,SAAS,CAAC,WAAW,GAAG,QAAQ,CAAC,MAAM,CAAC;;iBAExC,IAAI,CAAC,iBAAiB,CAAC;mBACrB,IAAI,EAAE,MAAM;mBACZ,QAAQ,EAAE,OAAO;mBACjB,IAAI,EAAE,SAAS;kBAChB,CAAC,CAAC;;iBAEH,OAAO,QAAQ,CAAC;gBACjB,CAAC;gBACD,OAAO,CAAC,CAAC,SAAS,GAAG,EAAE;;iBAEtB,IAAI,CAAC,iBAAiB,CAAC;mBACrB,IAAI,EAAE,MAAM;mBACZ,QAAQ,EAAE,OAAO;mBACjB,IAAI,EAAE,SAAS;mBACf,KAAK,EAAE,OAAO;kBACf,CAAC,CAAC;;iBAEH,MAAM,GAAG,CAAC;gBACX,CAAC,CAAC;YACN,CAAC;UACH;SACD,eAAe;QAChB,CAAC;MACH;;;;KAID,IAAI,eAAe,CAAC,GAAG,IAAI,IAAI,CAAC,YAAY,EAAE;OAC5C,IAAI,SAAS,CAAC,gBAAgB,EAAE;SAC9B,SAAS,CAAC,gBAAgB,CAAC,OAAO,EAAE,IAAI,CAAC,uBAAuB,CAAC,OAAO,CAAC,EAAE,KAAK,CAAC,CAAC;SAClF,SAAS,CAAC,gBAAgB,CAAC,UAAU,EAAE,IAAI,CAAC,qBAAqB,EAAE,EAAE,KAAK,CAAC,CAAC;QAC7E,MAAM,IAAI,SAAS,CAAC,WAAW,EAAE;;SAEhC,SAAS,CAAC,WAAW,CAAC,SAAS,EAAE,IAAI,CAAC,uBAAuB,CAAC,OAAO,CAAC,CAAC,CAAC;SACxE,SAAS,CAAC,WAAW,CAAC,YAAY,EAAE,IAAI,CAAC,qBAAqB,EAAE,CAAC,CAAC;QACnE;MACF;;;;;;KAMD,IAAI,MAAM,GAAGA,SAAO,CAAC,MAAM,CAAC;KAC5B,IAAI,mBAAmB,GAAG,MAAM,IAAI,MAAM,CAAC,GAAG,IAAI,MAAM,CAAC,GAAG,CAAC,OAAO,CAAC;KACrE,IAAI,sBAAsB;OACxB,CAAC,mBAAmB;OACpBA,SAAO,CAAC,OAAO;OACfA,SAAO,CAAC,OAAO,CAAC,SAAS;OACzBA,SAAO,CAAC,OAAO,CAAC,YAAY,CAAC;KAC/B,IAAI,eAAe,CAAC,QAAQ,IAAI,sBAAsB,EAAE;;OAEtD,IAAI,aAAa,GAAGA,SAAO,CAAC,UAAU,CAAC;OACvCA,SAAO,CAAC,UAAU,GAAG,WAAW;SAC9B,IAAI,WAAW,GAAG,IAAI,CAAC,SAAS,CAAC,IAAI,CAAC;SACtC,IAAI,CAAC,iBAAiB,CAAC,IAAI,CAAC,SAAS,EAAE,WAAW,CAAC,CAAC;;SAEpD,IAAI,aAAa,EAAE;WACjB,OAAO,aAAa,CAAC,KAAK,CAAC,IAAI,EAAE,SAAS,CAAC,CAAC;UAC7C;QACF,CAAC;;OAEF,IAAI,0BAA0B,GAAG,SAAS,gBAAgB,EAAE;;;SAG1D,OAAO,kCAAkC;WACvC,IAAI,GAAG,GAAG,SAAS,CAAC,MAAM,GAAG,CAAC,GAAG,SAAS,CAAC,CAAC,CAAC,GAAG,SAAS,CAAC;;;WAG1D,IAAI,GAAG,EAAE;;aAEP,IAAI,CAAC,iBAAiB,CAAC,IAAI,CAAC,SAAS,EAAE,GAAG,GAAG,EAAE,CAAC,CAAC;YAClD;;WAED,OAAO,gBAAgB,CAAC,KAAK,CAAC,IAAI,EAAE,SAAS,CAAC,CAAC;UAChD,CAAC;QACH,CAAC;;OAEFwB,MAAI,CAACxB,SAAO,CAAC,OAAO,EAAE,WAAW,EAAE,0BAA0B,EAAE,eAAe,CAAC,CAAC;OAChFwB,MAAI,CAACxB,SAAO,CAAC,OAAO,EAAE,cAAc,EAAE,0BAA0B,EAAE,eAAe,CAAC,CAAC;MACpF;;KAED,IAAI,eAAe,CAAC,OAAO,IAAI,SAAS,IAAIA,SAAO,IAAI,OAAO,CAAC,GAAG,EAAE;;OAElE,IAAI,qBAAqB,GAAG,SAAS,GAAG,EAAE,IAAI,EAAE;SAC9C,IAAI,CAAC,iBAAiB,CAAC;WACrB,OAAO,EAAE,GAAG;WACZ,KAAK,EAAE,IAAI,CAAC,KAAK;WACjB,QAAQ,EAAE,SAAS;UACpB,CAAC,CAAC;QACJ,CAAC;;OAEFY,MAAI,CAAC,CAAC,OAAO,EAAE,MAAM,EAAE,MAAM,EAAE,OAAO,EAAE,KAAK,CAAC,EAAE,SAAS,CAAC,EAAE,KAAK,EAAE;SACjE,iBAAiB,CAAC,OAAO,EAAE,KAAK,EAAE,qBAAqB,CAAC,CAAC;QAC1D,CAAC,CAAC;MACJ;IACF;;GAED,gBAAgB,EAAE,WAAW;;KAE3B,IAAI,OAAO,CAAC;KACZ,OAAO,IAAI,CAAC,gBAAgB,CAAC,MAAM,EAAE;OACnC,OAAO,GAAG,IAAI,CAAC,gBAAgB,CAAC,KAAK,EAAE,CAAC;;OAExC,IAAI,GAAG,GAAG,OAAO,CAAC,CAAC,CAAC;SAClB,IAAI,GAAG,OAAO,CAAC,CAAC,CAAC;SACjB,IAAI,GAAG,OAAO,CAAC,CAAC,CAAC,CAAC;;OAEpB,GAAG,CAAC,IAAI,CAAC,GAAG,IAAI,CAAC;MAClB;IACF;;GAED,eAAe,EAAE,WAAW;;KAE1B,KAAK,IAAI,MAAM,IAAI,IAAI,CAAC,uBAAuB,EAAE;OAC/C,IAAI,CAAC,gBAAgB,CAAC,MAAM,CAAC,GAAG,IAAI,CAAC,uBAAuB,CAAC,MAAM,CAAC,CAAC;MACtE;IACF;;GAED,aAAa,EAAE,WAAW;KACxB,IAAI,IAAI,GAAG,IAAI,CAAC;;;KAGhBA,MAAI,CAAC,IAAI,CAAC,QAAQ,EAAE,SAAS,CAAC,EAAE,MAAM,EAAE;OACtC,IAAI,SAAS,GAAG,MAAM,CAAC,CAAC,CAAC,CAAC;OAC1B,IAAI,IAAI,GAAG,MAAM,CAAC,CAAC,CAAC,CAAC;OACrB,SAAS,CAAC,KAAK,CAAC,IAAI,EAAE,CAAC,IAAI,CAAC,CAAC,MAAM,CAAC,IAAI,CAAC,CAAC,CAAC;MAC5C,CAAC,CAAC;IACJ;;GAED,SAAS,EAAE,SAAS,GAAG,EAAE;KACvB,IAAI,CAAC,GAAG,UAAU,CAAC,IAAI,CAAC,GAAG,CAAC;OAC1B,GAAG,GAAG,EAAE;OACR,CAAC,GAAG,CAAC,CAAC;;KAER,IAAI;OACF,OAAO,CAAC,EAAE,EAAE,GAAG,CAAC,OAAO,CAAC,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,CAAC,IAAI,EAAE,CAAC;MAC1C,CAAC,OAAO,CAAC,EAAE;OACV,MAAM,IAAIqB,WAAgB,CAAC,eAAe,GAAG,GAAG,CAAC,CAAC;MACnD;;KAED,IAAI,GAAG,CAAC,IAAI,IAAI,CAAC,IAAI,CAAC,cAAc,CAAC,cAAc,EAAE;OACnD,MAAM,IAAIA,WAAgB;SACxB,gFAAgF;QACjF,CAAC;MACH;;KAED,OAAO,GAAG,CAAC;IACZ;;GAED,gBAAgB,EAAE,SAAS,GAAG,EAAE;;KAE9B,IAAI,YAAY,GAAG,IAAI,GAAG,GAAG,CAAC,IAAI,IAAI,GAAG,CAAC,IAAI,GAAG,GAAG,GAAG,GAAG,CAAC,IAAI,GAAG,EAAE,CAAC,CAAC;;KAEtE,IAAI,GAAG,CAAC,QAAQ,EAAE;OAChB,YAAY,GAAG,GAAG,CAAC,QAAQ,GAAG,GAAG,GAAG,YAAY,CAAC;MAClD;KACD,OAAO,YAAY,CAAC;IACrB;;GAED,uBAAuB,EAAE,SAAS,SAAS,EAAE,OAAO,EAAE;KACpD,OAAO,GAAG,OAAO,IAAI,EAAE,CAAC;KACxB,OAAO,CAAC,SAAS,GAAG,OAAO,CAAC,SAAS,IAAI;OACvC,IAAI,EAAE,SAAS;OACf,OAAO,EAAE,KAAK;MACf,CAAC;;;KAGF,IAAI,CAAC,IAAI,CAAC,cAAc,EAAE;OACxB,IAAI,CAAC,gBAAgB,CAAC,SAAS,EAAE,OAAO,CAAC,CAAC;MAC3C;IACF;;GAED,gBAAgB,EAAE,SAAS,SAAS,EAAE,OAAO,EAAE;KAC7C,IAAI,MAAM,GAAG,IAAI,CAAC,cAAc,CAAC,SAAS,EAAE,OAAO,CAAC,CAAC;;KAErD,IAAI,CAAC,aAAa,CAAC,QAAQ,EAAE;OAC3B,SAAS,EAAE,SAAS;OACpB,OAAO,EAAE,OAAO;MACjB,CAAC,CAAC;;KAEH,IAAI,CAAC,iBAAiB;OACpB,SAAS,CAAC,IAAI;OACd,SAAS,CAAC,OAAO;OACjB,SAAS,CAAC,GAAG;OACb,SAAS,CAAC,MAAM;OAChB,MAAM;OACN,OAAO;MACR,CAAC;IACH;;GAED,cAAc,EAAE,SAAS,SAAS,EAAE,OAAO,EAAE;KAC3C,IAAI,IAAI,GAAG,IAAI,CAAC;KAChB,IAAI,MAAM,GAAG,EAAE,CAAC;KAChB,IAAI,SAAS,CAAC,KAAK,IAAI,SAAS,CAAC,KAAK,CAAC,MAAM,EAAE;OAC7CrB,MAAI,CAAC,SAAS,CAAC,KAAK,EAAE,SAAS,CAAC,EAAE,KAAK,EAAE;SACvC,IAAI,KAAK,GAAG,IAAI,CAAC,eAAe,CAAC,KAAK,EAAE,SAAS,CAAC,GAAG,CAAC,CAAC;SACvD,IAAI,KAAK,EAAE;WACT,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC;UACpB;QACF,CAAC,CAAC;;;OAGH,IAAI,OAAO,IAAI,OAAO,CAAC,cAAc,EAAE;SACrC,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,OAAO,CAAC,cAAc,IAAI,CAAC,GAAG,MAAM,CAAC,MAAM,EAAE,CAAC,EAAE,EAAE;WACpE,MAAM,CAAC,CAAC,CAAC,CAAC,MAAM,GAAG,KAAK,CAAC;UAC1B;QACF;MACF;KACD,MAAM,GAAG,MAAM,CAAC,KAAK,CAAC,CAAC,EAAE,IAAI,CAAC,cAAc,CAAC,eAAe,CAAC,CAAC;KAC9D,OAAO,MAAM,CAAC;IACf;;GAED,eAAe,EAAE,SAAS,KAAK,EAAE,YAAY,EAAE;;KAE7C,IAAI,UAAU,GAAG;OACf,QAAQ,EAAE,KAAK,CAAC,GAAG;OACnB,MAAM,EAAE,KAAK,CAAC,IAAI;OAClB,KAAK,EAAE,KAAK,CAAC,MAAM;OACnB,QAAQ,EAAE,KAAK,CAAC,IAAI,IAAI,GAAG;MAC5B,CAAC;;;;;;;KAOF,IAAI,CAAC,KAAK,CAAC,GAAG,EAAE;OACd,UAAU,CAAC,QAAQ,GAAG,YAAY,CAAC;MACpC;;KAED,UAAU,CAAC,MAAM,GAAG;;;OAGlB,CAAC,CAAC,CAAC,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,IAAI;SACtC,CAAC,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,IAAI,CAAC,UAAU,CAAC,QAAQ,CAAC;;OAE7D,oBAAoB,CAAC,IAAI,CAAC,UAAU,CAAC,UAAU,CAAC,CAAC;;OAEjD,oBAAoB,CAAC,IAAI,CAAC,UAAU,CAAC,QAAQ,CAAC;MAC/C,CAAC;;KAEF,OAAO,UAAU,CAAC;IACnB;;GAED,iBAAiB,EAAE,SAAS,IAAI,EAAE,OAAO,EAAE,OAAO,EAAE,MAAM,EAAE,MAAM,EAAE,OAAO,EAAE;KAC3E,IAAI,eAAe,GAAG,CAAC,IAAI,GAAG,IAAI,GAAG,IAAI,GAAG,EAAE,KAAK,OAAO,IAAI,EAAE,CAAC,CAAC;KAClE;OACE,CAAC,CAAC,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,IAAI;QACtC,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,IAAI,CAAC,OAAO,CAAC;SAC7C,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,IAAI,CAAC,eAAe,CAAC,CAAC;OACzD;OACA,OAAO;MACR;;KAED,IAAI,UAAU,CAAC;;KAEf,IAAI,MAAM,IAAI,MAAM,CAAC,MAAM,EAAE;OAC3B,OAAO,GAAG,MAAM,CAAC,CAAC,CAAC,CAAC,QAAQ,IAAI,OAAO,CAAC;;;OAGxC,MAAM,CAAC,OAAO,EAAE,CAAC;OACjB,UAAU,GAAG,CAAC,MAAM,EAAE,MAAM,CAAC,CAAC;MAC/B,MAAM,IAAI,OAAO,EAAE;OAClB,UAAU,GAAG;SACX,MAAM,EAAE;WACN;aACE,QAAQ,EAAE,OAAO;aACjB,MAAM,EAAE,MAAM;aACd,MAAM,EAAE,IAAI;YACb;UACF;QACF,CAAC;MACH;;KAED;OACE,CAAC,CAAC,IAAI,CAAC,cAAc,CAAC,UAAU,CAAC,IAAI;OACrC,IAAI,CAAC,cAAc,CAAC,UAAU,CAAC,IAAI,CAAC,OAAO,CAAC;OAC5C;OACA,OAAO;MACR;;KAED;OACE,CAAC,CAAC,IAAI,CAAC,cAAc,CAAC,aAAa,CAAC,IAAI;OACxC,CAAC,IAAI,CAAC,cAAc,CAAC,aAAa,CAAC,IAAI,CAAC,OAAO,CAAC;OAChD;OACA,OAAO;MACR;;KAED,IAAI,IAAI,GAAGC,aAAW;OACpB;;SAEE,SAAS,EAAE;WACT,MAAM,EAAE;aACN;eACE,IAAI,EAAE,IAAI;eACV,KAAK,EAAE,OAAO;eACd,UAAU,EAAE,UAAU;cACvB;YACF;UACF;SACD,WAAW,EAAE,OAAO;QACrB;OACD,OAAO;MACR,CAAC;;KAEF,IAAI,EAAE,GAAG,IAAI,CAAC,SAAS,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC;KAClC,IAAI,EAAE,CAAC,IAAI,IAAI,IAAI,IAAI,EAAE,CAAC,KAAK,KAAK,EAAE,EAAE;OACtC,EAAE,CAAC,KAAK,GAAG,4BAA4B,CAAC;MACzC;;;;;KAKD,IAAI,CAAC,IAAI,CAAC,SAAS,CAAC,SAAS,IAAI,IAAI,CAAC,SAAS,EAAE;OAC/C,IAAI,CAAC,SAAS,CAAC,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC;OAC1C,OAAO,IAAI,CAAC,SAAS,CAAC;MACvB;;KAED,IAAI,CAAC,SAAS,CAAC,SAAS,GAAGA,aAAW;OACpC;SACE,IAAI,EAAE,SAAS;SACf,OAAO,EAAE,IAAI;QACd;OACD,IAAI,CAAC,SAAS,CAAC,SAAS,IAAI,EAAE;MAC/B,CAAC;;;KAGF,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,CAAC;IAClB;;GAED,WAAW,EAAE,SAAS,IAAI,EAAE;;;KAG1B,IAAI,GAAG,GAAG,IAAI,CAAC,cAAc,CAAC,gBAAgB,CAAC;KAC/C,IAAI,IAAI,CAAC,OAAO,EAAE;OAChB,IAAI,CAAC,OAAO,GAAGC,UAAQ,CAAC,IAAI,CAAC,OAAO,EAAE,GAAG,CAAC,CAAC;MAC5C;KACD,IAAI,IAAI,CAAC,SAAS,EAAE;OAClB,IAAI,SAAS,GAAG,IAAI,CAAC,SAAS,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC;OACzC,SAAS,CAAC,KAAK,GAAGA,UAAQ,CAAC,SAAS,CAAC,KAAK,EAAE,GAAG,CAAC,CAAC;MAClD;;KAED,IAAI,OAAO,GAAG,IAAI,CAAC,OAAO,CAAC;KAC3B,IAAI,OAAO,EAAE;OACX,IAAI,OAAO,CAAC,GAAG,EAAE;SACf,OAAO,CAAC,GAAG,GAAGA,UAAQ,CAAC,OAAO,CAAC,GAAG,EAAE,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,CAAC;QACvE;OACD,IAAI,OAAO,CAAC,OAAO,EAAE;SACnB,OAAO,CAAC,OAAO,GAAGA,UAAQ,CAAC,OAAO,CAAC,OAAO,EAAE,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,CAAC;QAC/E;MACF;;KAED,IAAI,IAAI,CAAC,WAAW,IAAI,IAAI,CAAC,WAAW,CAAC,MAAM;OAC7C,IAAI,CAAC,gBAAgB,CAAC,IAAI,CAAC,WAAW,CAAC,CAAC;;KAE1C,OAAO,IAAI,CAAC;IACb;;;;;GAKD,gBAAgB,EAAE,SAAS,WAAW,EAAE;;;KAGtC,IAAI,QAAQ,GAAG,CAAC,IAAI,EAAE,MAAM,EAAE,KAAK,CAAC;OAClC,OAAO;OACP,KAAK;OACL,IAAI,CAAC;;KAEP,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,WAAW,CAAC,MAAM,CAAC,MAAM,EAAE,EAAE,CAAC,EAAE;OAClD,KAAK,GAAG,WAAW,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC;OAC9B;SACE,CAAC,KAAK,CAAC,cAAc,CAAC,MAAM,CAAC;SAC7B,CAACT,UAAQ,CAAC,KAAK,CAAC,IAAI,CAAC;SACrBU,cAAY,CAAC,KAAK,CAAC,IAAI,CAAC;;SAExB,SAAS;;OAEX,IAAI,GAAGF,aAAW,CAAC,EAAE,EAAE,KAAK,CAAC,IAAI,CAAC,CAAC;OACnC,KAAK,IAAI,CAAC,GAAG,CAAC,EAAE,CAAC,GAAG,QAAQ,CAAC,MAAM,EAAE,EAAE,CAAC,EAAE;SACxC,OAAO,GAAG,QAAQ,CAAC,CAAC,CAAC,CAAC;SACtB,IAAI,IAAI,CAAC,cAAc,CAAC,OAAO,CAAC,IAAI,IAAI,CAAC,OAAO,CAAC,EAAE;WACjD,IAAI,CAAC,OAAO,CAAC,GAAGC,UAAQ,CAAC,IAAI,CAAC,OAAO,CAAC,EAAE,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,CAAC;UAC3E;QACF;OACD,WAAW,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC,IAAI,GAAG,IAAI,CAAC;MACnC;IACF;;GAED,YAAY,EAAE,WAAW;KACvB,IAAI,CAAC,IAAI,CAAC,aAAa,IAAI,CAAC,IAAI,CAAC,YAAY,EAAE,OAAO;KACtD,IAAI,QAAQ,GAAG,EAAE,CAAC;;KAElB,IAAI,IAAI,CAAC,aAAa,IAAI,UAAU,CAAC,SAAS,EAAE;OAC9C,QAAQ,CAAC,OAAO,GAAG;SACjB,YAAY,EAAE,UAAU,CAAC,SAAS;QACnC,CAAC;MACH;;;KAGD,IAAId,SAAO,CAAC,QAAQ,IAAIA,SAAO,CAAC,QAAQ,CAAC,IAAI,EAAE;OAC7C,QAAQ,CAAC,GAAG,GAAGA,SAAO,CAAC,QAAQ,CAAC,IAAI,CAAC;MACtC;;KAED,IAAI,IAAI,CAAC,YAAY,IAAI,SAAS,CAAC,QAAQ,EAAE;OAC3C,IAAI,CAAC,QAAQ,CAAC,OAAO,EAAE,QAAQ,CAAC,OAAO,GAAG,EAAE,CAAC;OAC7C,QAAQ,CAAC,OAAO,CAAC,OAAO,GAAG,SAAS,CAAC,QAAQ,CAAC;MAC/C;;KAED,OAAO,QAAQ,CAAC;IACjB;;GAED,aAAa,EAAE,WAAW;KACxB,IAAI,CAAC,gBAAgB,GAAG,CAAC,CAAC;KAC1B,IAAI,CAAC,aAAa,GAAG,IAAI,CAAC;IAC3B;;GAED,cAAc,EAAE,WAAW;KACzB,OAAO,IAAI,CAAC,gBAAgB,IAAI,GAAG,EAAE,GAAG,IAAI,CAAC,aAAa,GAAG,IAAI,CAAC,gBAAgB,CAAC;IACpF;;;;;;;;;;;GAWD,aAAa,EAAE,SAAS,OAAO,EAAE;KAC/B,IAAI,IAAI,GAAG,IAAI,CAAC,SAAS,CAAC;;KAE1B;OACE,CAAC,IAAI;OACL,OAAO,CAAC,OAAO,KAAK,IAAI,CAAC,OAAO;OAChC,OAAO,CAAC,WAAW,KAAK,IAAI,CAAC,WAAW;;OAExC,OAAO,KAAK,CAAC;;;KAGf,IAAI,OAAO,CAAC,UAAU,IAAI,IAAI,CAAC,UAAU,EAAE;OACzC,OAAOsB,kBAAgB,CAAC,OAAO,CAAC,UAAU,EAAE,IAAI,CAAC,UAAU,CAAC,CAAC;MAC9D,MAAM,IAAI,OAAO,CAAC,SAAS,IAAI,IAAI,CAAC,SAAS,EAAE;;OAE9C,OAAOD,iBAAe,CAAC,OAAO,CAAC,SAAS,EAAE,IAAI,CAAC,SAAS,CAAC,CAAC;MAC3D;;KAED,OAAO,IAAI,CAAC;IACb;;GAED,gBAAgB,EAAE,SAAS,OAAO,EAAE;;KAElC,IAAI,IAAI,CAAC,cAAc,EAAE,EAAE;OACzB,OAAO;MACR;;KAED,IAAI,MAAM,GAAG,OAAO,CAAC,MAAM,CAAC;;;;;KAK5B,IAAI,EAAE,MAAM,KAAK,GAAG,IAAI,MAAM,KAAK,GAAG,IAAI,MAAM,KAAK,GAAG,CAAC,EAAE,OAAO;;KAElE,IAAI,KAAK,CAAC;KACV,IAAI;;;OAGF,IAAII,eAAa,EAAE,EAAE;SACnB,KAAK,GAAG,OAAO,CAAC,OAAO,CAAC,GAAG,CAAC,aAAa,CAAC,CAAC;QAC5C,MAAM;SACL,KAAK,GAAG,OAAO,CAAC,iBAAiB,CAAC,aAAa,CAAC,CAAC;QAClD;;;OAGD,KAAK,GAAG,QAAQ,CAAC,KAAK,EAAE,EAAE,CAAC,GAAG,IAAI,CAAC;MACpC,CAAC,OAAO,CAAC,EAAE;;MAEX;;KAED,IAAI,CAAC,gBAAgB,GAAG,KAAK;;SAEzB,KAAK;;SAEL,IAAI,CAAC,gBAAgB,GAAG,CAAC,IAAI,IAAI,CAAC;;KAEtC,IAAI,CAAC,aAAa,GAAG,GAAG,EAAE,CAAC;IAC5B;;GAED,KAAK,EAAE,SAAS,IAAI,EAAE;KACpB,IAAI,aAAa,GAAG,IAAI,CAAC,cAAc,CAAC;;KAExC,IAAI,QAAQ,GAAG;SACX,OAAO,EAAE,IAAI,CAAC,cAAc;SAC5B,MAAM,EAAE,aAAa,CAAC,MAAM;SAC5B,QAAQ,EAAE,YAAY;QACvB;OACD,QAAQ,GAAG,IAAI,CAAC,YAAY,EAAE,CAAC;;KAEjC,IAAI,QAAQ,EAAE;OACZ,QAAQ,CAAC,OAAO,GAAG,QAAQ,CAAC;MAC7B;;;KAGD,IAAI,IAAI,CAAC,cAAc,EAAE,OAAO,IAAI,CAAC,cAAc,CAAC;;KAEpD,IAAI,GAAGZ,aAAW,CAAC,QAAQ,EAAE,IAAI,CAAC,CAAC;;;KAGnC,IAAI,CAAC,IAAI,GAAGA,aAAW,CAACA,aAAW,CAAC,EAAE,EAAE,IAAI,CAAC,cAAc,CAAC,IAAI,CAAC,EAAE,IAAI,CAAC,IAAI,CAAC,CAAC;KAC9E,IAAI,CAAC,KAAK,GAAGA,aAAW,CAACA,aAAW,CAAC,EAAE,EAAE,IAAI,CAAC,cAAc,CAAC,KAAK,CAAC,EAAE,IAAI,CAAC,KAAK,CAAC,CAAC;;;KAGjF,IAAI,CAAC,KAAK,CAAC,kBAAkB,CAAC,GAAG,GAAG,EAAE,GAAG,IAAI,CAAC,UAAU,CAAC;;KAEzD,IAAI,IAAI,CAAC,YAAY,IAAI,IAAI,CAAC,YAAY,CAAC,MAAM,GAAG,CAAC,EAAE;;;OAGrD,IAAI,CAAC,WAAW,GAAG;SACjB,MAAM,EAAE,EAAE,CAAC,KAAK,CAAC,IAAI,CAAC,IAAI,CAAC,YAAY,EAAE,CAAC,CAAC;QAC5C,CAAC;MACH;;KAED,IAAI,IAAI,CAAC,cAAc,CAAC,IAAI,EAAE;;OAE5B,IAAI,CAAC,IAAI,GAAG,IAAI,CAAC,cAAc,CAAC,IAAI,CAAC;MACtC;;;KAGD,IAAI,aAAa,CAAC,WAAW,EAAE,IAAI,CAAC,WAAW,GAAG,aAAa,CAAC,WAAW,CAAC;;;KAG5E,IAAI,aAAa,CAAC,OAAO,EAAE,IAAI,CAAC,OAAO,GAAG,aAAa,CAAC,OAAO,CAAC;;;KAGhE,IAAI,aAAa,CAAC,UAAU,EAAE,IAAI,CAAC,WAAW,GAAG,aAAa,CAAC,UAAU,CAAC;;KAE1E,IAAI,GAAG,IAAI,CAAC,aAAa,CAAC,IAAI,CAAC,CAAC;;;KAGhC,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC,OAAO,CAAC,SAAS,GAAG,EAAE;OACtC,IAAI,IAAI,CAAC,GAAG,CAAC,IAAI,IAAI,IAAI,IAAI,CAAC,GAAG,CAAC,KAAK,EAAE,IAAIF,eAAa,CAAC,IAAI,CAAC,GAAG,CAAC,CAAC,EAAE;SACrE,OAAO,IAAI,CAAC,GAAG,CAAC,CAAC;QAClB;MACF,CAAC,CAAC;;KAEH,IAAIH,YAAU,CAAC,aAAa,CAAC,YAAY,CAAC,EAAE;OAC1C,IAAI,GAAG,aAAa,CAAC,YAAY,CAAC,IAAI,CAAC,IAAI,IAAI,CAAC;MACjD;;;KAGD,IAAI,CAAC,IAAI,IAAIG,eAAa,CAAC,IAAI,CAAC,EAAE;OAChC,OAAO;MACR;;;KAGD;OACEH,YAAU,CAAC,aAAa,CAAC,kBAAkB,CAAC;OAC5C,CAAC,aAAa,CAAC,kBAAkB,CAAC,IAAI,CAAC;OACvC;OACA,OAAO;MACR;;;;KAID,IAAI,IAAI,CAAC,cAAc,EAAE,EAAE;OACzB,IAAI,CAAC,SAAS,CAAC,MAAM,EAAE,sCAAsC,EAAE,IAAI,CAAC,CAAC;OACrE,OAAO;MACR;;KAED,IAAI,OAAO,aAAa,CAAC,UAAU,KAAK,QAAQ,EAAE;OAChD,IAAI,IAAI,CAAC,MAAM,EAAE,GAAG,aAAa,CAAC,UAAU,EAAE;SAC5C,IAAI,CAAC,qBAAqB,CAAC,IAAI,CAAC,CAAC;QAClC;MACF,MAAM;OACL,IAAI,CAAC,qBAAqB,CAAC,IAAI,CAAC,CAAC;MAClC;IACF;;GAED,aAAa,EAAE,SAAS,IAAI,EAAE;KAC5B,OAAOqB,UAAQ,CAAC,IAAI,EAAE,IAAI,CAAC,cAAc,CAAC,YAAY,CAAC,CAAC;IACzD;;GAED,QAAQ,EAAE,WAAW;KACnB,OAAOV,OAAK,EAAE,CAAC;IAChB;;GAED,qBAAqB,EAAE,SAAS,IAAI,EAAE,QAAQ,EAAE;KAC9C,IAAI,IAAI,GAAG,IAAI,CAAC;KAChB,IAAI,aAAa,GAAG,IAAI,CAAC,cAAc,CAAC;;KAExC,IAAI,CAAC,IAAI,CAAC,OAAO,EAAE,EAAE,OAAO;;;KAG5B,IAAI,GAAG,IAAI,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC;;;;;KAK9B,IAAI,CAAC,IAAI,CAAC,cAAc,CAAC,eAAe,IAAI,IAAI,CAAC,aAAa,CAAC,IAAI,CAAC,EAAE;OACpE,IAAI,CAAC,SAAS,CAAC,MAAM,EAAE,8BAA8B,EAAE,IAAI,CAAC,CAAC;OAC7D,OAAO;MACR;;;;;KAKD,IAAI,CAAC,YAAY,GAAG,IAAI,CAAC,QAAQ,KAAK,IAAI,CAAC,QAAQ,GAAG,IAAI,CAAC,QAAQ,EAAE,CAAC,CAAC;;;KAGvE,IAAI,CAAC,SAAS,GAAG,IAAI,CAAC;;KAEtB,IAAI,CAAC,SAAS,CAAC,OAAO,EAAE,sBAAsB,EAAE,IAAI,CAAC,CAAC;;KAEtD,IAAI,IAAI,GAAG;OACT,cAAc,EAAE,GAAG;OACnB,aAAa,EAAE,WAAW,GAAG,IAAI,CAAC,OAAO;OACzC,UAAU,EAAE,IAAI,CAAC,UAAU;MAC5B,CAAC;;KAEF,IAAI,IAAI,CAAC,aAAa,EAAE;OACtB,IAAI,CAAC,aAAa,GAAG,IAAI,CAAC,aAAa,CAAC;MACzC;;KAED,IAAI,SAAS,GAAG,IAAI,CAAC,SAAS,IAAI,IAAI,CAAC,SAAS,CAAC,MAAM,CAAC,CAAC,CAAC,CAAC;;;KAG3D;OACE,IAAI,CAAC,cAAc,CAAC,eAAe;OACnC,IAAI,CAAC,cAAc,CAAC,eAAe,CAAC,MAAM;OAC1C;OACA,IAAI,CAAC,iBAAiB,CAAC;SACrB,QAAQ,EAAE,QAAQ;SAClB,OAAO,EAAE,SAAS;aACd,CAAC,SAAS,CAAC,IAAI,GAAG,SAAS,CAAC,IAAI,GAAG,IAAI,GAAG,EAAE,IAAI,SAAS,CAAC,KAAK;aAC/D,IAAI,CAAC,OAAO;SAChB,QAAQ,EAAE,IAAI,CAAC,QAAQ;SACvB,KAAK,EAAE,IAAI,CAAC,KAAK,IAAI,OAAO;QAC7B,CAAC,CAAC;MACJ;;KAED,IAAI,GAAG,GAAG,IAAI,CAAC,eAAe,CAAC;KAC/B,CAAC,aAAa,CAAC,SAAS,IAAI,IAAI,CAAC,YAAY,EAAE,IAAI,CAAC,IAAI,EAAE;OACxD,GAAG,EAAE,GAAG;OACR,IAAI,EAAE,IAAI;OACV,IAAI,EAAE,IAAI;OACV,OAAO,EAAE,aAAa;OACtB,SAAS,EAAE,SAAS,OAAO,GAAG;SAC5B,IAAI,CAAC,aAAa,EAAE,CAAC;;SAErB,IAAI,CAAC,aAAa,CAAC,SAAS,EAAE;WAC5B,IAAI,EAAE,IAAI;WACV,GAAG,EAAE,GAAG;UACT,CAAC,CAAC;SACH,QAAQ,IAAI,QAAQ,EAAE,CAAC;QACxB;OACD,OAAO,EAAE,SAAS,OAAO,CAAC,KAAK,EAAE;SAC/B,IAAI,CAAC,SAAS,CAAC,OAAO,EAAE,kCAAkC,EAAE,KAAK,CAAC,CAAC;;SAEnE,IAAI,KAAK,CAAC,OAAO,EAAE;WACjB,IAAI,CAAC,gBAAgB,CAAC,KAAK,CAAC,OAAO,CAAC,CAAC;UACtC;;SAED,IAAI,CAAC,aAAa,CAAC,SAAS,EAAE;WAC5B,IAAI,EAAE,IAAI;WACV,GAAG,EAAE,GAAG;UACT,CAAC,CAAC;SACH,KAAK,GAAG,KAAK,IAAI,IAAI,KAAK,CAAC,oDAAoD,CAAC,CAAC;SACjF,QAAQ,IAAI,QAAQ,CAAC,KAAK,CAAC,CAAC;QAC7B;MACF,CAAC,CAAC;IACJ;;GAED,YAAY,EAAE,SAAS,IAAI,EAAE;;KAE3B,IAAI,GAAG,GAAG,IAAI,CAAC,GAAG,GAAG,GAAG,GAAGD,WAAS,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;;KAEhD,IAAI,gBAAgB,GAAG,IAAI,CAAC;KAC5B,IAAI,wBAAwB,GAAG,EAAE,CAAC;;KAElC,IAAI,IAAI,CAAC,OAAO,CAAC,OAAO,EAAE;OACxB,gBAAgB,GAAG,IAAI,CAAC,aAAa,CAAC,IAAI,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC;MAC7D;;KAED,IAAI,IAAI,CAAC,OAAO,CAAC,eAAe,EAAE;OAChC,wBAAwB,GAAG,IAAI,CAAC,aAAa,CAAC,IAAI,CAAC,OAAO,CAAC,eAAe,CAAC,CAAC;MAC7E;;KAED,IAAIO,eAAa,EAAE,EAAE;OACnB,wBAAwB,CAAC,IAAI,GAAG1B,WAAS,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;;OAErD,IAAI,mBAAmB,GAAGc,aAAW,CAAC,EAAE,EAAE,IAAI,CAAC,cAAc,CAAC,CAAC;OAC/D,IAAI,YAAY,GAAGA,aAAW,CAAC,mBAAmB,EAAE,wBAAwB,CAAC,CAAC;;OAE9E,IAAI,gBAAgB,EAAE;SACpB,YAAY,CAAC,OAAO,GAAG,gBAAgB,CAAC;QACzC;;OAED,OAAOb,SAAO;UACX,KAAK,CAAC,GAAG,EAAE,YAAY,CAAC;UACxB,IAAI,CAAC,SAAS,QAAQ,EAAE;WACvB,IAAI,QAAQ,CAAC,EAAE,EAAE;aACf,IAAI,CAAC,SAAS,IAAI,IAAI,CAAC,SAAS,EAAE,CAAC;YACpC,MAAM;aACL,IAAI,KAAK,GAAG,IAAI,KAAK,CAAC,qBAAqB,GAAG,QAAQ,CAAC,MAAM,CAAC,CAAC;;;aAG/D,KAAK,CAAC,OAAO,GAAG,QAAQ,CAAC;aACzB,IAAI,CAAC,OAAO,IAAI,IAAI,CAAC,OAAO,CAAC,KAAK,CAAC,CAAC;YACrC;UACF,CAAC;UACD,OAAO,CAAC,CAAC,WAAW;WACnB,IAAI,CAAC,OAAO;aACV,IAAI,CAAC,OAAO,CAAC,IAAI,KAAK,CAAC,wCAAwC,CAAC,CAAC,CAAC;UACrE,CAAC,CAAC;MACN;;KAED,IAAI,OAAO,GAAGA,SAAO,CAAC,cAAc,IAAI,IAAIA,SAAO,CAAC,cAAc,EAAE,CAAC;KACrE,IAAI,CAAC,OAAO,EAAE,OAAO;;;KAGrB,IAAI,OAAO,GAAG,iBAAiB,IAAI,OAAO,IAAI,OAAO,cAAc,KAAK,WAAW,CAAC;;KAEpF,IAAI,CAAC,OAAO,EAAE,OAAO;;KAErB,IAAI,iBAAiB,IAAI,OAAO,EAAE;OAChC,OAAO,CAAC,kBAAkB,GAAG,WAAW;SACtC,IAAI,OAAO,CAAC,UAAU,KAAK,CAAC,EAAE;WAC5B,OAAO;UACR,MAAM,IAAI,OAAO,CAAC,MAAM,KAAK,GAAG,EAAE;WACjC,IAAI,CAAC,SAAS,IAAI,IAAI,CAAC,SAAS,EAAE,CAAC;UACpC,MAAM,IAAI,IAAI,CAAC,OAAO,EAAE;WACvB,IAAI,GAAG,GAAG,IAAI,KAAK,CAAC,qBAAqB,GAAG,OAAO,CAAC,MAAM,CAAC,CAAC;WAC5D,GAAG,CAAC,OAAO,GAAG,OAAO,CAAC;WACtB,IAAI,CAAC,OAAO,CAAC,GAAG,CAAC,CAAC;UACnB;QACF,CAAC;MACH,MAAM;OACL,OAAO,GAAG,IAAI,cAAc,EAAE,CAAC;;;OAG/B,GAAG,GAAG,GAAG,CAAC,OAAO,CAAC,UAAU,EAAE,EAAE,CAAC,CAAC;;;OAGlC,IAAI,IAAI,CAAC,SAAS,EAAE;SAClB,OAAO,CAAC,MAAM,GAAG,IAAI,CAAC,SAAS,CAAC;QACjC;OACD,IAAI,IAAI,CAAC,OAAO,EAAE;SAChB,OAAO,CAAC,OAAO,GAAG,WAAW;WAC3B,IAAI,GAAG,GAAG,IAAI,KAAK,CAAC,mCAAmC,CAAC,CAAC;WACzD,GAAG,CAAC,OAAO,GAAG,OAAO,CAAC;WACtB,IAAI,CAAC,OAAO,CAAC,GAAG,CAAC,CAAC;UACnB,CAAC;QACH;MACF;;KAED,OAAO,CAAC,IAAI,CAAC,MAAM,EAAE,GAAG,CAAC,CAAC;;KAE1B,IAAI,gBAAgB,EAAE;OACpBY,MAAI,CAAC,gBAAgB,EAAE,SAAS,GAAG,EAAE,KAAK,EAAE;SAC1C,OAAO,CAAC,gBAAgB,CAAC,GAAG,EAAE,KAAK,CAAC,CAAC;QACtC,CAAC,CAAC;MACJ;;KAED,OAAO,CAAC,IAAI,CAACb,WAAS,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC;IACpC;;GAED,aAAa,EAAE,SAAS,IAAI,EAAE;KAC5B,IAAI,SAAS,GAAG,EAAE,CAAC;;KAEnB,KAAK,IAAI,GAAG,IAAI,IAAI,EAAE;OACpB,IAAI,IAAI,CAAC,cAAc,CAAC,GAAG,CAAC,EAAE;SAC5B,IAAI,KAAK,GAAG,IAAI,CAAC,GAAG,CAAC,CAAC;SACtB,SAAS,CAAC,GAAG,CAAC,GAAG,OAAO,KAAK,KAAK,UAAU,GAAG,KAAK,EAAE,GAAG,KAAK,CAAC;QAChE;MACF;;KAED,OAAO,SAAS,CAAC;IAClB;;GAED,SAAS,EAAE,SAAS,KAAK,EAAE;;KAEzB;OACE,IAAI,CAAC,uBAAuB,CAAC,KAAK,CAAC;QAClC,IAAI,CAAC,KAAK,IAAI,IAAI,CAAC,cAAc,CAAC,KAAK,CAAC;OACzC;;OAEA,QAAQ,CAAC,SAAS,CAAC,KAAK,CAAC,IAAI;SAC3B,IAAI,CAAC,uBAAuB,CAAC,KAAK,CAAC;SACnC,IAAI,CAAC,gBAAgB;SACrB,EAAE,CAAC,KAAK,CAAC,IAAI,CAAC,SAAS,EAAE,CAAC,CAAC;QAC5B,CAAC;MACH;IACF;;GAED,aAAa,EAAE,SAAS,GAAG,EAAE,OAAO,EAAE;KACpC,IAAIQ,aAAW,CAAC,OAAO,CAAC,EAAE;OACxB,OAAO,IAAI,CAAC,cAAc,CAAC,GAAG,CAAC,CAAC;MACjC,MAAM;OACL,IAAI,CAAC,cAAc,CAAC,GAAG,CAAC,GAAGM,aAAW,CAAC,IAAI,CAAC,cAAc,CAAC,GAAG,CAAC,IAAI,EAAE,EAAE,OAAO,CAAC,CAAC;MACjF;IACF;EACF,CAAC;;;CAGF,KAAK,CAAC,SAAS,CAAC,OAAO,GAAG,KAAK,CAAC,SAAS,CAAC,cAAc,CAAC;CACzD,KAAK,CAAC,SAAS,CAAC,iBAAiB,GAAG,KAAK,CAAC,SAAS,CAAC,UAAU,CAAC;;CAE/D,SAAc,GAAG,KAAK,CAAC;;CC7uEvB;;;;;;;;;CASA,IAAIb,SAAO;GACT,OAAO,MAAM,KAAK,WAAW;OACzB,MAAM;OACN,OAAOF,cAAM,KAAK,WAAW,GAAGA,cAAM,GAAG,OAAO,IAAI,KAAK,WAAW,GAAG,IAAI,GAAG,EAAE,CAAC;CACvF,IAAI,MAAM,GAAGE,SAAO,CAAC,KAAK,CAAC;;CAE3B,IAAIkC,OAAK,GAAG,IAAIC,KAAgB,EAAE,CAAC;;;;;;;;AAQnCD,QAAK,CAAC,UAAU,GAAG,WAAW;GAC5BlC,SAAO,CAAC,KAAK,GAAG,MAAM,CAAC;GACvB,OAAOkC,OAAK,CAAC;EACd,CAAC;;AAEFA,QAAK,CAAC,SAAS,EAAE,CAAC;;CAElB,aAAc,GAAGA,OAAK,CAAC;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;;CAoCvB,UAAqB,GAAGC,KAAgB,CAAC;;;CClEzC;AACA;CAOA,CAAC,YAAM;CAAA,MACKC,IADL,GACcC,MAAM,CAACC,QADrB,CACKF,IADL;CAEH,MAAMG,GAAG,GAAG;CACRC,IAAAA,IAAI,EAAEJ,IAAI,KAAK,SADP;CAERK,IAAAA,GAAG,EAAEL,IAAI,KAAK;CAFN,GAAZ;CAKAM,EAAAA,QAAQ,CAACC,gBAAT,CAA0B,kBAA1B,EAA8C,YAAM;CAChDT,IAAAA,SAAK,CAACU,OAAN,CAAc,YAAM;CAChB,UAAMC,QAAQ,GAAG,SAAjB;CACA,UAAMC,SAAS,GAAGJ,QAAQ,CAACK,cAAT,CAAwB,WAAxB,CAAlB;;CAEA,UAAIV,MAAM,CAACW,GAAX,EAAgB;CACZX,QAAAA,MAAM,CAACW,GAAP,CAAWC,KAAX,CAAiB;CACbC,UAAAA,KAAK,EAAE;CACHC,YAAAA,SAAS,EAAE;CADR;CADM,SAAjB;CAKH,OAVe;;;CAahB,UAAMC,YAAY,GAAG,WAArB,CAbgB;;CAgBhBV,MAAAA,QAAQ,CAACC,gBAAT,CAA0B,UAA1B,EAAsC,UAAAU,KAAK,EAAI;CAC3C,YAAI,CAACA,KAAK,CAACC,MAAN,CAAaC,SAAd,IAA2BT,SAAS,CAACU,QAAV,CAAmBH,KAAK,CAACC,MAAzB,CAA/B,EAAiE;CAC7D;CACH;;CAEDD,QAAAA,KAAK,CAACC,MAAN,CAAaC,SAAb,CAAuBE,MAAvB,CAA8BL,YAA9B;CACH,OAND,EAhBgB;;CAyBhBV,MAAAA,QAAQ,CAACC,gBAAT,CAA0B,SAA1B,EAAqC,UAAAU,KAAK,EAAI;CAC1C,YAAIA,KAAK,CAACK,OAAN,KAAkB,CAAtB,EAAyB;CACrB;CACH,SAHyC;CAM1C;;;CACAC,QAAAA,UAAU,CAAC,YAAM;CACb,cAAMC,OAAO,GAAGlB,QAAQ,CAACmB,aAAzB;;CAEA,cAAI,CAACD,OAAD,IAAY,CAACA,OAAO,CAACL,SAArB,IAAkCT,SAAS,CAACU,QAAV,CAAmBI,OAAnB,CAAtC,EAAmE;CAC/D;CACH;;CAEDA,UAAAA,OAAO,CAACL,SAAR,CAAkBO,GAAlB,CAAsBV,YAAtB;CACH,SARS,EAQP,EARO,CAAV;CASH,OAhBD,EAzBgB;;CA4ChB,UAAMW,MAAM,GAAG,IAAIC,IAAJ,CAASnB,QAAT,EAAmB;CAC9BoB,QAAAA,KAAK,EAAE,IADuB;CAE9BC,QAAAA,KAAK,EAAE,uBAFuB;CAG9BC,QAAAA,OAAO,EAAE,kBAHqB;CAI9BC,QAAAA,QAAQ,EAAE;CACNtE,UAAAA,MAAM,EAAE;CADF,SAJoB;CAO9BuE,QAAAA,QAAQ,EAAE;CACNC,UAAAA,QAAQ,EAAE;CADJ,SAPoB;CAU9BC,QAAAA,QAAQ,EAAE;CACNC,UAAAA,MAAM,EAAE;CADF,SAVoB;CAa9BC,QAAAA,IAAI,EAAE;CACFC,UAAAA,MAAM,EAAE;CADN,SAbwB;CAgB9BC,QAAAA,GAAG,EAAE;CACDC,UAAAA,OAAO,EAAErC,GAAG,CAACC,IAAJ,IAAYD,GAAG,CAACE,GADxB;CAEDoC,UAAAA,WAAW,EAAE;CAFZ;CAhByB,OAAnB,CAAf,CA5CgB;;CAmEhBxC,MAAAA,MAAM,CAAC0B,MAAP,GAAgBA,MAAhB,CAnEgB;;CAsEhB,UAAMe,OAAO,GAAGpC,QAAQ,CAACqC,gBAAT,CAA0B,eAA1B,CAAhB;CACA,UAAMC,KAAK,GAAG;CACVC,QAAAA,KAAK,EAAE,OADG;CAEVC,QAAAA,KAAK,EAAE,OAFG;CAGVC,QAAAA,OAAO,EAAE,SAHC;CAIVC,QAAAA,KAAK,EAAE;CAJG,OAAd;CAMA,UAAIC,WAAW,GAAGhD,MAAM,CAACC,QAAP,CAAgBgD,IAAhB,CAAqBC,OAArB,CAA6B,GAA7B,EAAkC,EAAlC,CAAlB;CACA,UAAMC,cAAc,GAAGnD,MAAM,CAACoD,OAAP,IAAkBpD,MAAM,CAACoD,OAAP,CAAeC,SAAxD,CA9EgB;;CAiFhB,eAASC,WAAT,CAAqBC,OAArB,EAA8BC,SAA9B,EAAyCC,KAAzC,EAAgD;CAC5C,YAAIF,OAAJ,EAAa;CACTA,UAAAA,OAAO,CAACrC,SAAR,CAAkBuC,KAAK,GAAG,KAAH,GAAW,QAAlC,EAA4CD,SAA5C;CACH;CACJ,OArFe;;;CAwFhB,eAASE,SAAT,CAAmBC,IAAnB,EAAyBC,IAAzB,EAA+B;CAC3B;CACA,YACI,EAAED,IAAI,IAAIhB,KAAV,KACC,CAACiB,IAAD,IAASD,IAAI,KAAKX,WADnB,IAEC,CAACA,WAAW,CAACa,MAAb,IAAuBF,IAAI,KAAKhB,KAAK,CAACC,KAH3C,EAIE;CACE;CACH;;CAED,gBAAQe,IAAR;CACI,eAAKhB,KAAK,CAACC,KAAX;CACIlB,YAAAA,MAAM,CAACoC,MAAP,GAAgB;CACZH,cAAAA,IAAI,EAAE,OADM;CAEZ9B,cAAAA,KAAK,EAAE,uBAFK;CAGZkC,cAAAA,OAAO,EAAE,CACL;CACIC,gBAAAA,GAAG,EAAE,wEADT;CAEIL,gBAAAA,IAAI,EAAE,WAFV;CAGIM,gBAAAA,IAAI,EAAE;CAHV,eADK,EAML;CACID,gBAAAA,GAAG,EAAE,wEADT;CAEIL,gBAAAA,IAAI,EAAE,WAFV;CAGIM,gBAAAA,IAAI,EAAE;CAHV,eANK,EAWL;CACID,gBAAAA,GAAG,EAAE,yEADT;CAEIL,gBAAAA,IAAI,EAAE,WAFV;CAGIM,gBAAAA,IAAI,EAAE;CAHV,eAXK,EAgBL;CACID,gBAAAA,GAAG,EAAE,yEADT;CAEIL,gBAAAA,IAAI,EAAE,WAFV;CAGIM,gBAAAA,IAAI,EAAE;CAHV,eAhBK,CAHG;CAyBZC,cAAAA,MAAM,EAAE,sEAzBI;CA0BZC,cAAAA,MAAM,EAAE,CACJ;CACIC,gBAAAA,IAAI,EAAE,UADV;CAEIC,gBAAAA,KAAK,EAAE,SAFX;CAGIC,gBAAAA,OAAO,EAAE,IAHb;CAIIN,gBAAAA,GAAG,EAAE,yEAJT;CAKIO,gBAAAA,OAAO,EAAE;CALb,eADI,EAQJ;CACIH,gBAAAA,IAAI,EAAE,UADV;CAEIC,gBAAAA,KAAK,EAAE,QAFX;CAGIC,gBAAAA,OAAO,EAAE,IAHb;CAIIN,gBAAAA,GAAG,EAAE;CAJT,eARI;CA1BI,aAAhB;CA2CA;;CAEJ,eAAKrB,KAAK,CAACE,KAAX;CACInB,YAAAA,MAAM,CAACoC,MAAP,GAAgB;CACZH,cAAAA,IAAI,EAAE,OADM;CAEZ9B,cAAAA,KAAK,EAAE,6DAFK;CAGZkC,cAAAA,OAAO,EAAE,CACL;CACIC,gBAAAA,GAAG,EAAE,6EADT;CAEIL,gBAAAA,IAAI,EAAE;CAFV,eADK,EAKL;CACIK,gBAAAA,GAAG,EAAE,6EADT;CAEIL,gBAAAA,IAAI,EAAE;CAFV,eALK;CAHG,aAAhB;CAeA;;CAEJ,eAAKhB,KAAK,CAACG,OAAX;CACIpB,YAAAA,MAAM,CAACoC,MAAP,GAAgB;CACZH,cAAAA,IAAI,EAAE,OADM;CAEZI,cAAAA,OAAO,EAAE,CACL;CACIC,gBAAAA,GAAG,EAAE,yCADT;CAEIQ,gBAAAA,QAAQ,EAAE;CAFd,eADK;CAFG,aAAhB;CAUA;;CAEJ,eAAK7B,KAAK,CAACI,KAAX;CACIrB,YAAAA,MAAM,CAACoC,MAAP,GAAgB;CACZH,cAAAA,IAAI,EAAE,OADM;CAEZI,cAAAA,OAAO,EAAE,CACL;CACIC,gBAAAA,GAAG,EAAE,4BADT;CAEIQ,gBAAAA,QAAQ,EAAE;CAFd,eADK;CAFG,aAAhB;CAUA;;CAEJ;CACI;CA5FR,SAV2B;;;CA0G3BxB,QAAAA,WAAW,GAAGW,IAAd,CA1G2B;;CA6G3Bc,QAAAA,KAAK,CAACC,IAAN,CAAWjC,OAAX,EAAoBkC,OAApB,CAA4B,UAAAC,MAAM;CAAA,iBAAItB,WAAW,CAACsB,MAAM,CAACC,aAAR,EAAuB,QAAvB,EAAiC,KAAjC,CAAf;CAAA,SAAlC,EA7G2B;;CAgH3BvB,QAAAA,WAAW,CAACjD,QAAQ,CAACyE,aAAT,0BAAwCnB,IAAxC,SAAD,EAAoD,QAApD,EAA8D,IAA9D,CAAX,CAhH2B;;CAmH3Bc,QAAAA,KAAK,CAACC,IAAN,CAAWrE,QAAQ,CAACqC,gBAAT,CAA0B,aAA1B,CAAX,EAAqDiC,OAArD,CAA6D,UAAAI,IAAI,EAAI;CACjEA,UAAAA,IAAI,CAACC,YAAL,CAAkB,QAAlB,EAA4B,EAA5B;CACH,SAFD;CAGA3E,QAAAA,QAAQ,CAACyE,aAAT,wBAAuCnB,IAAvC,GAA+CsB,eAA/C,CAA+D,QAA/D;CACH,OA/Me;;;CAkNhBR,MAAAA,KAAK,CAACC,IAAN,CAAWjC,OAAX,EAAoBkC,OAApB,CAA4B,UAAAC,MAAM,EAAI;CAClCA,QAAAA,MAAM,CAACtE,gBAAP,CAAwB,OAAxB,EAAiC,YAAM;CACnC,cAAMqD,IAAI,GAAGiB,MAAM,CAACM,YAAP,CAAoB,aAApB,CAAb;CAEAxB,UAAAA,SAAS,CAACC,IAAD,CAAT;;CAEA,cAAIR,cAAJ,EAAoB;CAChBnD,YAAAA,MAAM,CAACoD,OAAP,CAAeC,SAAf,CAAyB;CAAEM,cAAAA,IAAI,EAAJA;CAAF,aAAzB,EAAmC,EAAnC,aAA2CA,IAA3C;CACH;CACJ,SARD;CASH,OAVD,EAlNgB;;CA+NhB3D,MAAAA,MAAM,CAACM,gBAAP,CAAwB,UAAxB,EAAoC,UAAAU,KAAK,EAAI;CACzC,YAAIA,KAAK,CAACyC,KAAN,IAAe,UAAUzC,KAAK,CAACyC,KAAnC,EAA0C;CACtCC,UAAAA,SAAS,CAAC1C,KAAK,CAACyC,KAAN,CAAYE,IAAb,CAAT;CACH;CACJ,OAJD,EA/NgB;;CAsOhB,UAAIR,cAAJ,EAAoB;CAChB,YAAMP,KAAK,GAAG,CAACI,WAAW,CAACa,MAA3B,CADgB;;CAIhB,YAAIjB,KAAJ,EAAW;CACPI,UAAAA,WAAW,GAAGL,KAAK,CAACC,KAApB;CACH,SANe;;;CAShB,YAAII,WAAW,IAAIL,KAAnB,EAA0B;CACtB3C,UAAAA,MAAM,CAACoD,OAAP,CAAe+B,YAAf,CACI;CACIxB,YAAAA,IAAI,EAAEX;CADV,WADJ,EAII,EAJJ,EAKIJ,KAAK,GAAG,EAAH,cAAYI,WAAZ,CALT;CAOH,SAjBe;;;CAoBhB,YAAIA,WAAW,KAAKL,KAAK,CAACC,KAA1B,EAAiC;CAC7Bc,UAAAA,SAAS,CAACV,WAAD,EAAc,IAAd,CAAT;CACH;CACJ;CACJ,KA9PD;CA+PH,GAhQD,EAPG;CA0QH;;CACA,MAAI9C,GAAG,CAACC,IAAR,EAAc;CACVN,IAAAA,SAAK,CAACuF,MAAN,CAAa,2DAAb,EAA0EC,OAA1E;CACH,GA7QE;CAgRH;;CACA;;;CACA,MAAInF,GAAG,CAACC,IAAR,EAAc;CACV,KAAC,UAACmF,CAAD,EAAIC,CAAJ,EAAOC,CAAP,EAAUC,CAAV,EAAaC,CAAb,EAAgBC,CAAhB,EAAmBC,CAAnB,EAAyB;CACtBN,MAAAA,CAAC,CAACO,qBAAF,GAA0BH,CAA1B;;CACAJ,MAAAA,CAAC,CAACI,CAAD,CAAD,GACIJ,CAAC,CAACI,CAAD,CAAD,IACA,YAAW;CACP,SAACJ,CAAC,CAACI,CAAD,CAAD,CAAKI,CAAL,GAASR,CAAC,CAACI,CAAD,CAAD,CAAKI,CAAL,IAAU,EAApB,EAAwBC,IAAxB,CAA6BC,SAA7B;CACH,OAJL;;CAKAV,MAAAA,CAAC,CAACI,CAAD,CAAD,CAAKO,CAAL,GAAS,IAAI,IAAIC,IAAJ,EAAb;CACAP,MAAAA,CAAC,GAAGJ,CAAC,CAACY,aAAF,CAAgBX,CAAhB,CAAJ;CACAI,MAAAA,CAAC,GAAGL,CAAC,CAACa,oBAAF,CAAuBZ,CAAvB,EAA0B,CAA1B,CAAJ;CACAG,MAAAA,CAAC,CAACU,KAAF,GAAU,CAAV;CACAV,MAAAA,CAAC,CAAC3B,GAAF,GAAQyB,CAAR;CACAG,MAAAA,CAAC,CAACU,UAAF,CAAaC,YAAb,CAA0BZ,CAA1B,EAA6BC,CAA7B;CACH,KAbD,EAaG5F,MAbH,EAaWK,QAbX,EAaqB,QAbrB,EAa+B,+CAb/B,EAagF,IAbhF;;CAcAL,IAAAA,MAAM,CAACwG,EAAP,CAAU,QAAV,EAAoB,gBAApB,EAAsC,MAAtC;CACAxG,IAAAA,MAAM,CAACwG,EAAP,CAAU,MAAV,EAAkB,UAAlB;CACH;CACD;;CACH,CArSD","file":"demo.js","sourcesContent":["/*\n json-stringify-safe\n Like JSON.stringify, but doesn't throw on circular references.\n\n Originally forked from https://github.com/isaacs/json-stringify-safe\n version 5.0.1 on 3/8/2017 and modified to handle Errors serialization\n and IE8 compatibility. Tests for this are in test/vendor.\n\n ISC license: https://github.com/isaacs/json-stringify-safe/blob/master/LICENSE\n*/\n\nexports = module.exports = stringify;\nexports.getSerialize = serializer;\n\nfunction indexOf(haystack, needle) {\n for (var i = 0; i < haystack.length; ++i) {\n if (haystack[i] === needle) return i;\n }\n return -1;\n}\n\nfunction stringify(obj, replacer, spaces, cycleReplacer) {\n return JSON.stringify(obj, serializer(replacer, cycleReplacer), spaces);\n}\n\n// https://github.com/ftlabs/js-abbreviate/blob/fa709e5f139e7770a71827b1893f22418097fbda/index.js#L95-L106\nfunction stringifyError(value) {\n var err = {\n // These properties are implemented as magical getters and don't show up in for in\n stack: value.stack,\n message: value.message,\n name: value.name\n };\n\n for (var i in value) {\n if (Object.prototype.hasOwnProperty.call(value, i)) {\n err[i] = value[i];\n }\n }\n\n return err;\n}\n\nfunction serializer(replacer, cycleReplacer) {\n var stack = [];\n var keys = [];\n\n if (cycleReplacer == null) {\n cycleReplacer = function(key, value) {\n if (stack[0] === value) {\n return '[Circular ~]';\n }\n return '[Circular ~.' + keys.slice(0, indexOf(stack, value)).join('.') + ']';\n };\n }\n\n return function(key, value) {\n if (stack.length > 0) {\n var thisPos = indexOf(stack, this);\n ~thisPos ? stack.splice(thisPos + 1) : stack.push(this);\n ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key);\n\n if (~indexOf(stack, value)) {\n value = cycleReplacer.call(this, key, value);\n }\n } else {\n stack.push(value);\n }\n\n return replacer == null\n ? value instanceof Error ? stringifyError(value) : value\n : replacer.call(this, key, value);\n };\n}\n","var stringify = require('../vendor/json-stringify-safe/stringify');\n\nvar _window =\n typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined'\n ? global\n : typeof self !== 'undefined'\n ? self\n : {};\n\nfunction isObject(what) {\n return typeof what === 'object' && what !== null;\n}\n\n// Yanked from https://git.io/vS8DV re-used under CC0\n// with some tiny modifications\nfunction isError(value) {\n switch (Object.prototype.toString.call(value)) {\n case '[object Error]':\n return true;\n case '[object Exception]':\n return true;\n case '[object DOMException]':\n return true;\n default:\n return value instanceof Error;\n }\n}\n\nfunction isErrorEvent(value) {\n return Object.prototype.toString.call(value) === '[object ErrorEvent]';\n}\n\nfunction isDOMError(value) {\n return Object.prototype.toString.call(value) === '[object DOMError]';\n}\n\nfunction isDOMException(value) {\n return Object.prototype.toString.call(value) === '[object DOMException]';\n}\n\nfunction isUndefined(what) {\n return what === void 0;\n}\n\nfunction isFunction(what) {\n return typeof what === 'function';\n}\n\nfunction isPlainObject(what) {\n return Object.prototype.toString.call(what) === '[object Object]';\n}\n\nfunction isString(what) {\n return Object.prototype.toString.call(what) === '[object String]';\n}\n\nfunction isArray(what) {\n return Object.prototype.toString.call(what) === '[object Array]';\n}\n\nfunction isEmptyObject(what) {\n if (!isPlainObject(what)) return false;\n\n for (var _ in what) {\n if (what.hasOwnProperty(_)) {\n return false;\n }\n }\n return true;\n}\n\nfunction supportsErrorEvent() {\n try {\n new ErrorEvent(''); // eslint-disable-line no-new\n return true;\n } catch (e) {\n return false;\n }\n}\n\nfunction supportsDOMError() {\n try {\n new DOMError(''); // eslint-disable-line no-new\n return true;\n } catch (e) {\n return false;\n }\n}\n\nfunction supportsDOMException() {\n try {\n new DOMException(''); // eslint-disable-line no-new\n return true;\n } catch (e) {\n return false;\n }\n}\n\nfunction supportsFetch() {\n if (!('fetch' in _window)) return false;\n\n try {\n new Headers(); // eslint-disable-line no-new\n new Request(''); // eslint-disable-line no-new\n new Response(); // eslint-disable-line no-new\n return true;\n } catch (e) {\n return false;\n }\n}\n\n// Despite all stars in the sky saying that Edge supports old draft syntax, aka 'never', 'always', 'origin' and 'default\n// https://caniuse.com/#feat=referrer-policy\n// It doesn't. And it throw exception instead of ignoring this parameter...\n// REF: https://github.com/getsentry/raven-js/issues/1233\nfunction supportsReferrerPolicy() {\n if (!supportsFetch()) return false;\n\n try {\n // eslint-disable-next-line no-new\n new Request('pickleRick', {\n referrerPolicy: 'origin'\n });\n return true;\n } catch (e) {\n return false;\n }\n}\n\nfunction supportsPromiseRejectionEvent() {\n return typeof PromiseRejectionEvent === 'function';\n}\n\nfunction wrappedCallback(callback) {\n function dataCallback(data, original) {\n var normalizedData = callback(data) || data;\n if (original) {\n return original(normalizedData) || normalizedData;\n }\n return normalizedData;\n }\n\n return dataCallback;\n}\n\nfunction each(obj, callback) {\n var i, j;\n\n if (isUndefined(obj.length)) {\n for (i in obj) {\n if (hasKey(obj, i)) {\n callback.call(null, i, obj[i]);\n }\n }\n } else {\n j = obj.length;\n if (j) {\n for (i = 0; i < j; i++) {\n callback.call(null, i, obj[i]);\n }\n }\n }\n}\n\nfunction objectMerge(obj1, obj2) {\n if (!obj2) {\n return obj1;\n }\n each(obj2, function(key, value) {\n obj1[key] = value;\n });\n return obj1;\n}\n\n/**\n * This function is only used for react-native.\n * react-native freezes object that have already been sent over the\n * js bridge. We need this function in order to check if the object is frozen.\n * So it's ok that objectFrozen returns false if Object.isFrozen is not\n * supported because it's not relevant for other \"platforms\". See related issue:\n * https://github.com/getsentry/react-native-sentry/issues/57\n */\nfunction objectFrozen(obj) {\n if (!Object.isFrozen) {\n return false;\n }\n return Object.isFrozen(obj);\n}\n\nfunction truncate(str, max) {\n if (typeof max !== 'number') {\n throw new Error('2nd argument to `truncate` function should be a number');\n }\n if (typeof str !== 'string' || max === 0) {\n return str;\n }\n return str.length <= max ? str : str.substr(0, max) + '\\u2026';\n}\n\n/**\n * hasKey, a better form of hasOwnProperty\n * Example: hasKey(MainHostObject, property) === true/false\n *\n * @param {Object} host object to check property\n * @param {string} key to check\n */\nfunction hasKey(object, key) {\n return Object.prototype.hasOwnProperty.call(object, key);\n}\n\nfunction joinRegExp(patterns) {\n // Combine an array of regular expressions and strings into one large regexp\n // Be mad.\n var sources = [],\n i = 0,\n len = patterns.length,\n pattern;\n\n for (; i < len; i++) {\n pattern = patterns[i];\n if (isString(pattern)) {\n // If it's a string, we need to escape it\n // Taken from: https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions\n sources.push(pattern.replace(/([.*+?^=!:${}()|\\[\\]\\/\\\\])/g, '\\\\$1'));\n } else if (pattern && pattern.source) {\n // If it's a regexp already, we want to extract the source\n sources.push(pattern.source);\n }\n // Intentionally skip other cases\n }\n return new RegExp(sources.join('|'), 'i');\n}\n\nfunction urlencode(o) {\n var pairs = [];\n each(o, function(key, value) {\n pairs.push(encodeURIComponent(key) + '=' + encodeURIComponent(value));\n });\n return pairs.join('&');\n}\n\n// borrowed from https://tools.ietf.org/html/rfc3986#appendix-B\n// intentionally using regex and not <a/> href parsing trick because React Native and other\n// environments where DOM might not be available\nfunction parseUrl(url) {\n if (typeof url !== 'string') return {};\n var match = url.match(/^(([^:\\/?#]+):)?(\\/\\/([^\\/?#]*))?([^?#]*)(\\?([^#]*))?(#(.*))?$/);\n\n // coerce to undefined values to empty string so we don't get 'undefined'\n var query = match[6] || '';\n var fragment = match[8] || '';\n return {\n protocol: match[2],\n host: match[4],\n path: match[5],\n relative: match[5] + query + fragment // everything minus origin\n };\n}\nfunction uuid4() {\n var crypto = _window.crypto || _window.msCrypto;\n\n if (!isUndefined(crypto) && crypto.getRandomValues) {\n // Use window.crypto API if available\n // eslint-disable-next-line no-undef\n var arr = new Uint16Array(8);\n crypto.getRandomValues(arr);\n\n // set 4 in byte 7\n arr[3] = (arr[3] & 0xfff) | 0x4000;\n // set 2 most significant bits of byte 9 to '10'\n arr[4] = (arr[4] & 0x3fff) | 0x8000;\n\n var pad = function(num) {\n var v = num.toString(16);\n while (v.length < 4) {\n v = '0' + v;\n }\n return v;\n };\n\n return (\n pad(arr[0]) +\n pad(arr[1]) +\n pad(arr[2]) +\n pad(arr[3]) +\n pad(arr[4]) +\n pad(arr[5]) +\n pad(arr[6]) +\n pad(arr[7])\n );\n } else {\n // http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#2117523\n return 'xxxxxxxxxxxx4xxxyxxxxxxxxxxxxxxx'.replace(/[xy]/g, function(c) {\n var r = (Math.random() * 16) | 0,\n v = c === 'x' ? r : (r & 0x3) | 0x8;\n return v.toString(16);\n });\n }\n}\n\n/**\n * Given a child DOM element, returns a query-selector statement describing that\n * and its ancestors\n * e.g. [HTMLElement] => body > div > input#foo.btn[name=baz]\n * @param elem\n * @returns {string}\n */\nfunction htmlTreeAsString(elem) {\n /* eslint no-extra-parens:0*/\n var MAX_TRAVERSE_HEIGHT = 5,\n MAX_OUTPUT_LEN = 80,\n out = [],\n height = 0,\n len = 0,\n separator = ' > ',\n sepLength = separator.length,\n nextStr;\n\n while (elem && height++ < MAX_TRAVERSE_HEIGHT) {\n nextStr = htmlElementAsString(elem);\n // bail out if\n // - nextStr is the 'html' element\n // - the length of the string that would be created exceeds MAX_OUTPUT_LEN\n // (ignore this limit if we are on the first iteration)\n if (\n nextStr === 'html' ||\n (height > 1 && len + out.length * sepLength + nextStr.length >= MAX_OUTPUT_LEN)\n ) {\n break;\n }\n\n out.push(nextStr);\n\n len += nextStr.length;\n elem = elem.parentNode;\n }\n\n return out.reverse().join(separator);\n}\n\n/**\n * Returns a simple, query-selector representation of a DOM element\n * e.g. [HTMLElement] => input#foo.btn[name=baz]\n * @param HTMLElement\n * @returns {string}\n */\nfunction htmlElementAsString(elem) {\n var out = [],\n className,\n classes,\n key,\n attr,\n i;\n\n if (!elem || !elem.tagName) {\n return '';\n }\n\n out.push(elem.tagName.toLowerCase());\n if (elem.id) {\n out.push('#' + elem.id);\n }\n\n className = elem.className;\n if (className && isString(className)) {\n classes = className.split(/\\s+/);\n for (i = 0; i < classes.length; i++) {\n out.push('.' + classes[i]);\n }\n }\n var attrWhitelist = ['type', 'name', 'title', 'alt'];\n for (i = 0; i < attrWhitelist.length; i++) {\n key = attrWhitelist[i];\n attr = elem.getAttribute(key);\n if (attr) {\n out.push('[' + key + '=\"' + attr + '\"]');\n }\n }\n return out.join('');\n}\n\n/**\n * Returns true if either a OR b is truthy, but not both\n */\nfunction isOnlyOneTruthy(a, b) {\n return !!(!!a ^ !!b);\n}\n\n/**\n * Returns true if both parameters are undefined\n */\nfunction isBothUndefined(a, b) {\n return isUndefined(a) && isUndefined(b);\n}\n\n/**\n * Returns true if the two input exception interfaces have the same content\n */\nfunction isSameException(ex1, ex2) {\n if (isOnlyOneTruthy(ex1, ex2)) return false;\n\n ex1 = ex1.values[0];\n ex2 = ex2.values[0];\n\n if (ex1.type !== ex2.type || ex1.value !== ex2.value) return false;\n\n // in case both stacktraces are undefined, we can't decide so default to false\n if (isBothUndefined(ex1.stacktrace, ex2.stacktrace)) return false;\n\n return isSameStacktrace(ex1.stacktrace, ex2.stacktrace);\n}\n\n/**\n * Returns true if the two input stack trace interfaces have the same content\n */\nfunction isSameStacktrace(stack1, stack2) {\n if (isOnlyOneTruthy(stack1, stack2)) return false;\n\n var frames1 = stack1.frames;\n var frames2 = stack2.frames;\n\n // Exit early if stacktrace is malformed\n if (frames1 === undefined || frames2 === undefined) return false;\n\n // Exit early if frame count differs\n if (frames1.length !== frames2.length) return false;\n\n // Iterate through every frame; bail out if anything differs\n var a, b;\n for (var i = 0; i < frames1.length; i++) {\n a = frames1[i];\n b = frames2[i];\n if (\n a.filename !== b.filename ||\n a.lineno !== b.lineno ||\n a.colno !== b.colno ||\n a['function'] !== b['function']\n )\n return false;\n }\n return true;\n}\n\n/**\n * Polyfill a method\n * @param obj object e.g. `document`\n * @param name method name present on object e.g. `addEventListener`\n * @param replacement replacement function\n * @param track {optional} record instrumentation to an array\n */\nfunction fill(obj, name, replacement, track) {\n if (obj == null) return;\n var orig = obj[name];\n obj[name] = replacement(orig);\n obj[name].__raven__ = true;\n obj[name].__orig__ = orig;\n if (track) {\n track.push([obj, name, orig]);\n }\n}\n\n/**\n * Join values in array\n * @param input array of values to be joined together\n * @param delimiter string to be placed in-between values\n * @returns {string}\n */\nfunction safeJoin(input, delimiter) {\n if (!isArray(input)) return '';\n\n var output = [];\n\n for (var i = 0; i < input.length; i++) {\n try {\n output.push(String(input[i]));\n } catch (e) {\n output.push('[value cannot be serialized]');\n }\n }\n\n return output.join(delimiter);\n}\n\n// Default Node.js REPL depth\nvar MAX_SERIALIZE_EXCEPTION_DEPTH = 3;\n// 50kB, as 100kB is max payload size, so half sounds reasonable\nvar MAX_SERIALIZE_EXCEPTION_SIZE = 50 * 1024;\nvar MAX_SERIALIZE_KEYS_LENGTH = 40;\n\nfunction utf8Length(value) {\n return ~-encodeURI(value).split(/%..|./).length;\n}\n\nfunction jsonSize(value) {\n return utf8Length(JSON.stringify(value));\n}\n\nfunction serializeValue(value) {\n if (typeof value === 'string') {\n var maxLength = 40;\n return truncate(value, maxLength);\n } else if (\n typeof value === 'number' ||\n typeof value === 'boolean' ||\n typeof value === 'undefined'\n ) {\n return value;\n }\n\n var type = Object.prototype.toString.call(value);\n\n // Node.js REPL notation\n if (type === '[object Object]') return '[Object]';\n if (type === '[object Array]') return '[Array]';\n if (type === '[object Function]')\n return value.name ? '[Function: ' + value.name + ']' : '[Function]';\n\n return value;\n}\n\nfunction serializeObject(value, depth) {\n if (depth === 0) return serializeValue(value);\n\n if (isPlainObject(value)) {\n return Object.keys(value).reduce(function(acc, key) {\n acc[key] = serializeObject(value[key], depth - 1);\n return acc;\n }, {});\n } else if (Array.isArray(value)) {\n return value.map(function(val) {\n return serializeObject(val, depth - 1);\n });\n }\n\n return serializeValue(value);\n}\n\nfunction serializeException(ex, depth, maxSize) {\n if (!isPlainObject(ex)) return ex;\n\n depth = typeof depth !== 'number' ? MAX_SERIALIZE_EXCEPTION_DEPTH : depth;\n maxSize = typeof depth !== 'number' ? MAX_SERIALIZE_EXCEPTION_SIZE : maxSize;\n\n var serialized = serializeObject(ex, depth);\n\n if (jsonSize(stringify(serialized)) > maxSize) {\n return serializeException(ex, depth - 1);\n }\n\n return serialized;\n}\n\nfunction serializeKeysForMessage(keys, maxLength) {\n if (typeof keys === 'number' || typeof keys === 'string') return keys.toString();\n if (!Array.isArray(keys)) return '';\n\n keys = keys.filter(function(key) {\n return typeof key === 'string';\n });\n if (keys.length === 0) return '[object has no keys]';\n\n maxLength = typeof maxLength !== 'number' ? MAX_SERIALIZE_KEYS_LENGTH : maxLength;\n if (keys[0].length >= maxLength) return keys[0];\n\n for (var usedKeys = keys.length; usedKeys > 0; usedKeys--) {\n var serialized = keys.slice(0, usedKeys).join(', ');\n if (serialized.length > maxLength) continue;\n if (usedKeys === keys.length) return serialized;\n return serialized + '\\u2026';\n }\n\n return '';\n}\n\nfunction sanitize(input, sanitizeKeys) {\n if (!isArray(sanitizeKeys) || (isArray(sanitizeKeys) && sanitizeKeys.length === 0))\n return input;\n\n var sanitizeRegExp = joinRegExp(sanitizeKeys);\n var sanitizeMask = '********';\n var safeInput;\n\n try {\n safeInput = JSON.parse(stringify(input));\n } catch (o_O) {\n return input;\n }\n\n function sanitizeWorker(workerInput) {\n if (isArray(workerInput)) {\n return workerInput.map(function(val) {\n return sanitizeWorker(val);\n });\n }\n\n if (isPlainObject(workerInput)) {\n return Object.keys(workerInput).reduce(function(acc, k) {\n if (sanitizeRegExp.test(k)) {\n acc[k] = sanitizeMask;\n } else {\n acc[k] = sanitizeWorker(workerInput[k]);\n }\n return acc;\n }, {});\n }\n\n return workerInput;\n }\n\n return sanitizeWorker(safeInput);\n}\n\nmodule.exports = {\n isObject: isObject,\n isError: isError,\n isErrorEvent: isErrorEvent,\n isDOMError: isDOMError,\n isDOMException: isDOMException,\n isUndefined: isUndefined,\n isFunction: isFunction,\n isPlainObject: isPlainObject,\n isString: isString,\n isArray: isArray,\n isEmptyObject: isEmptyObject,\n supportsErrorEvent: supportsErrorEvent,\n supportsDOMError: supportsDOMError,\n supportsDOMException: supportsDOMException,\n supportsFetch: supportsFetch,\n supportsReferrerPolicy: supportsReferrerPolicy,\n supportsPromiseRejectionEvent: supportsPromiseRejectionEvent,\n wrappedCallback: wrappedCallback,\n each: each,\n objectMerge: objectMerge,\n truncate: truncate,\n objectFrozen: objectFrozen,\n hasKey: hasKey,\n joinRegExp: joinRegExp,\n urlencode: urlencode,\n uuid4: uuid4,\n htmlTreeAsString: htmlTreeAsString,\n htmlElementAsString: htmlElementAsString,\n isSameException: isSameException,\n isSameStacktrace: isSameStacktrace,\n parseUrl: parseUrl,\n fill: fill,\n safeJoin: safeJoin,\n serializeException: serializeException,\n serializeKeysForMessage: serializeKeysForMessage,\n sanitize: sanitize\n};\n","var utils = require('../../src/utils');\n\n/*\n TraceKit - Cross brower stack traces\n\n This was originally forked from github.com/occ/TraceKit, but has since been\n largely re-written and is now maintained as part of raven-js. Tests for\n this are in test/vendor.\n\n MIT license\n*/\n\nvar TraceKit = {\n collectWindowErrors: true,\n debug: false\n};\n\n// This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785)\nvar _window =\n typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {};\n\n// global reference to slice\nvar _slice = [].slice;\nvar UNKNOWN_FUNCTION = '?';\n\n// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Error#Error_types\nvar ERROR_TYPES_RE = /^(?:[Uu]ncaught (?:exception: )?)?(?:((?:Eval|Internal|Range|Reference|Syntax|Type|URI|)Error): )?(.*)$/;\n\nfunction getLocationHref() {\n if (typeof document === 'undefined' || document.location == null) return '';\n return document.location.href;\n}\n\nfunction getLocationOrigin() {\n if (typeof document === 'undefined' || document.location == null) return '';\n\n // Oh dear IE10...\n if (!document.location.origin) {\n return (\n document.location.protocol +\n '//' +\n document.location.hostname +\n (document.location.port ? ':' + document.location.port : '')\n );\n }\n\n return document.location.origin;\n}\n\n/**\n * TraceKit.report: cross-browser processing of unhandled exceptions\n *\n * Syntax:\n * TraceKit.report.subscribe(function(stackInfo) { ... })\n * TraceKit.report.unsubscribe(function(stackInfo) { ... })\n * TraceKit.report(exception)\n * try { ...code... } catch(ex) { TraceKit.report(ex); }\n *\n * Supports:\n * - Firefox: full stack trace with line numbers, plus column number\n * on top frame; column number is not guaranteed\n * - Opera: full stack trace with line and column numbers\n * - Chrome: full stack trace with line and column numbers\n * - Safari: line and column number for the top frame only; some frames\n * may be missing, and column number is not guaranteed\n * - IE: line and column number for the top frame only; some frames\n * may be missing, and column number is not guaranteed\n *\n * In theory, TraceKit should work on all of the following versions:\n * - IE5.5+ (only 8.0 tested)\n * - Firefox 0.9+ (only 3.5+ tested)\n * - Opera 7+ (only 10.50 tested; versions 9 and earlier may require\n * Exceptions Have Stacktrace to be enabled in opera:config)\n * - Safari 3+ (only 4+ tested)\n * - Chrome 1+ (only 5+ tested)\n * - Konqueror 3.5+ (untested)\n *\n * Requires TraceKit.computeStackTrace.\n *\n * Tries to catch all unhandled exceptions and report them to the\n * subscribed handlers. Please note that TraceKit.report will rethrow the\n * exception. This is REQUIRED in order to get a useful stack trace in IE.\n * If the exception does not reach the top of the browser, you will only\n * get a stack trace from the point where TraceKit.report was called.\n *\n * Handlers receive a stackInfo object as described in the\n * TraceKit.computeStackTrace docs.\n */\nTraceKit.report = (function reportModuleWrapper() {\n var handlers = [],\n lastArgs = null,\n lastException = null,\n lastExceptionStack = null;\n\n /**\n * Add a crash handler.\n * @param {Function} handler\n */\n function subscribe(handler) {\n installGlobalHandler();\n handlers.push(handler);\n }\n\n /**\n * Remove a crash handler.\n * @param {Function} handler\n */\n function unsubscribe(handler) {\n for (var i = handlers.length - 1; i >= 0; --i) {\n if (handlers[i] === handler) {\n handlers.splice(i, 1);\n }\n }\n }\n\n /**\n * Remove all crash handlers.\n */\n function unsubscribeAll() {\n uninstallGlobalHandler();\n handlers = [];\n }\n\n /**\n * Dispatch stack information to all handlers.\n * @param {Object.<string, *>} stack\n */\n function notifyHandlers(stack, isWindowError) {\n var exception = null;\n if (isWindowError && !TraceKit.collectWindowErrors) {\n return;\n }\n for (var i in handlers) {\n if (handlers.hasOwnProperty(i)) {\n try {\n handlers[i].apply(null, [stack].concat(_slice.call(arguments, 2)));\n } catch (inner) {\n exception = inner;\n }\n }\n }\n\n if (exception) {\n throw exception;\n }\n }\n\n var _oldOnerrorHandler, _onErrorHandlerInstalled;\n\n /**\n * Ensures all global unhandled exceptions are recorded.\n * Supported by Gecko and IE.\n * @param {string} msg Error message.\n * @param {string} url URL of script that generated the exception.\n * @param {(number|string)} lineNo The line number at which the error\n * occurred.\n * @param {?(number|string)} colNo The column number at which the error\n * occurred.\n * @param {?Error} ex The actual Error object.\n */\n function traceKitWindowOnError(msg, url, lineNo, colNo, ex) {\n var stack = null;\n // If 'ex' is ErrorEvent, get real Error from inside\n var exception = utils.isErrorEvent(ex) ? ex.error : ex;\n // If 'msg' is ErrorEvent, get real message from inside\n var message = utils.isErrorEvent(msg) ? msg.message : msg;\n\n if (lastExceptionStack) {\n TraceKit.computeStackTrace.augmentStackTraceWithInitialElement(\n lastExceptionStack,\n url,\n lineNo,\n message\n );\n processLastException();\n } else if (exception && utils.isError(exception)) {\n // non-string `exception` arg; attempt to extract stack trace\n\n // New chrome and blink send along a real error object\n // Let's just report that like a normal error.\n // See: https://mikewest.org/2013/08/debugging-runtime-errors-with-window-onerror\n stack = TraceKit.computeStackTrace(exception);\n notifyHandlers(stack, true);\n } else {\n var location = {\n url: url,\n line: lineNo,\n column: colNo\n };\n\n var name = undefined;\n var groups;\n\n if ({}.toString.call(message) === '[object String]') {\n var groups = message.match(ERROR_TYPES_RE);\n if (groups) {\n name = groups[1];\n message = groups[2];\n }\n }\n\n location.func = UNKNOWN_FUNCTION;\n\n stack = {\n name: name,\n message: message,\n url: getLocationHref(),\n stack: [location]\n };\n notifyHandlers(stack, true);\n }\n\n if (_oldOnerrorHandler) {\n return _oldOnerrorHandler.apply(this, arguments);\n }\n\n return false;\n }\n\n function installGlobalHandler() {\n if (_onErrorHandlerInstalled) {\n return;\n }\n _oldOnerrorHandler = _window.onerror;\n _window.onerror = traceKitWindowOnError;\n _onErrorHandlerInstalled = true;\n }\n\n function uninstallGlobalHandler() {\n if (!_onErrorHandlerInstalled) {\n return;\n }\n _window.onerror = _oldOnerrorHandler;\n _onErrorHandlerInstalled = false;\n _oldOnerrorHandler = undefined;\n }\n\n function processLastException() {\n var _lastExceptionStack = lastExceptionStack,\n _lastArgs = lastArgs;\n lastArgs = null;\n lastExceptionStack = null;\n lastException = null;\n notifyHandlers.apply(null, [_lastExceptionStack, false].concat(_lastArgs));\n }\n\n /**\n * Reports an unhandled Error to TraceKit.\n * @param {Error} ex\n * @param {?boolean} rethrow If false, do not re-throw the exception.\n * Only used for window.onerror to not cause an infinite loop of\n * rethrowing.\n */\n function report(ex, rethrow) {\n var args = _slice.call(arguments, 1);\n if (lastExceptionStack) {\n if (lastException === ex) {\n return; // already caught by an inner catch block, ignore\n } else {\n processLastException();\n }\n }\n\n var stack = TraceKit.computeStackTrace(ex);\n lastExceptionStack = stack;\n lastException = ex;\n lastArgs = args;\n\n // If the stack trace is incomplete, wait for 2 seconds for\n // slow slow IE to see if onerror occurs or not before reporting\n // this exception; otherwise, we will end up with an incomplete\n // stack trace\n setTimeout(function() {\n if (lastException === ex) {\n processLastException();\n }\n }, stack.incomplete ? 2000 : 0);\n\n if (rethrow !== false) {\n throw ex; // re-throw to propagate to the top level (and cause window.onerror)\n }\n }\n\n report.subscribe = subscribe;\n report.unsubscribe = unsubscribe;\n report.uninstall = unsubscribeAll;\n return report;\n})();\n\n/**\n * TraceKit.computeStackTrace: cross-browser stack traces in JavaScript\n *\n * Syntax:\n * s = TraceKit.computeStackTrace(exception) // consider using TraceKit.report instead (see below)\n * Returns:\n * s.name - exception name\n * s.message - exception message\n * s.stack[i].url - JavaScript or HTML file URL\n * s.stack[i].func - function name, or empty for anonymous functions (if guessing did not work)\n * s.stack[i].args - arguments passed to the function, if known\n * s.stack[i].line - line number, if known\n * s.stack[i].column - column number, if known\n *\n * Supports:\n * - Firefox: full stack trace with line numbers and unreliable column\n * number on top frame\n * - Opera 10: full stack trace with line and column numbers\n * - Opera 9-: full stack trace with line numbers\n * - Chrome: full stack trace with line and column numbers\n * - Safari: line and column number for the topmost stacktrace element\n * only\n * - IE: no line numbers whatsoever\n *\n * Tries to guess names of anonymous functions by looking for assignments\n * in the source code. In IE and Safari, we have to guess source file names\n * by searching for function bodies inside all page scripts. This will not\n * work for scripts that are loaded cross-domain.\n * Here be dragons: some function names may be guessed incorrectly, and\n * duplicate functions may be mismatched.\n *\n * TraceKit.computeStackTrace should only be used for tracing purposes.\n * Logging of unhandled exceptions should be done with TraceKit.report,\n * which builds on top of TraceKit.computeStackTrace and provides better\n * IE support by utilizing the window.onerror event to retrieve information\n * about the top of the stack.\n *\n * Note: In IE and Safari, no stack trace is recorded on the Error object,\n * so computeStackTrace instead walks its *own* chain of callers.\n * This means that:\n * * in Safari, some methods may be missing from the stack trace;\n * * in IE, the topmost function in the stack trace will always be the\n * caller of computeStackTrace.\n *\n * This is okay for tracing (because you are likely to be calling\n * computeStackTrace from the function you want to be the topmost element\n * of the stack trace anyway), but not okay for logging unhandled\n * exceptions (because your catch block will likely be far away from the\n * inner function that actually caused the exception).\n *\n */\nTraceKit.computeStackTrace = (function computeStackTraceWrapper() {\n // Contents of Exception in various browsers.\n //\n // SAFARI:\n // ex.message = Can't find variable: qq\n // ex.line = 59\n // ex.sourceId = 580238192\n // ex.sourceURL = http://...\n // ex.expressionBeginOffset = 96\n // ex.expressionCaretOffset = 98\n // ex.expressionEndOffset = 98\n // ex.name = ReferenceError\n //\n // FIREFOX:\n // ex.message = qq is not defined\n // ex.fileName = http://...\n // ex.lineNumber = 59\n // ex.columnNumber = 69\n // ex.stack = ...stack trace... (see the example below)\n // ex.name = ReferenceError\n //\n // CHROME:\n // ex.message = qq is not defined\n // ex.name = ReferenceError\n // ex.type = not_defined\n // ex.arguments = ['aa']\n // ex.stack = ...stack trace...\n //\n // INTERNET EXPLORER:\n // ex.message = ...\n // ex.name = ReferenceError\n //\n // OPERA:\n // ex.message = ...message... (see the example below)\n // ex.name = ReferenceError\n // ex.opera#sourceloc = 11 (pretty much useless, duplicates the info in ex.message)\n // ex.stacktrace = n/a; see 'opera:config#UserPrefs|Exceptions Have Stacktrace'\n\n /**\n * Computes stack trace information from the stack property.\n * Chrome and Gecko use this property.\n * @param {Error} ex\n * @return {?Object.<string, *>} Stack trace information.\n */\n function computeStackTraceFromStackProp(ex) {\n if (typeof ex.stack === 'undefined' || !ex.stack) return;\n\n var chrome = /^\\s*at (?:(.*?) ?\\()?((?:file|https?|blob|chrome-extension|native|eval|webpack|<anonymous>|[a-z]:|\\/).*?)(?::(\\d+))?(?::(\\d+))?\\)?\\s*$/i;\n var winjs = /^\\s*at (?:((?:\\[object object\\])?.+) )?\\(?((?:file|ms-appx(?:-web)|https?|webpack|blob):.*?):(\\d+)(?::(\\d+))?\\)?\\s*$/i;\n // NOTE: blob urls are now supposed to always have an origin, therefore it's format\n // which is `blob:http://url/path/with-some-uuid`, is matched by `blob.*?:\\/` as well\n var gecko = /^\\s*(.*?)(?:\\((.*?)\\))?(?:^|@)((?:file|https?|blob|chrome|webpack|resource|moz-extension).*?:\\/.*?|\\[native code\\]|[^@]*bundle)(?::(\\d+))?(?::(\\d+))?\\s*$/i;\n // Used to additionally parse URL/line/column from eval frames\n var geckoEval = /(\\S+) line (\\d+)(?: > eval line \\d+)* > eval/i;\n var chromeEval = /\\((\\S*)(?::(\\d+))(?::(\\d+))\\)/;\n var lines = ex.stack.split('\\n');\n var stack = [];\n var submatch;\n var parts;\n var element;\n var reference = /^(.*) is undefined$/.exec(ex.message);\n\n for (var i = 0, j = lines.length; i < j; ++i) {\n if ((parts = chrome.exec(lines[i]))) {\n var isNative = parts[2] && parts[2].indexOf('native') === 0; // start of line\n var isEval = parts[2] && parts[2].indexOf('eval') === 0; // start of line\n if (isEval && (submatch = chromeEval.exec(parts[2]))) {\n // throw out eval line/column and use top-most line/column number\n parts[2] = submatch[1]; // url\n parts[3] = submatch[2]; // line\n parts[4] = submatch[3]; // column\n }\n element = {\n url: !isNative ? parts[2] : null,\n func: parts[1] || UNKNOWN_FUNCTION,\n args: isNative ? [parts[2]] : [],\n line: parts[3] ? +parts[3] : null,\n column: parts[4] ? +parts[4] : null\n };\n } else if ((parts = winjs.exec(lines[i]))) {\n element = {\n url: parts[2],\n func: parts[1] || UNKNOWN_FUNCTION,\n args: [],\n line: +parts[3],\n column: parts[4] ? +parts[4] : null\n };\n } else if ((parts = gecko.exec(lines[i]))) {\n var isEval = parts[3] && parts[3].indexOf(' > eval') > -1;\n if (isEval && (submatch = geckoEval.exec(parts[3]))) {\n // throw out eval line/column and use top-most line number\n parts[3] = submatch[1];\n parts[4] = submatch[2];\n parts[5] = null; // no column when eval\n } else if (i === 0 && !parts[5] && typeof ex.columnNumber !== 'undefined') {\n // FireFox uses this awesome columnNumber property for its top frame\n // Also note, Firefox's column number is 0-based and everything else expects 1-based,\n // so adding 1\n // NOTE: this hack doesn't work if top-most frame is eval\n stack[0].column = ex.columnNumber + 1;\n }\n element = {\n url: parts[3],\n func: parts[1] || UNKNOWN_FUNCTION,\n args: parts[2] ? parts[2].split(',') : [],\n line: parts[4] ? +parts[4] : null,\n column: parts[5] ? +parts[5] : null\n };\n } else {\n continue;\n }\n\n if (!element.func && element.line) {\n element.func = UNKNOWN_FUNCTION;\n }\n\n if (element.url && element.url.substr(0, 5) === 'blob:') {\n // Special case for handling JavaScript loaded into a blob.\n // We use a synchronous AJAX request here as a blob is already in\n // memory - it's not making a network request. This will generate a warning\n // in the browser console, but there has already been an error so that's not\n // that much of an issue.\n var xhr = new XMLHttpRequest();\n xhr.open('GET', element.url, false);\n xhr.send(null);\n\n // If we failed to download the source, skip this patch\n if (xhr.status === 200) {\n var source = xhr.responseText || '';\n\n // We trim the source down to the last 300 characters as sourceMappingURL is always at the end of the file.\n // Why 300? To be in line with: https://github.com/getsentry/sentry/blob/4af29e8f2350e20c28a6933354e4f42437b4ba42/src/sentry/lang/javascript/processor.py#L164-L175\n source = source.slice(-300);\n\n // Now we dig out the source map URL\n var sourceMaps = source.match(/\\/\\/# sourceMappingURL=(.*)$/);\n\n // If we don't find a source map comment or we find more than one, continue on to the next element.\n if (sourceMaps) {\n var sourceMapAddress = sourceMaps[1];\n\n // Now we check to see if it's a relative URL.\n // If it is, convert it to an absolute one.\n if (sourceMapAddress.charAt(0) === '~') {\n sourceMapAddress = getLocationOrigin() + sourceMapAddress.slice(1);\n }\n\n // Now we strip the '.map' off of the end of the URL and update the\n // element so that Sentry can match the map to the blob.\n element.url = sourceMapAddress.slice(0, -4);\n }\n }\n }\n\n stack.push(element);\n }\n\n if (!stack.length) {\n return null;\n }\n\n return {\n name: ex.name,\n message: ex.message,\n url: getLocationHref(),\n stack: stack\n };\n }\n\n /**\n * Adds information about the first frame to incomplete stack traces.\n * Safari and IE require this to get complete data on the first frame.\n * @param {Object.<string, *>} stackInfo Stack trace information from\n * one of the compute* methods.\n * @param {string} url The URL of the script that caused an error.\n * @param {(number|string)} lineNo The line number of the script that\n * caused an error.\n * @param {string=} message The error generated by the browser, which\n * hopefully contains the name of the object that caused the error.\n * @return {boolean} Whether or not the stack information was\n * augmented.\n */\n function augmentStackTraceWithInitialElement(stackInfo, url, lineNo, message) {\n var initial = {\n url: url,\n line: lineNo\n };\n\n if (initial.url && initial.line) {\n stackInfo.incomplete = false;\n\n if (!initial.func) {\n initial.func = UNKNOWN_FUNCTION;\n }\n\n if (stackInfo.stack.length > 0) {\n if (stackInfo.stack[0].url === initial.url) {\n if (stackInfo.stack[0].line === initial.line) {\n return false; // already in stack trace\n } else if (\n !stackInfo.stack[0].line &&\n stackInfo.stack[0].func === initial.func\n ) {\n stackInfo.stack[0].line = initial.line;\n return false;\n }\n }\n }\n\n stackInfo.stack.unshift(initial);\n stackInfo.partial = true;\n return true;\n } else {\n stackInfo.incomplete = true;\n }\n\n return false;\n }\n\n /**\n * Computes stack trace information by walking the arguments.caller\n * chain at the time the exception occurred. This will cause earlier\n * frames to be missed but is the only way to get any stack trace in\n * Safari and IE. The top frame is restored by\n * {@link augmentStackTraceWithInitialElement}.\n * @param {Error} ex\n * @return {?Object.<string, *>} Stack trace information.\n */\n function computeStackTraceByWalkingCallerChain(ex, depth) {\n var functionName = /function\\s+([_$a-zA-Z\\xA0-\\uFFFF][_$a-zA-Z0-9\\xA0-\\uFFFF]*)?\\s*\\(/i,\n stack = [],\n funcs = {},\n recursion = false,\n parts,\n item,\n source;\n\n for (\n var curr = computeStackTraceByWalkingCallerChain.caller;\n curr && !recursion;\n curr = curr.caller\n ) {\n if (curr === computeStackTrace || curr === TraceKit.report) {\n // console.log('skipping internal function');\n continue;\n }\n\n item = {\n url: null,\n func: UNKNOWN_FUNCTION,\n line: null,\n column: null\n };\n\n if (curr.name) {\n item.func = curr.name;\n } else if ((parts = functionName.exec(curr.toString()))) {\n item.func = parts[1];\n }\n\n if (typeof item.func === 'undefined') {\n try {\n item.func = parts.input.substring(0, parts.input.indexOf('{'));\n } catch (e) {}\n }\n\n if (funcs['' + curr]) {\n recursion = true;\n } else {\n funcs['' + curr] = true;\n }\n\n stack.push(item);\n }\n\n if (depth) {\n // console.log('depth is ' + depth);\n // console.log('stack is ' + stack.length);\n stack.splice(0, depth);\n }\n\n var result = {\n name: ex.name,\n message: ex.message,\n url: getLocationHref(),\n stack: stack\n };\n augmentStackTraceWithInitialElement(\n result,\n ex.sourceURL || ex.fileName,\n ex.line || ex.lineNumber,\n ex.message || ex.description\n );\n return result;\n }\n\n /**\n * Computes a stack trace for an exception.\n * @param {Error} ex\n * @param {(string|number)=} depth\n */\n function computeStackTrace(ex, depth) {\n var stack = null;\n depth = depth == null ? 0 : +depth;\n\n try {\n stack = computeStackTraceFromStackProp(ex);\n if (stack) {\n return stack;\n }\n } catch (e) {\n if (TraceKit.debug) {\n throw e;\n }\n }\n\n try {\n stack = computeStackTraceByWalkingCallerChain(ex, depth + 1);\n if (stack) {\n return stack;\n }\n } catch (e) {\n if (TraceKit.debug) {\n throw e;\n }\n }\n return {\n name: ex.name,\n message: ex.message,\n url: getLocationHref()\n };\n }\n\n computeStackTrace.augmentStackTraceWithInitialElement = augmentStackTraceWithInitialElement;\n computeStackTrace.computeStackTraceFromStackProp = computeStackTraceFromStackProp;\n\n return computeStackTrace;\n})();\n\nmodule.exports = TraceKit;\n","/*\n * JavaScript MD5\n * https://github.com/blueimp/JavaScript-MD5\n *\n * Copyright 2011, Sebastian Tschan\n * https://blueimp.net\n *\n * Licensed under the MIT license:\n * https://opensource.org/licenses/MIT\n *\n * Based on\n * A JavaScript implementation of the RSA Data Security, Inc. MD5 Message\n * Digest Algorithm, as defined in RFC 1321.\n * Version 2.2 Copyright (C) Paul Johnston 1999 - 2009\n * Other contributors: Greg Holt, Andrew Kepert, Ydnar, Lostinet\n * Distributed under the BSD License\n * See http://pajhome.org.uk/crypt/md5 for more info.\n */\n\n/*\n* Add integers, wrapping at 2^32. This uses 16-bit operations internally\n* to work around bugs in some JS interpreters.\n*/\nfunction safeAdd(x, y) {\n var lsw = (x & 0xffff) + (y & 0xffff);\n var msw = (x >> 16) + (y >> 16) + (lsw >> 16);\n return (msw << 16) | (lsw & 0xffff);\n}\n\n/*\n* Bitwise rotate a 32-bit number to the left.\n*/\nfunction bitRotateLeft(num, cnt) {\n return (num << cnt) | (num >>> (32 - cnt));\n}\n\n/*\n* These functions implement the four basic operations the algorithm uses.\n*/\nfunction md5cmn(q, a, b, x, s, t) {\n return safeAdd(bitRotateLeft(safeAdd(safeAdd(a, q), safeAdd(x, t)), s), b);\n}\nfunction md5ff(a, b, c, d, x, s, t) {\n return md5cmn((b & c) | (~b & d), a, b, x, s, t);\n}\nfunction md5gg(a, b, c, d, x, s, t) {\n return md5cmn((b & d) | (c & ~d), a, b, x, s, t);\n}\nfunction md5hh(a, b, c, d, x, s, t) {\n return md5cmn(b ^ c ^ d, a, b, x, s, t);\n}\nfunction md5ii(a, b, c, d, x, s, t) {\n return md5cmn(c ^ (b | ~d), a, b, x, s, t);\n}\n\n/*\n* Calculate the MD5 of an array of little-endian words, and a bit length.\n*/\nfunction binlMD5(x, len) {\n /* append padding */\n x[len >> 5] |= 0x80 << (len % 32);\n x[(((len + 64) >>> 9) << 4) + 14] = len;\n\n var i;\n var olda;\n var oldb;\n var oldc;\n var oldd;\n var a = 1732584193;\n var b = -271733879;\n var c = -1732584194;\n var d = 271733878;\n\n for (i = 0; i < x.length; i += 16) {\n olda = a;\n oldb = b;\n oldc = c;\n oldd = d;\n\n a = md5ff(a, b, c, d, x[i], 7, -680876936);\n d = md5ff(d, a, b, c, x[i + 1], 12, -389564586);\n c = md5ff(c, d, a, b, x[i + 2], 17, 606105819);\n b = md5ff(b, c, d, a, x[i + 3], 22, -1044525330);\n a = md5ff(a, b, c, d, x[i + 4], 7, -176418897);\n d = md5ff(d, a, b, c, x[i + 5], 12, 1200080426);\n c = md5ff(c, d, a, b, x[i + 6], 17, -1473231341);\n b = md5ff(b, c, d, a, x[i + 7], 22, -45705983);\n a = md5ff(a, b, c, d, x[i + 8], 7, 1770035416);\n d = md5ff(d, a, b, c, x[i + 9], 12, -1958414417);\n c = md5ff(c, d, a, b, x[i + 10], 17, -42063);\n b = md5ff(b, c, d, a, x[i + 11], 22, -1990404162);\n a = md5ff(a, b, c, d, x[i + 12], 7, 1804603682);\n d = md5ff(d, a, b, c, x[i + 13], 12, -40341101);\n c = md5ff(c, d, a, b, x[i + 14], 17, -1502002290);\n b = md5ff(b, c, d, a, x[i + 15], 22, 1236535329);\n\n a = md5gg(a, b, c, d, x[i + 1], 5, -165796510);\n d = md5gg(d, a, b, c, x[i + 6], 9, -1069501632);\n c = md5gg(c, d, a, b, x[i + 11], 14, 643717713);\n b = md5gg(b, c, d, a, x[i], 20, -373897302);\n a = md5gg(a, b, c, d, x[i + 5], 5, -701558691);\n d = md5gg(d, a, b, c, x[i + 10], 9, 38016083);\n c = md5gg(c, d, a, b, x[i + 15], 14, -660478335);\n b = md5gg(b, c, d, a, x[i + 4], 20, -405537848);\n a = md5gg(a, b, c, d, x[i + 9], 5, 568446438);\n d = md5gg(d, a, b, c, x[i + 14], 9, -1019803690);\n c = md5gg(c, d, a, b, x[i + 3], 14, -187363961);\n b = md5gg(b, c, d, a, x[i + 8], 20, 1163531501);\n a = md5gg(a, b, c, d, x[i + 13], 5, -1444681467);\n d = md5gg(d, a, b, c, x[i + 2], 9, -51403784);\n c = md5gg(c, d, a, b, x[i + 7], 14, 1735328473);\n b = md5gg(b, c, d, a, x[i + 12], 20, -1926607734);\n\n a = md5hh(a, b, c, d, x[i + 5], 4, -378558);\n d = md5hh(d, a, b, c, x[i + 8], 11, -2022574463);\n c = md5hh(c, d, a, b, x[i + 11], 16, 1839030562);\n b = md5hh(b, c, d, a, x[i + 14], 23, -35309556);\n a = md5hh(a, b, c, d, x[i + 1], 4, -1530992060);\n d = md5hh(d, a, b, c, x[i + 4], 11, 1272893353);\n c = md5hh(c, d, a, b, x[i + 7], 16, -155497632);\n b = md5hh(b, c, d, a, x[i + 10], 23, -1094730640);\n a = md5hh(a, b, c, d, x[i + 13], 4, 681279174);\n d = md5hh(d, a, b, c, x[i], 11, -358537222);\n c = md5hh(c, d, a, b, x[i + 3], 16, -722521979);\n b = md5hh(b, c, d, a, x[i + 6], 23, 76029189);\n a = md5hh(a, b, c, d, x[i + 9], 4, -640364487);\n d = md5hh(d, a, b, c, x[i + 12], 11, -421815835);\n c = md5hh(c, d, a, b, x[i + 15], 16, 530742520);\n b = md5hh(b, c, d, a, x[i + 2], 23, -995338651);\n\n a = md5ii(a, b, c, d, x[i], 6, -198630844);\n d = md5ii(d, a, b, c, x[i + 7], 10, 1126891415);\n c = md5ii(c, d, a, b, x[i + 14], 15, -1416354905);\n b = md5ii(b, c, d, a, x[i + 5], 21, -57434055);\n a = md5ii(a, b, c, d, x[i + 12], 6, 1700485571);\n d = md5ii(d, a, b, c, x[i + 3], 10, -1894986606);\n c = md5ii(c, d, a, b, x[i + 10], 15, -1051523);\n b = md5ii(b, c, d, a, x[i + 1], 21, -2054922799);\n a = md5ii(a, b, c, d, x[i + 8], 6, 1873313359);\n d = md5ii(d, a, b, c, x[i + 15], 10, -30611744);\n c = md5ii(c, d, a, b, x[i + 6], 15, -1560198380);\n b = md5ii(b, c, d, a, x[i + 13], 21, 1309151649);\n a = md5ii(a, b, c, d, x[i + 4], 6, -145523070);\n d = md5ii(d, a, b, c, x[i + 11], 10, -1120210379);\n c = md5ii(c, d, a, b, x[i + 2], 15, 718787259);\n b = md5ii(b, c, d, a, x[i + 9], 21, -343485551);\n\n a = safeAdd(a, olda);\n b = safeAdd(b, oldb);\n c = safeAdd(c, oldc);\n d = safeAdd(d, oldd);\n }\n return [a, b, c, d];\n}\n\n/*\n* Convert an array of little-endian words to a string\n*/\nfunction binl2rstr(input) {\n var i;\n var output = '';\n var length32 = input.length * 32;\n for (i = 0; i < length32; i += 8) {\n output += String.fromCharCode((input[i >> 5] >>> (i % 32)) & 0xff);\n }\n return output;\n}\n\n/*\n* Convert a raw string to an array of little-endian words\n* Characters >255 have their high-byte silently ignored.\n*/\nfunction rstr2binl(input) {\n var i;\n var output = [];\n output[(input.length >> 2) - 1] = undefined;\n for (i = 0; i < output.length; i += 1) {\n output[i] = 0;\n }\n var length8 = input.length * 8;\n for (i = 0; i < length8; i += 8) {\n output[i >> 5] |= (input.charCodeAt(i / 8) & 0xff) << (i % 32);\n }\n return output;\n}\n\n/*\n* Calculate the MD5 of a raw string\n*/\nfunction rstrMD5(s) {\n return binl2rstr(binlMD5(rstr2binl(s), s.length * 8));\n}\n\n/*\n* Calculate the HMAC-MD5, of a key and some data (raw strings)\n*/\nfunction rstrHMACMD5(key, data) {\n var i;\n var bkey = rstr2binl(key);\n var ipad = [];\n var opad = [];\n var hash;\n ipad[15] = opad[15] = undefined;\n if (bkey.length > 16) {\n bkey = binlMD5(bkey, key.length * 8);\n }\n for (i = 0; i < 16; i += 1) {\n ipad[i] = bkey[i] ^ 0x36363636;\n opad[i] = bkey[i] ^ 0x5c5c5c5c;\n }\n hash = binlMD5(ipad.concat(rstr2binl(data)), 512 + data.length * 8);\n return binl2rstr(binlMD5(opad.concat(hash), 512 + 128));\n}\n\n/*\n* Convert a raw string to a hex string\n*/\nfunction rstr2hex(input) {\n var hexTab = '0123456789abcdef';\n var output = '';\n var x;\n var i;\n for (i = 0; i < input.length; i += 1) {\n x = input.charCodeAt(i);\n output += hexTab.charAt((x >>> 4) & 0x0f) + hexTab.charAt(x & 0x0f);\n }\n return output;\n}\n\n/*\n* Encode a string as utf-8\n*/\nfunction str2rstrUTF8(input) {\n return unescape(encodeURIComponent(input));\n}\n\n/*\n* Take string arguments and return either raw or hex encoded strings\n*/\nfunction rawMD5(s) {\n return rstrMD5(str2rstrUTF8(s));\n}\nfunction hexMD5(s) {\n return rstr2hex(rawMD5(s));\n}\nfunction rawHMACMD5(k, d) {\n return rstrHMACMD5(str2rstrUTF8(k), str2rstrUTF8(d));\n}\nfunction hexHMACMD5(k, d) {\n return rstr2hex(rawHMACMD5(k, d));\n}\n\nfunction md5(string, key, raw) {\n if (!key) {\n if (!raw) {\n return hexMD5(string);\n }\n return rawMD5(string);\n }\n if (!raw) {\n return hexHMACMD5(key, string);\n }\n return rawHMACMD5(key, string);\n}\n\nmodule.exports = md5;\n","function RavenConfigError(message) {\n this.name = 'RavenConfigError';\n this.message = message;\n}\nRavenConfigError.prototype = new Error();\nRavenConfigError.prototype.constructor = RavenConfigError;\n\nmodule.exports = RavenConfigError;\n","var utils = require('./utils');\n\nvar wrapMethod = function(console, level, callback) {\n var originalConsoleLevel = console[level];\n var originalConsole = console;\n\n if (!(level in console)) {\n return;\n }\n\n var sentryLevel = level === 'warn' ? 'warning' : level;\n\n console[level] = function() {\n var args = [].slice.call(arguments);\n\n var msg = utils.safeJoin(args, ' ');\n var data = {level: sentryLevel, logger: 'console', extra: {arguments: args}};\n\n if (level === 'assert') {\n if (args[0] === false) {\n // Default browsers message\n msg =\n 'Assertion failed: ' + (utils.safeJoin(args.slice(1), ' ') || 'console.assert');\n data.extra.arguments = args.slice(1);\n callback && callback(msg, data);\n }\n } else {\n callback && callback(msg, data);\n }\n\n // this fails for some browsers. :(\n if (originalConsoleLevel) {\n // IE9 doesn't allow calling apply on console functions directly\n // See: https://stackoverflow.com/questions/5472938/does-ie9-support-console-log-and-is-it-a-real-function#answer-5473193\n Function.prototype.apply.call(originalConsoleLevel, originalConsole, args);\n }\n };\n};\n\nmodule.exports = {\n wrapMethod: wrapMethod\n};\n","/*global XDomainRequest:false */\n\nvar TraceKit = require('../vendor/TraceKit/tracekit');\nvar stringify = require('../vendor/json-stringify-safe/stringify');\nvar md5 = require('../vendor/md5/md5');\nvar RavenConfigError = require('./configError');\n\nvar utils = require('./utils');\nvar isErrorEvent = utils.isErrorEvent;\nvar isDOMError = utils.isDOMError;\nvar isDOMException = utils.isDOMException;\nvar isError = utils.isError;\nvar isObject = utils.isObject;\nvar isPlainObject = utils.isPlainObject;\nvar isUndefined = utils.isUndefined;\nvar isFunction = utils.isFunction;\nvar isString = utils.isString;\nvar isArray = utils.isArray;\nvar isEmptyObject = utils.isEmptyObject;\nvar each = utils.each;\nvar objectMerge = utils.objectMerge;\nvar truncate = utils.truncate;\nvar objectFrozen = utils.objectFrozen;\nvar hasKey = utils.hasKey;\nvar joinRegExp = utils.joinRegExp;\nvar urlencode = utils.urlencode;\nvar uuid4 = utils.uuid4;\nvar htmlTreeAsString = utils.htmlTreeAsString;\nvar isSameException = utils.isSameException;\nvar isSameStacktrace = utils.isSameStacktrace;\nvar parseUrl = utils.parseUrl;\nvar fill = utils.fill;\nvar supportsFetch = utils.supportsFetch;\nvar supportsReferrerPolicy = utils.supportsReferrerPolicy;\nvar serializeKeysForMessage = utils.serializeKeysForMessage;\nvar serializeException = utils.serializeException;\nvar sanitize = utils.sanitize;\n\nvar wrapConsoleMethod = require('./console').wrapMethod;\n\nvar dsnKeys = 'source protocol user pass host port path'.split(' '),\n dsnPattern = /^(?:(\\w+):)?\\/\\/(?:(\\w+)(:\\w+)?@)?([\\w\\.-]+)(?::(\\d+))?(\\/.*)/;\n\nfunction now() {\n return +new Date();\n}\n\n// This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785)\nvar _window =\n typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {};\nvar _document = _window.document;\nvar _navigator = _window.navigator;\n\nfunction keepOriginalCallback(original, callback) {\n return isFunction(callback)\n ? function(data) {\n return callback(data, original);\n }\n : callback;\n}\n\n// First, check for JSON support\n// If there is no JSON, we no-op the core features of Raven\n// since JSON is required to encode the payload\nfunction Raven() {\n this._hasJSON = !!(typeof JSON === 'object' && JSON.stringify);\n // Raven can run in contexts where there's no document (react-native)\n this._hasDocument = !isUndefined(_document);\n this._hasNavigator = !isUndefined(_navigator);\n this._lastCapturedException = null;\n this._lastData = null;\n this._lastEventId = null;\n this._globalServer = null;\n this._globalKey = null;\n this._globalProject = null;\n this._globalContext = {};\n this._globalOptions = {\n // SENTRY_RELEASE can be injected by https://github.com/getsentry/sentry-webpack-plugin\n release: _window.SENTRY_RELEASE && _window.SENTRY_RELEASE.id,\n logger: 'javascript',\n ignoreErrors: [],\n ignoreUrls: [],\n whitelistUrls: [],\n includePaths: [],\n headers: null,\n collectWindowErrors: true,\n captureUnhandledRejections: true,\n maxMessageLength: 0,\n // By default, truncates URL values to 250 chars\n maxUrlLength: 250,\n stackTraceLimit: 50,\n autoBreadcrumbs: true,\n instrument: true,\n sampleRate: 1,\n sanitizeKeys: []\n };\n this._fetchDefaults = {\n method: 'POST',\n // Despite all stars in the sky saying that Edge supports old draft syntax, aka 'never', 'always', 'origin' and 'default\n // https://caniuse.com/#feat=referrer-policy\n // It doesn't. And it throw exception instead of ignoring this parameter...\n // REF: https://github.com/getsentry/raven-js/issues/1233\n referrerPolicy: supportsReferrerPolicy() ? 'origin' : ''\n };\n this._ignoreOnError = 0;\n this._isRavenInstalled = false;\n this._originalErrorStackTraceLimit = Error.stackTraceLimit;\n // capture references to window.console *and* all its methods first\n // before the console plugin has a chance to monkey patch\n this._originalConsole = _window.console || {};\n this._originalConsoleMethods = {};\n this._plugins = [];\n this._startTime = now();\n this._wrappedBuiltIns = [];\n this._breadcrumbs = [];\n this._lastCapturedEvent = null;\n this._keypressTimeout;\n this._location = _window.location;\n this._lastHref = this._location && this._location.href;\n this._resetBackoff();\n\n // eslint-disable-next-line guard-for-in\n for (var method in this._originalConsole) {\n this._originalConsoleMethods[method] = this._originalConsole[method];\n }\n}\n\n/*\n * The core Raven singleton\n *\n * @this {Raven}\n */\n\nRaven.prototype = {\n // Hardcode version string so that raven source can be loaded directly via\n // webpack (using a build step causes webpack #1617). Grunt verifies that\n // this value matches package.json during build.\n // See: https://github.com/getsentry/raven-js/issues/465\n VERSION: '3.27.0',\n\n debug: false,\n\n TraceKit: TraceKit, // alias to TraceKit\n\n /*\n * Configure Raven with a DSN and extra options\n *\n * @param {string} dsn The public Sentry DSN\n * @param {object} options Set of global options [optional]\n * @return {Raven}\n */\n config: function(dsn, options) {\n var self = this;\n\n if (self._globalServer) {\n this._logDebug('error', 'Error: Raven has already been configured');\n return self;\n }\n if (!dsn) return self;\n\n var globalOptions = self._globalOptions;\n\n // merge in options\n if (options) {\n each(options, function(key, value) {\n // tags and extra are special and need to be put into context\n if (key === 'tags' || key === 'extra' || key === 'user') {\n self._globalContext[key] = value;\n } else {\n globalOptions[key] = value;\n }\n });\n }\n\n self.setDSN(dsn);\n\n // \"Script error.\" is hard coded into browsers for errors that it can't read.\n // this is the result of a script being pulled in from an external domain and CORS.\n globalOptions.ignoreErrors.push(/^Script error\\.?$/);\n globalOptions.ignoreErrors.push(/^Javascript error: Script error\\.? on line 0$/);\n\n // join regexp rules into one big rule\n globalOptions.ignoreErrors = joinRegExp(globalOptions.ignoreErrors);\n globalOptions.ignoreUrls = globalOptions.ignoreUrls.length\n ? joinRegExp(globalOptions.ignoreUrls)\n : false;\n globalOptions.whitelistUrls = globalOptions.whitelistUrls.length\n ? joinRegExp(globalOptions.whitelistUrls)\n : false;\n globalOptions.includePaths = joinRegExp(globalOptions.includePaths);\n globalOptions.maxBreadcrumbs = Math.max(\n 0,\n Math.min(globalOptions.maxBreadcrumbs || 100, 100)\n ); // default and hard limit is 100\n\n var autoBreadcrumbDefaults = {\n xhr: true,\n console: true,\n dom: true,\n location: true,\n sentry: true\n };\n\n var autoBreadcrumbs = globalOptions.autoBreadcrumbs;\n if ({}.toString.call(autoBreadcrumbs) === '[object Object]') {\n autoBreadcrumbs = objectMerge(autoBreadcrumbDefaults, autoBreadcrumbs);\n } else if (autoBreadcrumbs !== false) {\n autoBreadcrumbs = autoBreadcrumbDefaults;\n }\n globalOptions.autoBreadcrumbs = autoBreadcrumbs;\n\n var instrumentDefaults = {\n tryCatch: true\n };\n\n var instrument = globalOptions.instrument;\n if ({}.toString.call(instrument) === '[object Object]') {\n instrument = objectMerge(instrumentDefaults, instrument);\n } else if (instrument !== false) {\n instrument = instrumentDefaults;\n }\n globalOptions.instrument = instrument;\n\n TraceKit.collectWindowErrors = !!globalOptions.collectWindowErrors;\n\n // return for chaining\n return self;\n },\n\n /*\n * Installs a global window.onerror error handler\n * to capture and report uncaught exceptions.\n * At this point, install() is required to be called due\n * to the way TraceKit is set up.\n *\n * @return {Raven}\n */\n install: function() {\n var self = this;\n if (self.isSetup() && !self._isRavenInstalled) {\n TraceKit.report.subscribe(function() {\n self._handleOnErrorStackInfo.apply(self, arguments);\n });\n\n if (self._globalOptions.captureUnhandledRejections) {\n self._attachPromiseRejectionHandler();\n }\n\n self._patchFunctionToString();\n\n if (self._globalOptions.instrument && self._globalOptions.instrument.tryCatch) {\n self._instrumentTryCatch();\n }\n\n if (self._globalOptions.autoBreadcrumbs) self._instrumentBreadcrumbs();\n\n // Install all of the plugins\n self._drainPlugins();\n\n self._isRavenInstalled = true;\n }\n\n Error.stackTraceLimit = self._globalOptions.stackTraceLimit;\n return this;\n },\n\n /*\n * Set the DSN (can be called multiple time unlike config)\n *\n * @param {string} dsn The public Sentry DSN\n */\n setDSN: function(dsn) {\n var self = this,\n uri = self._parseDSN(dsn),\n lastSlash = uri.path.lastIndexOf('/'),\n path = uri.path.substr(1, lastSlash);\n\n self._dsn = dsn;\n self._globalKey = uri.user;\n self._globalSecret = uri.pass && uri.pass.substr(1);\n self._globalProject = uri.path.substr(lastSlash + 1);\n\n self._globalServer = self._getGlobalServer(uri);\n\n self._globalEndpoint =\n self._globalServer + '/' + path + 'api/' + self._globalProject + '/store/';\n\n // Reset backoff state since we may be pointing at a\n // new project/server\n this._resetBackoff();\n },\n\n /*\n * Wrap code within a context so Raven can capture errors\n * reliably across domains that is executed immediately.\n *\n * @param {object} options A specific set of options for this context [optional]\n * @param {function} func The callback to be immediately executed within the context\n * @param {array} args An array of arguments to be called with the callback [optional]\n */\n context: function(options, func, args) {\n if (isFunction(options)) {\n args = func || [];\n func = options;\n options = {};\n }\n\n return this.wrap(options, func).apply(this, args);\n },\n\n /*\n * Wrap code within a context and returns back a new function to be executed\n *\n * @param {object} options A specific set of options for this context [optional]\n * @param {function} func The function to be wrapped in a new context\n * @param {function} _before A function to call before the try/catch wrapper [optional, private]\n * @return {function} The newly wrapped functions with a context\n */\n wrap: function(options, func, _before) {\n var self = this;\n // 1 argument has been passed, and it's not a function\n // so just return it\n if (isUndefined(func) && !isFunction(options)) {\n return options;\n }\n\n // options is optional\n if (isFunction(options)) {\n func = options;\n options = undefined;\n }\n\n // At this point, we've passed along 2 arguments, and the second one\n // is not a function either, so we'll just return the second argument.\n if (!isFunction(func)) {\n return func;\n }\n\n // We don't wanna wrap it twice!\n try {\n if (func.__raven__) {\n return func;\n }\n\n // If this has already been wrapped in the past, return that\n if (func.__raven_wrapper__) {\n return func.__raven_wrapper__;\n }\n } catch (e) {\n // Just accessing custom props in some Selenium environments\n // can cause a \"Permission denied\" exception (see raven-js#495).\n // Bail on wrapping and return the function as-is (defers to window.onerror).\n return func;\n }\n\n function wrapped() {\n var args = [],\n i = arguments.length,\n deep = !options || (options && options.deep !== false);\n\n if (_before && isFunction(_before)) {\n _before.apply(this, arguments);\n }\n\n // Recursively wrap all of a function's arguments that are\n // functions themselves.\n while (i--) args[i] = deep ? self.wrap(options, arguments[i]) : arguments[i];\n\n try {\n // Attempt to invoke user-land function\n // NOTE: If you are a Sentry user, and you are seeing this stack frame, it\n // means Raven caught an error invoking your application code. This is\n // expected behavior and NOT indicative of a bug with Raven.js.\n return func.apply(this, args);\n } catch (e) {\n self._ignoreNextOnError();\n self.captureException(e, options);\n throw e;\n }\n }\n\n // copy over properties of the old function\n for (var property in func) {\n if (hasKey(func, property)) {\n wrapped[property] = func[property];\n }\n }\n wrapped.prototype = func.prototype;\n\n func.__raven_wrapper__ = wrapped;\n // Signal that this function has been wrapped/filled already\n // for both debugging and to prevent it to being wrapped/filled twice\n wrapped.__raven__ = true;\n wrapped.__orig__ = func;\n\n return wrapped;\n },\n\n /**\n * Uninstalls the global error handler.\n *\n * @return {Raven}\n */\n uninstall: function() {\n TraceKit.report.uninstall();\n\n this._detachPromiseRejectionHandler();\n this._unpatchFunctionToString();\n this._restoreBuiltIns();\n this._restoreConsole();\n\n Error.stackTraceLimit = this._originalErrorStackTraceLimit;\n this._isRavenInstalled = false;\n\n return this;\n },\n\n /**\n * Callback used for `unhandledrejection` event\n *\n * @param {PromiseRejectionEvent} event An object containing\n * promise: the Promise that was rejected\n * reason: the value with which the Promise was rejected\n * @return void\n */\n _promiseRejectionHandler: function(event) {\n this._logDebug('debug', 'Raven caught unhandled promise rejection:', event);\n this.captureException(event.reason, {\n mechanism: {\n type: 'onunhandledrejection',\n handled: false\n }\n });\n },\n\n /**\n * Installs the global promise rejection handler.\n *\n * @return {raven}\n */\n _attachPromiseRejectionHandler: function() {\n this._promiseRejectionHandler = this._promiseRejectionHandler.bind(this);\n _window.addEventListener &&\n _window.addEventListener('unhandledrejection', this._promiseRejectionHandler);\n return this;\n },\n\n /**\n * Uninstalls the global promise rejection handler.\n *\n * @return {raven}\n */\n _detachPromiseRejectionHandler: function() {\n _window.removeEventListener &&\n _window.removeEventListener('unhandledrejection', this._promiseRejectionHandler);\n return this;\n },\n\n /**\n * Manually capture an exception and send it over to Sentry\n *\n * @param {error} ex An exception to be logged\n * @param {object} options A specific set of options for this error [optional]\n * @return {Raven}\n */\n captureException: function(ex, options) {\n options = objectMerge({trimHeadFrames: 0}, options ? options : {});\n\n if (isErrorEvent(ex) && ex.error) {\n // If it is an ErrorEvent with `error` property, extract it to get actual Error\n ex = ex.error;\n } else if (isDOMError(ex) || isDOMException(ex)) {\n // If it is a DOMError or DOMException (which are legacy APIs, but still supported in some browsers)\n // then we just extract the name and message, as they don't provide anything else\n // https://developer.mozilla.org/en-US/docs/Web/API/DOMError\n // https://developer.mozilla.org/en-US/docs/Web/API/DOMException\n var name = ex.name || (isDOMError(ex) ? 'DOMError' : 'DOMException');\n var message = ex.message ? name + ': ' + ex.message : name;\n\n return this.captureMessage(\n message,\n objectMerge(options, {\n // neither DOMError or DOMException provide stack trace and we most likely wont get it this way as well\n // but it's barely any overhead so we may at least try\n stacktrace: true,\n trimHeadFrames: options.trimHeadFrames + 1\n })\n );\n } else if (isError(ex)) {\n // we have a real Error object\n ex = ex;\n } else if (isPlainObject(ex)) {\n // If it is plain Object, serialize it manually and extract options\n // This will allow us to group events based on top-level keys\n // which is much better than creating new group when any key/value change\n options = this._getCaptureExceptionOptionsFromPlainObject(options, ex);\n ex = new Error(options.message);\n } else {\n // If none of previous checks were valid, then it means that\n // it's not a DOMError/DOMException\n // it's not a plain Object\n // it's not a valid ErrorEvent (one with an error property)\n // it's not an Error\n // So bail out and capture it as a simple message:\n return this.captureMessage(\n ex,\n objectMerge(options, {\n stacktrace: true, // if we fall back to captureMessage, default to attempting a new trace\n trimHeadFrames: options.trimHeadFrames + 1\n })\n );\n }\n\n // Store the raw exception object for potential debugging and introspection\n this._lastCapturedException = ex;\n\n // TraceKit.report will re-raise any exception passed to it,\n // which means you have to wrap it in try/catch. Instead, we\n // can wrap it here and only re-raise if TraceKit.report\n // raises an exception different from the one we asked to\n // report on.\n try {\n var stack = TraceKit.computeStackTrace(ex);\n this._handleStackInfo(stack, options);\n } catch (ex1) {\n if (ex !== ex1) {\n throw ex1;\n }\n }\n\n return this;\n },\n\n _getCaptureExceptionOptionsFromPlainObject: function(currentOptions, ex) {\n var exKeys = Object.keys(ex).sort();\n var options = objectMerge(currentOptions, {\n message:\n 'Non-Error exception captured with keys: ' + serializeKeysForMessage(exKeys),\n fingerprint: [md5(exKeys)],\n extra: currentOptions.extra || {}\n });\n options.extra.__serialized__ = serializeException(ex);\n\n return options;\n },\n\n /*\n * Manually send a message to Sentry\n *\n * @param {string} msg A plain message to be captured in Sentry\n * @param {object} options A specific set of options for this message [optional]\n * @return {Raven}\n */\n captureMessage: function(msg, options) {\n // config() automagically converts ignoreErrors from a list to a RegExp so we need to test for an\n // early call; we'll error on the side of logging anything called before configuration since it's\n // probably something you should see:\n if (\n !!this._globalOptions.ignoreErrors.test &&\n this._globalOptions.ignoreErrors.test(msg)\n ) {\n return;\n }\n\n options = options || {};\n msg = msg + ''; // Make sure it's actually a string\n\n var data = objectMerge(\n {\n message: msg\n },\n options\n );\n\n var ex;\n // Generate a \"synthetic\" stack trace from this point.\n // NOTE: If you are a Sentry user, and you are seeing this stack frame, it is NOT indicative\n // of a bug with Raven.js. Sentry generates synthetic traces either by configuration,\n // or if it catches a thrown object without a \"stack\" property.\n try {\n throw new Error(msg);\n } catch (ex1) {\n ex = ex1;\n }\n\n // null exception name so `Error` isn't prefixed to msg\n ex.name = null;\n var stack = TraceKit.computeStackTrace(ex);\n\n // stack[0] is `throw new Error(msg)` call itself, we are interested in the frame that was just before that, stack[1]\n var initialCall = isArray(stack.stack) && stack.stack[1];\n\n // if stack[1] is `Raven.captureException`, it means that someone passed a string to it and we redirected that call\n // to be handled by `captureMessage`, thus `initialCall` is the 3rd one, not 2nd\n // initialCall => captureException(string) => captureMessage(string)\n if (initialCall && initialCall.func === 'Raven.captureException') {\n initialCall = stack.stack[2];\n }\n\n var fileurl = (initialCall && initialCall.url) || '';\n\n if (\n !!this._globalOptions.ignoreUrls.test &&\n this._globalOptions.ignoreUrls.test(fileurl)\n ) {\n return;\n }\n\n if (\n !!this._globalOptions.whitelistUrls.test &&\n !this._globalOptions.whitelistUrls.test(fileurl)\n ) {\n return;\n }\n\n // Always attempt to get stacktrace if message is empty.\n // It's the only way to provide any helpful information to the user.\n if (this._globalOptions.stacktrace || options.stacktrace || data.message === '') {\n // fingerprint on msg, not stack trace (legacy behavior, could be revisited)\n data.fingerprint = data.fingerprint == null ? msg : data.fingerprint;\n\n options = objectMerge(\n {\n trimHeadFrames: 0\n },\n options\n );\n // Since we know this is a synthetic trace, the top frame (this function call)\n // MUST be from Raven.js, so mark it for trimming\n // We add to the trim counter so that callers can choose to trim extra frames, such\n // as utility functions.\n options.trimHeadFrames += 1;\n\n var frames = this._prepareFrames(stack, options);\n data.stacktrace = {\n // Sentry expects frames oldest to newest\n frames: frames.reverse()\n };\n }\n\n // Make sure that fingerprint is always wrapped in an array\n if (data.fingerprint) {\n data.fingerprint = isArray(data.fingerprint)\n ? data.fingerprint\n : [data.fingerprint];\n }\n\n // Fire away!\n this._send(data);\n\n return this;\n },\n\n captureBreadcrumb: function(obj) {\n var crumb = objectMerge(\n {\n timestamp: now() / 1000\n },\n obj\n );\n\n if (isFunction(this._globalOptions.breadcrumbCallback)) {\n var result = this._globalOptions.breadcrumbCallback(crumb);\n\n if (isObject(result) && !isEmptyObject(result)) {\n crumb = result;\n } else if (result === false) {\n return this;\n }\n }\n\n this._breadcrumbs.push(crumb);\n if (this._breadcrumbs.length > this._globalOptions.maxBreadcrumbs) {\n this._breadcrumbs.shift();\n }\n return this;\n },\n\n addPlugin: function(plugin /*arg1, arg2, ... argN*/) {\n var pluginArgs = [].slice.call(arguments, 1);\n\n this._plugins.push([plugin, pluginArgs]);\n if (this._isRavenInstalled) {\n this._drainPlugins();\n }\n\n return this;\n },\n\n /*\n * Set/clear a user to be sent along with the payload.\n *\n * @param {object} user An object representing user data [optional]\n * @return {Raven}\n */\n setUserContext: function(user) {\n // Intentionally do not merge here since that's an unexpected behavior.\n this._globalContext.user = user;\n\n return this;\n },\n\n /*\n * Merge extra attributes to be sent along with the payload.\n *\n * @param {object} extra An object representing extra data [optional]\n * @return {Raven}\n */\n setExtraContext: function(extra) {\n this._mergeContext('extra', extra);\n\n return this;\n },\n\n /*\n * Merge tags to be sent along with the payload.\n *\n * @param {object} tags An object representing tags [optional]\n * @return {Raven}\n */\n setTagsContext: function(tags) {\n this._mergeContext('tags', tags);\n\n return this;\n },\n\n /*\n * Clear all of the context.\n *\n * @return {Raven}\n */\n clearContext: function() {\n this._globalContext = {};\n\n return this;\n },\n\n /*\n * Get a copy of the current context. This cannot be mutated.\n *\n * @return {object} copy of context\n */\n getContext: function() {\n // lol javascript\n return JSON.parse(stringify(this._globalContext));\n },\n\n /*\n * Set environment of application\n *\n * @param {string} environment Typically something like 'production'.\n * @return {Raven}\n */\n setEnvironment: function(environment) {\n this._globalOptions.environment = environment;\n\n return this;\n },\n\n /*\n * Set release version of application\n *\n * @param {string} release Typically something like a git SHA to identify version\n * @return {Raven}\n */\n setRelease: function(release) {\n this._globalOptions.release = release;\n\n return this;\n },\n\n /*\n * Set the dataCallback option\n *\n * @param {function} callback The callback to run which allows the\n * data blob to be mutated before sending\n * @return {Raven}\n */\n setDataCallback: function(callback) {\n var original = this._globalOptions.dataCallback;\n this._globalOptions.dataCallback = keepOriginalCallback(original, callback);\n return this;\n },\n\n /*\n * Set the breadcrumbCallback option\n *\n * @param {function} callback The callback to run which allows filtering\n * or mutating breadcrumbs\n * @return {Raven}\n */\n setBreadcrumbCallback: function(callback) {\n var original = this._globalOptions.breadcrumbCallback;\n this._globalOptions.breadcrumbCallback = keepOriginalCallback(original, callback);\n return this;\n },\n\n /*\n * Set the shouldSendCallback option\n *\n * @param {function} callback The callback to run which allows\n * introspecting the blob before sending\n * @return {Raven}\n */\n setShouldSendCallback: function(callback) {\n var original = this._globalOptions.shouldSendCallback;\n this._globalOptions.shouldSendCallback = keepOriginalCallback(original, callback);\n return this;\n },\n\n /**\n * Override the default HTTP transport mechanism that transmits data\n * to the Sentry server.\n *\n * @param {function} transport Function invoked instead of the default\n * `makeRequest` handler.\n *\n * @return {Raven}\n */\n setTransport: function(transport) {\n this._globalOptions.transport = transport;\n\n return this;\n },\n\n /*\n * Get the latest raw exception that was captured by Raven.\n *\n * @return {error}\n */\n lastException: function() {\n return this._lastCapturedException;\n },\n\n /*\n * Get the last event id\n *\n * @return {string}\n */\n lastEventId: function() {\n return this._lastEventId;\n },\n\n /*\n * Determine if Raven is setup and ready to go.\n *\n * @return {boolean}\n */\n isSetup: function() {\n if (!this._hasJSON) return false; // needs JSON support\n if (!this._globalServer) {\n if (!this.ravenNotConfiguredError) {\n this.ravenNotConfiguredError = true;\n this._logDebug('error', 'Error: Raven has not been configured.');\n }\n return false;\n }\n return true;\n },\n\n afterLoad: function() {\n // TODO: remove window dependence?\n\n // Attempt to initialize Raven on load\n var RavenConfig = _window.RavenConfig;\n if (RavenConfig) {\n this.config(RavenConfig.dsn, RavenConfig.config).install();\n }\n },\n\n showReportDialog: function(options) {\n if (\n !_document // doesn't work without a document (React native)\n )\n return;\n\n options = objectMerge(\n {\n eventId: this.lastEventId(),\n dsn: this._dsn,\n user: this._globalContext.user || {}\n },\n options\n );\n\n if (!options.eventId) {\n throw new RavenConfigError('Missing eventId');\n }\n\n if (!options.dsn) {\n throw new RavenConfigError('Missing DSN');\n }\n\n var encode = encodeURIComponent;\n var encodedOptions = [];\n\n for (var key in options) {\n if (key === 'user') {\n var user = options.user;\n if (user.name) encodedOptions.push('name=' + encode(user.name));\n if (user.email) encodedOptions.push('email=' + encode(user.email));\n } else {\n encodedOptions.push(encode(key) + '=' + encode(options[key]));\n }\n }\n var globalServer = this._getGlobalServer(this._parseDSN(options.dsn));\n\n var script = _document.createElement('script');\n script.async = true;\n script.src = globalServer + '/api/embed/error-page/?' + encodedOptions.join('&');\n (_document.head || _document.body).appendChild(script);\n },\n\n /**** Private functions ****/\n _ignoreNextOnError: function() {\n var self = this;\n this._ignoreOnError += 1;\n setTimeout(function() {\n // onerror should trigger before setTimeout\n self._ignoreOnError -= 1;\n });\n },\n\n _triggerEvent: function(eventType, options) {\n // NOTE: `event` is a native browser thing, so let's avoid conflicting wiht it\n var evt, key;\n\n if (!this._hasDocument) return;\n\n options = options || {};\n\n eventType = 'raven' + eventType.substr(0, 1).toUpperCase() + eventType.substr(1);\n\n if (_document.createEvent) {\n evt = _document.createEvent('HTMLEvents');\n evt.initEvent(eventType, true, true);\n } else {\n evt = _document.createEventObject();\n evt.eventType = eventType;\n }\n\n for (key in options)\n if (hasKey(options, key)) {\n evt[key] = options[key];\n }\n\n if (_document.createEvent) {\n // IE9 if standards\n _document.dispatchEvent(evt);\n } else {\n // IE8 regardless of Quirks or Standards\n // IE9 if quirks\n try {\n _document.fireEvent('on' + evt.eventType.toLowerCase(), evt);\n } catch (e) {\n // Do nothing\n }\n }\n },\n\n /**\n * Wraps addEventListener to capture UI breadcrumbs\n * @param evtName the event name (e.g. \"click\")\n * @returns {Function}\n * @private\n */\n _breadcrumbEventHandler: function(evtName) {\n var self = this;\n return function(evt) {\n // reset keypress timeout; e.g. triggering a 'click' after\n // a 'keypress' will reset the keypress debounce so that a new\n // set of keypresses can be recorded\n self._keypressTimeout = null;\n\n // It's possible this handler might trigger multiple times for the same\n // event (e.g. event propagation through node ancestors). Ignore if we've\n // already captured the event.\n if (self._lastCapturedEvent === evt) return;\n\n self._lastCapturedEvent = evt;\n\n // try/catch both:\n // - accessing evt.target (see getsentry/raven-js#838, #768)\n // - `htmlTreeAsString` because it's complex, and just accessing the DOM incorrectly\n // can throw an exception in some circumstances.\n var target;\n try {\n target = htmlTreeAsString(evt.target);\n } catch (e) {\n target = '<unknown>';\n }\n\n self.captureBreadcrumb({\n category: 'ui.' + evtName, // e.g. ui.click, ui.input\n message: target\n });\n };\n },\n\n /**\n * Wraps addEventListener to capture keypress UI events\n * @returns {Function}\n * @private\n */\n _keypressEventHandler: function() {\n var self = this,\n debounceDuration = 1000; // milliseconds\n\n // TODO: if somehow user switches keypress target before\n // debounce timeout is triggered, we will only capture\n // a single breadcrumb from the FIRST target (acceptable?)\n return function(evt) {\n var target;\n try {\n target = evt.target;\n } catch (e) {\n // just accessing event properties can throw an exception in some rare circumstances\n // see: https://github.com/getsentry/raven-js/issues/838\n return;\n }\n var tagName = target && target.tagName;\n\n // only consider keypress events on actual input elements\n // this will disregard keypresses targeting body (e.g. tabbing\n // through elements, hotkeys, etc)\n if (\n !tagName ||\n (tagName !== 'INPUT' && tagName !== 'TEXTAREA' && !target.isContentEditable)\n )\n return;\n\n // record first keypress in a series, but ignore subsequent\n // keypresses until debounce clears\n var timeout = self._keypressTimeout;\n if (!timeout) {\n self._breadcrumbEventHandler('input')(evt);\n }\n clearTimeout(timeout);\n self._keypressTimeout = setTimeout(function() {\n self._keypressTimeout = null;\n }, debounceDuration);\n };\n },\n\n /**\n * Captures a breadcrumb of type \"navigation\", normalizing input URLs\n * @param to the originating URL\n * @param from the target URL\n * @private\n */\n _captureUrlChange: function(from, to) {\n var parsedLoc = parseUrl(this._location.href);\n var parsedTo = parseUrl(to);\n var parsedFrom = parseUrl(from);\n\n // because onpopstate only tells you the \"new\" (to) value of location.href, and\n // not the previous (from) value, we need to track the value of the current URL\n // state ourselves\n this._lastHref = to;\n\n // Use only the path component of the URL if the URL matches the current\n // document (almost all the time when using pushState)\n if (parsedLoc.protocol === parsedTo.protocol && parsedLoc.host === parsedTo.host)\n to = parsedTo.relative;\n if (parsedLoc.protocol === parsedFrom.protocol && parsedLoc.host === parsedFrom.host)\n from = parsedFrom.relative;\n\n this.captureBreadcrumb({\n category: 'navigation',\n data: {\n to: to,\n from: from\n }\n });\n },\n\n _patchFunctionToString: function() {\n var self = this;\n self._originalFunctionToString = Function.prototype.toString;\n // eslint-disable-next-line no-extend-native\n Function.prototype.toString = function() {\n if (typeof this === 'function' && this.__raven__) {\n return self._originalFunctionToString.apply(this.__orig__, arguments);\n }\n return self._originalFunctionToString.apply(this, arguments);\n };\n },\n\n _unpatchFunctionToString: function() {\n if (this._originalFunctionToString) {\n // eslint-disable-next-line no-extend-native\n Function.prototype.toString = this._originalFunctionToString;\n }\n },\n\n /**\n * Wrap timer functions and event targets to catch errors and provide\n * better metadata.\n */\n _instrumentTryCatch: function() {\n var self = this;\n\n var wrappedBuiltIns = self._wrappedBuiltIns;\n\n function wrapTimeFn(orig) {\n return function(fn, t) {\n // preserve arity\n // Make a copy of the arguments to prevent deoptimization\n // https://github.com/petkaantonov/bluebird/wiki/Optimization-killers#32-leaking-arguments\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; ++i) {\n args[i] = arguments[i];\n }\n var originalCallback = args[0];\n if (isFunction(originalCallback)) {\n args[0] = self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {function: orig.name || '<anonymous>'}\n }\n },\n originalCallback\n );\n }\n\n // IE < 9 doesn't support .call/.apply on setInterval/setTimeout, but it\n // also supports only two arguments and doesn't care what this is, so we\n // can just call the original function directly.\n if (orig.apply) {\n return orig.apply(this, args);\n } else {\n return orig(args[0], args[1]);\n }\n };\n }\n\n var autoBreadcrumbs = this._globalOptions.autoBreadcrumbs;\n\n function wrapEventTarget(global) {\n var proto = _window[global] && _window[global].prototype;\n if (proto && proto.hasOwnProperty && proto.hasOwnProperty('addEventListener')) {\n fill(\n proto,\n 'addEventListener',\n function(orig) {\n return function(evtName, fn, capture, secure) {\n // preserve arity\n try {\n if (fn && fn.handleEvent) {\n fn.handleEvent = self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {\n target: global,\n function: 'handleEvent',\n handler: (fn && fn.name) || '<anonymous>'\n }\n }\n },\n fn.handleEvent\n );\n }\n } catch (err) {\n // can sometimes get 'Permission denied to access property \"handle Event'\n }\n\n // More breadcrumb DOM capture ... done here and not in `_instrumentBreadcrumbs`\n // so that we don't have more than one wrapper function\n var before, clickHandler, keypressHandler;\n\n if (\n autoBreadcrumbs &&\n autoBreadcrumbs.dom &&\n (global === 'EventTarget' || global === 'Node')\n ) {\n // NOTE: generating multiple handlers per addEventListener invocation, should\n // revisit and verify we can just use one (almost certainly)\n clickHandler = self._breadcrumbEventHandler('click');\n keypressHandler = self._keypressEventHandler();\n before = function(evt) {\n // need to intercept every DOM event in `before` argument, in case that\n // same wrapped method is re-used for different events (e.g. mousemove THEN click)\n // see #724\n if (!evt) return;\n\n var eventType;\n try {\n eventType = evt.type;\n } catch (e) {\n // just accessing event properties can throw an exception in some rare circumstances\n // see: https://github.com/getsentry/raven-js/issues/838\n return;\n }\n if (eventType === 'click') return clickHandler(evt);\n else if (eventType === 'keypress') return keypressHandler(evt);\n };\n }\n return orig.call(\n this,\n evtName,\n self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {\n target: global,\n function: 'addEventListener',\n handler: (fn && fn.name) || '<anonymous>'\n }\n }\n },\n fn,\n before\n ),\n capture,\n secure\n );\n };\n },\n wrappedBuiltIns\n );\n fill(\n proto,\n 'removeEventListener',\n function(orig) {\n return function(evt, fn, capture, secure) {\n try {\n fn = fn && (fn.__raven_wrapper__ ? fn.__raven_wrapper__ : fn);\n } catch (e) {\n // ignore, accessing __raven_wrapper__ will throw in some Selenium environments\n }\n return orig.call(this, evt, fn, capture, secure);\n };\n },\n wrappedBuiltIns\n );\n }\n }\n\n fill(_window, 'setTimeout', wrapTimeFn, wrappedBuiltIns);\n fill(_window, 'setInterval', wrapTimeFn, wrappedBuiltIns);\n if (_window.requestAnimationFrame) {\n fill(\n _window,\n 'requestAnimationFrame',\n function(orig) {\n return function(cb) {\n return orig(\n self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {\n function: 'requestAnimationFrame',\n handler: (orig && orig.name) || '<anonymous>'\n }\n }\n },\n cb\n )\n );\n };\n },\n wrappedBuiltIns\n );\n }\n\n // event targets borrowed from bugsnag-js:\n // https://github.com/bugsnag/bugsnag-js/blob/master/src/bugsnag.js#L666\n var eventTargets = [\n 'EventTarget',\n 'Window',\n 'Node',\n 'ApplicationCache',\n 'AudioTrackList',\n 'ChannelMergerNode',\n 'CryptoOperation',\n 'EventSource',\n 'FileReader',\n 'HTMLUnknownElement',\n 'IDBDatabase',\n 'IDBRequest',\n 'IDBTransaction',\n 'KeyOperation',\n 'MediaController',\n 'MessagePort',\n 'ModalWindow',\n 'Notification',\n 'SVGElementInstance',\n 'Screen',\n 'TextTrack',\n 'TextTrackCue',\n 'TextTrackList',\n 'WebSocket',\n 'WebSocketWorker',\n 'Worker',\n 'XMLHttpRequest',\n 'XMLHttpRequestEventTarget',\n 'XMLHttpRequestUpload'\n ];\n for (var i = 0; i < eventTargets.length; i++) {\n wrapEventTarget(eventTargets[i]);\n }\n },\n\n /**\n * Instrument browser built-ins w/ breadcrumb capturing\n * - XMLHttpRequests\n * - DOM interactions (click/typing)\n * - window.location changes\n * - console\n *\n * Can be disabled or individually configured via the `autoBreadcrumbs` config option\n */\n _instrumentBreadcrumbs: function() {\n var self = this;\n var autoBreadcrumbs = this._globalOptions.autoBreadcrumbs;\n\n var wrappedBuiltIns = self._wrappedBuiltIns;\n\n function wrapProp(prop, xhr) {\n if (prop in xhr && isFunction(xhr[prop])) {\n fill(xhr, prop, function(orig) {\n return self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {function: prop, handler: (orig && orig.name) || '<anonymous>'}\n }\n },\n orig\n );\n }); // intentionally don't track filled methods on XHR instances\n }\n }\n\n if (autoBreadcrumbs.xhr && 'XMLHttpRequest' in _window) {\n var xhrproto = _window.XMLHttpRequest && _window.XMLHttpRequest.prototype;\n fill(\n xhrproto,\n 'open',\n function(origOpen) {\n return function(method, url) {\n // preserve arity\n\n // if Sentry key appears in URL, don't capture\n if (isString(url) && url.indexOf(self._globalKey) === -1) {\n this.__raven_xhr = {\n method: method,\n url: url,\n status_code: null\n };\n }\n\n return origOpen.apply(this, arguments);\n };\n },\n wrappedBuiltIns\n );\n\n fill(\n xhrproto,\n 'send',\n function(origSend) {\n return function() {\n // preserve arity\n var xhr = this;\n\n function onreadystatechangeHandler() {\n if (xhr.__raven_xhr && xhr.readyState === 4) {\n try {\n // touching statusCode in some platforms throws\n // an exception\n xhr.__raven_xhr.status_code = xhr.status;\n } catch (e) {\n /* do nothing */\n }\n\n self.captureBreadcrumb({\n type: 'http',\n category: 'xhr',\n data: xhr.__raven_xhr\n });\n }\n }\n\n var props = ['onload', 'onerror', 'onprogress'];\n for (var j = 0; j < props.length; j++) {\n wrapProp(props[j], xhr);\n }\n\n if ('onreadystatechange' in xhr && isFunction(xhr.onreadystatechange)) {\n fill(\n xhr,\n 'onreadystatechange',\n function(orig) {\n return self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {\n function: 'onreadystatechange',\n handler: (orig && orig.name) || '<anonymous>'\n }\n }\n },\n orig,\n onreadystatechangeHandler\n );\n } /* intentionally don't track this instrumentation */\n );\n } else {\n // if onreadystatechange wasn't actually set by the page on this xhr, we\n // are free to set our own and capture the breadcrumb\n xhr.onreadystatechange = onreadystatechangeHandler;\n }\n\n return origSend.apply(this, arguments);\n };\n },\n wrappedBuiltIns\n );\n }\n\n if (autoBreadcrumbs.xhr && supportsFetch()) {\n fill(\n _window,\n 'fetch',\n function(origFetch) {\n return function() {\n // preserve arity\n // Make a copy of the arguments to prevent deoptimization\n // https://github.com/petkaantonov/bluebird/wiki/Optimization-killers#32-leaking-arguments\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; ++i) {\n args[i] = arguments[i];\n }\n\n var fetchInput = args[0];\n var method = 'GET';\n var url;\n\n if (typeof fetchInput === 'string') {\n url = fetchInput;\n } else if ('Request' in _window && fetchInput instanceof _window.Request) {\n url = fetchInput.url;\n if (fetchInput.method) {\n method = fetchInput.method;\n }\n } else {\n url = '' + fetchInput;\n }\n\n // if Sentry key appears in URL, don't capture, as it's our own request\n if (url.indexOf(self._globalKey) !== -1) {\n return origFetch.apply(this, args);\n }\n\n if (args[1] && args[1].method) {\n method = args[1].method;\n }\n\n var fetchData = {\n method: method,\n url: url,\n status_code: null\n };\n\n return origFetch\n .apply(this, args)\n .then(function(response) {\n fetchData.status_code = response.status;\n\n self.captureBreadcrumb({\n type: 'http',\n category: 'fetch',\n data: fetchData\n });\n\n return response;\n })\n ['catch'](function(err) {\n // if there is an error performing the request\n self.captureBreadcrumb({\n type: 'http',\n category: 'fetch',\n data: fetchData,\n level: 'error'\n });\n\n throw err;\n });\n };\n },\n wrappedBuiltIns\n );\n }\n\n // Capture breadcrumbs from any click that is unhandled / bubbled up all the way\n // to the document. Do this before we instrument addEventListener.\n if (autoBreadcrumbs.dom && this._hasDocument) {\n if (_document.addEventListener) {\n _document.addEventListener('click', self._breadcrumbEventHandler('click'), false);\n _document.addEventListener('keypress', self._keypressEventHandler(), false);\n } else if (_document.attachEvent) {\n // IE8 Compatibility\n _document.attachEvent('onclick', self._breadcrumbEventHandler('click'));\n _document.attachEvent('onkeypress', self._keypressEventHandler());\n }\n }\n\n // record navigation (URL) changes\n // NOTE: in Chrome App environment, touching history.pushState, *even inside\n // a try/catch block*, will cause Chrome to output an error to console.error\n // borrowed from: https://github.com/angular/angular.js/pull/13945/files\n var chrome = _window.chrome;\n var isChromePackagedApp = chrome && chrome.app && chrome.app.runtime;\n var hasPushAndReplaceState =\n !isChromePackagedApp &&\n _window.history &&\n _window.history.pushState &&\n _window.history.replaceState;\n if (autoBreadcrumbs.location && hasPushAndReplaceState) {\n // TODO: remove onpopstate handler on uninstall()\n var oldOnPopState = _window.onpopstate;\n _window.onpopstate = function() {\n var currentHref = self._location.href;\n self._captureUrlChange(self._lastHref, currentHref);\n\n if (oldOnPopState) {\n return oldOnPopState.apply(this, arguments);\n }\n };\n\n var historyReplacementFunction = function(origHistFunction) {\n // note history.pushState.length is 0; intentionally not declaring\n // params to preserve 0 arity\n return function(/* state, title, url */) {\n var url = arguments.length > 2 ? arguments[2] : undefined;\n\n // url argument is optional\n if (url) {\n // coerce to string (this is what pushState does)\n self._captureUrlChange(self._lastHref, url + '');\n }\n\n return origHistFunction.apply(this, arguments);\n };\n };\n\n fill(_window.history, 'pushState', historyReplacementFunction, wrappedBuiltIns);\n fill(_window.history, 'replaceState', historyReplacementFunction, wrappedBuiltIns);\n }\n\n if (autoBreadcrumbs.console && 'console' in _window && console.log) {\n // console\n var consoleMethodCallback = function(msg, data) {\n self.captureBreadcrumb({\n message: msg,\n level: data.level,\n category: 'console'\n });\n };\n\n each(['debug', 'info', 'warn', 'error', 'log'], function(_, level) {\n wrapConsoleMethod(console, level, consoleMethodCallback);\n });\n }\n },\n\n _restoreBuiltIns: function() {\n // restore any wrapped builtins\n var builtin;\n while (this._wrappedBuiltIns.length) {\n builtin = this._wrappedBuiltIns.shift();\n\n var obj = builtin[0],\n name = builtin[1],\n orig = builtin[2];\n\n obj[name] = orig;\n }\n },\n\n _restoreConsole: function() {\n // eslint-disable-next-line guard-for-in\n for (var method in this._originalConsoleMethods) {\n this._originalConsole[method] = this._originalConsoleMethods[method];\n }\n },\n\n _drainPlugins: function() {\n var self = this;\n\n // FIX ME TODO\n each(this._plugins, function(_, plugin) {\n var installer = plugin[0];\n var args = plugin[1];\n installer.apply(self, [self].concat(args));\n });\n },\n\n _parseDSN: function(str) {\n var m = dsnPattern.exec(str),\n dsn = {},\n i = 7;\n\n try {\n while (i--) dsn[dsnKeys[i]] = m[i] || '';\n } catch (e) {\n throw new RavenConfigError('Invalid DSN: ' + str);\n }\n\n if (dsn.pass && !this._globalOptions.allowSecretKey) {\n throw new RavenConfigError(\n 'Do not specify your secret key in the DSN. See: http://bit.ly/raven-secret-key'\n );\n }\n\n return dsn;\n },\n\n _getGlobalServer: function(uri) {\n // assemble the endpoint from the uri pieces\n var globalServer = '//' + uri.host + (uri.port ? ':' + uri.port : '');\n\n if (uri.protocol) {\n globalServer = uri.protocol + ':' + globalServer;\n }\n return globalServer;\n },\n\n _handleOnErrorStackInfo: function(stackInfo, options) {\n options = options || {};\n options.mechanism = options.mechanism || {\n type: 'onerror',\n handled: false\n };\n\n // if we are intentionally ignoring errors via onerror, bail out\n if (!this._ignoreOnError) {\n this._handleStackInfo(stackInfo, options);\n }\n },\n\n _handleStackInfo: function(stackInfo, options) {\n var frames = this._prepareFrames(stackInfo, options);\n\n this._triggerEvent('handle', {\n stackInfo: stackInfo,\n options: options\n });\n\n this._processException(\n stackInfo.name,\n stackInfo.message,\n stackInfo.url,\n stackInfo.lineno,\n frames,\n options\n );\n },\n\n _prepareFrames: function(stackInfo, options) {\n var self = this;\n var frames = [];\n if (stackInfo.stack && stackInfo.stack.length) {\n each(stackInfo.stack, function(i, stack) {\n var frame = self._normalizeFrame(stack, stackInfo.url);\n if (frame) {\n frames.push(frame);\n }\n });\n\n // e.g. frames captured via captureMessage throw\n if (options && options.trimHeadFrames) {\n for (var j = 0; j < options.trimHeadFrames && j < frames.length; j++) {\n frames[j].in_app = false;\n }\n }\n }\n frames = frames.slice(0, this._globalOptions.stackTraceLimit);\n return frames;\n },\n\n _normalizeFrame: function(frame, stackInfoUrl) {\n // normalize the frames data\n var normalized = {\n filename: frame.url,\n lineno: frame.line,\n colno: frame.column,\n function: frame.func || '?'\n };\n\n // Case when we don't have any information about the error\n // E.g. throwing a string or raw object, instead of an `Error` in Firefox\n // Generating synthetic error doesn't add any value here\n //\n // We should probably somehow let a user know that they should fix their code\n if (!frame.url) {\n normalized.filename = stackInfoUrl; // fallback to whole stacks url from onerror handler\n }\n\n normalized.in_app = !// determine if an exception came from outside of our app\n // first we check the global includePaths list.\n (\n (!!this._globalOptions.includePaths.test &&\n !this._globalOptions.includePaths.test(normalized.filename)) ||\n // Now we check for fun, if the function name is Raven or TraceKit\n /(Raven|TraceKit)\\./.test(normalized['function']) ||\n // finally, we do a last ditch effort and check for raven.min.js\n /raven\\.(min\\.)?js$/.test(normalized.filename)\n );\n\n return normalized;\n },\n\n _processException: function(type, message, fileurl, lineno, frames, options) {\n var prefixedMessage = (type ? type + ': ' : '') + (message || '');\n if (\n !!this._globalOptions.ignoreErrors.test &&\n (this._globalOptions.ignoreErrors.test(message) ||\n this._globalOptions.ignoreErrors.test(prefixedMessage))\n ) {\n return;\n }\n\n var stacktrace;\n\n if (frames && frames.length) {\n fileurl = frames[0].filename || fileurl;\n // Sentry expects frames oldest to newest\n // and JS sends them as newest to oldest\n frames.reverse();\n stacktrace = {frames: frames};\n } else if (fileurl) {\n stacktrace = {\n frames: [\n {\n filename: fileurl,\n lineno: lineno,\n in_app: true\n }\n ]\n };\n }\n\n if (\n !!this._globalOptions.ignoreUrls.test &&\n this._globalOptions.ignoreUrls.test(fileurl)\n ) {\n return;\n }\n\n if (\n !!this._globalOptions.whitelistUrls.test &&\n !this._globalOptions.whitelistUrls.test(fileurl)\n ) {\n return;\n }\n\n var data = objectMerge(\n {\n // sentry.interfaces.Exception\n exception: {\n values: [\n {\n type: type,\n value: message,\n stacktrace: stacktrace\n }\n ]\n },\n transaction: fileurl\n },\n options\n );\n\n var ex = data.exception.values[0];\n if (ex.type == null && ex.value === '') {\n ex.value = 'Unrecoverable error caught';\n }\n\n // Move mechanism from options to exception interface\n // We do this, as requiring user to pass `{exception:{mechanism:{ ... }}}` would be\n // too much\n if (!data.exception.mechanism && data.mechanism) {\n data.exception.mechanism = data.mechanism;\n delete data.mechanism;\n }\n\n data.exception.mechanism = objectMerge(\n {\n type: 'generic',\n handled: true\n },\n data.exception.mechanism || {}\n );\n\n // Fire away!\n this._send(data);\n },\n\n _trimPacket: function(data) {\n // For now, we only want to truncate the two different messages\n // but this could/should be expanded to just trim everything\n var max = this._globalOptions.maxMessageLength;\n if (data.message) {\n data.message = truncate(data.message, max);\n }\n if (data.exception) {\n var exception = data.exception.values[0];\n exception.value = truncate(exception.value, max);\n }\n\n var request = data.request;\n if (request) {\n if (request.url) {\n request.url = truncate(request.url, this._globalOptions.maxUrlLength);\n }\n if (request.Referer) {\n request.Referer = truncate(request.Referer, this._globalOptions.maxUrlLength);\n }\n }\n\n if (data.breadcrumbs && data.breadcrumbs.values)\n this._trimBreadcrumbs(data.breadcrumbs);\n\n return data;\n },\n\n /**\n * Truncate breadcrumb values (right now just URLs)\n */\n _trimBreadcrumbs: function(breadcrumbs) {\n // known breadcrumb properties with urls\n // TODO: also consider arbitrary prop values that start with (https?)?://\n var urlProps = ['to', 'from', 'url'],\n urlProp,\n crumb,\n data;\n\n for (var i = 0; i < breadcrumbs.values.length; ++i) {\n crumb = breadcrumbs.values[i];\n if (\n !crumb.hasOwnProperty('data') ||\n !isObject(crumb.data) ||\n objectFrozen(crumb.data)\n )\n continue;\n\n data = objectMerge({}, crumb.data);\n for (var j = 0; j < urlProps.length; ++j) {\n urlProp = urlProps[j];\n if (data.hasOwnProperty(urlProp) && data[urlProp]) {\n data[urlProp] = truncate(data[urlProp], this._globalOptions.maxUrlLength);\n }\n }\n breadcrumbs.values[i].data = data;\n }\n },\n\n _getHttpData: function() {\n if (!this._hasNavigator && !this._hasDocument) return;\n var httpData = {};\n\n if (this._hasNavigator && _navigator.userAgent) {\n httpData.headers = {\n 'User-Agent': _navigator.userAgent\n };\n }\n\n // Check in `window` instead of `document`, as we may be in ServiceWorker environment\n if (_window.location && _window.location.href) {\n httpData.url = _window.location.href;\n }\n\n if (this._hasDocument && _document.referrer) {\n if (!httpData.headers) httpData.headers = {};\n httpData.headers.Referer = _document.referrer;\n }\n\n return httpData;\n },\n\n _resetBackoff: function() {\n this._backoffDuration = 0;\n this._backoffStart = null;\n },\n\n _shouldBackoff: function() {\n return this._backoffDuration && now() - this._backoffStart < this._backoffDuration;\n },\n\n /**\n * Returns true if the in-process data payload matches the signature\n * of the previously-sent data\n *\n * NOTE: This has to be done at this level because TraceKit can generate\n * data from window.onerror WITHOUT an exception object (IE8, IE9,\n * other old browsers). This can take the form of an \"exception\"\n * data object with a single frame (derived from the onerror args).\n */\n _isRepeatData: function(current) {\n var last = this._lastData;\n\n if (\n !last ||\n current.message !== last.message || // defined for captureMessage\n current.transaction !== last.transaction // defined for captureException/onerror\n )\n return false;\n\n // Stacktrace interface (i.e. from captureMessage)\n if (current.stacktrace || last.stacktrace) {\n return isSameStacktrace(current.stacktrace, last.stacktrace);\n } else if (current.exception || last.exception) {\n // Exception interface (i.e. from captureException/onerror)\n return isSameException(current.exception, last.exception);\n }\n\n return true;\n },\n\n _setBackoffState: function(request) {\n // If we are already in a backoff state, don't change anything\n if (this._shouldBackoff()) {\n return;\n }\n\n var status = request.status;\n\n // 400 - project_id doesn't exist or some other fatal\n // 401 - invalid/revoked dsn\n // 429 - too many requests\n if (!(status === 400 || status === 401 || status === 429)) return;\n\n var retry;\n try {\n // If Retry-After is not in Access-Control-Expose-Headers, most\n // browsers will throw an exception trying to access it\n if (supportsFetch()) {\n retry = request.headers.get('Retry-After');\n } else {\n retry = request.getResponseHeader('Retry-After');\n }\n\n // Retry-After is returned in seconds\n retry = parseInt(retry, 10) * 1000;\n } catch (e) {\n /* eslint no-empty:0 */\n }\n\n this._backoffDuration = retry\n ? // If Sentry server returned a Retry-After value, use it\n retry\n : // Otherwise, double the last backoff duration (starts at 1 sec)\n this._backoffDuration * 2 || 1000;\n\n this._backoffStart = now();\n },\n\n _send: function(data) {\n var globalOptions = this._globalOptions;\n\n var baseData = {\n project: this._globalProject,\n logger: globalOptions.logger,\n platform: 'javascript'\n },\n httpData = this._getHttpData();\n\n if (httpData) {\n baseData.request = httpData;\n }\n\n // HACK: delete `trimHeadFrames` to prevent from appearing in outbound payload\n if (data.trimHeadFrames) delete data.trimHeadFrames;\n\n data = objectMerge(baseData, data);\n\n // Merge in the tags and extra separately since objectMerge doesn't handle a deep merge\n data.tags = objectMerge(objectMerge({}, this._globalContext.tags), data.tags);\n data.extra = objectMerge(objectMerge({}, this._globalContext.extra), data.extra);\n\n // Send along our own collected metadata with extra\n data.extra['session:duration'] = now() - this._startTime;\n\n if (this._breadcrumbs && this._breadcrumbs.length > 0) {\n // intentionally make shallow copy so that additions\n // to breadcrumbs aren't accidentally sent in this request\n data.breadcrumbs = {\n values: [].slice.call(this._breadcrumbs, 0)\n };\n }\n\n if (this._globalContext.user) {\n // sentry.interfaces.User\n data.user = this._globalContext.user;\n }\n\n // Include the environment if it's defined in globalOptions\n if (globalOptions.environment) data.environment = globalOptions.environment;\n\n // Include the release if it's defined in globalOptions\n if (globalOptions.release) data.release = globalOptions.release;\n\n // Include server_name if it's defined in globalOptions\n if (globalOptions.serverName) data.server_name = globalOptions.serverName;\n\n data = this._sanitizeData(data);\n\n // Cleanup empty properties before sending them to the server\n Object.keys(data).forEach(function(key) {\n if (data[key] == null || data[key] === '' || isEmptyObject(data[key])) {\n delete data[key];\n }\n });\n\n if (isFunction(globalOptions.dataCallback)) {\n data = globalOptions.dataCallback(data) || data;\n }\n\n // Why??????????\n if (!data || isEmptyObject(data)) {\n return;\n }\n\n // Check if the request should be filtered or not\n if (\n isFunction(globalOptions.shouldSendCallback) &&\n !globalOptions.shouldSendCallback(data)\n ) {\n return;\n }\n\n // Backoff state: Sentry server previously responded w/ an error (e.g. 429 - too many requests),\n // so drop requests until \"cool-off\" period has elapsed.\n if (this._shouldBackoff()) {\n this._logDebug('warn', 'Raven dropped error due to backoff: ', data);\n return;\n }\n\n if (typeof globalOptions.sampleRate === 'number') {\n if (Math.random() < globalOptions.sampleRate) {\n this._sendProcessedPayload(data);\n }\n } else {\n this._sendProcessedPayload(data);\n }\n },\n\n _sanitizeData: function(data) {\n return sanitize(data, this._globalOptions.sanitizeKeys);\n },\n\n _getUuid: function() {\n return uuid4();\n },\n\n _sendProcessedPayload: function(data, callback) {\n var self = this;\n var globalOptions = this._globalOptions;\n\n if (!this.isSetup()) return;\n\n // Try and clean up the packet before sending by truncating long values\n data = this._trimPacket(data);\n\n // ideally duplicate error testing should occur *before* dataCallback/shouldSendCallback,\n // but this would require copying an un-truncated copy of the data packet, which can be\n // arbitrarily deep (extra_data) -- could be worthwhile? will revisit\n if (!this._globalOptions.allowDuplicates && this._isRepeatData(data)) {\n this._logDebug('warn', 'Raven dropped repeat event: ', data);\n return;\n }\n\n // Send along an event_id if not explicitly passed.\n // This event_id can be used to reference the error within Sentry itself.\n // Set lastEventId after we know the error should actually be sent\n this._lastEventId = data.event_id || (data.event_id = this._getUuid());\n\n // Store outbound payload after trim\n this._lastData = data;\n\n this._logDebug('debug', 'Raven about to send:', data);\n\n var auth = {\n sentry_version: '7',\n sentry_client: 'raven-js/' + this.VERSION,\n sentry_key: this._globalKey\n };\n\n if (this._globalSecret) {\n auth.sentry_secret = this._globalSecret;\n }\n\n var exception = data.exception && data.exception.values[0];\n\n // only capture 'sentry' breadcrumb is autoBreadcrumbs is truthy\n if (\n this._globalOptions.autoBreadcrumbs &&\n this._globalOptions.autoBreadcrumbs.sentry\n ) {\n this.captureBreadcrumb({\n category: 'sentry',\n message: exception\n ? (exception.type ? exception.type + ': ' : '') + exception.value\n : data.message,\n event_id: data.event_id,\n level: data.level || 'error' // presume error unless specified\n });\n }\n\n var url = this._globalEndpoint;\n (globalOptions.transport || this._makeRequest).call(this, {\n url: url,\n auth: auth,\n data: data,\n options: globalOptions,\n onSuccess: function success() {\n self._resetBackoff();\n\n self._triggerEvent('success', {\n data: data,\n src: url\n });\n callback && callback();\n },\n onError: function failure(error) {\n self._logDebug('error', 'Raven transport failed to send: ', error);\n\n if (error.request) {\n self._setBackoffState(error.request);\n }\n\n self._triggerEvent('failure', {\n data: data,\n src: url\n });\n error = error || new Error('Raven send failed (no additional details provided)');\n callback && callback(error);\n }\n });\n },\n\n _makeRequest: function(opts) {\n // Auth is intentionally sent as part of query string (NOT as custom HTTP header) to avoid preflight CORS requests\n var url = opts.url + '?' + urlencode(opts.auth);\n\n var evaluatedHeaders = null;\n var evaluatedFetchParameters = {};\n\n if (opts.options.headers) {\n evaluatedHeaders = this._evaluateHash(opts.options.headers);\n }\n\n if (opts.options.fetchParameters) {\n evaluatedFetchParameters = this._evaluateHash(opts.options.fetchParameters);\n }\n\n if (supportsFetch()) {\n evaluatedFetchParameters.body = stringify(opts.data);\n\n var defaultFetchOptions = objectMerge({}, this._fetchDefaults);\n var fetchOptions = objectMerge(defaultFetchOptions, evaluatedFetchParameters);\n\n if (evaluatedHeaders) {\n fetchOptions.headers = evaluatedHeaders;\n }\n\n return _window\n .fetch(url, fetchOptions)\n .then(function(response) {\n if (response.ok) {\n opts.onSuccess && opts.onSuccess();\n } else {\n var error = new Error('Sentry error code: ' + response.status);\n // It's called request only to keep compatibility with XHR interface\n // and not add more redundant checks in setBackoffState method\n error.request = response;\n opts.onError && opts.onError(error);\n }\n })\n ['catch'](function() {\n opts.onError &&\n opts.onError(new Error('Sentry error code: network unavailable'));\n });\n }\n\n var request = _window.XMLHttpRequest && new _window.XMLHttpRequest();\n if (!request) return;\n\n // if browser doesn't support CORS (e.g. IE7), we are out of luck\n var hasCORS = 'withCredentials' in request || typeof XDomainRequest !== 'undefined';\n\n if (!hasCORS) return;\n\n if ('withCredentials' in request) {\n request.onreadystatechange = function() {\n if (request.readyState !== 4) {\n return;\n } else if (request.status === 200) {\n opts.onSuccess && opts.onSuccess();\n } else if (opts.onError) {\n var err = new Error('Sentry error code: ' + request.status);\n err.request = request;\n opts.onError(err);\n }\n };\n } else {\n request = new XDomainRequest();\n // xdomainrequest cannot go http -> https (or vice versa),\n // so always use protocol relative\n url = url.replace(/^https?:/, '');\n\n // onreadystatechange not supported by XDomainRequest\n if (opts.onSuccess) {\n request.onload = opts.onSuccess;\n }\n if (opts.onError) {\n request.onerror = function() {\n var err = new Error('Sentry error code: XDomainRequest');\n err.request = request;\n opts.onError(err);\n };\n }\n }\n\n request.open('POST', url);\n\n if (evaluatedHeaders) {\n each(evaluatedHeaders, function(key, value) {\n request.setRequestHeader(key, value);\n });\n }\n\n request.send(stringify(opts.data));\n },\n\n _evaluateHash: function(hash) {\n var evaluated = {};\n\n for (var key in hash) {\n if (hash.hasOwnProperty(key)) {\n var value = hash[key];\n evaluated[key] = typeof value === 'function' ? value() : value;\n }\n }\n\n return evaluated;\n },\n\n _logDebug: function(level) {\n // We allow `Raven.debug` and `Raven.config(DSN, { debug: true })` to not make backward incompatible API change\n if (\n this._originalConsoleMethods[level] &&\n (this.debug || this._globalOptions.debug)\n ) {\n // In IE<10 console methods do not have their own 'apply' method\n Function.prototype.apply.call(\n this._originalConsoleMethods[level],\n this._originalConsole,\n [].slice.call(arguments, 1)\n );\n }\n },\n\n _mergeContext: function(key, context) {\n if (isUndefined(context)) {\n delete this._globalContext[key];\n } else {\n this._globalContext[key] = objectMerge(this._globalContext[key] || {}, context);\n }\n }\n};\n\n// Deprecations\nRaven.prototype.setUser = Raven.prototype.setUserContext;\nRaven.prototype.setReleaseContext = Raven.prototype.setRelease;\n\nmodule.exports = Raven;\n","/**\n * Enforces a single instance of the Raven client, and the\n * main entry point for Raven. If you are a consumer of the\n * Raven library, you SHOULD load this file (vs raven.js).\n **/\n\nvar RavenConstructor = require('./raven');\n\n// This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785)\nvar _window =\n typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {};\nvar _Raven = _window.Raven;\n\nvar Raven = new RavenConstructor();\n\n/*\n * Allow multiple versions of Raven to be installed.\n * Strip Raven from the global context and returns the instance.\n *\n * @return {Raven}\n */\nRaven.noConflict = function() {\n _window.Raven = _Raven;\n return Raven;\n};\n\nRaven.afterLoad();\n\nmodule.exports = Raven;\n\n/**\n * DISCLAIMER:\n *\n * Expose `Client` constructor for cases where user want to track multiple \"sub-applications\" in one larger app.\n * It's not meant to be used by a wide audience, so pleaaase make sure that you know what you're doing before using it.\n * Accidentally calling `install` multiple times, may result in an unexpected behavior that's very hard to debug.\n *\n * It's called `Client' to be in-line with Raven Node implementation.\n *\n * HOWTO:\n *\n * import Raven from 'raven-js';\n *\n * const someAppReporter = new Raven.Client();\n * const someOtherAppReporter = new Raven.Client();\n *\n * someAppReporter.config('__DSN__', {\n * ...config goes here\n * });\n *\n * someOtherAppReporter.config('__OTHER_DSN__', {\n * ...config goes here\n * });\n *\n * someAppReporter.captureMessage(...);\n * someAppReporter.captureException(...);\n * someAppReporter.captureBreadcrumb(...);\n *\n * someOtherAppReporter.captureMessage(...);\n * someOtherAppReporter.captureException(...);\n * someOtherAppReporter.captureBreadcrumb(...);\n *\n * It should \"just work\".\n */\nmodule.exports.Client = RavenConstructor;\n","// ==========================================================================\n// Plyr.io demo\n// This code is purely for the https://plyr.io website\n// Please see readme.md in the root or github.com/sampotts/plyr\n// ==========================================================================\n\nimport Raven from 'raven-js';\n\n(() => {\n const { host } = window.location;\n const env = {\n prod: host === 'plyr.io',\n dev: host === 'dev.plyr.io',\n };\n\n document.addEventListener('DOMContentLoaded', () => {\n Raven.context(() => {\n const selector = '#player';\n const container = document.getElementById('container');\n\n if (window.shr) {\n window.shr.setup({\n count: {\n classname: 'button__count',\n },\n });\n }\n\n // Setup tab focus\n const tabClassName = 'tab-focus';\n\n // Remove class on blur\n document.addEventListener('focusout', event => {\n if (!event.target.classList || container.contains(event.target)) {\n return;\n }\n\n event.target.classList.remove(tabClassName);\n });\n\n // Add classname to tabbed elements\n document.addEventListener('keydown', event => {\n if (event.keyCode !== 9) {\n return;\n }\n\n // Delay the adding of classname until the focus has changed\n // This event fires before the focusin event\n setTimeout(() => {\n const focused = document.activeElement;\n\n if (!focused || !focused.classList || container.contains(focused)) {\n return;\n }\n\n focused.classList.add(tabClassName);\n }, 10);\n });\n\n // Setup the player\n const player = new Plyr(selector, {\n debug: true,\n title: 'View From A Blue Moon',\n iconUrl: '../dist/plyr.svg',\n keyboard: {\n global: true,\n },\n tooltips: {\n controls: true,\n },\n captions: {\n active: true,\n },\n keys: {\n google: 'AIzaSyDrNwtN3nLH_8rjCmu5Wq3ZCm4MNAVdc0c',\n },\n ads: {\n enabled: env.prod || env.dev,\n publisherId: '918848828995742',\n },\n });\n\n // Expose for tinkering in the console\n window.player = player;\n\n // Setup type toggle\n const buttons = document.querySelectorAll('[data-source]');\n const types = {\n video: 'video',\n audio: 'audio',\n youtube: 'youtube',\n vimeo: 'vimeo',\n };\n let currentType = window.location.hash.replace('#', '');\n const historySupport = window.history && window.history.pushState;\n\n // Toggle class on an element\n function toggleClass(element, className, state) {\n if (element) {\n element.classList[state ? 'add' : 'remove'](className);\n }\n }\n\n // Set a new source\n function newSource(type, init) {\n // Bail if new type isn't known, it's the current type, or current type is empty (video is default) and new type is video\n if (\n !(type in types) ||\n (!init && type === currentType) ||\n (!currentType.length && type === types.video)\n ) {\n return;\n }\n\n switch (type) {\n case types.video:\n player.source = {\n type: 'video',\n title: 'View From A Blue Moon',\n sources: [\n {\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-576p.mp4',\n type: 'video/mp4',\n size: 576,\n },\n {\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-720p.mp4',\n type: 'video/mp4',\n size: 720,\n },\n {\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-1080p.mp4',\n type: 'video/mp4',\n size: 1080,\n },\n {\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-1440p.mp4',\n type: 'video/mp4',\n size: 1440,\n },\n ],\n poster: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.jpg',\n tracks: [\n {\n kind: 'captions',\n label: 'English',\n srclang: 'en',\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.en.vtt',\n default: true,\n },\n {\n kind: 'captions',\n label: 'French',\n srclang: 'fr',\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.fr.vtt',\n },\n ],\n };\n\n break;\n\n case types.audio:\n player.source = {\n type: 'audio',\n title: 'Kishi Bashi – “It All Began With A Burst”',\n sources: [\n {\n src: 'https://cdn.plyr.io/static/demo/Kishi_Bashi_-_It_All_Began_With_a_Burst.mp3',\n type: 'audio/mp3',\n },\n {\n src: 'https://cdn.plyr.io/static/demo/Kishi_Bashi_-_It_All_Began_With_a_Burst.ogg',\n type: 'audio/ogg',\n },\n ],\n };\n\n break;\n\n case types.youtube:\n player.source = {\n type: 'video',\n sources: [\n {\n src: 'https://youtube.com/watch?v=bTqVqk7FSmY',\n provider: 'youtube',\n },\n ],\n };\n\n break;\n\n case types.vimeo:\n player.source = {\n type: 'video',\n sources: [\n {\n src: 'https://vimeo.com/76979871',\n provider: 'vimeo',\n },\n ],\n };\n\n break;\n\n default:\n break;\n }\n\n // Set the current type for next time\n currentType = type;\n\n // Remove active classes\n Array.from(buttons).forEach(button => toggleClass(button.parentElement, 'active', false));\n\n // Set active on parent\n toggleClass(document.querySelector(`[data-source=\"${type}\"]`), 'active', true);\n\n // Show cite\n Array.from(document.querySelectorAll('.plyr__cite')).forEach(cite => {\n cite.setAttribute('hidden', '');\n });\n document.querySelector(`.plyr__cite--${type}`).removeAttribute('hidden');\n }\n\n // Bind to each button\n Array.from(buttons).forEach(button => {\n button.addEventListener('click', () => {\n const type = button.getAttribute('data-source');\n\n newSource(type);\n\n if (historySupport) {\n window.history.pushState({ type }, '', `#${type}`);\n }\n });\n });\n\n // List for backwards/forwards\n window.addEventListener('popstate', event => {\n if (event.state && 'type' in event.state) {\n newSource(event.state.type);\n }\n });\n\n // On load\n if (historySupport) {\n const video = !currentType.length;\n\n // If there's no current type set, assume video\n if (video) {\n currentType = types.video;\n }\n\n // Replace current history state\n if (currentType in types) {\n window.history.replaceState(\n {\n type: currentType,\n },\n '',\n video ? '' : `#${currentType}`,\n );\n }\n\n // If it's not video, load the source\n if (currentType !== types.video) {\n newSource(currentType, true);\n }\n }\n });\n });\n\n // Raven / Sentry\n // For demo site (https://plyr.io) only\n if (env.prod) {\n Raven.config('https://d4ad9866ad834437a4754e23937071e4@sentry.io/305555').install();\n }\n\n // Google analytics\n // For demo site (https://plyr.io) only\n /* eslint-disable */\n if (env.prod) {\n ((i, s, o, g, r, a, m) => {\n i.GoogleAnalyticsObject = r;\n i[r] =\n i[r] ||\n function() {\n (i[r].q = i[r].q || []).push(arguments);\n };\n i[r].l = 1 * new Date();\n a = s.createElement(o);\n m = s.getElementsByTagName(o)[0];\n a.async = 1;\n a.src = g;\n m.parentNode.insertBefore(a, m);\n })(window, document, 'script', 'https://www.google-analytics.com/analytics.js', 'ga');\n window.ga('create', 'UA-40881672-11', 'auto');\n window.ga('send', 'pageview');\n }\n /* eslint-enable */\n})();\n"]}
\ No newline at end of file diff --git a/demo/dist/demo.min.js b/demo/dist/demo.min.js deleted file mode 100644 index 0050e0f2..00000000 --- a/demo/dist/demo.min.js +++ /dev/null @@ -1,2 +0,0 @@ -"object"==typeof navigator&&function(){"use strict";var e="undefined"!=typeof window?window:"undefined"!=typeof global?global:"undefined"!=typeof self?self:{};var t,r=(function(e,t){function r(e,t){for(var r=0;r<e.length;++r)if(e[r]===t)return r;return-1}function n(e,t){var n=[],o=[];return null==t&&(t=function(e,t){return n[0]===t?"[Circular ~]":"[Circular ~."+o.slice(0,r(n,t)).join(".")+"]"}),function(i,a){if(n.length>0){var s=r(n,this);~s?n.splice(s+1):n.push(this),~s?o.splice(s,1/0,i):o.push(i),~r(n,a)&&(a=t.call(this,i,a))}else n.push(a);return null==e?a instanceof Error?function(e){var t={stack:e.stack,message:e.message,name:e.name};for(var r in e)Object.prototype.hasOwnProperty.call(e,r)&&(t[r]=e[r]);return t}(a):a:e.call(this,i,a)}}(e.exports=function(e,t,r,o){return JSON.stringify(e,n(t,o),r)}).getSerialize=n}(t={exports:{}},t.exports),t.exports),n=(r.getSerialize,"undefined"!=typeof window?window:void 0!==e?e:"undefined"!=typeof self?self:{});function o(e){return void 0===e}function i(e){return"[object Object]"===Object.prototype.toString.call(e)}function a(e){return"[object String]"===Object.prototype.toString.call(e)}function s(e){return"[object Array]"===Object.prototype.toString.call(e)}function c(){if(!("fetch"in n))return!1;try{return new Headers,new Request(""),new Response,!0}catch(e){return!1}}function l(e,t){var r,n;if(o(e.length))for(r in e)h(e,r)&&t.call(null,r,e[r]);else if(n=e.length)for(r=0;r<n;r++)t.call(null,r,e[r])}function u(e,t){if("number"!=typeof t)throw new Error("2nd argument to `truncate` function should be a number");return"string"!=typeof e||0===t?e:e.length<=t?e:e.substr(0,t)+"…"}function h(e,t){return Object.prototype.hasOwnProperty.call(e,t)}function p(e){for(var t,r=[],n=0,o=e.length;n<o;n++)a(t=e[n])?r.push(t.replace(/([.*+?^=!:${}()|\[\]\/\\])/g,"\\$1")):t&&t.source&&r.push(t.source);return new RegExp(r.join("|"),"i")}function f(e){var t,r,n,o,i,s=[];if(!e||!e.tagName)return"";if(s.push(e.tagName.toLowerCase()),e.id&&s.push("#"+e.id),(t=e.className)&&a(t))for(r=t.split(/\s+/),i=0;i<r.length;i++)s.push("."+r[i]);var c=["type","name","title","alt"];for(i=0;i<c.length;i++)n=c[i],(o=e.getAttribute(n))&&s.push("["+n+'="'+o+'"]');return s.join("")}function d(e,t){return!!(!!e^!!t)}function g(e,t){if(d(e,t))return!1;var r,n,o=e.frames,i=t.frames;if(void 0===o||void 0===i)return!1;if(o.length!==i.length)return!1;for(var a=0;a<o.length;a++)if(r=o[a],n=i[a],r.filename!==n.filename||r.lineno!==n.lineno||r.colno!==n.colno||r.function!==n.function)return!1;return!0}var m=3,_=51200,v=40;function b(e){return function(e){return~-encodeURI(e).split(/%..|./).length}(JSON.stringify(e))}function y(e){if("string"==typeof e){return u(e,40)}if("number"==typeof e||"boolean"==typeof e||void 0===e)return e;var t=Object.prototype.toString.call(e);return"[object Object]"===t?"[Object]":"[object Array]"===t?"[Array]":"[object Function]"===t?e.name?"[Function: "+e.name+"]":"[Function]":e}var E={isObject:function(e){return"object"==typeof e&&null!==e},isError:function(e){switch(Object.prototype.toString.call(e)){case"[object Error]":case"[object Exception]":case"[object DOMException]":return!0;default:return e instanceof Error}},isErrorEvent:function(e){return"[object ErrorEvent]"===Object.prototype.toString.call(e)},isDOMError:function(e){return"[object DOMError]"===Object.prototype.toString.call(e)},isDOMException:function(e){return"[object DOMException]"===Object.prototype.toString.call(e)},isUndefined:o,isFunction:function(e){return"function"==typeof e},isPlainObject:i,isString:a,isArray:s,isEmptyObject:function(e){if(!i(e))return!1;for(var t in e)if(e.hasOwnProperty(t))return!1;return!0},supportsErrorEvent:function(){try{return new ErrorEvent(""),!0}catch(e){return!1}},supportsDOMError:function(){try{return new DOMError(""),!0}catch(e){return!1}},supportsDOMException:function(){try{return new DOMException(""),!0}catch(e){return!1}},supportsFetch:c,supportsReferrerPolicy:function(){if(!c())return!1;try{return new Request("pickleRick",{referrerPolicy:"origin"}),!0}catch(e){return!1}},supportsPromiseRejectionEvent:function(){return"function"==typeof PromiseRejectionEvent},wrappedCallback:function(e){return function(t,r){var n=e(t)||t;return r&&r(n)||n}},each:l,objectMerge:function(e,t){return t?(l(t,function(t,r){e[t]=r}),e):e},truncate:u,objectFrozen:function(e){return!!Object.isFrozen&&Object.isFrozen(e)},hasKey:h,joinRegExp:p,urlencode:function(e){var t=[];return l(e,function(e,r){t.push(encodeURIComponent(e)+"="+encodeURIComponent(r))}),t.join("&")},uuid4:function(){var e=n.crypto||n.msCrypto;if(!o(e)&&e.getRandomValues){var t=new Uint16Array(8);e.getRandomValues(t),t[3]=4095&t[3]|16384,t[4]=16383&t[4]|32768;var r=function(e){for(var t=e.toString(16);t.length<4;)t="0"+t;return t};return r(t[0])+r(t[1])+r(t[2])+r(t[3])+r(t[4])+r(t[5])+r(t[6])+r(t[7])}return"xxxxxxxxxxxx4xxxyxxxxxxxxxxxxxxx".replace(/[xy]/g,function(e){var t=16*Math.random()|0;return("x"===e?t:3&t|8).toString(16)})},htmlTreeAsString:function(e){for(var t,r=[],n=0,o=0,i=" > ".length;e&&n++<5&&!("html"===(t=f(e))||n>1&&o+r.length*i+t.length>=80);)r.push(t),o+=t.length,e=e.parentNode;return r.reverse().join(" > ")},htmlElementAsString:f,isSameException:function(e,t){return!d(e,t)&&(e=e.values[0],t=t.values[0],e.type===t.type&&e.value===t.value&&(r=e.stacktrace,n=t.stacktrace,(!o(r)||!o(n))&&g(e.stacktrace,t.stacktrace)));var r,n},isSameStacktrace:g,parseUrl:function(e){if("string"!=typeof e)return{};var t=e.match(/^(([^:\/?#]+):)?(\/\/([^\/?#]*))?([^?#]*)(\?([^#]*))?(#(.*))?$/),r=t[6]||"",n=t[8]||"";return{protocol:t[2],host:t[4],path:t[5],relative:t[5]+r+n}},fill:function(e,t,r,n){if(null!=e){var o=e[t];e[t]=r(o),e[t].__raven__=!0,e[t].__orig__=o,n&&n.push([e,t,o])}},safeJoin:function(e,t){if(!s(e))return"";for(var r=[],n=0;n<e.length;n++)try{r.push(String(e[n]))}catch(e){r.push("[value cannot be serialized]")}return r.join(t)},serializeException:function e(t,n,o){if(!i(t))return t;o="number"!=typeof(n="number"!=typeof n?m:n)?_:o;var a=function e(t,r){return 0===r?y(t):i(t)?Object.keys(t).reduce(function(n,o){return n[o]=e(t[o],r-1),n},{}):Array.isArray(t)?t.map(function(t){return e(t,r-1)}):y(t)}(t,n);return b(r(a))>o?e(t,n-1):a},serializeKeysForMessage:function(e,t){if("number"==typeof e||"string"==typeof e)return e.toString();if(!Array.isArray(e))return"";if(0===(e=e.filter(function(e){return"string"==typeof e})).length)return"[object has no keys]";if(t="number"!=typeof t?v:t,e[0].length>=t)return e[0];for(var r=e.length;r>0;r--){var n=e.slice(0,r).join(", ");if(!(n.length>t))return r===e.length?n:n+"…"}return""},sanitize:function(e,t){if(!s(t)||s(t)&&0===t.length)return e;var n,o=p(t),a="********";try{n=JSON.parse(r(e))}catch(t){return e}return function e(t){return s(t)?t.map(function(t){return e(t)}):i(t)?Object.keys(t).reduce(function(r,n){return o.test(n)?r[n]=a:r[n]=e(t[n]),r},{}):t}(n)}},w={collectWindowErrors:!0,debug:!1},x="undefined"!=typeof window?window:void 0!==e?e:"undefined"!=typeof self?self:{},k=[].slice,S="?",O=/^(?:[Uu]ncaught (?:exception: )?)?(?:((?:Eval|Internal|Range|Reference|Syntax|Type|URI|)Error): )?(.*)$/;function C(){return"undefined"==typeof document||null==document.location?"":document.location.href}w.report=function(){var e,t,r=[],n=null,o=null,i=null;function a(e,t){var n=null;if(!t||w.collectWindowErrors){for(var o in r)if(r.hasOwnProperty(o))try{r[o].apply(null,[e].concat(k.call(arguments,2)))}catch(e){n=e}if(n)throw n}}function s(t,r,n,o,s){var l=E.isErrorEvent(s)?s.error:s,u=E.isErrorEvent(t)?t.message:t;if(i)w.computeStackTrace.augmentStackTraceWithInitialElement(i,r,n,u),c();else if(l&&E.isError(l))a(w.computeStackTrace(l),!0);else{var h,p={url:r,line:n,column:o},f=void 0;if("[object String]"==={}.toString.call(u))(h=u.match(O))&&(f=h[1],u=h[2]);p.func=S,a({name:f,message:u,url:C(),stack:[p]},!0)}return!!e&&e.apply(this,arguments)}function c(){var e=i,t=n;n=null,i=null,o=null,a.apply(null,[e,!1].concat(t))}function l(e,t){var r=k.call(arguments,1);if(i){if(o===e)return;c()}var a=w.computeStackTrace(e);if(i=a,o=e,n=r,setTimeout(function(){o===e&&c()},a.incomplete?2e3:0),!1!==t)throw e}return l.subscribe=function(n){t||(e=x.onerror,x.onerror=s,t=!0),r.push(n)},l.unsubscribe=function(e){for(var t=r.length-1;t>=0;--t)r[t]===e&&r.splice(t,1)},l.uninstall=function(){t&&(x.onerror=e,t=!1,e=void 0),r=[]},l}(),w.computeStackTrace=function(){function e(e){if(void 0!==e.stack&&e.stack){for(var t,r,n,o=/^\s*at (?:(.*?) ?\()?((?:file|https?|blob|chrome-extension|native|eval|webpack|<anonymous>|[a-z]:|\/).*?)(?::(\d+))?(?::(\d+))?\)?\s*$/i,i=/^\s*at (?:((?:\[object object\])?.+) )?\(?((?:file|ms-appx(?:-web)|https?|webpack|blob):.*?):(\d+)(?::(\d+))?\)?\s*$/i,a=/^\s*(.*?)(?:\((.*?)\))?(?:^|@)((?:file|https?|blob|chrome|webpack|resource|moz-extension).*?:\/.*?|\[native code\]|[^@]*bundle)(?::(\d+))?(?::(\d+))?\s*$/i,s=/(\S+) line (\d+)(?: > eval line \d+)* > eval/i,c=/\((\S*)(?::(\d+))(?::(\d+))\)/,l=e.stack.split("\n"),u=[],h=(/^(.*) is undefined$/.exec(e.message),0),p=l.length;h<p;++h){if(r=o.exec(l[h])){var f=r[2]&&0===r[2].indexOf("native");r[2]&&0===r[2].indexOf("eval")&&(t=c.exec(r[2]))&&(r[2]=t[1],r[3]=t[2],r[4]=t[3]),n={url:f?null:r[2],func:r[1]||S,args:f?[r[2]]:[],line:r[3]?+r[3]:null,column:r[4]?+r[4]:null}}else if(r=i.exec(l[h]))n={url:r[2],func:r[1]||S,args:[],line:+r[3],column:r[4]?+r[4]:null};else{if(!(r=a.exec(l[h])))continue;r[3]&&r[3].indexOf(" > eval")>-1&&(t=s.exec(r[3]))?(r[3]=t[1],r[4]=t[2],r[5]=null):0!==h||r[5]||void 0===e.columnNumber||(u[0].column=e.columnNumber+1),n={url:r[3],func:r[1]||S,args:r[2]?r[2].split(","):[],line:r[4]?+r[4]:null,column:r[5]?+r[5]:null}}if(!n.func&&n.line&&(n.func=S),n.url&&"blob:"===n.url.substr(0,5)){var d=new XMLHttpRequest;if(d.open("GET",n.url,!1),d.send(null),200===d.status){var g=d.responseText||"",m=(g=g.slice(-300)).match(/\/\/# sourceMappingURL=(.*)$/);if(m){var _=m[1];"~"===_.charAt(0)&&(_=("undefined"==typeof document||null==document.location?"":document.location.origin?document.location.origin:document.location.protocol+"//"+document.location.hostname+(document.location.port?":"+document.location.port:""))+_.slice(1)),n.url=_.slice(0,-4)}}}u.push(n)}return u.length?{name:e.name,message:e.message,url:C(),stack:u}:null}}function t(e,t,r,n){var o={url:t,line:r};if(o.url&&o.line){if(e.incomplete=!1,o.func||(o.func=S),e.stack.length>0&&e.stack[0].url===o.url){if(e.stack[0].line===o.line)return!1;if(!e.stack[0].line&&e.stack[0].func===o.func)return e.stack[0].line=o.line,!1}return e.stack.unshift(o),e.partial=!0,!0}return e.incomplete=!0,!1}function r(e,o){for(var i,a,s=/function\s+([_$a-zA-Z\xA0-\uFFFF][_$a-zA-Z0-9\xA0-\uFFFF]*)?\s*\(/i,c=[],l={},u=!1,h=r.caller;h&&!u;h=h.caller)if(h!==n&&h!==w.report){if(a={url:null,func:S,line:null,column:null},h.name?a.func=h.name:(i=s.exec(h.toString()))&&(a.func=i[1]),void 0===a.func)try{a.func=i.input.substring(0,i.input.indexOf("{"))}catch(e){}l[""+h]?u=!0:l[""+h]=!0,c.push(a)}o&&c.splice(0,o);var p={name:e.name,message:e.message,url:C(),stack:c};return t(p,e.sourceURL||e.fileName,e.line||e.lineNumber,e.message||e.description),p}function n(t,n){var o=null;n=null==n?0:+n;try{if(o=e(t))return o}catch(e){if(w.debug)throw e}try{if(o=r(t,n+1))return o}catch(e){if(w.debug)throw e}return{name:t.name,message:t.message,url:C()}}return n.augmentStackTraceWithInitialElement=t,n.computeStackTraceFromStackProp=e,n}();var j=w;function R(e,t){var r=(65535&e)+(65535&t);return(e>>16)+(t>>16)+(r>>16)<<16|65535&r}function T(e,t,r,n,o,i){return R((a=R(R(t,e),R(n,i)))<<(s=o)|a>>>32-s,r);var a,s}function F(e,t,r,n,o,i,a){return T(t&r|~t&n,e,t,o,i,a)}function D(e,t,r,n,o,i,a){return T(t&n|r&~n,e,t,o,i,a)}function A(e,t,r,n,o,i,a){return T(t^r^n,e,t,o,i,a)}function B(e,t,r,n,o,i,a){return T(r^(t|~n),e,t,o,i,a)}function M(e,t){var r,n,o,i,a;e[t>>5]|=128<<t%32,e[14+(t+64>>>9<<4)]=t;var s=1732584193,c=-271733879,l=-1732584194,u=271733878;for(r=0;r<e.length;r+=16)n=s,o=c,i=l,a=u,s=F(s,c,l,u,e[r],7,-680876936),u=F(u,s,c,l,e[r+1],12,-389564586),l=F(l,u,s,c,e[r+2],17,606105819),c=F(c,l,u,s,e[r+3],22,-1044525330),s=F(s,c,l,u,e[r+4],7,-176418897),u=F(u,s,c,l,e[r+5],12,1200080426),l=F(l,u,s,c,e[r+6],17,-1473231341),c=F(c,l,u,s,e[r+7],22,-45705983),s=F(s,c,l,u,e[r+8],7,1770035416),u=F(u,s,c,l,e[r+9],12,-1958414417),l=F(l,u,s,c,e[r+10],17,-42063),c=F(c,l,u,s,e[r+11],22,-1990404162),s=F(s,c,l,u,e[r+12],7,1804603682),u=F(u,s,c,l,e[r+13],12,-40341101),l=F(l,u,s,c,e[r+14],17,-1502002290),s=D(s,c=F(c,l,u,s,e[r+15],22,1236535329),l,u,e[r+1],5,-165796510),u=D(u,s,c,l,e[r+6],9,-1069501632),l=D(l,u,s,c,e[r+11],14,643717713),c=D(c,l,u,s,e[r],20,-373897302),s=D(s,c,l,u,e[r+5],5,-701558691),u=D(u,s,c,l,e[r+10],9,38016083),l=D(l,u,s,c,e[r+15],14,-660478335),c=D(c,l,u,s,e[r+4],20,-405537848),s=D(s,c,l,u,e[r+9],5,568446438),u=D(u,s,c,l,e[r+14],9,-1019803690),l=D(l,u,s,c,e[r+3],14,-187363961),c=D(c,l,u,s,e[r+8],20,1163531501),s=D(s,c,l,u,e[r+13],5,-1444681467),u=D(u,s,c,l,e[r+2],9,-51403784),l=D(l,u,s,c,e[r+7],14,1735328473),s=A(s,c=D(c,l,u,s,e[r+12],20,-1926607734),l,u,e[r+5],4,-378558),u=A(u,s,c,l,e[r+8],11,-2022574463),l=A(l,u,s,c,e[r+11],16,1839030562),c=A(c,l,u,s,e[r+14],23,-35309556),s=A(s,c,l,u,e[r+1],4,-1530992060),u=A(u,s,c,l,e[r+4],11,1272893353),l=A(l,u,s,c,e[r+7],16,-155497632),c=A(c,l,u,s,e[r+10],23,-1094730640),s=A(s,c,l,u,e[r+13],4,681279174),u=A(u,s,c,l,e[r],11,-358537222),l=A(l,u,s,c,e[r+3],16,-722521979),c=A(c,l,u,s,e[r+6],23,76029189),s=A(s,c,l,u,e[r+9],4,-640364487),u=A(u,s,c,l,e[r+12],11,-421815835),l=A(l,u,s,c,e[r+15],16,530742520),s=B(s,c=A(c,l,u,s,e[r+2],23,-995338651),l,u,e[r],6,-198630844),u=B(u,s,c,l,e[r+7],10,1126891415),l=B(l,u,s,c,e[r+14],15,-1416354905),c=B(c,l,u,s,e[r+5],21,-57434055),s=B(s,c,l,u,e[r+12],6,1700485571),u=B(u,s,c,l,e[r+3],10,-1894986606),l=B(l,u,s,c,e[r+10],15,-1051523),c=B(c,l,u,s,e[r+1],21,-2054922799),s=B(s,c,l,u,e[r+8],6,1873313359),u=B(u,s,c,l,e[r+15],10,-30611744),l=B(l,u,s,c,e[r+6],15,-1560198380),c=B(c,l,u,s,e[r+13],21,1309151649),s=B(s,c,l,u,e[r+4],6,-145523070),u=B(u,s,c,l,e[r+11],10,-1120210379),l=B(l,u,s,c,e[r+2],15,718787259),c=B(c,l,u,s,e[r+9],21,-343485551),s=R(s,n),c=R(c,o),l=R(l,i),u=R(u,a);return[s,c,l,u]}function L(e){var t,r="",n=32*e.length;for(t=0;t<n;t+=8)r+=String.fromCharCode(e[t>>5]>>>t%32&255);return r}function H(e){var t,r=[];for(r[(e.length>>2)-1]=void 0,t=0;t<r.length;t+=1)r[t]=0;var n=8*e.length;for(t=0;t<n;t+=8)r[t>>5]|=(255&e.charCodeAt(t/8))<<t%32;return r}function I(e){var t,r,n="";for(r=0;r<e.length;r+=1)t=e.charCodeAt(r),n+="0123456789abcdef".charAt(t>>>4&15)+"0123456789abcdef".charAt(15&t);return n}function P(e){return unescape(encodeURIComponent(e))}function U(e){return function(e){return L(M(H(e),8*e.length))}(P(e))}function N(e,t){return function(e,t){var r,n,o=H(e),i=[],a=[];for(i[15]=a[15]=void 0,o.length>16&&(o=M(o,8*e.length)),r=0;r<16;r+=1)i[r]=909522486^o[r],a[r]=1549556828^o[r];return n=M(i.concat(H(t)),512+8*t.length),L(M(a.concat(n),640))}(P(e),P(t))}var q=function(e,t,r){return t?r?N(t,e):I(N(t,e)):r?U(e):I(U(e))};function z(e){this.name="RavenConfigError",this.message=e}z.prototype=new Error,z.prototype.constructor=z;var K=z,W=function(e,t,r){var n=e[t],o=e;if(t in e){var i="warn"===t?"warning":t;e[t]=function(){var e=[].slice.call(arguments),a=E.safeJoin(e," "),s={level:i,logger:"console",extra:{arguments:e}};"assert"===t?!1===e[0]&&(a="Assertion failed: "+(E.safeJoin(e.slice(1)," ")||"console.assert"),s.extra.arguments=e.slice(1),r&&r(a,s)):r&&r(a,s),n&&Function.prototype.apply.call(n,o,e)}}},V=E.isErrorEvent,$=E.isDOMError,X=E.isDOMException,J=E.isError,G=E.isObject,Y=E.isPlainObject,Z=E.isUndefined,Q=E.isFunction,ee=E.isString,te=E.isArray,re=E.isEmptyObject,ne=E.each,oe=E.objectMerge,ie=E.truncate,ae=E.objectFrozen,se=E.hasKey,ce=E.joinRegExp,le=E.urlencode,ue=E.uuid4,he=E.htmlTreeAsString,pe=E.isSameException,fe=E.isSameStacktrace,de=E.parseUrl,ge=E.fill,me=E.supportsFetch,_e=E.supportsReferrerPolicy,ve=E.serializeKeysForMessage,be=E.serializeException,ye=E.sanitize,Ee=W,we="source protocol user pass host port path".split(" "),xe=/^(?:(\w+):)?\/\/(?:(\w+)(:\w+)?@)?([\w\.-]+)(?::(\d+))?(\/.*)/;function ke(){return+new Date}var Se="undefined"!=typeof window?window:void 0!==e?e:"undefined"!=typeof self?self:{},Oe=Se.document,Ce=Se.navigator;function je(e,t){return Q(t)?function(r){return t(r,e)}:t}function Re(){for(var e in this._hasJSON=!("object"!=typeof JSON||!JSON.stringify),this._hasDocument=!Z(Oe),this._hasNavigator=!Z(Ce),this._lastCapturedException=null,this._lastData=null,this._lastEventId=null,this._globalServer=null,this._globalKey=null,this._globalProject=null,this._globalContext={},this._globalOptions={release:Se.SENTRY_RELEASE&&Se.SENTRY_RELEASE.id,logger:"javascript",ignoreErrors:[],ignoreUrls:[],whitelistUrls:[],includePaths:[],headers:null,collectWindowErrors:!0,captureUnhandledRejections:!0,maxMessageLength:0,maxUrlLength:250,stackTraceLimit:50,autoBreadcrumbs:!0,instrument:!0,sampleRate:1,sanitizeKeys:[]},this._fetchDefaults={method:"POST",referrerPolicy:_e()?"origin":""},this._ignoreOnError=0,this._isRavenInstalled=!1,this._originalErrorStackTraceLimit=Error.stackTraceLimit,this._originalConsole=Se.console||{},this._originalConsoleMethods={},this._plugins=[],this._startTime=ke(),this._wrappedBuiltIns=[],this._breadcrumbs=[],this._lastCapturedEvent=null,this._keypressTimeout,this._location=Se.location,this._lastHref=this._location&&this._location.href,this._resetBackoff(),this._originalConsole)this._originalConsoleMethods[e]=this._originalConsole[e]}Re.prototype={VERSION:"3.27.0",debug:!1,TraceKit:j,config:function(e,t){var r=this;if(r._globalServer)return this._logDebug("error","Error: Raven has already been configured"),r;if(!e)return r;var n=r._globalOptions;t&&ne(t,function(e,t){"tags"===e||"extra"===e||"user"===e?r._globalContext[e]=t:n[e]=t}),r.setDSN(e),n.ignoreErrors.push(/^Script error\.?$/),n.ignoreErrors.push(/^Javascript error: Script error\.? on line 0$/),n.ignoreErrors=ce(n.ignoreErrors),n.ignoreUrls=!!n.ignoreUrls.length&&ce(n.ignoreUrls),n.whitelistUrls=!!n.whitelistUrls.length&&ce(n.whitelistUrls),n.includePaths=ce(n.includePaths),n.maxBreadcrumbs=Math.max(0,Math.min(n.maxBreadcrumbs||100,100));var o={xhr:!0,console:!0,dom:!0,location:!0,sentry:!0},i=n.autoBreadcrumbs;"[object Object]"==={}.toString.call(i)?i=oe(o,i):!1!==i&&(i=o),n.autoBreadcrumbs=i;var a={tryCatch:!0},s=n.instrument;return"[object Object]"==={}.toString.call(s)?s=oe(a,s):!1!==s&&(s=a),n.instrument=s,j.collectWindowErrors=!!n.collectWindowErrors,r},install:function(){var e=this;return e.isSetup()&&!e._isRavenInstalled&&(j.report.subscribe(function(){e._handleOnErrorStackInfo.apply(e,arguments)}),e._globalOptions.captureUnhandledRejections&&e._attachPromiseRejectionHandler(),e._patchFunctionToString(),e._globalOptions.instrument&&e._globalOptions.instrument.tryCatch&&e._instrumentTryCatch(),e._globalOptions.autoBreadcrumbs&&e._instrumentBreadcrumbs(),e._drainPlugins(),e._isRavenInstalled=!0),Error.stackTraceLimit=e._globalOptions.stackTraceLimit,this},setDSN:function(e){var t=this._parseDSN(e),r=t.path.lastIndexOf("/"),n=t.path.substr(1,r);this._dsn=e,this._globalKey=t.user,this._globalSecret=t.pass&&t.pass.substr(1),this._globalProject=t.path.substr(r+1),this._globalServer=this._getGlobalServer(t),this._globalEndpoint=this._globalServer+"/"+n+"api/"+this._globalProject+"/store/",this._resetBackoff()},context:function(e,t,r){return Q(e)&&(r=t||[],t=e,e={}),this.wrap(e,t).apply(this,r)},wrap:function(e,t,r){var n=this;if(Z(t)&&!Q(e))return e;if(Q(e)&&(t=e,e=void 0),!Q(t))return t;try{if(t.__raven__)return t;if(t.__raven_wrapper__)return t.__raven_wrapper__}catch(e){return t}function o(){var o=[],i=arguments.length,a=!e||e&&!1!==e.deep;for(r&&Q(r)&&r.apply(this,arguments);i--;)o[i]=a?n.wrap(e,arguments[i]):arguments[i];try{return t.apply(this,o)}catch(t){throw n._ignoreNextOnError(),n.captureException(t,e),t}}for(var i in t)se(t,i)&&(o[i]=t[i]);return o.prototype=t.prototype,t.__raven_wrapper__=o,o.__raven__=!0,o.__orig__=t,o},uninstall:function(){return j.report.uninstall(),this._detachPromiseRejectionHandler(),this._unpatchFunctionToString(),this._restoreBuiltIns(),this._restoreConsole(),Error.stackTraceLimit=this._originalErrorStackTraceLimit,this._isRavenInstalled=!1,this},_promiseRejectionHandler:function(e){this._logDebug("debug","Raven caught unhandled promise rejection:",e),this.captureException(e.reason,{mechanism:{type:"onunhandledrejection",handled:!1}})},_attachPromiseRejectionHandler:function(){return this._promiseRejectionHandler=this._promiseRejectionHandler.bind(this),Se.addEventListener&&Se.addEventListener("unhandledrejection",this._promiseRejectionHandler),this},_detachPromiseRejectionHandler:function(){return Se.removeEventListener&&Se.removeEventListener("unhandledrejection",this._promiseRejectionHandler),this},captureException:function(e,t){if(t=oe({trimHeadFrames:0},t||{}),V(e)&&e.error)e=e.error;else{if($(e)||X(e)){var r=e.name||($(e)?"DOMError":"DOMException"),n=e.message?r+": "+e.message:r;return this.captureMessage(n,oe(t,{stacktrace:!0,trimHeadFrames:t.trimHeadFrames+1}))}if(J(e))e=e;else{if(!Y(e))return this.captureMessage(e,oe(t,{stacktrace:!0,trimHeadFrames:t.trimHeadFrames+1}));t=this._getCaptureExceptionOptionsFromPlainObject(t,e),e=new Error(t.message)}}this._lastCapturedException=e;try{var o=j.computeStackTrace(e);this._handleStackInfo(o,t)}catch(t){if(e!==t)throw t}return this},_getCaptureExceptionOptionsFromPlainObject:function(e,t){var r=Object.keys(t).sort(),n=oe(e,{message:"Non-Error exception captured with keys: "+ve(r),fingerprint:[q(r)],extra:e.extra||{}});return n.extra.__serialized__=be(t),n},captureMessage:function(e,t){if(!this._globalOptions.ignoreErrors.test||!this._globalOptions.ignoreErrors.test(e)){var r,n=oe({message:e+=""},t=t||{});try{throw new Error(e)}catch(e){r=e}r.name=null;var o=j.computeStackTrace(r),i=te(o.stack)&&o.stack[1];i&&"Raven.captureException"===i.func&&(i=o.stack[2]);var a=i&&i.url||"";if((!this._globalOptions.ignoreUrls.test||!this._globalOptions.ignoreUrls.test(a))&&(!this._globalOptions.whitelistUrls.test||this._globalOptions.whitelistUrls.test(a))){if(this._globalOptions.stacktrace||t.stacktrace||""===n.message){n.fingerprint=null==n.fingerprint?e:n.fingerprint,(t=oe({trimHeadFrames:0},t)).trimHeadFrames+=1;var s=this._prepareFrames(o,t);n.stacktrace={frames:s.reverse()}}return n.fingerprint&&(n.fingerprint=te(n.fingerprint)?n.fingerprint:[n.fingerprint]),this._send(n),this}}},captureBreadcrumb:function(e){var t=oe({timestamp:ke()/1e3},e);if(Q(this._globalOptions.breadcrumbCallback)){var r=this._globalOptions.breadcrumbCallback(t);if(G(r)&&!re(r))t=r;else if(!1===r)return this}return this._breadcrumbs.push(t),this._breadcrumbs.length>this._globalOptions.maxBreadcrumbs&&this._breadcrumbs.shift(),this},addPlugin:function(e){var t=[].slice.call(arguments,1);return this._plugins.push([e,t]),this._isRavenInstalled&&this._drainPlugins(),this},setUserContext:function(e){return this._globalContext.user=e,this},setExtraContext:function(e){return this._mergeContext("extra",e),this},setTagsContext:function(e){return this._mergeContext("tags",e),this},clearContext:function(){return this._globalContext={},this},getContext:function(){return JSON.parse(r(this._globalContext))},setEnvironment:function(e){return this._globalOptions.environment=e,this},setRelease:function(e){return this._globalOptions.release=e,this},setDataCallback:function(e){var t=this._globalOptions.dataCallback;return this._globalOptions.dataCallback=je(t,e),this},setBreadcrumbCallback:function(e){var t=this._globalOptions.breadcrumbCallback;return this._globalOptions.breadcrumbCallback=je(t,e),this},setShouldSendCallback:function(e){var t=this._globalOptions.shouldSendCallback;return this._globalOptions.shouldSendCallback=je(t,e),this},setTransport:function(e){return this._globalOptions.transport=e,this},lastException:function(){return this._lastCapturedException},lastEventId:function(){return this._lastEventId},isSetup:function(){return!!this._hasJSON&&(!!this._globalServer||(this.ravenNotConfiguredError||(this.ravenNotConfiguredError=!0,this._logDebug("error","Error: Raven has not been configured.")),!1))},afterLoad:function(){var e=Se.RavenConfig;e&&this.config(e.dsn,e.config).install()},showReportDialog:function(e){if(Oe){if(!(e=oe({eventId:this.lastEventId(),dsn:this._dsn,user:this._globalContext.user||{}},e)).eventId)throw new K("Missing eventId");if(!e.dsn)throw new K("Missing DSN");var t=encodeURIComponent,r=[];for(var n in e)if("user"===n){var o=e.user;o.name&&r.push("name="+t(o.name)),o.email&&r.push("email="+t(o.email))}else r.push(t(n)+"="+t(e[n]));var i=this._getGlobalServer(this._parseDSN(e.dsn)),a=Oe.createElement("script");a.async=!0,a.src=i+"/api/embed/error-page/?"+r.join("&"),(Oe.head||Oe.body).appendChild(a)}},_ignoreNextOnError:function(){var e=this;this._ignoreOnError+=1,setTimeout(function(){e._ignoreOnError-=1})},_triggerEvent:function(e,t){var r,n;if(this._hasDocument){for(n in t=t||{},e="raven"+e.substr(0,1).toUpperCase()+e.substr(1),Oe.createEvent?(r=Oe.createEvent("HTMLEvents")).initEvent(e,!0,!0):(r=Oe.createEventObject()).eventType=e,t)se(t,n)&&(r[n]=t[n]);if(Oe.createEvent)Oe.dispatchEvent(r);else try{Oe.fireEvent("on"+r.eventType.toLowerCase(),r)}catch(e){}}},_breadcrumbEventHandler:function(e){var t=this;return function(r){if(t._keypressTimeout=null,t._lastCapturedEvent!==r){var n;t._lastCapturedEvent=r;try{n=he(r.target)}catch(e){n="<unknown>"}t.captureBreadcrumb({category:"ui."+e,message:n})}}},_keypressEventHandler:function(){var e=this;return function(t){var r;try{r=t.target}catch(e){return}var n=r&&r.tagName;if(n&&("INPUT"===n||"TEXTAREA"===n||r.isContentEditable)){var o=e._keypressTimeout;o||e._breadcrumbEventHandler("input")(t),clearTimeout(o),e._keypressTimeout=setTimeout(function(){e._keypressTimeout=null},1e3)}}},_captureUrlChange:function(e,t){var r=de(this._location.href),n=de(t),o=de(e);this._lastHref=t,r.protocol===n.protocol&&r.host===n.host&&(t=n.relative),r.protocol===o.protocol&&r.host===o.host&&(e=o.relative),this.captureBreadcrumb({category:"navigation",data:{to:t,from:e}})},_patchFunctionToString:function(){var e=this;e._originalFunctionToString=Function.prototype.toString,Function.prototype.toString=function(){return"function"==typeof this&&this.__raven__?e._originalFunctionToString.apply(this.__orig__,arguments):e._originalFunctionToString.apply(this,arguments)}},_unpatchFunctionToString:function(){this._originalFunctionToString&&(Function.prototype.toString=this._originalFunctionToString)},_instrumentTryCatch:function(){var e=this,t=e._wrappedBuiltIns;function r(t){return function(r,n){for(var o=new Array(arguments.length),i=0;i<o.length;++i)o[i]=arguments[i];var a=o[0];return Q(a)&&(o[0]=e.wrap({mechanism:{type:"instrument",data:{function:t.name||"<anonymous>"}}},a)),t.apply?t.apply(this,o):t(o[0],o[1])}}var n=this._globalOptions.autoBreadcrumbs;function o(r){var o=Se[r]&&Se[r].prototype;o&&o.hasOwnProperty&&o.hasOwnProperty("addEventListener")&&(ge(o,"addEventListener",function(t){return function(o,i,a,s){try{i&&i.handleEvent&&(i.handleEvent=e.wrap({mechanism:{type:"instrument",data:{target:r,function:"handleEvent",handler:i&&i.name||"<anonymous>"}}},i.handleEvent))}catch(e){}var c,l,u;return n&&n.dom&&("EventTarget"===r||"Node"===r)&&(l=e._breadcrumbEventHandler("click"),u=e._keypressEventHandler(),c=function(e){if(e){var t;try{t=e.type}catch(e){return}return"click"===t?l(e):"keypress"===t?u(e):void 0}}),t.call(this,o,e.wrap({mechanism:{type:"instrument",data:{target:r,function:"addEventListener",handler:i&&i.name||"<anonymous>"}}},i,c),a,s)}},t),ge(o,"removeEventListener",function(e){return function(t,r,n,o){try{r=r&&(r.__raven_wrapper__?r.__raven_wrapper__:r)}catch(e){}return e.call(this,t,r,n,o)}},t))}ge(Se,"setTimeout",r,t),ge(Se,"setInterval",r,t),Se.requestAnimationFrame&&ge(Se,"requestAnimationFrame",function(t){return function(r){return t(e.wrap({mechanism:{type:"instrument",data:{function:"requestAnimationFrame",handler:t&&t.name||"<anonymous>"}}},r))}},t);for(var i=["EventTarget","Window","Node","ApplicationCache","AudioTrackList","ChannelMergerNode","CryptoOperation","EventSource","FileReader","HTMLUnknownElement","IDBDatabase","IDBRequest","IDBTransaction","KeyOperation","MediaController","MessagePort","ModalWindow","Notification","SVGElementInstance","Screen","TextTrack","TextTrackCue","TextTrackList","WebSocket","WebSocketWorker","Worker","XMLHttpRequest","XMLHttpRequestEventTarget","XMLHttpRequestUpload"],a=0;a<i.length;a++)o(i[a])},_instrumentBreadcrumbs:function(){var e=this,t=this._globalOptions.autoBreadcrumbs,r=e._wrappedBuiltIns;function n(t,r){t in r&&Q(r[t])&&ge(r,t,function(r){return e.wrap({mechanism:{type:"instrument",data:{function:t,handler:r&&r.name||"<anonymous>"}}},r)})}if(t.xhr&&"XMLHttpRequest"in Se){var o=Se.XMLHttpRequest&&Se.XMLHttpRequest.prototype;ge(o,"open",function(t){return function(r,n){return ee(n)&&-1===n.indexOf(e._globalKey)&&(this.__raven_xhr={method:r,url:n,status_code:null}),t.apply(this,arguments)}},r),ge(o,"send",function(t){return function(){var r=this;function o(){if(r.__raven_xhr&&4===r.readyState){try{r.__raven_xhr.status_code=r.status}catch(e){}e.captureBreadcrumb({type:"http",category:"xhr",data:r.__raven_xhr})}}for(var i=["onload","onerror","onprogress"],a=0;a<i.length;a++)n(i[a],r);return"onreadystatechange"in r&&Q(r.onreadystatechange)?ge(r,"onreadystatechange",function(t){return e.wrap({mechanism:{type:"instrument",data:{function:"onreadystatechange",handler:t&&t.name||"<anonymous>"}}},t,o)}):r.onreadystatechange=o,t.apply(this,arguments)}},r)}t.xhr&&me()&&ge(Se,"fetch",function(t){return function(){for(var r=new Array(arguments.length),n=0;n<r.length;++n)r[n]=arguments[n];var o,i=r[0],a="GET";if("string"==typeof i?o=i:"Request"in Se&&i instanceof Se.Request?(o=i.url,i.method&&(a=i.method)):o=""+i,-1!==o.indexOf(e._globalKey))return t.apply(this,r);r[1]&&r[1].method&&(a=r[1].method);var s={method:a,url:o,status_code:null};return t.apply(this,r).then(function(t){return s.status_code=t.status,e.captureBreadcrumb({type:"http",category:"fetch",data:s}),t}).catch(function(t){throw e.captureBreadcrumb({type:"http",category:"fetch",data:s,level:"error"}),t})}},r),t.dom&&this._hasDocument&&(Oe.addEventListener?(Oe.addEventListener("click",e._breadcrumbEventHandler("click"),!1),Oe.addEventListener("keypress",e._keypressEventHandler(),!1)):Oe.attachEvent&&(Oe.attachEvent("onclick",e._breadcrumbEventHandler("click")),Oe.attachEvent("onkeypress",e._keypressEventHandler())));var i=Se.chrome,a=!(i&&i.app&&i.app.runtime)&&Se.history&&Se.history.pushState&&Se.history.replaceState;if(t.location&&a){var s=Se.onpopstate;Se.onpopstate=function(){var t=e._location.href;if(e._captureUrlChange(e._lastHref,t),s)return s.apply(this,arguments)};var c=function(t){return function(){var r=arguments.length>2?arguments[2]:void 0;return r&&e._captureUrlChange(e._lastHref,r+""),t.apply(this,arguments)}};ge(Se.history,"pushState",c,r),ge(Se.history,"replaceState",c,r)}if(t.console&&"console"in Se&&console.log){var l=function(t,r){e.captureBreadcrumb({message:t,level:r.level,category:"console"})};ne(["debug","info","warn","error","log"],function(e,t){Ee(console,t,l)})}},_restoreBuiltIns:function(){for(var e;this._wrappedBuiltIns.length;){var t=(e=this._wrappedBuiltIns.shift())[0],r=e[1],n=e[2];t[r]=n}},_restoreConsole:function(){for(var e in this._originalConsoleMethods)this._originalConsole[e]=this._originalConsoleMethods[e]},_drainPlugins:function(){var e=this;ne(this._plugins,function(t,r){var n=r[0],o=r[1];n.apply(e,[e].concat(o))})},_parseDSN:function(e){var t=xe.exec(e),r={},n=7;try{for(;n--;)r[we[n]]=t[n]||""}catch(t){throw new K("Invalid DSN: "+e)}if(r.pass&&!this._globalOptions.allowSecretKey)throw new K("Do not specify your secret key in the DSN. See: http://bit.ly/raven-secret-key");return r},_getGlobalServer:function(e){var t="//"+e.host+(e.port?":"+e.port:"");return e.protocol&&(t=e.protocol+":"+t),t},_handleOnErrorStackInfo:function(e,t){(t=t||{}).mechanism=t.mechanism||{type:"onerror",handled:!1},this._ignoreOnError||this._handleStackInfo(e,t)},_handleStackInfo:function(e,t){var r=this._prepareFrames(e,t);this._triggerEvent("handle",{stackInfo:e,options:t}),this._processException(e.name,e.message,e.url,e.lineno,r,t)},_prepareFrames:function(e,t){var r=this,n=[];if(e.stack&&e.stack.length&&(ne(e.stack,function(t,o){var i=r._normalizeFrame(o,e.url);i&&n.push(i)}),t&&t.trimHeadFrames))for(var o=0;o<t.trimHeadFrames&&o<n.length;o++)n[o].in_app=!1;return n=n.slice(0,this._globalOptions.stackTraceLimit)},_normalizeFrame:function(e,t){var r={filename:e.url,lineno:e.line,colno:e.column,function:e.func||"?"};return e.url||(r.filename=t),r.in_app=!(this._globalOptions.includePaths.test&&!this._globalOptions.includePaths.test(r.filename)||/(Raven|TraceKit)\./.test(r.function)||/raven\.(min\.)?js$/.test(r.filename)),r},_processException:function(e,t,r,n,o,i){var a,s=(e?e+": ":"")+(t||"");if((!this._globalOptions.ignoreErrors.test||!this._globalOptions.ignoreErrors.test(t)&&!this._globalOptions.ignoreErrors.test(s))&&(o&&o.length?(r=o[0].filename||r,o.reverse(),a={frames:o}):r&&(a={frames:[{filename:r,lineno:n,in_app:!0}]}),(!this._globalOptions.ignoreUrls.test||!this._globalOptions.ignoreUrls.test(r))&&(!this._globalOptions.whitelistUrls.test||this._globalOptions.whitelistUrls.test(r)))){var c=oe({exception:{values:[{type:e,value:t,stacktrace:a}]},transaction:r},i),l=c.exception.values[0];null==l.type&&""===l.value&&(l.value="Unrecoverable error caught"),!c.exception.mechanism&&c.mechanism&&(c.exception.mechanism=c.mechanism,delete c.mechanism),c.exception.mechanism=oe({type:"generic",handled:!0},c.exception.mechanism||{}),this._send(c)}},_trimPacket:function(e){var t=this._globalOptions.maxMessageLength;if(e.message&&(e.message=ie(e.message,t)),e.exception){var r=e.exception.values[0];r.value=ie(r.value,t)}var n=e.request;return n&&(n.url&&(n.url=ie(n.url,this._globalOptions.maxUrlLength)),n.Referer&&(n.Referer=ie(n.Referer,this._globalOptions.maxUrlLength))),e.breadcrumbs&&e.breadcrumbs.values&&this._trimBreadcrumbs(e.breadcrumbs),e},_trimBreadcrumbs:function(e){for(var t,r,n,o=["to","from","url"],i=0;i<e.values.length;++i)if((r=e.values[i]).hasOwnProperty("data")&&G(r.data)&&!ae(r.data)){n=oe({},r.data);for(var a=0;a<o.length;++a)t=o[a],n.hasOwnProperty(t)&&n[t]&&(n[t]=ie(n[t],this._globalOptions.maxUrlLength));e.values[i].data=n}},_getHttpData:function(){if(this._hasNavigator||this._hasDocument){var e={};return this._hasNavigator&&Ce.userAgent&&(e.headers={"User-Agent":Ce.userAgent}),Se.location&&Se.location.href&&(e.url=Se.location.href),this._hasDocument&&Oe.referrer&&(e.headers||(e.headers={}),e.headers.Referer=Oe.referrer),e}},_resetBackoff:function(){this._backoffDuration=0,this._backoffStart=null},_shouldBackoff:function(){return this._backoffDuration&&ke()-this._backoffStart<this._backoffDuration},_isRepeatData:function(e){var t=this._lastData;return!(!t||e.message!==t.message||e.transaction!==t.transaction)&&(e.stacktrace||t.stacktrace?fe(e.stacktrace,t.stacktrace):!e.exception&&!t.exception||pe(e.exception,t.exception))},_setBackoffState:function(e){if(!this._shouldBackoff()){var t=e.status;if(400===t||401===t||429===t){var r;try{r=me()?e.headers.get("Retry-After"):e.getResponseHeader("Retry-After"),r=1e3*parseInt(r,10)}catch(e){}this._backoffDuration=r||(2*this._backoffDuration||1e3),this._backoffStart=ke()}}},_send:function(e){var t=this._globalOptions,r={project:this._globalProject,logger:t.logger,platform:"javascript"},n=this._getHttpData();n&&(r.request=n),e.trimHeadFrames&&delete e.trimHeadFrames,(e=oe(r,e)).tags=oe(oe({},this._globalContext.tags),e.tags),e.extra=oe(oe({},this._globalContext.extra),e.extra),e.extra["session:duration"]=ke()-this._startTime,this._breadcrumbs&&this._breadcrumbs.length>0&&(e.breadcrumbs={values:[].slice.call(this._breadcrumbs,0)}),this._globalContext.user&&(e.user=this._globalContext.user),t.environment&&(e.environment=t.environment),t.release&&(e.release=t.release),t.serverName&&(e.server_name=t.serverName),e=this._sanitizeData(e),Object.keys(e).forEach(function(t){(null==e[t]||""===e[t]||re(e[t]))&&delete e[t]}),Q(t.dataCallback)&&(e=t.dataCallback(e)||e),e&&!re(e)&&(Q(t.shouldSendCallback)&&!t.shouldSendCallback(e)||(this._shouldBackoff()?this._logDebug("warn","Raven dropped error due to backoff: ",e):"number"==typeof t.sampleRate?Math.random()<t.sampleRate&&this._sendProcessedPayload(e):this._sendProcessedPayload(e)))},_sanitizeData:function(e){return ye(e,this._globalOptions.sanitizeKeys)},_getUuid:function(){return ue()},_sendProcessedPayload:function(e,t){var r=this,n=this._globalOptions;if(this.isSetup())if(e=this._trimPacket(e),this._globalOptions.allowDuplicates||!this._isRepeatData(e)){this._lastEventId=e.event_id||(e.event_id=this._getUuid()),this._lastData=e,this._logDebug("debug","Raven about to send:",e);var o={sentry_version:"7",sentry_client:"raven-js/"+this.VERSION,sentry_key:this._globalKey};this._globalSecret&&(o.sentry_secret=this._globalSecret);var i=e.exception&&e.exception.values[0];this._globalOptions.autoBreadcrumbs&&this._globalOptions.autoBreadcrumbs.sentry&&this.captureBreadcrumb({category:"sentry",message:i?(i.type?i.type+": ":"")+i.value:e.message,event_id:e.event_id,level:e.level||"error"});var a=this._globalEndpoint;(n.transport||this._makeRequest).call(this,{url:a,auth:o,data:e,options:n,onSuccess:function(){r._resetBackoff(),r._triggerEvent("success",{data:e,src:a}),t&&t()},onError:function(n){r._logDebug("error","Raven transport failed to send: ",n),n.request&&r._setBackoffState(n.request),r._triggerEvent("failure",{data:e,src:a}),n=n||new Error("Raven send failed (no additional details provided)"),t&&t(n)}})}else this._logDebug("warn","Raven dropped repeat event: ",e)},_makeRequest:function(e){var t=e.url+"?"+le(e.auth),n=null,o={};if(e.options.headers&&(n=this._evaluateHash(e.options.headers)),e.options.fetchParameters&&(o=this._evaluateHash(e.options.fetchParameters)),me()){o.body=r(e.data);var i=oe({},this._fetchDefaults),a=oe(i,o);return n&&(a.headers=n),Se.fetch(t,a).then(function(t){if(t.ok)e.onSuccess&&e.onSuccess();else{var r=new Error("Sentry error code: "+t.status);r.request=t,e.onError&&e.onError(r)}}).catch(function(){e.onError&&e.onError(new Error("Sentry error code: network unavailable"))})}var s=Se.XMLHttpRequest&&new Se.XMLHttpRequest;s&&(("withCredentials"in s||"undefined"!=typeof XDomainRequest)&&("withCredentials"in s?s.onreadystatechange=function(){if(4===s.readyState)if(200===s.status)e.onSuccess&&e.onSuccess();else if(e.onError){var t=new Error("Sentry error code: "+s.status);t.request=s,e.onError(t)}}:(s=new XDomainRequest,t=t.replace(/^https?:/,""),e.onSuccess&&(s.onload=e.onSuccess),e.onError&&(s.onerror=function(){var t=new Error("Sentry error code: XDomainRequest");t.request=s,e.onError(t)})),s.open("POST",t),n&&ne(n,function(e,t){s.setRequestHeader(e,t)}),s.send(r(e.data))))},_evaluateHash:function(e){var t={};for(var r in e)if(e.hasOwnProperty(r)){var n=e[r];t[r]="function"==typeof n?n():n}return t},_logDebug:function(e){this._originalConsoleMethods[e]&&(this.debug||this._globalOptions.debug)&&Function.prototype.apply.call(this._originalConsoleMethods[e],this._originalConsole,[].slice.call(arguments,1))},_mergeContext:function(e,t){Z(t)?delete this._globalContext[e]:this._globalContext[e]=oe(this._globalContext[e]||{},t)}},Re.prototype.setUser=Re.prototype.setUserContext,Re.prototype.setReleaseContext=Re.prototype.setRelease;var Te=Re,Fe="undefined"!=typeof window?window:void 0!==e?e:"undefined"!=typeof self?self:{},De=Fe.Raven,Ae=new Te;Ae.noConflict=function(){return Fe.Raven=De,Ae},Ae.afterLoad();var Be,Me,Le,He,Ie,Pe,Ue,Ne,qe=Ae,ze=Te;qe.Client=ze,Ue=window.location.host,Ne={prod:"plyr.io"===Ue,dev:"dev.plyr.io"===Ue},document.addEventListener("DOMContentLoaded",function(){qe.context(function(){var e=document.getElementById("container");window.shr&&window.shr.setup({count:{classname:"button__count"}}),document.addEventListener("focusout",function(t){t.target.classList&&!e.contains(t.target)&&t.target.classList.remove("tab-focus")}),document.addEventListener("keydown",function(t){9===t.keyCode&&setTimeout(function(){var t=document.activeElement;t&&t.classList&&!e.contains(t)&&t.classList.add("tab-focus")},10)});var t=new Plyr("#player",{debug:!0,title:"View From A Blue Moon",iconUrl:"../dist/plyr.svg",keyboard:{global:!0},tooltips:{controls:!0},captions:{active:!0},keys:{google:"AIzaSyDrNwtN3nLH_8rjCmu5Wq3ZCm4MNAVdc0c"},ads:{enabled:Ne.prod||Ne.dev,publisherId:"918848828995742"}});window.player=t;var r=document.querySelectorAll("[data-source]"),n={video:"video",audio:"audio",youtube:"youtube",vimeo:"vimeo"},o=window.location.hash.replace("#",""),i=window.history&&window.history.pushState;function a(e,t,r){e&&e.classList[r?"add":"remove"](t)}function s(e,i){if(e in n&&(i||e!==o)&&(o.length||e!==n.video)){switch(e){case n.video:t.source={type:"video",title:"View From A Blue Moon",sources:[{src:"https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-576p.mp4",type:"video/mp4",size:576},{src:"https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-720p.mp4",type:"video/mp4",size:720},{src:"https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-1080p.mp4",type:"video/mp4",size:1080},{src:"https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-1440p.mp4",type:"video/mp4",size:1440}],poster:"https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.jpg",tracks:[{kind:"captions",label:"English",srclang:"en",src:"https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.en.vtt",default:!0},{kind:"captions",label:"French",srclang:"fr",src:"https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.fr.vtt"}]};break;case n.audio:t.source={type:"audio",title:"Kishi Bashi – “It All Began With A Burst”",sources:[{src:"https://cdn.plyr.io/static/demo/Kishi_Bashi_-_It_All_Began_With_a_Burst.mp3",type:"audio/mp3"},{src:"https://cdn.plyr.io/static/demo/Kishi_Bashi_-_It_All_Began_With_a_Burst.ogg",type:"audio/ogg"}]};break;case n.youtube:t.source={type:"video",sources:[{src:"https://youtube.com/watch?v=bTqVqk7FSmY",provider:"youtube"}]};break;case n.vimeo:t.source={type:"video",sources:[{src:"https://vimeo.com/76979871",provider:"vimeo"}]}}o=e,Array.from(r).forEach(function(e){return a(e.parentElement,"active",!1)}),a(document.querySelector('[data-source="'.concat(e,'"]')),"active",!0),Array.from(document.querySelectorAll(".plyr__cite")).forEach(function(e){e.setAttribute("hidden","")}),document.querySelector(".plyr__cite--".concat(e)).removeAttribute("hidden")}}if(Array.from(r).forEach(function(e){e.addEventListener("click",function(){var t=e.getAttribute("data-source");s(t),i&&window.history.pushState({type:t},"","#".concat(t))})}),window.addEventListener("popstate",function(e){e.state&&"type"in e.state&&s(e.state.type)}),i){var c=!o.length;c&&(o=n.video),o in n&&window.history.replaceState({type:o},"",c?"":"#".concat(o)),o!==n.video&&s(o,!0)}})}),Ne.prod&&qe.config("https://d4ad9866ad834437a4754e23937071e4@sentry.io/305555").install(),Ne.prod&&(Be=window,Me=document,Le="script",He="ga",Be.GoogleAnalyticsObject=He,Be.ga=Be.ga||function(){(Be.ga.q=Be.ga.q||[]).push(arguments)},Be.ga.l=1*new Date,Ie=Me.createElement(Le),Pe=Me.getElementsByTagName(Le)[0],Ie.async=1,Ie.src="https://www.google-analytics.com/analytics.js",Pe.parentNode.insertBefore(Ie,Pe),window.ga("create","UA-40881672-11","auto"),window.ga("send","pageview"))}(); -//# sourceMappingURL=demo.min.js.map diff --git a/demo/dist/demo.min.js.map b/demo/dist/demo.min.js.map deleted file mode 100644 index 59365114..00000000 --- a/demo/dist/demo.min.js.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"sources":["node_modules/raven-js/vendor/json-stringify-safe/stringify.js","node_modules/raven-js/src/utils.js","node_modules/raven-js/vendor/TraceKit/tracekit.js","node_modules/raven-js/vendor/md5/md5.js","node_modules/raven-js/src/configError.js","node_modules/raven-js/src/console.js","node_modules/raven-js/src/raven.js","node_modules/raven-js/src/singleton.js","demo/src/js/demo.js"],"names":["indexOf","haystack","needle","i","length","serializer","replacer","cycleReplacer","stack","keys","key","value","slice","join","thisPos","this","splice","push","Infinity","call","Error","err","message","name","Object","prototype","hasOwnProperty","stringifyError","module","exports","obj","spaces","JSON","stringify","getSerialize","_window","window","global","self","isUndefined","what","isPlainObject","toString","isString","isArray","supportsFetch","Headers","Request","Response","e","each","callback","j","hasKey","truncate","str","max","substr","object","joinRegExp","patterns","pattern","sources","len","replace","source","RegExp","htmlElementAsString","elem","className","classes","attr","out","tagName","toLowerCase","id","split","attrWhitelist","getAttribute","isOnlyOneTruthy","a","b","isSameStacktrace","stack1","stack2","frames1","frames","frames2","undefined","filename","lineno","colno","MAX_SERIALIZE_EXCEPTION_DEPTH","MAX_SERIALIZE_EXCEPTION_SIZE","MAX_SERIALIZE_KEYS_LENGTH","jsonSize","encodeURI","utf8Length","serializeValue","type","utils","isObject","isError","isErrorEvent","isDOMError","isDOMException","isFunction","isEmptyObject","_","supportsErrorEvent","ErrorEvent","supportsDOMError","DOMError","supportsDOMException","DOMException","supportsReferrerPolicy","referrerPolicy","supportsPromiseRejectionEvent","PromiseRejectionEvent","wrappedCallback","data","original","normalizedData","objectMerge","obj1","obj2","objectFrozen","isFrozen","urlencode","o","pairs","encodeURIComponent","uuid4","crypto","msCrypto","getRandomValues","arr","Uint16Array","pad","num","v","c","r","Math","random","htmlTreeAsString","nextStr","height","sepLength","parentNode","reverse","isSameException","ex1","ex2","values","stacktrace","parseUrl","url","match","query","fragment","protocol","host","path","relative","fill","replacement","track","orig","__raven__","__orig__","safeJoin","input","delimiter","output","String","serializeException","ex","depth","maxSize","serialized","serializeObject","reduce","acc","Array","map","val","serializeKeysForMessage","maxLength","filter","usedKeys","sanitize","sanitizeKeys","safeInput","sanitizeRegExp","sanitizeMask","parse","o_O","sanitizeWorker","workerInput","k","test","TraceKit","collectWindowErrors","debug","_slice","UNKNOWN_FUNCTION","ERROR_TYPES_RE","getLocationHref","document","location","href","report","_oldOnerrorHandler","_onErrorHandlerInstalled","handlers","lastArgs","lastException","lastExceptionStack","notifyHandlers","isWindowError","exception","apply","concat","arguments","inner","traceKitWindowOnError","msg","lineNo","colNo","error","computeStackTrace","augmentStackTraceWithInitialElement","processLastException","groups","line","column","func","_lastExceptionStack","_lastArgs","rethrow","args","setTimeout","incomplete","subscribe","handler","onerror","unsubscribe","uninstall","computeStackTraceFromStackProp","submatch","parts","element","chrome","winjs","gecko","geckoEval","chromeEval","lines","exec","isNative","columnNumber","xhr","XMLHttpRequest","open","send","status","responseText","sourceMaps","sourceMapAddress","charAt","origin","hostname","port","stackInfo","initial","unshift","partial","computeStackTraceByWalkingCallerChain","item","functionName","funcs","recursion","curr","caller","substring","result","sourceURL","fileName","lineNumber","description","tracekit","safeAdd","x","y","lsw","md5cmn","q","s","t","cnt","md5ff","d","md5gg","md5hh","md5ii","binlMD5","olda","oldb","oldc","oldd","binl2rstr","length32","fromCharCode","rstr2binl","length8","charCodeAt","rstr2hex","str2rstrUTF8","unescape","rawMD5","rstrMD5","rawHMACMD5","hash","bkey","ipad","opad","rstrHMACMD5","md5_1","string","raw","RavenConfigError","constructor","configError","console$1","console","level","originalConsoleLevel","originalConsole","sentryLevel","logger","extra","Function","wrapConsoleMethod","require$$0","dsnKeys","dsnPattern","now","Date","_document","_navigator","navigator","keepOriginalCallback","Raven","method","_hasJSON","_hasDocument","_hasNavigator","_lastCapturedException","_lastData","_lastEventId","_globalServer","_globalKey","_globalProject","_globalContext","_globalOptions","release","SENTRY_RELEASE","ignoreErrors","ignoreUrls","whitelistUrls","includePaths","headers","captureUnhandledRejections","maxMessageLength","maxUrlLength","stackTraceLimit","autoBreadcrumbs","instrument","sampleRate","_fetchDefaults","_ignoreOnError","_isRavenInstalled","_originalErrorStackTraceLimit","_originalConsole","_originalConsoleMethods","_plugins","_startTime","_wrappedBuiltIns","_breadcrumbs","_lastCapturedEvent","_keypressTimeout","_location","_lastHref","_resetBackoff","VERSION","config","dsn","options","_logDebug","globalOptions","setDSN","maxBreadcrumbs","min","autoBreadcrumbDefaults","dom","sentry","instrumentDefaults","tryCatch","install","isSetup","_handleOnErrorStackInfo","_attachPromiseRejectionHandler","_patchFunctionToString","_instrumentTryCatch","_instrumentBreadcrumbs","_drainPlugins","uri","_parseDSN","lastSlash","lastIndexOf","_dsn","user","_globalSecret","pass","_getGlobalServer","_globalEndpoint","context","wrap","_before","__raven_wrapper__","wrapped","deep","_ignoreNextOnError","captureException","property","_detachPromiseRejectionHandler","_unpatchFunctionToString","_restoreBuiltIns","_restoreConsole","_promiseRejectionHandler","event","reason","mechanism","handled","bind","addEventListener","removeEventListener","trimHeadFrames","captureMessage","_getCaptureExceptionOptionsFromPlainObject","_handleStackInfo","currentOptions","exKeys","sort","fingerprint","md5","__serialized__","initialCall","fileurl","_prepareFrames","_send","captureBreadcrumb","crumb","timestamp","breadcrumbCallback","shift","addPlugin","plugin","pluginArgs","setUserContext","setExtraContext","_mergeContext","setTagsContext","tags","clearContext","getContext","setEnvironment","environment","setRelease","setDataCallback","dataCallback","setBreadcrumbCallback","setShouldSendCallback","shouldSendCallback","setTransport","transport","lastEventId","ravenNotConfiguredError","afterLoad","RavenConfig","showReportDialog","eventId","encode","encodedOptions","email","globalServer","script","createElement","async","src","head","body","appendChild","_triggerEvent","eventType","evt","toUpperCase","createEvent","initEvent","createEventObject","dispatchEvent","fireEvent","_breadcrumbEventHandler","evtName","target","category","_keypressEventHandler","isContentEditable","timeout","clearTimeout","_captureUrlChange","from","to","parsedLoc","parsedTo","parsedFrom","_originalFunctionToString","wrappedBuiltIns","wrapTimeFn","fn","originalCallback","function","wrapEventTarget","proto","capture","secure","handleEvent","before","clickHandler","keypressHandler","requestAnimationFrame","cb","eventTargets","wrapProp","prop","xhrproto","origOpen","__raven_xhr","status_code","origSend","onreadystatechangeHandler","readyState","props","onreadystatechange","origFetch","fetchInput","fetchData","then","response","attachEvent","hasPushAndReplaceState","app","runtime","history","pushState","replaceState","oldOnPopState","onpopstate","currentHref","historyReplacementFunction","origHistFunction","log","consoleMethodCallback","builtin","installer","m","allowSecretKey","_processException","frame","_normalizeFrame","in_app","stackInfoUrl","normalized","prefixedMessage","transaction","_trimPacket","request","Referer","breadcrumbs","_trimBreadcrumbs","urlProp","urlProps","_getHttpData","httpData","userAgent","User-Agent","referrer","_backoffDuration","_backoffStart","_shouldBackoff","_isRepeatData","current","last","_setBackoffState","retry","get","getResponseHeader","parseInt","baseData","project","platform","serverName","server_name","_sanitizeData","forEach","_sendProcessedPayload","_getUuid","allowDuplicates","event_id","auth","sentry_version","sentry_client","sentry_key","sentry_secret","_makeRequest","onSuccess","onError","opts","evaluatedHeaders","evaluatedFetchParameters","_evaluateHash","fetchParameters","defaultFetchOptions","fetchOptions","fetch","ok","XDomainRequest","onload","setRequestHeader","evaluated","setUser","setReleaseContext","raven","_Raven","RavenConstructor","noConflict","env","singleton","Client","prod","dev","container","getElementById","shr","setup","count","classname","classList","contains","remove","keyCode","focused","activeElement","add","player","Plyr","title","iconUrl","keyboard","tooltips","controls","captions","active","google","ads","enabled","publisherId","buttons","querySelectorAll","types","video","audio","youtube","vimeo","currentType","historySupport","toggleClass","state","newSource","init","size","poster","tracks","kind","label","srclang","default","provider","button","parentElement","querySelector","cite","setAttribute","removeAttribute","GoogleAnalyticsObject","l","getElementsByTagName","insertBefore","ga"],"mappings":"sLAcA,SAASA,EAAQC,EAAUC,GACzB,IAAK,IAAIC,EAAI,EAAGA,EAAIF,EAASG,SAAUD,EACrC,GAAIF,EAASE,KAAOD,EAAQ,OAAOC,EAErC,OAAQ,EAyBV,SAASE,EAAWC,EAAUC,GAC5B,IAAIC,EAAQ,GACRC,EAAO,GAWX,OATqB,MAAjBF,IACFA,EAAgB,SAASG,EAAKC,GAC5B,OAAIH,EAAM,KAAOG,EACR,eAEF,eAAiBF,EAAKG,MAAM,EAAGZ,EAAQQ,EAAOG,IAAQE,KAAK,KAAO,MAItE,SAASH,EAAKC,GACnB,GAAIH,EAAMJ,OAAS,EAAG,CACpB,IAAIU,EAAUd,EAAQQ,EAAOO,OAC5BD,EAAUN,EAAMQ,OAAOF,EAAU,GAAKN,EAAMS,KAAKF,OACjDD,EAAUL,EAAKO,OAAOF,EAASI,EAAAA,EAAUR,GAAOD,EAAKQ,KAAKP,IAEtDV,EAAQQ,EAAOG,KAClBA,EAAQJ,EAAcY,KAAKJ,KAAML,EAAKC,SAGxCH,EAAMS,KAAKN,GAGb,OAAmB,MAAZL,EACHK,aAAiBS,MA5CzB,SAAwBT,GACtB,IAAIU,EAAM,CAERb,MAAOG,EAAMH,MACbc,QAASX,EAAMW,QACfC,KAAMZ,EAAMY,MAGd,IAAK,IAAIpB,KAAKQ,EACRa,OAAOC,UAAUC,eAAeP,KAAKR,EAAOR,KAC9CkB,EAAIlB,GAAKQ,EAAMR,IAInB,OAAOkB,EA8BwBM,CAAehB,GAASA,EACjDL,EAASa,KAAKJ,KAAML,EAAKC,KA5DvBiB,EAAAC,QAUV,SAAmBC,EAAKxB,EAAUyB,EAAQxB,GACxC,OAAOyB,KAAKC,UAAUH,EAAKzB,EAAWC,EAAUC,GAAgBwB,KAVlEG,aAAuB7B,wCCVnB8B,kBACgB,oBAAXC,OACHA,YACkB,IAAXC,EACLA,EACgB,oBAATC,KACLA,KACA,IAiCV,SAASC,EAAYC,GACnB,YAAgB,IAATA,EAOT,SAASC,EAAcD,GACrB,MAAgD,oBAAzChB,OAAOC,UAAUiB,SAASvB,KAAKqB,GAGxC,SAASG,EAASH,GAChB,MAAgD,oBAAzChB,OAAOC,UAAUiB,SAASvB,KAAKqB,GAGxC,SAASI,EAAQJ,GACf,MAAgD,mBAAzChB,OAAOC,UAAUiB,SAASvB,KAAKqB,GAyCxC,SAASK,IACP,KAAM,UAAWV,GAAU,OAAO,EAElC,IAIE,OAHA,IAAIW,QACJ,IAAIC,QAAQ,IACZ,IAAIC,UACG,EACP,MAAOC,GACP,OAAO,GAsCX,SAASC,EAAKpB,EAAKqB,GACjB,IAAIhD,EAAGiD,EAEP,GAAIb,EAAYT,EAAI1B,QAClB,IAAKD,KAAK2B,EACJuB,EAAOvB,EAAK3B,IACdgD,EAAShC,KAAK,KAAMhB,EAAG2B,EAAI3B,SAK/B,GADAiD,EAAItB,EAAI1B,OAEN,IAAKD,EAAI,EAAGA,EAAIiD,EAAGjD,IACjBgD,EAAShC,KAAK,KAAMhB,EAAG2B,EAAI3B,IA+BnC,SAASmD,EAASC,EAAKC,GACrB,GAAmB,iBAARA,EACT,MAAM,IAAIpC,MAAM,0DAElB,MAAmB,iBAARmC,GAA4B,IAARC,EACtBD,EAEFA,EAAInD,QAAUoD,EAAMD,EAAMA,EAAIE,OAAO,EAAGD,GAAO,IAUxD,SAASH,EAAOK,EAAQhD,GACtB,OAAOc,OAAOC,UAAUC,eAAeP,KAAKuC,EAAQhD,GAGtD,SAASiD,EAAWC,GAQlB,IALA,IAGEC,EAHEC,EAAU,GACZ3D,EAAI,EACJ4D,EAAMH,EAASxD,OAGVD,EAAI4D,EAAK5D,IAEVwC,EADJkB,EAAUD,EAASzD,IAIjB2D,EAAQ7C,KAAK4C,EAAQG,QAAQ,8BAA+B,SACnDH,GAAWA,EAAQI,QAE5BH,EAAQ7C,KAAK4C,EAAQI,QAIzB,OAAO,IAAIC,OAAOJ,EAAQjD,KAAK,KAAM,KAoHvC,SAASsD,EAAoBC,GAC3B,IACEC,EACAC,EACA5D,EACA6D,EACApE,EALEqE,EAAM,GAOV,IAAKJ,IAASA,EAAKK,QACjB,MAAO,GAST,GANAD,EAAIvD,KAAKmD,EAAKK,QAAQC,eAClBN,EAAKO,IACPH,EAAIvD,KAAK,IAAMmD,EAAKO,KAGtBN,EAAYD,EAAKC,YACA1B,EAAS0B,GAExB,IADAC,EAAUD,EAAUO,MAAM,OACrBzE,EAAI,EAAGA,EAAImE,EAAQlE,OAAQD,IAC9BqE,EAAIvD,KAAK,IAAMqD,EAAQnE,IAG3B,IAAI0E,EAAgB,CAAC,OAAQ,OAAQ,QAAS,OAC9C,IAAK1E,EAAI,EAAGA,EAAI0E,EAAczE,OAAQD,IACpCO,EAAMmE,EAAc1E,IACpBoE,EAAOH,EAAKU,aAAapE,KAEvB8D,EAAIvD,KAAK,IAAMP,EAAM,KAAO6D,EAAO,MAGvC,OAAOC,EAAI3D,KAAK,IAMlB,SAASkE,EAAgBC,EAAGC,GAC1B,WAAYD,IAAMC,GA8BpB,SAASC,EAAiBC,EAAQC,GAChC,GAAIL,EAAgBI,EAAQC,GAAS,OAAO,EAE5C,IAUIJ,EAAGC,EAVHI,EAAUF,EAAOG,OACjBC,EAAUH,EAAOE,OAGrB,QAAgBE,IAAZH,QAAqCG,IAAZD,EAAuB,OAAO,EAG3D,GAAIF,EAAQjF,SAAWmF,EAAQnF,OAAQ,OAAO,EAI9C,IAAK,IAAID,EAAI,EAAGA,EAAIkF,EAAQjF,OAAQD,IAGlC,GAFA6E,EAAIK,EAAQlF,GACZ8E,EAAIM,EAAQpF,GAEV6E,EAAES,WAAaR,EAAEQ,UACjBT,EAAEU,SAAWT,EAAES,QACfV,EAAEW,QAAUV,EAAEU,OACdX,EAAY,WAAMC,EAAY,SAE9B,OAAO,EAEX,OAAO,EA4CT,IAAIW,EAAgC,EAEhCC,EAA+B,MAC/BC,EAA4B,GAMhC,SAASC,EAASpF,GAChB,OALF,SAAoBA,GAClB,QAASqF,UAAUrF,GAAOiE,MAAM,SAASxE,OAIlC6F,CAAWjE,KAAKC,UAAUtB,IAGnC,SAASuF,EAAevF,GACtB,GAAqB,iBAAVA,EAAoB,CAE7B,OAAO2C,EAAS3C,EADA,IAEX,GACY,iBAAVA,GACU,kBAAVA,QACU,IAAVA,EAEP,OAAOA,EAGT,IAAIwF,EAAO3E,OAAOC,UAAUiB,SAASvB,KAAKR,GAG1C,MAAa,oBAATwF,EAAmC,WAC1B,mBAATA,EAAkC,UACzB,sBAATA,EACKxF,EAAMY,KAAO,cAAgBZ,EAAMY,KAAO,IAAM,aAElDZ,EA+FT,IAAAyF,EAAiB,CACfC,SA5lBF,SAAkB7D,GAChB,MAAuB,iBAATA,GAA8B,OAATA,GA4lBnC8D,QAvlBF,SAAiB3F,GACf,OAAQa,OAAOC,UAAUiB,SAASvB,KAAKR,IACrC,IAAK,iBAEL,IAAK,qBAEL,IAAK,wBACH,OAAO,EACT,QACE,OAAOA,aAAiBS,QA+kB5BmF,aA3kBF,SAAsB5F,GACpB,MAAiD,wBAA1Ca,OAAOC,UAAUiB,SAASvB,KAAKR,IA2kBtC6F,WAxkBF,SAAoB7F,GAClB,MAAiD,sBAA1Ca,OAAOC,UAAUiB,SAASvB,KAAKR,IAwkBtC8F,eArkBF,SAAwB9F,GACtB,MAAiD,0BAA1Ca,OAAOC,UAAUiB,SAASvB,KAAKR,IAqkBtC4B,YAAaA,EACbmE,WA/jBF,SAAoBlE,GAClB,MAAuB,mBAATA,GA+jBdC,cAAeA,EACfE,SAAUA,EACVC,QAASA,EACT+D,cAnjBF,SAAuBnE,GACrB,IAAKC,EAAcD,GAAO,OAAO,EAEjC,IAAK,IAAIoE,KAAKpE,EACZ,GAAIA,EAAKd,eAAekF,GACtB,OAAO,EAGX,OAAO,GA4iBPC,mBAziBF,WACE,IAEE,OADA,IAAIC,WAAW,KACR,EACP,MAAO7D,GACP,OAAO,IAqiBT8D,iBAjiBF,WACE,IAEE,OADA,IAAIC,SAAS,KACN,EACP,MAAO/D,GACP,OAAO,IA6hBTgE,qBAzhBF,WACE,IAEE,OADA,IAAIC,aAAa,KACV,EACP,MAAOjE,GACP,OAAO,IAqhBTJ,cAAeA,EACfsE,uBAjgBF,WACE,IAAKtE,IAAiB,OAAO,EAE7B,IAKE,OAHA,IAAIE,QAAQ,aAAc,CACxBqE,eAAgB,YAEX,EACP,MAAOnE,GACP,OAAO,IAwfToE,8BApfF,WACE,MAAwC,mBAA1BC,uBAofdC,gBAjfF,SAAyBpE,GASvB,OARA,SAAsBqE,EAAMC,GAC1B,IAAIC,EAAiBvE,EAASqE,IAASA,EACvC,OAAIC,GACKA,EAASC,IAEXA,IA4eTxE,KAAMA,EACNyE,YApdF,SAAqBC,EAAMC,GACzB,OAAKA,GAGL3E,EAAK2E,EAAM,SAASnH,EAAKC,GACvBiH,EAAKlH,GAAOC,IAEPiH,GALEA,GAmdTtE,SAAUA,EACVwE,aApcF,SAAsBhG,GACpB,QAAKN,OAAOuG,UAGLvG,OAAOuG,SAASjG,IAicvBuB,OAAQA,EACRM,WAAYA,EACZqE,UApZF,SAAmBC,GACjB,IAAIC,EAAQ,GAIZ,OAHAhF,EAAK+E,EAAG,SAASvH,EAAKC,GACpBuH,EAAMjH,KAAKkH,mBAAmBzH,GAAO,IAAMyH,mBAAmBxH,MAEzDuH,EAAMrH,KAAK,MAgZlBuH,MA5XF,WACE,IAAIC,EAASlG,EAAQkG,QAAUlG,EAAQmG,SAEvC,IAAK/F,EAAY8F,IAAWA,EAAOE,gBAAiB,CAGlD,IAAIC,EAAM,IAAIC,YAAY,GAC1BJ,EAAOE,gBAAgBC,GAGvBA,EAAI,GAAe,KAATA,EAAI,GAAc,MAE5BA,EAAI,GAAe,MAATA,EAAI,GAAe,MAE7B,IAAIE,EAAM,SAASC,GAEjB,IADA,IAAIC,EAAID,EAAIjG,SAAS,IACdkG,EAAExI,OAAS,GAChBwI,EAAI,IAAMA,EAEZ,OAAOA,GAGT,OACEF,EAAIF,EAAI,IACRE,EAAIF,EAAI,IACRE,EAAIF,EAAI,IACRE,EAAIF,EAAI,IACRE,EAAIF,EAAI,IACRE,EAAIF,EAAI,IACRE,EAAIF,EAAI,IACRE,EAAIF,EAAI,IAIV,MAAO,mCAAmCxE,QAAQ,QAAS,SAAS6E,GAClE,IAAIC,EAAqB,GAAhBC,KAAKC,SAAiB,EAE/B,OADY,MAANH,EAAYC,EAAS,EAAJA,EAAW,GACzBpG,SAAS,OAwVtBuG,iBA5UF,SAA0B7E,GAWxB,IATA,IAOE8E,EALA1E,EAAM,GACN2E,EAAS,EACTpF,EAAM,EAENqF,EADY,MACUhJ,OAGjBgE,GAAQ+E,IATW,KAgBV,UANdD,EAAU/E,EAAoBC,KAO3B+E,EAAS,GAAKpF,EAAMS,EAAIpE,OAASgJ,EAAYF,EAAQ9I,QAhBvC,KAqBjBoE,EAAIvD,KAAKiI,GAETnF,GAAOmF,EAAQ9I,OACfgE,EAAOA,EAAKiF,WAGd,OAAO7E,EAAI8E,UAAUzI,KAvBP,QAsUdsD,oBAAqBA,EACrBoF,gBAnPF,SAAyBC,EAAKC,GAC5B,OAAI1E,EAAgByE,EAAKC,KAEzBD,EAAMA,EAAIE,OAAO,GACjBD,EAAMA,EAAIC,OAAO,GAEbF,EAAIrD,OAASsD,EAAItD,MAAQqD,EAAI7I,QAAU8I,EAAI9I,QAbxBqE,EAgBHwE,EAAIG,WAhBE1E,EAgBUwE,EAAIE,aAfjCpH,EAAYyC,KAAMzC,EAAY0C,KAiB9BC,EAAiBsE,EAAIG,WAAYF,EAAIE,cAlB9C,IAAyB3E,EAAGC,GA2P1BC,iBAAkBA,EAClB0E,SA/YF,SAAkBC,GAChB,GAAmB,iBAARA,EAAkB,MAAO,GACpC,IAAIC,EAAQD,EAAIC,MAAM,kEAGlBC,EAAQD,EAAM,IAAM,GACpBE,EAAWF,EAAM,IAAM,GAC3B,MAAO,CACLG,SAAUH,EAAM,GAChBI,KAAMJ,EAAM,GACZK,KAAML,EAAM,GACZM,SAAUN,EAAM,GAAKC,EAAQC,IAqY/BK,KAlMF,SAAcvI,EAAKP,EAAM+I,EAAaC,GACpC,GAAW,MAAPzI,EAAJ,CACA,IAAI0I,EAAO1I,EAAIP,GACfO,EAAIP,GAAQ+I,EAAYE,GACxB1I,EAAIP,GAAMkJ,WAAY,EACtB3I,EAAIP,GAAMmJ,SAAWF,EACjBD,GACFA,EAAMtJ,KAAK,CAACa,EAAKP,EAAMiJ,MA4LzBG,SAlLF,SAAkBC,EAAOC,GACvB,IAAKjI,EAAQgI,GAAQ,MAAO,GAI5B,IAFA,IAAIE,EAAS,GAEJ3K,EAAI,EAAGA,EAAIyK,EAAMxK,OAAQD,IAChC,IACE2K,EAAO7J,KAAK8J,OAAOH,EAAMzK,KACzB,MAAO8C,GACP6H,EAAO7J,KAAK,gCAIhB,OAAO6J,EAAOjK,KAAKgK,IAsKnBG,mBA7GF,SAASA,EAAmBC,EAAIC,EAAOC,GACrC,IAAK1I,EAAcwI,GAAK,OAAOA,EAG/BE,EAA2B,iBAD3BD,EAAyB,iBAAVA,EAAqBtF,EAAgCsF,GAC9BrF,EAA+BsF,EAErE,IAAIC,EAvBN,SAASC,EAAgB1K,EAAOuK,GAC9B,OAAc,IAAVA,EAAoBhF,EAAevF,GAEnC8B,EAAc9B,GACTa,OAAOf,KAAKE,GAAO2K,OAAO,SAASC,EAAK7K,GAE7C,OADA6K,EAAI7K,GAAO2K,EAAgB1K,EAAMD,GAAMwK,EAAQ,GACxCK,GACN,IACMC,MAAM5I,QAAQjC,GAChBA,EAAM8K,IAAI,SAASC,GACxB,OAAOL,EAAgBK,EAAKR,EAAQ,KAIjChF,EAAevF,GASL0K,CAAgBJ,EAAIC,GAErC,OAAInF,EAAS9D,EAAUmJ,IAAeD,EAC7BH,EAAmBC,EAAIC,EAAQ,GAGjCE,GAkGPO,wBA/FF,SAAiClL,EAAMmL,GACrC,GAAoB,iBAATnL,GAAqC,iBAATA,EAAmB,OAAOA,EAAKiC,WACtE,IAAK8I,MAAM5I,QAAQnC,GAAO,MAAO,GAKjC,GAAoB,KAHpBA,EAAOA,EAAKoL,OAAO,SAASnL,GAC1B,MAAsB,iBAARA,KAEPN,OAAc,MAAO,uBAG9B,GADAwL,EAAiC,iBAAdA,EAAyB9F,EAA4B8F,EACpEnL,EAAK,GAAGL,QAAUwL,EAAW,OAAOnL,EAAK,GAE7C,IAAK,IAAIqL,EAAWrL,EAAKL,OAAQ0L,EAAW,EAAGA,IAAY,CACzD,IAAIV,EAAa3K,EAAKG,MAAM,EAAGkL,GAAUjL,KAAK,MAC9C,KAAIuK,EAAWhL,OAASwL,GACxB,OAAIE,IAAarL,EAAKL,OAAegL,EAC9BA,EAAa,IAGtB,MAAO,IA6EPW,SA1EF,SAAkBnB,EAAOoB,GACvB,IAAKpJ,EAAQoJ,IAAkBpJ,EAAQoJ,IAAyC,IAAxBA,EAAa5L,OACnE,OAAOwK,EAET,IAEIqB,EAFAC,EAAiBvI,EAAWqI,GAC5BG,EAAe,WAGnB,IACEF,EAAYjK,KAAKoK,MAAMnK,EAAU2I,IACjC,MAAOyB,GACP,OAAOzB,EAwBT,OArBA,SAAS0B,EAAeC,GACtB,OAAI3J,EAAQ2J,GACHA,EAAYd,IAAI,SAASC,GAC9B,OAAOY,EAAeZ,KAItBjJ,EAAc8J,GACT/K,OAAOf,KAAK8L,GAAajB,OAAO,SAASC,EAAKiB,GAMnD,OALIN,EAAeO,KAAKD,GACtBjB,EAAIiB,GAAKL,EAETZ,EAAIiB,GAAKF,EAAeC,EAAYC,IAE/BjB,GACN,IAGEgB,EAGFD,CAAeL,KCvlBpBS,EAAW,CACbC,qBAAqB,EACrBC,OAAO,GAILzK,EACgB,oBAAXC,OACHA,YACkB,IAAXC,EAAyBA,EAAyB,oBAATC,KAAuBA,KAAO,GAGhFuK,EAAS,GAAGjM,MACZkM,EAAmB,IAGnBC,EAAiB,0GAErB,SAASC,IACP,MAAwB,oBAAbC,UAAiD,MAArBA,SAASC,SAAyB,GAClED,SAASC,SAASC,KA0D3BT,EAASU,OAAS,WAChB,IA0DIC,EAAoBC,EA1DpBC,EAAW,GACbC,EAAW,KACXC,EAAgB,KAChBC,EAAqB,KAmCvB,SAASC,EAAenN,EAAOoN,GAC7B,IAAIC,EAAY,KAChB,IAAID,GAAkBlB,EAASC,oBAA/B,CAGA,IAAK,IAAIxM,KAAKoN,EACZ,GAAIA,EAAS7L,eAAevB,GAC1B,IACEoN,EAASpN,GAAG2N,MAAM,KAAM,CAACtN,GAAOuN,OAAOlB,EAAO1L,KAAK6M,UAAW,KAC9D,MAAOC,GACPJ,EAAYI,EAKlB,GAAIJ,EACF,MAAMA,GAiBV,SAASK,EAAsBC,EAAKtE,EAAKuE,EAAQC,EAAOpD,GACtD,IAEI4C,EAAYzH,EAAMG,aAAa0E,GAAMA,EAAGqD,MAAQrD,EAEhD3J,EAAU8E,EAAMG,aAAa4H,GAAOA,EAAI7M,QAAU6M,EAEtD,GAAIT,EACFhB,EAAS6B,kBAAkBC,oCACzBd,EACA7D,EACAuE,EACA9M,GAEFmN,SACK,GAAIZ,GAAazH,EAAME,QAAQuH,GAOpCF,EADQjB,EAAS6B,kBAAkBV,IACb,OACjB,CACL,IAUMa,EAVFxB,EAAW,CACbrD,IAAKA,EACL8E,KAAMP,EACNQ,OAAQP,GAGN9M,OAAOiE,EAGX,GAAkC,oBAA9B,GAAG9C,SAASvB,KAAKG,IACfoN,EAASpN,EAAQwI,MAAMiD,MAEzBxL,EAAOmN,EAAO,GACdpN,EAAUoN,EAAO,IAIrBxB,EAAS2B,KAAO/B,EAQhBa,EANQ,CACNpM,KAAMA,EACND,QAASA,EACTuI,IAAKmD,IACLxM,MAAO,CAAC0M,KAEY,GAGxB,QAAIG,GACKA,EAAmBS,MAAM/M,KAAMiN,WAwB1C,SAASS,IACP,IAAIK,EAAsBpB,EACxBqB,EAAYvB,EACdA,EAAW,KACXE,EAAqB,KACrBD,EAAgB,KAChBE,EAAeG,MAAM,KAAM,CAACgB,GAAqB,GAAOf,OAAOgB,IAUjE,SAAS3B,EAAOnC,EAAI+D,GAClB,IAAIC,EAAOpC,EAAO1L,KAAK6M,UAAW,GAClC,GAAIN,EAAoB,CACtB,GAAID,IAAkBxC,EACpB,OAEAwD,IAIJ,IAAIjO,EAAQkM,EAAS6B,kBAAkBtD,GAevC,GAdAyC,EAAqBlN,EACrBiN,EAAgBxC,EAChBuC,EAAWyB,EAMXC,WAAW,WACLzB,IAAkBxC,GACpBwD,KAEDjO,EAAM2O,WAAa,IAAO,IAEb,IAAZH,EACF,MAAM/D,EAOV,OAHAmC,EAAOgC,UAzLP,SAAmBC,GA0Hb/B,IAGJD,EAAqBlL,EAAQmN,QAC7BnN,EAAQmN,QAAUpB,EAClBZ,GAA2B,GA7H3BC,EAAStM,KAAKoO,IAwLhBjC,EAAOmC,YAjLP,SAAqBF,GACnB,IAAK,IAAIlP,EAAIoN,EAASnN,OAAS,EAAGD,GAAK,IAAKA,EACtCoN,EAASpN,KAAOkP,GAClB9B,EAASvM,OAAOb,EAAG,IA+KzBiN,EAAOoC,UAvKP,WA+GOlC,IAGLnL,EAAQmN,QAAUjC,EAClBC,GAA2B,EAC3BD,OAAqB7H,GAlHrB+H,EAAW,IAsKNH,EAtMS,GA4PlBV,EAAS6B,kBAAoB,WA4C3B,SAASkB,EAA+BxE,GACtC,QAAwB,IAAbA,EAAGzK,OAA0ByK,EAAGzK,MAA3C,CAiBA,IAfA,IAUIkP,EACAC,EACAC,EAZAC,EAAS,0IACTC,EAAQ,wHAGRC,EAAQ,6JAERC,EAAY,gDACZC,EAAa,gCACbC,EAAQjF,EAAGzK,MAAMoE,MAAM,MACvBpE,EAAQ,GAMHL,GAFO,sBAAsBgQ,KAAKlF,EAAG3J,SAEjC,GAAG8B,EAAI8M,EAAM9P,OAAQD,EAAIiD,IAAKjD,EAAG,CAC5C,GAAKwP,EAAQE,EAAOM,KAAKD,EAAM/P,IAAM,CACnC,IAAIiQ,EAAWT,EAAM,IAAqC,IAA/BA,EAAM,GAAG3P,QAAQ,UAC/B2P,EAAM,IAAmC,IAA7BA,EAAM,GAAG3P,QAAQ,UAC3B0P,EAAWO,EAAWE,KAAKR,EAAM,OAE9CA,EAAM,GAAKD,EAAS,GACpBC,EAAM,GAAKD,EAAS,GACpBC,EAAM,GAAKD,EAAS,IAEtBE,EAAU,CACR/F,IAAMuG,EAAsB,KAAXT,EAAM,GACvBd,KAAMc,EAAM,IAAM7C,EAClBmC,KAAMmB,EAAW,CAACT,EAAM,IAAM,GAC9BhB,KAAMgB,EAAM,IAAMA,EAAM,GAAK,KAC7Bf,OAAQe,EAAM,IAAMA,EAAM,GAAK,WAE5B,GAAKA,EAAQG,EAAMK,KAAKD,EAAM/P,IACnCyP,EAAU,CACR/F,IAAK8F,EAAM,GACXd,KAAMc,EAAM,IAAM7C,EAClBmC,KAAM,GACNN,MAAOgB,EAAM,GACbf,OAAQe,EAAM,IAAMA,EAAM,GAAK,UAE5B,CAAA,KAAKA,EAAQI,EAAMI,KAAKD,EAAM/P,KAsBnC,SArBawP,EAAM,IAAMA,EAAM,GAAG3P,QAAQ,YAAc,IACzC0P,EAAWM,EAAUG,KAAKR,EAAM,MAE7CA,EAAM,GAAKD,EAAS,GACpBC,EAAM,GAAKD,EAAS,GACpBC,EAAM,GAAK,MACI,IAANxP,GAAYwP,EAAM,SAAiC,IAApB1E,EAAGoF,eAK3C7P,EAAM,GAAGoO,OAAS3D,EAAGoF,aAAe,GAEtCT,EAAU,CACR/F,IAAK8F,EAAM,GACXd,KAAMc,EAAM,IAAM7C,EAClBmC,KAAMU,EAAM,GAAKA,EAAM,GAAG/K,MAAM,KAAO,GACvC+J,KAAMgB,EAAM,IAAMA,EAAM,GAAK,KAC7Bf,OAAQe,EAAM,IAAMA,EAAM,GAAK,MAUnC,IAJKC,EAAQf,MAAQe,EAAQjB,OAC3BiB,EAAQf,KAAO/B,GAGb8C,EAAQ/F,KAAoC,UAA7B+F,EAAQ/F,IAAIpG,OAAO,EAAG,GAAgB,CAMvD,IAAI6M,EAAM,IAAIC,eAKd,GAJAD,EAAIE,KAAK,MAAOZ,EAAQ/F,KAAK,GAC7ByG,EAAIG,KAAK,MAGU,MAAfH,EAAII,OAAgB,CACtB,IAAIzM,EAASqM,EAAIK,cAAgB,GAO7BC,GAHJ3M,EAASA,EAAOrD,OAAO,MAGCkJ,MAAM,gCAG9B,GAAI8G,EAAY,CACd,IAAIC,EAAmBD,EAAW,GAIC,MAA/BC,EAAiBC,OAAO,KAC1BD,GAlcY,oBAAb5D,UAAiD,MAArBA,SAASC,SAAyB,GAGpED,SAASC,SAAS6D,OAShB9D,SAASC,SAAS6D,OAPrB9D,SAASC,SAASjD,SAClB,KACAgD,SAASC,SAAS8D,UACjB/D,SAASC,SAAS+D,KAAO,IAAMhE,SAASC,SAAS+D,KAAO,KA0bRJ,EAAiBjQ,MAAM,IAKlEgP,EAAQ/F,IAAMgH,EAAiBjQ,MAAM,GAAI,KAK/CJ,EAAMS,KAAK2O,GAGb,OAAKpP,EAAMJ,OAIJ,CACLmB,KAAM0J,EAAG1J,KACTD,QAAS2J,EAAG3J,QACZuI,IAAKmD,IACLxM,MAAOA,GAPA,MAwBX,SAASgO,EAAoC0C,EAAWrH,EAAKuE,EAAQ9M,GACnE,IAAI6P,EAAU,CACZtH,IAAKA,EACL8E,KAAMP,GAGR,GAAI+C,EAAQtH,KAAOsH,EAAQxC,KAAM,CAO/B,GANAuC,EAAU/B,YAAa,EAElBgC,EAAQtC,OACXsC,EAAQtC,KAAO/B,GAGboE,EAAU1Q,MAAMJ,OAAS,GACvB8Q,EAAU1Q,MAAM,GAAGqJ,MAAQsH,EAAQtH,IAAK,CAC1C,GAAIqH,EAAU1Q,MAAM,GAAGmO,OAASwC,EAAQxC,KACtC,OAAO,EACF,IACJuC,EAAU1Q,MAAM,GAAGmO,MACpBuC,EAAU1Q,MAAM,GAAGqO,OAASsC,EAAQtC,KAGpC,OADAqC,EAAU1Q,MAAM,GAAGmO,KAAOwC,EAAQxC,MAC3B,EAOb,OAFAuC,EAAU1Q,MAAM4Q,QAAQD,GACxBD,EAAUG,SAAU,GACb,EAKT,OAHEH,EAAU/B,YAAa,GAGlB,EAYT,SAASmC,EAAsCrG,EAAIC,GASjD,IARA,IAIEyE,EACA4B,EALEC,EAAe,qEACjBhR,EAAQ,GACRiR,EAAQ,GACRC,GAAY,EAMRC,EAAOL,EAAsCM,OACjDD,IAASD,EACTC,EAAOA,EAAKC,OAEZ,GAAID,IAASpD,GAAqBoD,IAASjF,EAASU,OAApD,CAkBA,GAbAmE,EAAO,CACL1H,IAAK,KACLgF,KAAM/B,EACN6B,KAAM,KACNC,OAAQ,MAGN+C,EAAKpQ,KACPgQ,EAAK1C,KAAO8C,EAAKpQ,MACPoO,EAAQ6B,EAAarB,KAAKwB,EAAKjP,eACzC6O,EAAK1C,KAAOc,EAAM,SAGK,IAAd4B,EAAK1C,KACd,IACE0C,EAAK1C,KAAOc,EAAM/E,MAAMiH,UAAU,EAAGlC,EAAM/E,MAAM5K,QAAQ,MACzD,MAAOiD,IAGPwO,EAAM,GAAKE,GACbD,GAAY,EAEZD,EAAM,GAAKE,IAAQ,EAGrBnR,EAAMS,KAAKsQ,GAGTrG,GAGF1K,EAAMQ,OAAO,EAAGkK,GAGlB,IAAI4G,EAAS,CACXvQ,KAAM0J,EAAG1J,KACTD,QAAS2J,EAAG3J,QACZuI,IAAKmD,IACLxM,MAAOA,GAQT,OANAgO,EACEsD,EACA7G,EAAG8G,WAAa9G,EAAG+G,SACnB/G,EAAG0D,MAAQ1D,EAAGgH,WACdhH,EAAG3J,SAAW2J,EAAGiH,aAEZJ,EAQT,SAASvD,EAAkBtD,EAAIC,GAC7B,IAAI1K,EAAQ,KACZ0K,EAAiB,MAATA,EAAgB,GAAKA,EAE7B,IAEE,GADA1K,EAAQiP,EAA+BxE,GAErC,OAAOzK,EAET,MAAOyC,GACP,GAAIyJ,EAASE,MACX,MAAM3J,EAIV,IAEE,GADAzC,EAAQ8Q,EAAsCrG,EAAIC,EAAQ,GAExD,OAAO1K,EAET,MAAOyC,GACP,GAAIyJ,EAASE,MACX,MAAM3J,EAGV,MAAO,CACL1B,KAAM0J,EAAG1J,KACTD,QAAS2J,EAAG3J,QACZuI,IAAKmD,KAOT,OAHAuB,EAAkBC,oCAAsCA,EACxDD,EAAkBkB,+BAAiCA,EAE5ClB,EAhVoB,GAmV7B,IAAA4D,EAAiBzF,EClpBjB,SAAS0F,EAAQC,EAAGC,GAClB,IAAIC,GAAW,MAAJF,IAAmB,MAAJC,GAE1B,OADWD,GAAK,KAAOC,GAAK,KAAOC,GAAO,KAC3B,GAAa,MAANA,EAaxB,SAASC,EAAOC,EAAGzN,EAAGC,EAAGoN,EAAGK,EAAGC,GAC7B,OAAOP,GARczJ,EAQQyJ,EAAQA,EAAQpN,EAAGyN,GAAIL,EAAQC,EAAGM,OARrCC,EAQ0CF,GAP7C/J,IAAS,GAAKiK,EAOmC3N,GAR1E,IAAuB0D,EAAKiK,EAU5B,SAASC,EAAM7N,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAGK,EAAGC,GAC/B,OAAOH,EAAQvN,EAAI4D,GAAO5D,EAAI6N,EAAI9N,EAAGC,EAAGoN,EAAGK,EAAGC,GAEhD,SAASI,EAAM/N,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAGK,EAAGC,GAC/B,OAAOH,EAAQvN,EAAI6N,EAAMjK,GAAKiK,EAAI9N,EAAGC,EAAGoN,EAAGK,EAAGC,GAEhD,SAASK,EAAMhO,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAGK,EAAGC,GAC/B,OAAOH,EAAOvN,EAAI4D,EAAIiK,EAAG9N,EAAGC,EAAGoN,EAAGK,EAAGC,GAEvC,SAASM,EAAMjO,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAGK,EAAGC,GAC/B,OAAOH,EAAO3J,GAAK5D,GAAK6N,GAAI9N,EAAGC,EAAGoN,EAAGK,EAAGC,GAM1C,SAASO,EAAQb,EAAGtO,GAKlB,IAAI5D,EACAgT,EACAC,EACAC,EACAC,EAPJjB,EAAEtO,GAAO,IAAM,KAASA,EAAM,GAC9BsO,EAA8B,IAAzBtO,EAAM,KAAQ,GAAM,IAAWA,EAOpC,IAAIiB,EAAI,WACJC,GAAK,UACL4D,GAAK,WACLiK,EAAI,UAER,IAAK3S,EAAI,EAAGA,EAAIkS,EAAEjS,OAAQD,GAAK,GAC7BgT,EAAOnO,EACPoO,EAAOnO,EACPoO,EAAOxK,EACPyK,EAAOR,EAEP9N,EAAI6N,EAAM7N,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,GAAI,GAAI,WAChC2S,EAAID,EAAMC,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,GAAI,IAAK,WACrC0I,EAAIgK,EAAMhK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,GAAI,GAAI,WACpC8E,EAAI4N,EAAM5N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,GAAI,IAAK,YACrC6E,EAAI6N,EAAM7N,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,GAAI,WACpC2S,EAAID,EAAMC,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,GAAI,GAAI,YACpC0I,EAAIgK,EAAMhK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,GAAI,IAAK,YACrC8E,EAAI4N,EAAM5N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,GAAI,IAAK,UACrC6E,EAAI6N,EAAM7N,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,EAAG,YACnC2S,EAAID,EAAMC,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,GAAI,IAAK,YACrC0I,EAAIgK,EAAMhK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,IAAK,IAAK,OACtC8E,EAAI4N,EAAM5N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,IAAK,IAAK,YACtC6E,EAAI6N,EAAM7N,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,IAAK,EAAG,YACpC2S,EAAID,EAAMC,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,IAAK,IAAK,UACtC0I,EAAIgK,EAAMhK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,IAAK,IAAK,YAGtC6E,EAAI+N,EAAM/N,EAFVC,EAAI4N,EAAM5N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,IAAK,GAAI,YAErB0I,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,GAAI,WACpC2S,EAAIC,EAAMD,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,GAAI,GAAI,YACpC0I,EAAIkK,EAAMlK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,IAAK,GAAI,WACrC8E,EAAI8N,EAAM9N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,GAAI,IAAK,WACjC6E,EAAI+N,EAAM/N,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,GAAI,WACpC2S,EAAIC,EAAMD,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,IAAK,EAAG,UACpC0I,EAAIkK,EAAMlK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,IAAK,IAAK,WACtC8E,EAAI8N,EAAM9N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,GAAI,IAAK,WACrC6E,EAAI+N,EAAM/N,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,EAAG,WACnC2S,EAAIC,EAAMD,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,IAAK,GAAI,YACrC0I,EAAIkK,EAAMlK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,GAAI,IAAK,WACrC8E,EAAI8N,EAAM9N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,GAAI,GAAI,YACpC6E,EAAI+N,EAAM/N,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,IAAK,GAAI,YACrC2S,EAAIC,EAAMD,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,GAAI,GAAI,UACpC0I,EAAIkK,EAAMlK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,GAAI,GAAI,YAGpC6E,EAAIgO,EAAMhO,EAFVC,EAAI8N,EAAM9N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,IAAK,IAAK,YAEtB0I,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,GAAI,QACpC2S,EAAIE,EAAMF,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,GAAI,IAAK,YACrC0I,EAAImK,EAAMnK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,IAAK,GAAI,YACrC8E,EAAI+N,EAAM/N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,IAAK,IAAK,UACtC6E,EAAIgO,EAAMhO,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,GAAI,YACpC2S,EAAIE,EAAMF,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,GAAI,GAAI,YACpC0I,EAAImK,EAAMnK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,GAAI,IAAK,WACrC8E,EAAI+N,EAAM/N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,IAAK,IAAK,YACtC6E,EAAIgO,EAAMhO,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,IAAK,EAAG,WACpC2S,EAAIE,EAAMF,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,GAAI,IAAK,WACjC0I,EAAImK,EAAMnK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,GAAI,IAAK,WACrC8E,EAAI+N,EAAM/N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,GAAI,GAAI,UACpC6E,EAAIgO,EAAMhO,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,GAAI,WACpC2S,EAAIE,EAAMF,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,IAAK,IAAK,WACtC0I,EAAImK,EAAMnK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,IAAK,GAAI,WAGrC6E,EAAIiO,EAAMjO,EAFVC,EAAI+N,EAAM/N,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,GAAI,IAAK,WAErB0I,EAAGiK,EAAGT,EAAElS,GAAI,GAAI,WAChC2S,EAAIG,EAAMH,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,GAAI,GAAI,YACpC0I,EAAIoK,EAAMpK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,IAAK,IAAK,YACtC8E,EAAIgO,EAAMhO,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,GAAI,IAAK,UACrC6E,EAAIiO,EAAMjO,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,IAAK,EAAG,YACpC2S,EAAIG,EAAMH,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,GAAI,IAAK,YACrC0I,EAAIoK,EAAMpK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,IAAK,IAAK,SACtC8E,EAAIgO,EAAMhO,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,GAAI,IAAK,YACrC6E,EAAIiO,EAAMjO,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,EAAG,YACnC2S,EAAIG,EAAMH,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,IAAK,IAAK,UACtC0I,EAAIoK,EAAMpK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,GAAI,IAAK,YACrC8E,EAAIgO,EAAMhO,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,IAAK,GAAI,YACrC6E,EAAIiO,EAAMjO,EAAGC,EAAG4D,EAAGiK,EAAGT,EAAElS,EAAI,GAAI,GAAI,WACpC2S,EAAIG,EAAMH,EAAG9N,EAAGC,EAAG4D,EAAGwJ,EAAElS,EAAI,IAAK,IAAK,YACtC0I,EAAIoK,EAAMpK,EAAGiK,EAAG9N,EAAGC,EAAGoN,EAAElS,EAAI,GAAI,GAAI,WACpC8E,EAAIgO,EAAMhO,EAAG4D,EAAGiK,EAAG9N,EAAGqN,EAAElS,EAAI,GAAI,IAAK,WAErC6E,EAAIoN,EAAQpN,EAAGmO,GACflO,EAAImN,EAAQnN,EAAGmO,GACfvK,EAAIuJ,EAAQvJ,EAAGwK,GACfP,EAAIV,EAAQU,EAAGQ,GAEjB,MAAO,CAACtO,EAAGC,EAAG4D,EAAGiK,GAMnB,SAASS,EAAU3I,GACjB,IAAIzK,EACA2K,EAAS,GACT0I,EAA0B,GAAf5I,EAAMxK,OACrB,IAAKD,EAAI,EAAGA,EAAIqT,EAAUrT,GAAK,EAC7B2K,GAAUC,OAAO0I,aAAc7I,EAAMzK,GAAK,KAAQA,EAAI,GAAO,KAE/D,OAAO2K,EAOT,SAAS4I,EAAU9I,GACjB,IAAIzK,EACA2K,EAAS,GAEb,IADAA,GAAQF,EAAMxK,QAAU,GAAK,QAAKoF,EAC7BrF,EAAI,EAAGA,EAAI2K,EAAO1K,OAAQD,GAAK,EAClC2K,EAAO3K,GAAK,EAEd,IAAIwT,EAAyB,EAAf/I,EAAMxK,OACpB,IAAKD,EAAI,EAAGA,EAAIwT,EAASxT,GAAK,EAC5B2K,EAAO3K,GAAK,KAAiC,IAA1ByK,EAAMgJ,WAAWzT,EAAI,KAAeA,EAAI,GAE7D,OAAO2K,EAkCT,SAAS+I,EAASjJ,GAChB,IAEIyH,EACAlS,EAFA2K,EAAS,GAGb,IAAK3K,EAAI,EAAGA,EAAIyK,EAAMxK,OAAQD,GAAK,EACjCkS,EAAIzH,EAAMgJ,WAAWzT,GACrB2K,GANW,mBAMMgG,OAAQuB,IAAM,EAAK,IANzB,mBAMwCvB,OAAW,GAAJuB,GAE5D,OAAOvH,EAMT,SAASgJ,EAAalJ,GACpB,OAAOmJ,SAAS5L,mBAAmByC,IAMrC,SAASoJ,EAAOtB,GACd,OAnDF,SAAiBA,GACf,OAAOa,EAAUL,EAAQQ,EAAUhB,GAAe,EAAXA,EAAEtS,SAkDlC6T,CAAQH,EAAapB,IAK9B,SAASwB,EAAW1H,EAAGsG,GACrB,OAlDF,SAAqBpS,EAAK8G,GACxB,IAAIrH,EAIAgU,EAHAC,EAAOV,EAAUhT,GACjB2T,EAAO,GACPC,EAAO,GAMX,IAJAD,EAAK,IAAMC,EAAK,SAAM9O,EAClB4O,EAAKhU,OAAS,KAChBgU,EAAOlB,EAAQkB,EAAmB,EAAb1T,EAAIN,SAEtBD,EAAI,EAAGA,EAAI,GAAIA,GAAK,EACvBkU,EAAKlU,GAAe,UAAViU,EAAKjU,GACfmU,EAAKnU,GAAe,WAAViU,EAAKjU,GAGjB,OADAgU,EAAOjB,EAAQmB,EAAKtG,OAAO2F,EAAUlM,IAAQ,IAAoB,EAAdA,EAAKpH,QACjDmT,EAAUL,EAAQoB,EAAKvG,OAAOoG,GAAO,MAmCrCI,CAAYT,EAAatH,GAAIsH,EAAahB,IAmBnD,IAAA0B,EAbA,SAAaC,EAAQ/T,EAAKgU,GACxB,OAAKhU,EAMAgU,EAGER,EAAWxT,EAAK+T,GAbhBZ,EAASK,EAWIxT,EAAK+T,IANlBC,EAGEV,EAAOS,GAdTZ,EAASG,EAYES,KC/PpB,SAASE,EAAiBrT,GACxBP,KAAKQ,KAAO,mBACZR,KAAKO,QAAUA,EAEjBqT,EAAiBlT,UAAY,IAAIL,MACjCuT,EAAiBlT,UAAUmT,YAAcD,EAEzC,IAAAE,EAAiBF,ECgCjBG,EArCiB,SAASC,EAASC,EAAO7R,GACxC,IAAI8R,EAAuBF,EAAQC,GAC/BE,EAAkBH,EAEtB,GAAMC,KAASD,EAAf,CAIA,IAAII,EAAwB,SAAVH,EAAmB,UAAYA,EAEjDD,EAAQC,GAAS,WACf,IAAI/F,EAAO,GAAGrO,MAAMO,KAAK6M,WAErBG,EAAM/H,EAAMuE,SAASsE,EAAM,KAC3BzH,EAAO,CAACwN,MAAOG,EAAaC,OAAQ,UAAWC,MAAO,CAACrH,UAAWiB,IAExD,WAAV+F,GACc,IAAZ/F,EAAK,KAEPd,EACE,sBAAwB/H,EAAMuE,SAASsE,EAAKrO,MAAM,GAAI,MAAQ,kBAChE4G,EAAK6N,MAAMrH,UAAYiB,EAAKrO,MAAM,GAClCuC,GAAYA,EAASgL,EAAK3G,IAG5BrE,GAAYA,EAASgL,EAAK3G,GAIxByN,GAGFK,SAAS7T,UAAUqM,MAAM3M,KAAK8T,EAAsBC,EAAiBjG,MC1BvE1I,EAAeH,EAAMG,aACrBC,EAAaJ,EAAMI,WACnBC,EAAiBL,EAAMK,eACvBH,EAAUF,EAAME,QAChBD,EAAWD,EAAMC,SACjB5D,EAAgB2D,EAAM3D,cACtBF,EAAc6D,EAAM7D,YACpBmE,EAAaN,EAAMM,WACnB/D,GAAWyD,EAAMzD,SACjBC,GAAUwD,EAAMxD,QAChB+D,GAAgBP,EAAMO,cACtBzD,GAAOkD,EAAMlD,KACbyE,GAAcvB,EAAMuB,YACpBrE,GAAW8C,EAAM9C,SACjBwE,GAAe1B,EAAM0B,aACrBzE,GAAS+C,EAAM/C,OACfM,GAAayC,EAAMzC,WACnBqE,GAAY5B,EAAM4B,UAClBI,GAAQhC,EAAMgC,MACda,GAAmB7C,EAAM6C,iBACzBM,GAAkBnD,EAAMmD,gBACxBrE,GAAmBkB,EAAMlB,iBACzB0E,GAAWxD,EAAMwD,SACjBS,GAAOjE,EAAMiE,KACbxH,GAAgBuD,EAAMvD,cACtBsE,GAAyBf,EAAMe,uBAC/BwE,GAA0BvF,EAAMuF,wBAChCX,GAAqB5E,EAAM4E,mBAC3Be,GAAW3F,EAAM2F,SAEjBwJ,GAAoBC,EAEpBC,GAAU,2CAA2C7Q,MAAM,KAC7D8Q,GAAa,gEAEf,SAASC,KACP,OAAQ,IAAIC,KAId,IAAIzT,GACgB,oBAAXC,OACHA,YACkB,IAAXC,EAAyBA,EAAyB,oBAATC,KAAuBA,KAAO,GAChFuT,GAAY1T,GAAQ8K,SACpB6I,GAAa3T,GAAQ4T,UAEzB,SAASC,GAAqBvO,EAAUtE,GACtC,OAAOuD,EAAWvD,GACd,SAASqE,GACP,OAAOrE,EAASqE,EAAMC,IAExBtE,EAMN,SAAS8S,KA0DP,IAAK,IAAIC,KAzDTnV,KAAKoV,WAA8B,iBAATnU,OAAqBA,KAAKC,WAEpDlB,KAAKqV,cAAgB7T,EAAYsT,IACjC9U,KAAKsV,eAAiB9T,EAAYuT,IAClC/U,KAAKuV,uBAAyB,KAC9BvV,KAAKwV,UAAY,KACjBxV,KAAKyV,aAAe,KACpBzV,KAAK0V,cAAgB,KACrB1V,KAAK2V,WAAa,KAClB3V,KAAK4V,eAAiB,KACtB5V,KAAK6V,eAAiB,GACtB7V,KAAK8V,eAAiB,CAEpBC,QAAS3U,GAAQ4U,gBAAkB5U,GAAQ4U,eAAepS,GAC1DyQ,OAAQ,aACR4B,aAAc,GACdC,WAAY,GACZC,cAAe,GACfC,aAAc,GACdC,QAAS,KACTzK,qBAAqB,EACrB0K,4BAA4B,EAC5BC,iBAAkB,EAElBC,aAAc,IACdC,gBAAiB,GACjBC,iBAAiB,EACjBC,YAAY,EACZC,WAAY,EACZ3L,aAAc,IAEhBjL,KAAK6W,eAAiB,CACpB1B,OAAQ,OAKR9O,eAAgBD,KAA2B,SAAW,IAExDpG,KAAK8W,eAAiB,EACtB9W,KAAK+W,mBAAoB,EACzB/W,KAAKgX,8BAAgC3W,MAAMoW,gBAG3CzW,KAAKiX,iBAAmB7V,GAAQ4S,SAAW,GAC3ChU,KAAKkX,wBAA0B,GAC/BlX,KAAKmX,SAAW,GAChBnX,KAAKoX,WAAaxC,KAClB5U,KAAKqX,iBAAmB,GACxBrX,KAAKsX,aAAe,GACpBtX,KAAKuX,mBAAqB,KAC1BvX,KAAKwX,iBACLxX,KAAKyX,UAAYrW,GAAQ+K,SACzBnM,KAAK0X,UAAY1X,KAAKyX,WAAazX,KAAKyX,UAAUrL,KAClDpM,KAAK2X,gBAGc3X,KAAKiX,iBACtBjX,KAAKkX,wBAAwB/B,GAAUnV,KAAKiX,iBAAiB9B,GAUjED,GAAMxU,UAAY,CAKhBkX,QAAS,SAET/L,OAAO,EAEPF,SAAUA,EASVkM,OAAQ,SAASC,EAAKC,GACpB,IAAIxW,EAAOvB,KAEX,GAAIuB,EAAKmU,cAEP,OADA1V,KAAKgY,UAAU,QAAS,4CACjBzW,EAET,IAAKuW,EAAK,OAAOvW,EAEjB,IAAI0W,EAAgB1W,EAAKuU,eAGrBiC,GACF5V,GAAK4V,EAAS,SAASpY,EAAKC,GAEd,SAARD,GAA0B,UAARA,GAA2B,SAARA,EACvC4B,EAAKsU,eAAelW,GAAOC,EAE3BqY,EAActY,GAAOC,IAK3B2B,EAAK2W,OAAOJ,GAIZG,EAAchC,aAAa/V,KAAK,qBAChC+X,EAAchC,aAAa/V,KAAK,iDAGhC+X,EAAchC,aAAerT,GAAWqV,EAAchC,cACtDgC,EAAc/B,aAAa+B,EAAc/B,WAAW7W,QAChDuD,GAAWqV,EAAc/B,YAE7B+B,EAAc9B,gBAAgB8B,EAAc9B,cAAc9W,QACtDuD,GAAWqV,EAAc9B,eAE7B8B,EAAc7B,aAAexT,GAAWqV,EAAc7B,cACtD6B,EAAcE,eAAiBnQ,KAAKvF,IAClC,EACAuF,KAAKoQ,IAAIH,EAAcE,gBAAkB,IAAK,MAGhD,IAAIE,EAAyB,CAC3B9I,KAAK,EACLyE,SAAS,EACTsE,KAAK,EACLnM,UAAU,EACVoM,QAAQ,GAGN7B,EAAkBuB,EAAcvB,gBACM,oBAAtC,GAAG/U,SAASvB,KAAKsW,GACnBA,EAAkB9P,GAAYyR,EAAwB3B,IACzB,IAApBA,IACTA,EAAkB2B,GAEpBJ,EAAcvB,gBAAkBA,EAEhC,IAAI8B,EAAqB,CACvBC,UAAU,GAGR9B,EAAasB,EAActB,WAW/B,MAVqC,oBAAjC,GAAGhV,SAASvB,KAAKuW,GACnBA,EAAa/P,GAAY4R,EAAoB7B,IACrB,IAAfA,IACTA,EAAa6B,GAEfP,EAActB,WAAaA,EAE3BhL,EAASC,sBAAwBqM,EAAcrM,oBAGxCrK,GAWTmX,QAAS,WACP,IAAInX,EAAOvB,KAyBX,OAxBIuB,EAAKoX,YAAcpX,EAAKwV,oBAC1BpL,EAASU,OAAOgC,UAAU,WACxB9M,EAAKqX,wBAAwB7L,MAAMxL,EAAM0L,aAGvC1L,EAAKuU,eAAeQ,4BACtB/U,EAAKsX,iCAGPtX,EAAKuX,yBAEDvX,EAAKuU,eAAea,YAAcpV,EAAKuU,eAAea,WAAW8B,UACnElX,EAAKwX,sBAGHxX,EAAKuU,eAAeY,iBAAiBnV,EAAKyX,yBAG9CzX,EAAK0X,gBAEL1X,EAAKwV,mBAAoB,GAG3B1W,MAAMoW,gBAAkBlV,EAAKuU,eAAeW,gBACrCzW,MAQTkY,OAAQ,SAASJ,GACf,IACEoB,EADSlZ,KACEmZ,UAAUrB,GACrBsB,EAAYF,EAAI9P,KAAKiQ,YAAY,KACjCjQ,EAAO8P,EAAI9P,KAAK1G,OAAO,EAAG0W,GAHjBpZ,KAKNsZ,KAAOxB,EALD9X,KAMN2V,WAAauD,EAAIK,KANXvZ,KAONwZ,cAAgBN,EAAIO,MAAQP,EAAIO,KAAK/W,OAAO,GAPtC1C,KAQN4V,eAAiBsD,EAAI9P,KAAK1G,OAAO0W,EAAY,GARvCpZ,KAUN0V,cAVM1V,KAUe0Z,iBAAiBR,GAVhClZ,KAYN2Z,gBAZM3Z,KAaJ0V,cAAgB,IAAMtM,EAAO,OAbzBpJ,KAauC4V,eAAiB,UAInE5V,KAAK2X,iBAWPiC,QAAS,SAAS7B,EAASjK,EAAMI,GAO/B,OANIvI,EAAWoS,KACb7J,EAAOJ,GAAQ,GACfA,EAAOiK,EACPA,EAAU,IAGL/X,KAAK6Z,KAAK9B,EAASjK,GAAMf,MAAM/M,KAAMkO,IAW9C2L,KAAM,SAAS9B,EAASjK,EAAMgM,GAC5B,IAAIvY,EAAOvB,KAGX,GAAIwB,EAAYsM,KAAUnI,EAAWoS,GACnC,OAAOA,EAWT,GAPIpS,EAAWoS,KACbjK,EAAOiK,EACPA,OAAUtT,IAKPkB,EAAWmI,GACd,OAAOA,EAIT,IACE,GAAIA,EAAKpE,UACP,OAAOoE,EAIT,GAAIA,EAAKiM,kBACP,OAAOjM,EAAKiM,kBAEd,MAAO7X,GAIP,OAAO4L,EAGT,SAASkM,IACP,IAAI9L,EAAO,GACT9O,EAAI6N,UAAU5N,OACd4a,GAAQlC,GAAYA,IAA4B,IAAjBA,EAAQkC,KAQzC,IANIH,GAAWnU,EAAWmU,IACxBA,EAAQ/M,MAAM/M,KAAMiN,WAKf7N,KAAK8O,EAAK9O,GAAK6a,EAAO1Y,EAAKsY,KAAK9B,EAAS9K,UAAU7N,IAAM6N,UAAU7N,GAE1E,IAKE,OAAO0O,EAAKf,MAAM/M,KAAMkO,GACxB,MAAOhM,GAGP,MAFAX,EAAK2Y,qBACL3Y,EAAK4Y,iBAAiBjY,EAAG6V,GACnB7V,GAKV,IAAK,IAAIkY,KAAYtM,EACfxL,GAAOwL,EAAMsM,KACfJ,EAAQI,GAAYtM,EAAKsM,IAW7B,OARAJ,EAAQtZ,UAAYoN,EAAKpN,UAEzBoN,EAAKiM,kBAAoBC,EAGzBA,EAAQtQ,WAAY,EACpBsQ,EAAQrQ,SAAWmE,EAEZkM,GAQTvL,UAAW,WAWT,OAVA9C,EAASU,OAAOoC,YAEhBzO,KAAKqa,iCACLra,KAAKsa,2BACLta,KAAKua,mBACLva,KAAKwa,kBAELna,MAAMoW,gBAAkBzW,KAAKgX,8BAC7BhX,KAAK+W,mBAAoB,EAElB/W,MAWTya,yBAA0B,SAASC,GACjC1a,KAAKgY,UAAU,QAAS,4CAA6C0C,GACrE1a,KAAKma,iBAAiBO,EAAMC,OAAQ,CAClCC,UAAW,CACTxV,KAAM,uBACNyV,SAAS,MAUfhC,+BAAgC,WAI9B,OAHA7Y,KAAKya,yBAA2Bza,KAAKya,yBAAyBK,KAAK9a,MACnEoB,GAAQ2Z,kBACN3Z,GAAQ2Z,iBAAiB,qBAAsB/a,KAAKya,0BAC/Cza,MAQTqa,+BAAgC,WAG9B,OAFAjZ,GAAQ4Z,qBACN5Z,GAAQ4Z,oBAAoB,qBAAsBhb,KAAKya,0BAClDza,MAUTma,iBAAkB,SAASjQ,EAAI6N,GAG7B,GAFAA,EAAUnR,GAAY,CAACqU,eAAgB,GAAIlD,GAAoB,IAE3DvS,EAAa0E,IAAOA,EAAGqD,MAEzBrD,EAAKA,EAAGqD,UACH,CAAA,GAAI9H,EAAWyE,IAAOxE,EAAewE,GAAK,CAK/C,IAAI1J,EAAO0J,EAAG1J,OAASiF,EAAWyE,GAAM,WAAa,gBACjD3J,EAAU2J,EAAG3J,QAAUC,EAAO,KAAO0J,EAAG3J,QAAUC,EAEtD,OAAOR,KAAKkb,eACV3a,EACAqG,GAAYmR,EAAS,CAGnBnP,YAAY,EACZqS,eAAgBlD,EAAQkD,eAAiB,KAGxC,GAAI1V,EAAQ2E,GAEjBA,EAAKA,MACA,CAAA,IAAIxI,EAAcwI,GAavB,OAAOlK,KAAKkb,eACVhR,EACAtD,GAAYmR,EAAS,CACnBnP,YAAY,EACZqS,eAAgBlD,EAAQkD,eAAiB,KAb7ClD,EAAU/X,KAAKmb,2CAA2CpD,EAAS7N,GACnEA,EAAK,IAAI7J,MAAM0X,EAAQxX,UAkBzBP,KAAKuV,uBAAyBrL,EAO9B,IACE,IAAIzK,EAAQkM,EAAS6B,kBAAkBtD,GACvClK,KAAKob,iBAAiB3b,EAAOsY,GAC7B,MAAOtP,GACP,GAAIyB,IAAOzB,EACT,MAAMA,EAIV,OAAOzI,MAGTmb,2CAA4C,SAASE,EAAgBnR,GACnE,IAAIoR,EAAS7a,OAAOf,KAAKwK,GAAIqR,OACzBxD,EAAUnR,GAAYyU,EAAgB,CACxC9a,QACE,2CAA6CqK,GAAwB0Q,GACvEE,YAAa,CAACC,EAAIH,IAClBhH,MAAO+G,EAAe/G,OAAS,KAIjC,OAFAyD,EAAQzD,MAAMoH,eAAiBzR,GAAmBC,GAE3C6N,GAUTmD,eAAgB,SAAS9N,EAAK2K,GAI5B,IACI/X,KAAK8V,eAAeG,aAAavK,OACnC1L,KAAK8V,eAAeG,aAAavK,KAAK0B,GAFxC,CAUA,IAOIlD,EAPAzD,EAAOG,GACT,CACErG,QAJJ6M,GAAY,IADZ2K,EAAUA,GAAW,IAerB,IACE,MAAM,IAAI1X,MAAM+M,GAChB,MAAO3E,GACPyB,EAAKzB,EAIPyB,EAAG1J,KAAO,KACV,IAAIf,EAAQkM,EAAS6B,kBAAkBtD,GAGnCyR,EAAc9Z,GAAQpC,EAAMA,QAAUA,EAAMA,MAAM,GAKlDkc,GAAoC,2BAArBA,EAAY7N,OAC7B6N,EAAclc,EAAMA,MAAM,IAG5B,IAAImc,EAAWD,GAAeA,EAAY7S,KAAQ,GAElD,KACI9I,KAAK8V,eAAeI,WAAWxK,OACjC1L,KAAK8V,eAAeI,WAAWxK,KAAKkQ,OAMlC5b,KAAK8V,eAAeK,cAAczK,MACnC1L,KAAK8V,eAAeK,cAAczK,KAAKkQ,IAF1C,CASA,GAAI5b,KAAK8V,eAAelN,YAAcmP,EAAQnP,YAA+B,KAAjBnC,EAAKlG,QAAgB,CAE/EkG,EAAK+U,YAAkC,MAApB/U,EAAK+U,YAAsBpO,EAAM3G,EAAK+U,aAEzDzD,EAAUnR,GACR,CACEqU,eAAgB,GAElBlD,IAMMkD,gBAAkB,EAE1B,IAAI1W,EAASvE,KAAK6b,eAAepc,EAAOsY,GACxCtR,EAAKmC,WAAa,CAEhBrE,OAAQA,EAAOgE,WAcnB,OATI9B,EAAK+U,cACP/U,EAAK+U,YAAc3Z,GAAQ4E,EAAK+U,aAC5B/U,EAAK+U,YACL,CAAC/U,EAAK+U,cAIZxb,KAAK8b,MAAMrV,GAEJzG,QAGT+b,kBAAmB,SAAShb,GAC1B,IAAIib,EAAQpV,GACV,CACEqV,UAAWrH,KAAQ,KAErB7T,GAGF,GAAI4E,EAAW3F,KAAK8V,eAAeoG,oBAAqB,CACtD,IAAInL,EAAS/Q,KAAK8V,eAAeoG,mBAAmBF,GAEpD,GAAI1W,EAASyL,KAAYnL,GAAcmL,GACrCiL,EAAQjL,OACH,IAAe,IAAXA,EACT,OAAO/Q,KAQX,OAJAA,KAAKsX,aAAapX,KAAK8b,GACnBhc,KAAKsX,aAAajY,OAASW,KAAK8V,eAAeqC,gBACjDnY,KAAKsX,aAAa6E,QAEbnc,MAGToc,UAAW,SAASC,GAClB,IAAIC,EAAa,GAAGzc,MAAMO,KAAK6M,UAAW,GAO1C,OALAjN,KAAKmX,SAASjX,KAAK,CAACmc,EAAQC,IACxBtc,KAAK+W,mBACP/W,KAAKiZ,gBAGAjZ,MASTuc,eAAgB,SAAShD,GAIvB,OAFAvZ,KAAK6V,eAAe0D,KAAOA,EAEpBvZ,MASTwc,gBAAiB,SAASlI,GAGxB,OAFAtU,KAAKyc,cAAc,QAASnI,GAErBtU,MAST0c,eAAgB,SAASC,GAGvB,OAFA3c,KAAKyc,cAAc,OAAQE,GAEpB3c,MAQT4c,aAAc,WAGZ,OAFA5c,KAAK6V,eAAiB,GAEf7V,MAQT6c,WAAY,WAEV,OAAO5b,KAAKoK,MAAMnK,EAAUlB,KAAK6V,kBASnCiH,eAAgB,SAASC,GAGvB,OAFA/c,KAAK8V,eAAeiH,YAAcA,EAE3B/c,MASTgd,WAAY,SAASjH,GAGnB,OAFA/V,KAAK8V,eAAeC,QAAUA,EAEvB/V,MAUTid,gBAAiB,SAAS7a,GACxB,IAAIsE,EAAW1G,KAAK8V,eAAeoH,aAEnC,OADAld,KAAK8V,eAAeoH,aAAejI,GAAqBvO,EAAUtE,GAC3DpC,MAUTmd,sBAAuB,SAAS/a,GAC9B,IAAIsE,EAAW1G,KAAK8V,eAAeoG,mBAEnC,OADAlc,KAAK8V,eAAeoG,mBAAqBjH,GAAqBvO,EAAUtE,GACjEpC,MAUTod,sBAAuB,SAAShb,GAC9B,IAAIsE,EAAW1G,KAAK8V,eAAeuH,mBAEnC,OADArd,KAAK8V,eAAeuH,mBAAqBpI,GAAqBvO,EAAUtE,GACjEpC,MAYTsd,aAAc,SAASC,GAGrB,OAFAvd,KAAK8V,eAAeyH,UAAYA,EAEzBvd,MAQT0M,cAAe,WACb,OAAO1M,KAAKuV,wBAQdiI,YAAa,WACX,OAAOxd,KAAKyV,cAQdkD,QAAS,WACP,QAAK3Y,KAAKoV,aACLpV,KAAK0V,gBACH1V,KAAKyd,0BACRzd,KAAKyd,yBAA0B,EAC/Bzd,KAAKgY,UAAU,QAAS,2CAEnB,KAKX0F,UAAW,WAIT,IAAIC,EAAcvc,GAAQuc,YACtBA,GACF3d,KAAK6X,OAAO8F,EAAY7F,IAAK6F,EAAY9F,QAAQa,WAIrDkF,iBAAkB,SAAS7F,GACzB,GACGjD,GADH,CAcA,KATAiD,EAAUnR,GACR,CACEiX,QAAS7d,KAAKwd,cACd1F,IAAK9X,KAAKsZ,KACVC,KAAMvZ,KAAK6V,eAAe0D,MAAQ,IAEpCxB,IAGW8F,QACX,MAAM,IAAIjK,EAAiB,mBAG7B,IAAKmE,EAAQD,IACX,MAAM,IAAIlE,EAAiB,eAG7B,IAAIkK,EAAS1W,mBACT2W,EAAiB,GAErB,IAAK,IAAIpe,KAAOoY,EACd,GAAY,SAARpY,EAAgB,CAClB,IAAI4Z,EAAOxB,EAAQwB,KACfA,EAAK/Y,MAAMud,EAAe7d,KAAK,QAAU4d,EAAOvE,EAAK/Y,OACrD+Y,EAAKyE,OAAOD,EAAe7d,KAAK,SAAW4d,EAAOvE,EAAKyE,aAE3DD,EAAe7d,KAAK4d,EAAOne,GAAO,IAAMme,EAAO/F,EAAQpY,KAG3D,IAAIse,EAAeje,KAAK0Z,iBAAiB1Z,KAAKmZ,UAAUpB,EAAQD,MAE5DoG,EAASpJ,GAAUqJ,cAAc,UACrCD,EAAOE,OAAQ,EACfF,EAAOG,IAAMJ,EAAe,0BAA4BF,EAAeje,KAAK,MAC3EgV,GAAUwJ,MAAQxJ,GAAUyJ,MAAMC,YAAYN,KAIjDhE,mBAAoB,WAClB,IAAI3Y,EAAOvB,KACXA,KAAK8W,gBAAkB,EACvB3I,WAAW,WAET5M,EAAKuV,gBAAkB,KAI3B2H,cAAe,SAASC,EAAW3G,GAEjC,IAAI4G,EAAKhf,EAET,GAAKK,KAAKqV,aAAV,CAcA,IAAK1V,KAZLoY,EAAUA,GAAW,GAErB2G,EAAY,QAAUA,EAAUhc,OAAO,EAAG,GAAGkc,cAAgBF,EAAUhc,OAAO,GAE1EoS,GAAU+J,aACZF,EAAM7J,GAAU+J,YAAY,eACxBC,UAAUJ,GAAW,GAAM,IAE/BC,EAAM7J,GAAUiK,qBACZL,UAAYA,EAGN3G,EACNzV,GAAOyV,EAASpY,KAClBgf,EAAIhf,GAAOoY,EAAQpY,IAGvB,GAAImV,GAAU+J,YAEZ/J,GAAUkK,cAAcL,QAIxB,IACE7J,GAAUmK,UAAU,KAAON,EAAID,UAAU/a,cAAegb,GACxD,MAAOzc,OAYbgd,wBAAyB,SAASC,GAChC,IAAI5d,EAAOvB,KACX,OAAO,SAAS2e,GASd,GALApd,EAAKiW,iBAAmB,KAKpBjW,EAAKgW,qBAAuBoH,EAAhC,CAQA,IAAIS,EANJ7d,EAAKgW,mBAAqBoH,EAO1B,IACES,EAASlX,GAAiByW,EAAIS,QAC9B,MAAOld,GACPkd,EAAS,YAGX7d,EAAKwa,kBAAkB,CACrBsD,SAAU,MAAQF,EAClB5e,QAAS6e,OAUfE,sBAAuB,WACrB,IAAI/d,EAAOvB,KAMX,OAAO,SAAS2e,GACd,IAAIS,EACJ,IACEA,EAAST,EAAIS,OACb,MAAOld,GAGP,OAEF,IAAIwB,EAAU0b,GAAUA,EAAO1b,QAK/B,GACGA,IACY,UAAZA,GAAmC,aAAZA,GAA2B0b,EAAOG,mBAF5D,CAQA,IAAIC,EAAUje,EAAKiW,iBACdgI,GACHje,EAAK2d,wBAAwB,QAA7B3d,CAAsCod,GAExCc,aAAaD,GACbje,EAAKiW,iBAAmBrJ,WAAW,WACjC5M,EAAKiW,iBAAmB,MAjCP,QA4CvBkI,kBAAmB,SAASC,EAAMC,GAChC,IAAIC,EAAYhX,GAAS7I,KAAKyX,UAAUrL,MACpC0T,EAAWjX,GAAS+W,GACpBG,EAAalX,GAAS8W,GAK1B3f,KAAK0X,UAAYkI,EAIbC,EAAU3W,WAAa4W,EAAS5W,UAAY2W,EAAU1W,OAAS2W,EAAS3W,OAC1EyW,EAAKE,EAASzW,UACZwW,EAAU3W,WAAa6W,EAAW7W,UAAY2W,EAAU1W,OAAS4W,EAAW5W,OAC9EwW,EAAOI,EAAW1W,UAEpBrJ,KAAK+b,kBAAkB,CACrBsD,SAAU,aACV5Y,KAAM,CACJmZ,GAAIA,EACJD,KAAMA,MAKZ7G,uBAAwB,WACtB,IAAIvX,EAAOvB,KACXuB,EAAKye,0BAA4BzL,SAAS7T,UAAUiB,SAEpD4S,SAAS7T,UAAUiB,SAAW,WAC5B,MAAoB,mBAAT3B,MAAuBA,KAAK0J,UAC9BnI,EAAKye,0BAA0BjT,MAAM/M,KAAK2J,SAAUsD,WAEtD1L,EAAKye,0BAA0BjT,MAAM/M,KAAMiN,aAItDqN,yBAA0B,WACpBta,KAAKggB,4BAEPzL,SAAS7T,UAAUiB,SAAW3B,KAAKggB,4BAQvCjH,oBAAqB,WACnB,IAAIxX,EAAOvB,KAEPigB,EAAkB1e,EAAK8V,iBAE3B,SAAS6I,EAAWzW,GAClB,OAAO,SAAS0W,EAAIvO,GAKlB,IADA,IAAI1D,EAAO,IAAIzD,MAAMwC,UAAU5N,QACtBD,EAAI,EAAGA,EAAI8O,EAAK7O,SAAUD,EACjC8O,EAAK9O,GAAK6N,UAAU7N,GAEtB,IAAIghB,EAAmBlS,EAAK,GAgB5B,OAfIvI,EAAWya,KACblS,EAAK,GAAK3M,EAAKsY,KACb,CACEe,UAAW,CACTxV,KAAM,aACNqB,KAAM,CAAC4Z,SAAU5W,EAAKjJ,MAAQ,iBAGlC4f,IAOA3W,EAAKsD,MACAtD,EAAKsD,MAAM/M,KAAMkO,GAEjBzE,EAAKyE,EAAK,GAAIA,EAAK,KAKhC,IAAIwI,EAAkB1W,KAAK8V,eAAeY,gBAE1C,SAAS4J,EAAgBhf,GACvB,IAAIif,EAAQnf,GAAQE,IAAWF,GAAQE,GAAQZ,UAC3C6f,GAASA,EAAM5f,gBAAkB4f,EAAM5f,eAAe,sBACxD2I,GACEiX,EACA,mBACA,SAAS9W,GACP,OAAO,SAAS0V,EAASgB,EAAIK,EAASC,GAEpC,IACMN,GAAMA,EAAGO,cACXP,EAAGO,YAAcnf,EAAKsY,KACpB,CACEe,UAAW,CACTxV,KAAM,aACNqB,KAAM,CACJ2Y,OAAQ9d,EACR+e,SAAU,cACV/R,QAAU6R,GAAMA,EAAG3f,MAAS,iBAIlC2f,EAAGO,cAGP,MAAOpgB,IAMT,IAAIqgB,EAAQC,EAAcC,EA6B1B,OA1BEnK,GACAA,EAAgB4B,MACJ,gBAAXhX,GAAuC,SAAXA,KAI7Bsf,EAAerf,EAAK2d,wBAAwB,SAC5C2B,EAAkBtf,EAAK+d,wBACvBqB,EAAS,SAAShC,GAIhB,GAAKA,EAAL,CAEA,IAAID,EACJ,IACEA,EAAYC,EAAIvZ,KAChB,MAAOlD,GAGP,OAEF,MAAkB,UAAdwc,EAA8BkC,EAAajC,GACxB,aAAdD,EAAiCmC,EAAgBlC,QAArD,KAGFlV,EAAKrJ,KACVJ,KACAmf,EACA5d,EAAKsY,KACH,CACEe,UAAW,CACTxV,KAAM,aACNqB,KAAM,CACJ2Y,OAAQ9d,EACR+e,SAAU,mBACV/R,QAAU6R,GAAMA,EAAG3f,MAAS,iBAIlC2f,EACAQ,GAEFH,EACAC,KAINR,GAEF3W,GACEiX,EACA,sBACA,SAAS9W,GACP,OAAO,SAASkV,EAAKwB,EAAIK,EAASC,GAChC,IACEN,EAAKA,IAAOA,EAAGpG,kBAAoBoG,EAAGpG,kBAAoBoG,GAC1D,MAAOje,IAGT,OAAOuH,EAAKrJ,KAAKJ,KAAM2e,EAAKwB,EAAIK,EAASC,KAG7CR,IAKN3W,GAAKlI,GAAS,aAAc8e,EAAYD,GACxC3W,GAAKlI,GAAS,cAAe8e,EAAYD,GACrC7e,GAAQ0f,uBACVxX,GACElI,GACA,wBACA,SAASqI,GACP,OAAO,SAASsX,GACd,OAAOtX,EACLlI,EAAKsY,KACH,CACEe,UAAW,CACTxV,KAAM,aACNqB,KAAM,CACJ4Z,SAAU,wBACV/R,QAAU7E,GAAQA,EAAKjJ,MAAS,iBAItCugB,MAKRd,GAqCJ,IA/BA,IAAIe,EAAe,CACjB,cACA,SACA,OACA,mBACA,iBACA,oBACA,kBACA,cACA,aACA,qBACA,cACA,aACA,iBACA,eACA,kBACA,cACA,cACA,eACA,qBACA,SACA,YACA,eACA,gBACA,YACA,kBACA,SACA,iBACA,4BACA,wBAEO5hB,EAAI,EAAGA,EAAI4hB,EAAa3hB,OAAQD,IACvCkhB,EAAgBU,EAAa5hB,KAajC4Z,uBAAwB,WACtB,IAAIzX,EAAOvB,KACP0W,EAAkB1W,KAAK8V,eAAeY,gBAEtCuJ,EAAkB1e,EAAK8V,iBAE3B,SAAS4J,EAASC,EAAM3R,GAClB2R,KAAQ3R,GAAO5J,EAAW4J,EAAI2R,KAChC5X,GAAKiG,EAAK2R,EAAM,SAASzX,GACvB,OAAOlI,EAAKsY,KACV,CACEe,UAAW,CACTxV,KAAM,aACNqB,KAAM,CAAC4Z,SAAUa,EAAM5S,QAAU7E,GAAQA,EAAKjJ,MAAS,iBAG3DiJ,KAMR,GAAIiN,EAAgBnH,KAAO,mBAAoBnO,GAAS,CACtD,IAAI+f,EAAW/f,GAAQoO,gBAAkBpO,GAAQoO,eAAe9O,UAChE4I,GACE6X,EACA,OACA,SAASC,GACP,OAAO,SAASjM,EAAQrM,GAYtB,OARIlH,GAASkH,KAA0C,IAAlCA,EAAI7J,QAAQsC,EAAKoU,cACpC3V,KAAKqhB,YAAc,CACjBlM,OAAQA,EACRrM,IAAKA,EACLwY,YAAa,OAIVF,EAASrU,MAAM/M,KAAMiN,aAGhCgT,GAGF3W,GACE6X,EACA,OACA,SAASI,GACP,OAAO,WAEL,IAAIhS,EAAMvP,KAEV,SAASwhB,IACP,GAAIjS,EAAI8R,aAAkC,IAAnB9R,EAAIkS,WAAkB,CAC3C,IAGElS,EAAI8R,YAAYC,YAAc/R,EAAII,OAClC,MAAOzN,IAITX,EAAKwa,kBAAkB,CACrB3W,KAAM,OACNia,SAAU,MACV5Y,KAAM8I,EAAI8R,eAMhB,IADA,IAAIK,EAAQ,CAAC,SAAU,UAAW,cACzBrf,EAAI,EAAGA,EAAIqf,EAAMriB,OAAQgD,IAChC4e,EAASS,EAAMrf,GAAIkN,GA6BrB,MA1BI,uBAAwBA,GAAO5J,EAAW4J,EAAIoS,oBAChDrY,GACEiG,EACA,qBACA,SAAS9F,GACP,OAAOlI,EAAKsY,KACV,CACEe,UAAW,CACTxV,KAAM,aACNqB,KAAM,CACJ4Z,SAAU,qBACV/R,QAAU7E,GAAQA,EAAKjJ,MAAS,iBAItCiJ,EACA+X,KAONjS,EAAIoS,mBAAqBH,EAGpBD,EAASxU,MAAM/M,KAAMiN,aAGhCgT,GAIAvJ,EAAgBnH,KAAOzN,MACzBwH,GACElI,GACA,QACA,SAASwgB,GACP,OAAO,WAKL,IADA,IAAI1T,EAAO,IAAIzD,MAAMwC,UAAU5N,QACtBD,EAAI,EAAGA,EAAI8O,EAAK7O,SAAUD,EACjC8O,EAAK9O,GAAK6N,UAAU7N,GAGtB,IAEI0J,EAFA+Y,EAAa3T,EAAK,GAClBiH,EAAS,MAeb,GAZ0B,iBAAf0M,EACT/Y,EAAM+Y,EACG,YAAazgB,IAAWygB,aAAsBzgB,GAAQY,SAC/D8G,EAAM+Y,EAAW/Y,IACb+Y,EAAW1M,SACbA,EAAS0M,EAAW1M,SAGtBrM,EAAM,GAAK+Y,GAIyB,IAAlC/Y,EAAI7J,QAAQsC,EAAKoU,YACnB,OAAOiM,EAAU7U,MAAM/M,KAAMkO,GAG3BA,EAAK,IAAMA,EAAK,GAAGiH,SACrBA,EAASjH,EAAK,GAAGiH,QAGnB,IAAI2M,EAAY,CACd3M,OAAQA,EACRrM,IAAKA,EACLwY,YAAa,MAGf,OAAOM,EACJ7U,MAAM/M,KAAMkO,GACZ6T,KAAK,SAASC,GASb,OARAF,EAAUR,YAAcU,EAASrS,OAEjCpO,EAAKwa,kBAAkB,CACrB3W,KAAM,OACNia,SAAU,QACV5Y,KAAMqb,IAGDE,IAED,MAAE,SAAS1hB,GASjB,MAPAiB,EAAKwa,kBAAkB,CACrB3W,KAAM,OACNia,SAAU,QACV5Y,KAAMqb,EACN7N,MAAO,UAGH3T,MAId2f,GAMAvJ,EAAgB4B,KAAOtY,KAAKqV,eAC1BP,GAAUiG,kBACZjG,GAAUiG,iBAAiB,QAASxZ,EAAK2d,wBAAwB,UAAU,GAC3EpK,GAAUiG,iBAAiB,WAAYxZ,EAAK+d,yBAAyB,IAC5DxK,GAAUmN,cAEnBnN,GAAUmN,YAAY,UAAW1gB,EAAK2d,wBAAwB,UAC9DpK,GAAUmN,YAAY,aAAc1gB,EAAK+d,2BAQ7C,IAAIxQ,EAAS1N,GAAQ0N,OAEjBoT,IADsBpT,GAAUA,EAAOqT,KAAOrT,EAAOqT,IAAIC,UAG3DhhB,GAAQihB,SACRjhB,GAAQihB,QAAQC,WAChBlhB,GAAQihB,QAAQE,aAClB,GAAI7L,EAAgBvK,UAAY+V,EAAwB,CAEtD,IAAIM,EAAgBphB,GAAQqhB,WAC5BrhB,GAAQqhB,WAAa,WACnB,IAAIC,EAAcnhB,EAAKkW,UAAUrL,KAGjC,GAFA7K,EAAKme,kBAAkBne,EAAKmW,UAAWgL,GAEnCF,EACF,OAAOA,EAAczV,MAAM/M,KAAMiN,YAIrC,IAAI0V,EAA6B,SAASC,GAGxC,OAAO,WACL,IAAI9Z,EAAMmE,UAAU5N,OAAS,EAAI4N,UAAU,QAAKxI,EAQhD,OALIqE,GAEFvH,EAAKme,kBAAkBne,EAAKmW,UAAW5O,EAAM,IAGxC8Z,EAAiB7V,MAAM/M,KAAMiN,aAIxC3D,GAAKlI,GAAQihB,QAAS,YAAaM,EAA4B1C,GAC/D3W,GAAKlI,GAAQihB,QAAS,eAAgBM,EAA4B1C,GAGpE,GAAIvJ,EAAgB1C,SAAW,YAAa5S,IAAW4S,QAAQ6O,IAAK,CAElE,IAAIC,EAAwB,SAAS1V,EAAK3G,GACxClF,EAAKwa,kBAAkB,CACrBxb,QAAS6M,EACT6G,MAAOxN,EAAKwN,MACZoL,SAAU,aAIdld,GAAK,CAAC,QAAS,OAAQ,OAAQ,QAAS,OAAQ,SAAS0D,EAAGoO,GAC1DO,GAAkBR,QAASC,EAAO6O,OAKxCvI,iBAAkB,WAGhB,IADA,IAAIwI,EACG/iB,KAAKqX,iBAAiBhY,QAAQ,CAGnC,IAAI0B,GAFJgiB,EAAU/iB,KAAKqX,iBAAiB8E,SAEd,GAChB3b,EAAOuiB,EAAQ,GACftZ,EAAOsZ,EAAQ,GAEjBhiB,EAAIP,GAAQiJ,IAIhB+Q,gBAAiB,WAEf,IAAK,IAAIrF,KAAUnV,KAAKkX,wBACtBlX,KAAKiX,iBAAiB9B,GAAUnV,KAAKkX,wBAAwB/B,IAIjE8D,cAAe,WACb,IAAI1X,EAAOvB,KAGXmC,GAAKnC,KAAKmX,SAAU,SAAStR,EAAGwW,GAC9B,IAAI2G,EAAY3G,EAAO,GACnBnO,EAAOmO,EAAO,GAClB2G,EAAUjW,MAAMxL,EAAM,CAACA,GAAMyL,OAAOkB,OAIxCiL,UAAW,SAAS3W,GAClB,IAAIygB,EAAItO,GAAWvF,KAAK5M,GACtBsV,EAAM,GACN1Y,EAAI,EAEN,IACE,KAAOA,KAAK0Y,EAAIpD,GAAQtV,IAAM6jB,EAAE7jB,IAAM,GACtC,MAAO8C,GACP,MAAM,IAAI0R,EAAiB,gBAAkBpR,GAG/C,GAAIsV,EAAI2B,OAASzZ,KAAK8V,eAAeoN,eACnC,MAAM,IAAItP,EACR,kFAIJ,OAAOkE,GAGT4B,iBAAkB,SAASR,GAEzB,IAAI+E,EAAe,KAAO/E,EAAI/P,MAAQ+P,EAAIhJ,KAAO,IAAMgJ,EAAIhJ,KAAO,IAKlE,OAHIgJ,EAAIhQ,WACN+U,EAAe/E,EAAIhQ,SAAW,IAAM+U,GAE/BA,GAGTrF,wBAAyB,SAASzI,EAAW4H,IAC3CA,EAAUA,GAAW,IACb6C,UAAY7C,EAAQ6C,WAAa,CACvCxV,KAAM,UACNyV,SAAS,GAIN7a,KAAK8W,gBACR9W,KAAKob,iBAAiBjL,EAAW4H,IAIrCqD,iBAAkB,SAASjL,EAAW4H,GACpC,IAAIxT,EAASvE,KAAK6b,eAAe1L,EAAW4H,GAE5C/X,KAAKye,cAAc,SAAU,CAC3BtO,UAAWA,EACX4H,QAASA,IAGX/X,KAAKmjB,kBACHhT,EAAU3P,KACV2P,EAAU5P,QACV4P,EAAUrH,IACVqH,EAAUxL,OACVJ,EACAwT,IAIJ8D,eAAgB,SAAS1L,EAAW4H,GAClC,IAAIxW,EAAOvB,KACPuE,EAAS,GACb,GAAI4L,EAAU1Q,OAAS0Q,EAAU1Q,MAAMJ,SACrC8C,GAAKgO,EAAU1Q,MAAO,SAASL,EAAGK,GAChC,IAAI2jB,EAAQ7hB,EAAK8hB,gBAAgB5jB,EAAO0Q,EAAUrH,KAC9Csa,GACF7e,EAAOrE,KAAKkjB,KAKZrL,GAAWA,EAAQkD,gBACrB,IAAK,IAAI5Y,EAAI,EAAGA,EAAI0V,EAAQkD,gBAAkB5Y,EAAIkC,EAAOlF,OAAQgD,IAC/DkC,EAAOlC,GAAGihB,QAAS,EAKzB,OADA/e,EAASA,EAAO1E,MAAM,EAAGG,KAAK8V,eAAeW,kBAI/C4M,gBAAiB,SAASD,EAAOG,GAE/B,IAAIC,EAAa,CACf9e,SAAU0e,EAAMta,IAChBnE,OAAQye,EAAMxV,KACdhJ,MAAOwe,EAAMvV,OACbwS,SAAU+C,EAAMtV,MAAQ,KAuB1B,OAfKsV,EAAMta,MACT0a,EAAW9e,SAAW6e,GAGxBC,EAAWF,SAGNtjB,KAAK8V,eAAeM,aAAa1K,OACjC1L,KAAK8V,eAAeM,aAAa1K,KAAK8X,EAAW9e,WAEpD,qBAAqBgH,KAAK8X,EAAqB,WAE/C,qBAAqB9X,KAAK8X,EAAW9e,WAGhC8e,GAGTL,kBAAmB,SAAS/d,EAAM7E,EAASqb,EAASjX,EAAQJ,EAAQwT,GAClE,IASInP,EATA6a,GAAmBre,EAAOA,EAAO,KAAO,KAAO7E,GAAW,IAC9D,KACIP,KAAK8V,eAAeG,aAAavK,OAClC1L,KAAK8V,eAAeG,aAAavK,KAAKnL,KACrCP,KAAK8V,eAAeG,aAAavK,KAAK+X,MAOtClf,GAAUA,EAAOlF,QACnBuc,EAAUrX,EAAO,GAAGG,UAAYkX,EAGhCrX,EAAOgE,UACPK,EAAa,CAACrE,OAAQA,IACbqX,IACThT,EAAa,CACXrE,OAAQ,CACN,CACEG,SAAUkX,EACVjX,OAAQA,EACR2e,QAAQ,QAOZtjB,KAAK8V,eAAeI,WAAWxK,OACjC1L,KAAK8V,eAAeI,WAAWxK,KAAKkQ,OAMlC5b,KAAK8V,eAAeK,cAAczK,MACnC1L,KAAK8V,eAAeK,cAAczK,KAAKkQ,KAF1C,CAOA,IAAInV,EAAOG,GACT,CAEEkG,UAAW,CACTnE,OAAQ,CACN,CACEvD,KAAMA,EACNxF,MAAOW,EACPqI,WAAYA,KAIlB8a,YAAa9H,GAEf7D,GAGE7N,EAAKzD,EAAKqG,UAAUnE,OAAO,GAChB,MAAXuB,EAAG9E,MAA6B,KAAb8E,EAAGtK,QACxBsK,EAAGtK,MAAQ,+BAMR6G,EAAKqG,UAAU8N,WAAanU,EAAKmU,YACpCnU,EAAKqG,UAAU8N,UAAYnU,EAAKmU,iBACzBnU,EAAKmU,WAGdnU,EAAKqG,UAAU8N,UAAYhU,GACzB,CACExB,KAAM,UACNyV,SAAS,GAEXpU,EAAKqG,UAAU8N,WAAa,IAI9B5a,KAAK8b,MAAMrV,KAGbkd,YAAa,SAASld,GAGpB,IAAIhE,EAAMzC,KAAK8V,eAAeS,iBAI9B,GAHI9P,EAAKlG,UACPkG,EAAKlG,QAAUgC,GAASkE,EAAKlG,QAASkC,IAEpCgE,EAAKqG,UAAW,CAClB,IAAIA,EAAYrG,EAAKqG,UAAUnE,OAAO,GACtCmE,EAAUlN,MAAQ2C,GAASuK,EAAUlN,MAAO6C,GAG9C,IAAImhB,EAAUnd,EAAKmd,QAanB,OAZIA,IACEA,EAAQ9a,MACV8a,EAAQ9a,IAAMvG,GAASqhB,EAAQ9a,IAAK9I,KAAK8V,eAAeU,eAEtDoN,EAAQC,UACVD,EAAQC,QAAUthB,GAASqhB,EAAQC,QAAS7jB,KAAK8V,eAAeU,gBAIhE/P,EAAKqd,aAAerd,EAAKqd,YAAYnb,QACvC3I,KAAK+jB,iBAAiBtd,EAAKqd,aAEtBrd,GAMTsd,iBAAkB,SAASD,GAQzB,IALA,IACEE,EACAhI,EACAvV,EAHEwd,EAAW,CAAC,KAAM,OAAQ,OAKrB7kB,EAAI,EAAGA,EAAI0kB,EAAYnb,OAAOtJ,SAAUD,EAE/C,IADA4c,EAAQ8H,EAAYnb,OAAOvJ,IAElBuB,eAAe,SACrB2E,EAAS0W,EAAMvV,QAChBM,GAAaiV,EAAMvV,MAHrB,CAOAA,EAAOG,GAAY,GAAIoV,EAAMvV,MAC7B,IAAK,IAAIpE,EAAI,EAAGA,EAAI4hB,EAAS5kB,SAAUgD,EACrC2hB,EAAUC,EAAS5hB,GACfoE,EAAK9F,eAAeqjB,IAAYvd,EAAKud,KACvCvd,EAAKud,GAAWzhB,GAASkE,EAAKud,GAAUhkB,KAAK8V,eAAeU,eAGhEsN,EAAYnb,OAAOvJ,GAAGqH,KAAOA,IAIjCyd,aAAc,WACZ,GAAKlkB,KAAKsV,eAAkBtV,KAAKqV,aAAjC,CACA,IAAI8O,EAAW,GAkBf,OAhBInkB,KAAKsV,eAAiBP,GAAWqP,YACnCD,EAAS9N,QAAU,CACjBgO,aAActP,GAAWqP,YAKzBhjB,GAAQ+K,UAAY/K,GAAQ+K,SAASC,OACvC+X,EAASrb,IAAM1H,GAAQ+K,SAASC,MAG9BpM,KAAKqV,cAAgBP,GAAUwP,WAC5BH,EAAS9N,UAAS8N,EAAS9N,QAAU,IAC1C8N,EAAS9N,QAAQwN,QAAU/O,GAAUwP,UAGhCH,IAGTxM,cAAe,WACb3X,KAAKukB,iBAAmB,EACxBvkB,KAAKwkB,cAAgB,MAGvBC,eAAgB,WACd,OAAOzkB,KAAKukB,kBAAoB3P,KAAQ5U,KAAKwkB,cAAgBxkB,KAAKukB,kBAYpEG,cAAe,SAASC,GACtB,IAAIC,EAAO5kB,KAAKwV,UAEhB,SACGoP,GACDD,EAAQpkB,UAAYqkB,EAAKrkB,SACzBokB,EAAQjB,cAAgBkB,EAAKlB,eAK3BiB,EAAQ/b,YAAcgc,EAAKhc,WACtBzE,GAAiBwgB,EAAQ/b,WAAYgc,EAAKhc,aACxC+b,EAAQ7X,YAAa8X,EAAK9X,WAE5BtE,GAAgBmc,EAAQ7X,UAAW8X,EAAK9X,aAMnD+X,iBAAkB,SAASjB,GAEzB,IAAI5jB,KAAKykB,iBAAT,CAIA,IAAI9U,EAASiU,EAAQjU,OAKrB,GAAiB,MAAXA,GAA6B,MAAXA,GAA6B,MAAXA,EAA1C,CAEA,IAAImV,EACJ,IAIIA,EADEhjB,KACM8hB,EAAQvN,QAAQ0O,IAAI,eAEpBnB,EAAQoB,kBAAkB,eAIpCF,EAA8B,IAAtBG,SAASH,EAAO,IACxB,MAAO5iB,IAITlC,KAAKukB,iBAAmBO,IAII,EAAxB9kB,KAAKukB,kBAAwB,KAEjCvkB,KAAKwkB,cAAgB5P,QAGvBkH,MAAO,SAASrV,GACd,IAAIwR,EAAgBjY,KAAK8V,eAErBoP,EAAW,CACXC,QAASnlB,KAAK4V,eACdvB,OAAQ4D,EAAc5D,OACtB+Q,SAAU,cAEZjB,EAAWnkB,KAAKkkB,eAEdC,IACFe,EAAStB,QAAUO,GAIjB1d,EAAKwU,uBAAuBxU,EAAKwU,gBAErCxU,EAAOG,GAAYse,EAAUze,IAGxBkW,KAAO/V,GAAYA,GAAY,GAAI5G,KAAK6V,eAAe8G,MAAOlW,EAAKkW,MACxElW,EAAK6N,MAAQ1N,GAAYA,GAAY,GAAI5G,KAAK6V,eAAevB,OAAQ7N,EAAK6N,OAG1E7N,EAAK6N,MAAM,oBAAsBM,KAAQ5U,KAAKoX,WAE1CpX,KAAKsX,cAAgBtX,KAAKsX,aAAajY,OAAS,IAGlDoH,EAAKqd,YAAc,CACjBnb,OAAQ,GAAG9I,MAAMO,KAAKJ,KAAKsX,aAAc,KAIzCtX,KAAK6V,eAAe0D,OAEtB9S,EAAK8S,KAAOvZ,KAAK6V,eAAe0D,MAI9BtB,EAAc8E,cAAatW,EAAKsW,YAAc9E,EAAc8E,aAG5D9E,EAAclC,UAAStP,EAAKsP,QAAUkC,EAAclC,SAGpDkC,EAAcoN,aAAY5e,EAAK6e,YAAcrN,EAAcoN,YAE/D5e,EAAOzG,KAAKulB,cAAc9e,GAG1BhG,OAAOf,KAAK+G,GAAM+e,QAAQ,SAAS7lB,IAChB,MAAb8G,EAAK9G,IAA8B,KAAd8G,EAAK9G,IAAeiG,GAAca,EAAK9G,aACvD8G,EAAK9G,KAIZgG,EAAWsS,EAAciF,gBAC3BzW,EAAOwR,EAAciF,aAAazW,IAASA,GAIxCA,IAAQb,GAAca,KAMzBd,EAAWsS,EAAcoF,sBACxBpF,EAAcoF,mBAAmB5W,KAOhCzG,KAAKykB,iBACPzkB,KAAKgY,UAAU,OAAQ,uCAAwCvR,GAIzB,iBAA7BwR,EAAcrB,WACnB5O,KAAKC,SAAWgQ,EAAcrB,YAChC5W,KAAKylB,sBAAsBhf,GAG7BzG,KAAKylB,sBAAsBhf,MAI/B8e,cAAe,SAAS9e,GACtB,OAAOuE,GAASvE,EAAMzG,KAAK8V,eAAe7K,eAG5Cya,SAAU,WACR,OAAOre,MAGToe,sBAAuB,SAAShf,EAAMrE,GACpC,IAAIb,EAAOvB,KACPiY,EAAgBjY,KAAK8V,eAEzB,GAAK9V,KAAK2Y,UAQV,GALAlS,EAAOzG,KAAK2jB,YAAYld,GAKnBzG,KAAK8V,eAAe6P,kBAAmB3lB,KAAK0kB,cAAcje,GAA/D,CAQAzG,KAAKyV,aAAehP,EAAKmf,WAAanf,EAAKmf,SAAW5lB,KAAK0lB,YAG3D1lB,KAAKwV,UAAY/O,EAEjBzG,KAAKgY,UAAU,QAAS,uBAAwBvR,GAEhD,IAAIof,EAAO,CACTC,eAAgB,IAChBC,cAAe,YAAc/lB,KAAK4X,QAClCoO,WAAYhmB,KAAK2V,YAGf3V,KAAKwZ,gBACPqM,EAAKI,cAAgBjmB,KAAKwZ,eAG5B,IAAI1M,EAAYrG,EAAKqG,WAAarG,EAAKqG,UAAUnE,OAAO,GAItD3I,KAAK8V,eAAeY,iBACpB1W,KAAK8V,eAAeY,gBAAgB6B,QAEpCvY,KAAK+b,kBAAkB,CACrBsD,SAAU,SACV9e,QAASuM,GACJA,EAAU1H,KAAO0H,EAAU1H,KAAO,KAAO,IAAM0H,EAAUlN,MAC1D6G,EAAKlG,QACTqlB,SAAUnf,EAAKmf,SACf3R,MAAOxN,EAAKwN,OAAS,UAIzB,IAAInL,EAAM9I,KAAK2Z,iBACd1B,EAAcsF,WAAavd,KAAKkmB,cAAc9lB,KAAKJ,KAAM,CACxD8I,IAAKA,EACL+c,KAAMA,EACNpf,KAAMA,EACNsR,QAASE,EACTkO,UAAW,WACT5kB,EAAKoW,gBAELpW,EAAKkd,cAAc,UAAW,CAC5BhY,KAAMA,EACN4X,IAAKvV,IAEP1G,GAAYA,KAEdgkB,QAAS,SAAiB7Y,GACxBhM,EAAKyW,UAAU,QAAS,mCAAoCzK,GAExDA,EAAMqW,SACRriB,EAAKsjB,iBAAiBtX,EAAMqW,SAG9BriB,EAAKkd,cAAc,UAAW,CAC5BhY,KAAMA,EACN4X,IAAKvV,IAEPyE,EAAQA,GAAS,IAAIlN,MAAM,sDAC3B+B,GAAYA,EAASmL,WApEvBvN,KAAKgY,UAAU,OAAQ,+BAAgCvR,IAyE3Dyf,aAAc,SAASG,GAErB,IAAIvd,EAAMud,EAAKvd,IAAM,IAAM7B,GAAUof,EAAKR,MAEtCS,EAAmB,KACnBC,EAA2B,GAU/B,GARIF,EAAKtO,QAAQ1B,UACfiQ,EAAmBtmB,KAAKwmB,cAAcH,EAAKtO,QAAQ1B,UAGjDgQ,EAAKtO,QAAQ0O,kBACfF,EAA2BvmB,KAAKwmB,cAAcH,EAAKtO,QAAQ0O,kBAGzD3kB,KAAiB,CACnBykB,EAAyBhI,KAAOrd,EAAUmlB,EAAK5f,MAE/C,IAAIigB,EAAsB9f,GAAY,GAAI5G,KAAK6W,gBAC3C8P,EAAe/f,GAAY8f,EAAqBH,GAMpD,OAJID,IACFK,EAAatQ,QAAUiQ,GAGlBllB,GACJwlB,MAAM9d,EAAK6d,GACX5E,KAAK,SAASC,GACb,GAAIA,EAAS6E,GACXR,EAAKF,WAAaE,EAAKF,gBAClB,CACL,IAAI5Y,EAAQ,IAAIlN,MAAM,sBAAwB2hB,EAASrS,QAGvDpC,EAAMqW,QAAU5B,EAChBqE,EAAKD,SAAWC,EAAKD,QAAQ7Y,MAGzB,MAAE,WACR8Y,EAAKD,SACHC,EAAKD,QAAQ,IAAI/lB,MAAM,6CAI/B,IAAIujB,EAAUxiB,GAAQoO,gBAAkB,IAAIpO,GAAQoO,eAC/CoU,KAGS,oBAAqBA,GAAqC,oBAAnBkD,kBAIjD,oBAAqBlD,EACvBA,EAAQjC,mBAAqB,WAC3B,GAA2B,IAAvBiC,EAAQnC,WAEL,GAAuB,MAAnBmC,EAAQjU,OACjB0W,EAAKF,WAAaE,EAAKF,iBAClB,GAAIE,EAAKD,QAAS,CACvB,IAAI9lB,EAAM,IAAID,MAAM,sBAAwBujB,EAAQjU,QACpDrP,EAAIsjB,QAAUA,EACdyC,EAAKD,QAAQ9lB,MAIjBsjB,EAAU,IAAIkD,eAGdhe,EAAMA,EAAI7F,QAAQ,WAAY,IAG1BojB,EAAKF,YACPvC,EAAQmD,OAASV,EAAKF,WAEpBE,EAAKD,UACPxC,EAAQrV,QAAU,WAChB,IAAIjO,EAAM,IAAID,MAAM,qCACpBC,EAAIsjB,QAAUA,EACdyC,EAAKD,QAAQ9lB,MAKnBsjB,EAAQnU,KAAK,OAAQ3G,GAEjBwd,GACFnkB,GAAKmkB,EAAkB,SAAS3mB,EAAKC,GACnCgkB,EAAQoD,iBAAiBrnB,EAAKC,KAIlCgkB,EAAQlU,KAAKxO,EAAUmlB,EAAK5f,UAG9B+f,cAAe,SAASpT,GACtB,IAAI6T,EAAY,GAEhB,IAAK,IAAItnB,KAAOyT,EACd,GAAIA,EAAKzS,eAAehB,GAAM,CAC5B,IAAIC,EAAQwT,EAAKzT,GACjBsnB,EAAUtnB,GAAwB,mBAAVC,EAAuBA,IAAUA,EAI7D,OAAOqnB,GAGTjP,UAAW,SAAS/D,GAGhBjU,KAAKkX,wBAAwBjD,KAC5BjU,KAAK6L,OAAS7L,KAAK8V,eAAejK,QAGnC0I,SAAS7T,UAAUqM,MAAM3M,KACvBJ,KAAKkX,wBAAwBjD,GAC7BjU,KAAKiX,iBACL,GAAGpX,MAAMO,KAAK6M,UAAW,KAK/BwP,cAAe,SAAS9c,EAAKia,GACvBpY,EAAYoY,UACP5Z,KAAK6V,eAAelW,GAE3BK,KAAK6V,eAAelW,GAAOiH,GAAY5G,KAAK6V,eAAelW,IAAQ,GAAIia,KAM7E1E,GAAMxU,UAAUwmB,QAAUhS,GAAMxU,UAAU6b,eAC1CrH,GAAMxU,UAAUymB,kBAAoBjS,GAAMxU,UAAUsc,WAEpD,IAAAoK,GAAiBlS,GCpuEb9T,GACgB,oBAAXC,OACHA,YACkB,IAAXC,EAAyBA,EAAyB,oBAATC,KAAuBA,KAAO,GAChF8lB,GAASjmB,GAAQ8T,MAEjBA,GAAQ,IAAIoS,GAQhBpS,GAAMqS,WAAa,WAEjB,OADAnmB,GAAQ8T,MAAQmS,GACTnS,IAGTA,GAAMwI,YAEN,IC6PUte,GAAGuS,GAAGzK,GAAMa,GAAG9D,GAAGgf,GAlRhB9Z,GACFqe,GDoBVC,GAAiBvS,GAoCjBwS,GAAwBJ,gBCzDZne,GAAS9H,OAAO8K,SAAhBhD,KACFqe,GAAM,CACRG,KAAe,YAATxe,GACNye,IAAc,gBAATze,IAGT+C,SAAS6O,iBAAiB,mBAAoB,WAC1C7F,GAAM0E,QAAQ,WACV,IACMiO,EAAY3b,SAAS4b,eAAe,aAEtCzmB,OAAO0mB,KACP1mB,OAAO0mB,IAAIC,MAAM,CACbC,MAAO,CACHC,UAAW,mBASvBhc,SAAS6O,iBAAiB,WAAY,SAAAL,GAC7BA,EAAM0E,OAAO+I,YAAaN,EAAUO,SAAS1N,EAAM0E,SAIxD1E,EAAM0E,OAAO+I,UAAUE,OARN,eAYrBnc,SAAS6O,iBAAiB,UAAW,SAAAL,GACX,IAAlBA,EAAM4N,SAMVna,WAAW,WACP,IAAMoa,EAAUrc,SAASsc,cAEpBD,GAAYA,EAAQJ,YAAaN,EAAUO,SAASG,IAIzDA,EAAQJ,UAAUM,IA1BL,cA2Bd,MAIP,IAAMC,EAAS,IAAIC,KA3CF,UA2CiB,CAC9B9c,OAAO,EACP+c,MAAO,wBACPC,QAAS,mBACTC,SAAU,CACNxnB,QAAQ,GAEZynB,SAAU,CACNC,UAAU,GAEdC,SAAU,CACNC,QAAQ,GAEZxpB,KAAM,CACFypB,OAAQ,2CAEZC,IAAK,CACDC,QAAS7B,GAAIG,MAAQH,GAAII,IACzB0B,YAAa,qBAKrBjoB,OAAOqnB,OAASA,EAGhB,IAAMa,EAAUrd,SAASsd,iBAAiB,iBACpCC,EAAQ,CACVC,MAAO,QACPC,MAAO,QACPC,QAAS,UACTC,MAAO,SAEPC,EAAczoB,OAAO8K,SAASiH,KAAKnQ,QAAQ,IAAK,IAC9C8mB,EAAiB1oB,OAAOghB,SAAWhhB,OAAOghB,QAAQC,UAGxD,SAAS0H,EAAYnb,EAASvL,EAAW2mB,GACjCpb,GACAA,EAAQsZ,UAAU8B,EAAQ,MAAQ,UAAU3mB,GAKpD,SAAS4mB,EAAU9kB,EAAM+kB,GAErB,GACM/kB,KAAQqkB,IACRU,GAAQ/kB,IAAS0kB,KACjBA,EAAYzqB,QAAU+F,IAASqkB,EAAMC,OAH3C,CAQA,OAAQtkB,GACJ,KAAKqkB,EAAMC,MACPhB,EAAOxlB,OAAS,CACZkC,KAAM,QACNwjB,MAAO,wBACP7lB,QAAS,CACL,CACIsb,IAAK,yEACLjZ,KAAM,YACNglB,KAAM,KAEV,CACI/L,IAAK,yEACLjZ,KAAM,YACNglB,KAAM,KAEV,CACI/L,IAAK,0EACLjZ,KAAM,YACNglB,KAAM,MAEV,CACI/L,IAAK,0EACLjZ,KAAM,YACNglB,KAAM,OAGdC,OAAQ,uEACRC,OAAQ,CACJ,CACIC,KAAM,WACNC,MAAO,UACPC,QAAS,KACTpM,IAAK,0EACLqM,SAAS,GAEb,CACIH,KAAM,WACNC,MAAO,SACPC,QAAS,KACTpM,IAAK,6EAKjB,MAEJ,KAAKoL,EAAME,MACPjB,EAAOxlB,OAAS,CACZkC,KAAM,QACNwjB,MAAO,8DACP7lB,QAAS,CACL,CACIsb,IAAK,8EACLjZ,KAAM,aAEV,CACIiZ,IAAK,8EACLjZ,KAAM,eAKlB,MAEJ,KAAKqkB,EAAMG,QACPlB,EAAOxlB,OAAS,CACZkC,KAAM,QACNrC,QAAS,CACL,CACIsb,IAAK,0CACLsM,SAAU,aAKtB,MAEJ,KAAKlB,EAAMI,MACPnB,EAAOxlB,OAAS,CACZkC,KAAM,QACNrC,QAAS,CACL,CACIsb,IAAK,6BACLsM,SAAU,WAY9Bb,EAAc1kB,EAGdqF,MAAMkV,KAAK4J,GAAS/D,QAAQ,SAAAoF,GAAM,OAAIZ,EAAYY,EAAOC,cAAe,UAAU,KAGlFb,EAAY9d,SAAS4e,cAAT,iBAAA9d,OAAwC5H,EAAxC,OAAmD,UAAU,GAGzEqF,MAAMkV,KAAKzT,SAASsd,iBAAiB,gBAAgBhE,QAAQ,SAAAuF,GACzDA,EAAKC,aAAa,SAAU,MAEhC9e,SAAS4e,cAAT,gBAAA9d,OAAuC5H,IAAQ6lB,gBAAgB,WAwBnE,GApBAxgB,MAAMkV,KAAK4J,GAAS/D,QAAQ,SAAAoF,GACxBA,EAAO7P,iBAAiB,QAAS,WAC7B,IAAM3V,EAAOwlB,EAAO7mB,aAAa,eAEjCmmB,EAAU9kB,GAEN2kB,GACA1oB,OAAOghB,QAAQC,UAAU,CAAEld,KAAAA,GAAQ,GAAnC,IAAA4H,OAA2C5H,QAMvD/D,OAAO0Z,iBAAiB,WAAY,SAAAL,GAC5BA,EAAMuP,OAAS,SAAUvP,EAAMuP,OAC/BC,EAAUxP,EAAMuP,MAAM7kB,QAK1B2kB,EAAgB,CAChB,IAAML,GAASI,EAAYzqB,OAGvBqqB,IACAI,EAAcL,EAAMC,OAIpBI,KAAeL,GACfpoB,OAAOghB,QAAQE,aACX,CACInd,KAAM0kB,GAEV,GACAJ,EAAQ,GAAH,IAAA1c,OAAY8c,IAKrBA,IAAgBL,EAAMC,OACtBQ,EAAUJ,GAAa,QAQnCtC,GAAIG,MACJzS,GAAM2C,OAAO,6DAA6Da,UAM1E8O,GAAIG,OACFvoB,GAaCiC,OAbEsQ,GAaMzF,SAbHhF,GAaa,SAbPa,GAakE,KAZ5E3I,GAAE8rB,sBAAwBnjB,GAC1B3I,GAAC,GACGA,GAAC,IACD,YACKA,GAAC,GAAIsS,EAAItS,GAAC,GAAIsS,GAAK,IAAIxR,KAAK+M,YAErC7N,GAAC,GAAI+rB,EAAI,EAAI,IAAItW,KACjB5Q,GAAI0N,GAAEwM,cAAcjX,IACpB+b,GAAItR,GAAEyZ,qBAAqBlkB,IAAG,GAC9BjD,GAAEma,MAAQ,EACVna,GAAEoa,IAEyB,gDAD3B4E,GAAE3a,WAAW+iB,aAAapnB,GAAGgf,IAEjC5hB,OAAOiqB,GAAG,SAAU,iBAAkB,QACtCjqB,OAAOiqB,GAAG,OAAQ","file":"demo.min.js","sourcesContent":["/*\n json-stringify-safe\n Like JSON.stringify, but doesn't throw on circular references.\n\n Originally forked from https://github.com/isaacs/json-stringify-safe\n version 5.0.1 on 3/8/2017 and modified to handle Errors serialization\n and IE8 compatibility. Tests for this are in test/vendor.\n\n ISC license: https://github.com/isaacs/json-stringify-safe/blob/master/LICENSE\n*/\n\nexports = module.exports = stringify;\nexports.getSerialize = serializer;\n\nfunction indexOf(haystack, needle) {\n for (var i = 0; i < haystack.length; ++i) {\n if (haystack[i] === needle) return i;\n }\n return -1;\n}\n\nfunction stringify(obj, replacer, spaces, cycleReplacer) {\n return JSON.stringify(obj, serializer(replacer, cycleReplacer), spaces);\n}\n\n// https://github.com/ftlabs/js-abbreviate/blob/fa709e5f139e7770a71827b1893f22418097fbda/index.js#L95-L106\nfunction stringifyError(value) {\n var err = {\n // These properties are implemented as magical getters and don't show up in for in\n stack: value.stack,\n message: value.message,\n name: value.name\n };\n\n for (var i in value) {\n if (Object.prototype.hasOwnProperty.call(value, i)) {\n err[i] = value[i];\n }\n }\n\n return err;\n}\n\nfunction serializer(replacer, cycleReplacer) {\n var stack = [];\n var keys = [];\n\n if (cycleReplacer == null) {\n cycleReplacer = function(key, value) {\n if (stack[0] === value) {\n return '[Circular ~]';\n }\n return '[Circular ~.' + keys.slice(0, indexOf(stack, value)).join('.') + ']';\n };\n }\n\n return function(key, value) {\n if (stack.length > 0) {\n var thisPos = indexOf(stack, this);\n ~thisPos ? stack.splice(thisPos + 1) : stack.push(this);\n ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key);\n\n if (~indexOf(stack, value)) {\n value = cycleReplacer.call(this, key, value);\n }\n } else {\n stack.push(value);\n }\n\n return replacer == null\n ? value instanceof Error ? stringifyError(value) : value\n : replacer.call(this, key, value);\n };\n}\n","var stringify = require('../vendor/json-stringify-safe/stringify');\n\nvar _window =\n typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined'\n ? global\n : typeof self !== 'undefined'\n ? self\n : {};\n\nfunction isObject(what) {\n return typeof what === 'object' && what !== null;\n}\n\n// Yanked from https://git.io/vS8DV re-used under CC0\n// with some tiny modifications\nfunction isError(value) {\n switch (Object.prototype.toString.call(value)) {\n case '[object Error]':\n return true;\n case '[object Exception]':\n return true;\n case '[object DOMException]':\n return true;\n default:\n return value instanceof Error;\n }\n}\n\nfunction isErrorEvent(value) {\n return Object.prototype.toString.call(value) === '[object ErrorEvent]';\n}\n\nfunction isDOMError(value) {\n return Object.prototype.toString.call(value) === '[object DOMError]';\n}\n\nfunction isDOMException(value) {\n return Object.prototype.toString.call(value) === '[object DOMException]';\n}\n\nfunction isUndefined(what) {\n return what === void 0;\n}\n\nfunction isFunction(what) {\n return typeof what === 'function';\n}\n\nfunction isPlainObject(what) {\n return Object.prototype.toString.call(what) === '[object Object]';\n}\n\nfunction isString(what) {\n return Object.prototype.toString.call(what) === '[object String]';\n}\n\nfunction isArray(what) {\n return Object.prototype.toString.call(what) === '[object Array]';\n}\n\nfunction isEmptyObject(what) {\n if (!isPlainObject(what)) return false;\n\n for (var _ in what) {\n if (what.hasOwnProperty(_)) {\n return false;\n }\n }\n return true;\n}\n\nfunction supportsErrorEvent() {\n try {\n new ErrorEvent(''); // eslint-disable-line no-new\n return true;\n } catch (e) {\n return false;\n }\n}\n\nfunction supportsDOMError() {\n try {\n new DOMError(''); // eslint-disable-line no-new\n return true;\n } catch (e) {\n return false;\n }\n}\n\nfunction supportsDOMException() {\n try {\n new DOMException(''); // eslint-disable-line no-new\n return true;\n } catch (e) {\n return false;\n }\n}\n\nfunction supportsFetch() {\n if (!('fetch' in _window)) return false;\n\n try {\n new Headers(); // eslint-disable-line no-new\n new Request(''); // eslint-disable-line no-new\n new Response(); // eslint-disable-line no-new\n return true;\n } catch (e) {\n return false;\n }\n}\n\n// Despite all stars in the sky saying that Edge supports old draft syntax, aka 'never', 'always', 'origin' and 'default\n// https://caniuse.com/#feat=referrer-policy\n// It doesn't. And it throw exception instead of ignoring this parameter...\n// REF: https://github.com/getsentry/raven-js/issues/1233\nfunction supportsReferrerPolicy() {\n if (!supportsFetch()) return false;\n\n try {\n // eslint-disable-next-line no-new\n new Request('pickleRick', {\n referrerPolicy: 'origin'\n });\n return true;\n } catch (e) {\n return false;\n }\n}\n\nfunction supportsPromiseRejectionEvent() {\n return typeof PromiseRejectionEvent === 'function';\n}\n\nfunction wrappedCallback(callback) {\n function dataCallback(data, original) {\n var normalizedData = callback(data) || data;\n if (original) {\n return original(normalizedData) || normalizedData;\n }\n return normalizedData;\n }\n\n return dataCallback;\n}\n\nfunction each(obj, callback) {\n var i, j;\n\n if (isUndefined(obj.length)) {\n for (i in obj) {\n if (hasKey(obj, i)) {\n callback.call(null, i, obj[i]);\n }\n }\n } else {\n j = obj.length;\n if (j) {\n for (i = 0; i < j; i++) {\n callback.call(null, i, obj[i]);\n }\n }\n }\n}\n\nfunction objectMerge(obj1, obj2) {\n if (!obj2) {\n return obj1;\n }\n each(obj2, function(key, value) {\n obj1[key] = value;\n });\n return obj1;\n}\n\n/**\n * This function is only used for react-native.\n * react-native freezes object that have already been sent over the\n * js bridge. We need this function in order to check if the object is frozen.\n * So it's ok that objectFrozen returns false if Object.isFrozen is not\n * supported because it's not relevant for other \"platforms\". See related issue:\n * https://github.com/getsentry/react-native-sentry/issues/57\n */\nfunction objectFrozen(obj) {\n if (!Object.isFrozen) {\n return false;\n }\n return Object.isFrozen(obj);\n}\n\nfunction truncate(str, max) {\n if (typeof max !== 'number') {\n throw new Error('2nd argument to `truncate` function should be a number');\n }\n if (typeof str !== 'string' || max === 0) {\n return str;\n }\n return str.length <= max ? str : str.substr(0, max) + '\\u2026';\n}\n\n/**\n * hasKey, a better form of hasOwnProperty\n * Example: hasKey(MainHostObject, property) === true/false\n *\n * @param {Object} host object to check property\n * @param {string} key to check\n */\nfunction hasKey(object, key) {\n return Object.prototype.hasOwnProperty.call(object, key);\n}\n\nfunction joinRegExp(patterns) {\n // Combine an array of regular expressions and strings into one large regexp\n // Be mad.\n var sources = [],\n i = 0,\n len = patterns.length,\n pattern;\n\n for (; i < len; i++) {\n pattern = patterns[i];\n if (isString(pattern)) {\n // If it's a string, we need to escape it\n // Taken from: https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Regular_Expressions\n sources.push(pattern.replace(/([.*+?^=!:${}()|\\[\\]\\/\\\\])/g, '\\\\$1'));\n } else if (pattern && pattern.source) {\n // If it's a regexp already, we want to extract the source\n sources.push(pattern.source);\n }\n // Intentionally skip other cases\n }\n return new RegExp(sources.join('|'), 'i');\n}\n\nfunction urlencode(o) {\n var pairs = [];\n each(o, function(key, value) {\n pairs.push(encodeURIComponent(key) + '=' + encodeURIComponent(value));\n });\n return pairs.join('&');\n}\n\n// borrowed from https://tools.ietf.org/html/rfc3986#appendix-B\n// intentionally using regex and not <a/> href parsing trick because React Native and other\n// environments where DOM might not be available\nfunction parseUrl(url) {\n if (typeof url !== 'string') return {};\n var match = url.match(/^(([^:\\/?#]+):)?(\\/\\/([^\\/?#]*))?([^?#]*)(\\?([^#]*))?(#(.*))?$/);\n\n // coerce to undefined values to empty string so we don't get 'undefined'\n var query = match[6] || '';\n var fragment = match[8] || '';\n return {\n protocol: match[2],\n host: match[4],\n path: match[5],\n relative: match[5] + query + fragment // everything minus origin\n };\n}\nfunction uuid4() {\n var crypto = _window.crypto || _window.msCrypto;\n\n if (!isUndefined(crypto) && crypto.getRandomValues) {\n // Use window.crypto API if available\n // eslint-disable-next-line no-undef\n var arr = new Uint16Array(8);\n crypto.getRandomValues(arr);\n\n // set 4 in byte 7\n arr[3] = (arr[3] & 0xfff) | 0x4000;\n // set 2 most significant bits of byte 9 to '10'\n arr[4] = (arr[4] & 0x3fff) | 0x8000;\n\n var pad = function(num) {\n var v = num.toString(16);\n while (v.length < 4) {\n v = '0' + v;\n }\n return v;\n };\n\n return (\n pad(arr[0]) +\n pad(arr[1]) +\n pad(arr[2]) +\n pad(arr[3]) +\n pad(arr[4]) +\n pad(arr[5]) +\n pad(arr[6]) +\n pad(arr[7])\n );\n } else {\n // http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#2117523\n return 'xxxxxxxxxxxx4xxxyxxxxxxxxxxxxxxx'.replace(/[xy]/g, function(c) {\n var r = (Math.random() * 16) | 0,\n v = c === 'x' ? r : (r & 0x3) | 0x8;\n return v.toString(16);\n });\n }\n}\n\n/**\n * Given a child DOM element, returns a query-selector statement describing that\n * and its ancestors\n * e.g. [HTMLElement] => body > div > input#foo.btn[name=baz]\n * @param elem\n * @returns {string}\n */\nfunction htmlTreeAsString(elem) {\n /* eslint no-extra-parens:0*/\n var MAX_TRAVERSE_HEIGHT = 5,\n MAX_OUTPUT_LEN = 80,\n out = [],\n height = 0,\n len = 0,\n separator = ' > ',\n sepLength = separator.length,\n nextStr;\n\n while (elem && height++ < MAX_TRAVERSE_HEIGHT) {\n nextStr = htmlElementAsString(elem);\n // bail out if\n // - nextStr is the 'html' element\n // - the length of the string that would be created exceeds MAX_OUTPUT_LEN\n // (ignore this limit if we are on the first iteration)\n if (\n nextStr === 'html' ||\n (height > 1 && len + out.length * sepLength + nextStr.length >= MAX_OUTPUT_LEN)\n ) {\n break;\n }\n\n out.push(nextStr);\n\n len += nextStr.length;\n elem = elem.parentNode;\n }\n\n return out.reverse().join(separator);\n}\n\n/**\n * Returns a simple, query-selector representation of a DOM element\n * e.g. [HTMLElement] => input#foo.btn[name=baz]\n * @param HTMLElement\n * @returns {string}\n */\nfunction htmlElementAsString(elem) {\n var out = [],\n className,\n classes,\n key,\n attr,\n i;\n\n if (!elem || !elem.tagName) {\n return '';\n }\n\n out.push(elem.tagName.toLowerCase());\n if (elem.id) {\n out.push('#' + elem.id);\n }\n\n className = elem.className;\n if (className && isString(className)) {\n classes = className.split(/\\s+/);\n for (i = 0; i < classes.length; i++) {\n out.push('.' + classes[i]);\n }\n }\n var attrWhitelist = ['type', 'name', 'title', 'alt'];\n for (i = 0; i < attrWhitelist.length; i++) {\n key = attrWhitelist[i];\n attr = elem.getAttribute(key);\n if (attr) {\n out.push('[' + key + '=\"' + attr + '\"]');\n }\n }\n return out.join('');\n}\n\n/**\n * Returns true if either a OR b is truthy, but not both\n */\nfunction isOnlyOneTruthy(a, b) {\n return !!(!!a ^ !!b);\n}\n\n/**\n * Returns true if both parameters are undefined\n */\nfunction isBothUndefined(a, b) {\n return isUndefined(a) && isUndefined(b);\n}\n\n/**\n * Returns true if the two input exception interfaces have the same content\n */\nfunction isSameException(ex1, ex2) {\n if (isOnlyOneTruthy(ex1, ex2)) return false;\n\n ex1 = ex1.values[0];\n ex2 = ex2.values[0];\n\n if (ex1.type !== ex2.type || ex1.value !== ex2.value) return false;\n\n // in case both stacktraces are undefined, we can't decide so default to false\n if (isBothUndefined(ex1.stacktrace, ex2.stacktrace)) return false;\n\n return isSameStacktrace(ex1.stacktrace, ex2.stacktrace);\n}\n\n/**\n * Returns true if the two input stack trace interfaces have the same content\n */\nfunction isSameStacktrace(stack1, stack2) {\n if (isOnlyOneTruthy(stack1, stack2)) return false;\n\n var frames1 = stack1.frames;\n var frames2 = stack2.frames;\n\n // Exit early if stacktrace is malformed\n if (frames1 === undefined || frames2 === undefined) return false;\n\n // Exit early if frame count differs\n if (frames1.length !== frames2.length) return false;\n\n // Iterate through every frame; bail out if anything differs\n var a, b;\n for (var i = 0; i < frames1.length; i++) {\n a = frames1[i];\n b = frames2[i];\n if (\n a.filename !== b.filename ||\n a.lineno !== b.lineno ||\n a.colno !== b.colno ||\n a['function'] !== b['function']\n )\n return false;\n }\n return true;\n}\n\n/**\n * Polyfill a method\n * @param obj object e.g. `document`\n * @param name method name present on object e.g. `addEventListener`\n * @param replacement replacement function\n * @param track {optional} record instrumentation to an array\n */\nfunction fill(obj, name, replacement, track) {\n if (obj == null) return;\n var orig = obj[name];\n obj[name] = replacement(orig);\n obj[name].__raven__ = true;\n obj[name].__orig__ = orig;\n if (track) {\n track.push([obj, name, orig]);\n }\n}\n\n/**\n * Join values in array\n * @param input array of values to be joined together\n * @param delimiter string to be placed in-between values\n * @returns {string}\n */\nfunction safeJoin(input, delimiter) {\n if (!isArray(input)) return '';\n\n var output = [];\n\n for (var i = 0; i < input.length; i++) {\n try {\n output.push(String(input[i]));\n } catch (e) {\n output.push('[value cannot be serialized]');\n }\n }\n\n return output.join(delimiter);\n}\n\n// Default Node.js REPL depth\nvar MAX_SERIALIZE_EXCEPTION_DEPTH = 3;\n// 50kB, as 100kB is max payload size, so half sounds reasonable\nvar MAX_SERIALIZE_EXCEPTION_SIZE = 50 * 1024;\nvar MAX_SERIALIZE_KEYS_LENGTH = 40;\n\nfunction utf8Length(value) {\n return ~-encodeURI(value).split(/%..|./).length;\n}\n\nfunction jsonSize(value) {\n return utf8Length(JSON.stringify(value));\n}\n\nfunction serializeValue(value) {\n if (typeof value === 'string') {\n var maxLength = 40;\n return truncate(value, maxLength);\n } else if (\n typeof value === 'number' ||\n typeof value === 'boolean' ||\n typeof value === 'undefined'\n ) {\n return value;\n }\n\n var type = Object.prototype.toString.call(value);\n\n // Node.js REPL notation\n if (type === '[object Object]') return '[Object]';\n if (type === '[object Array]') return '[Array]';\n if (type === '[object Function]')\n return value.name ? '[Function: ' + value.name + ']' : '[Function]';\n\n return value;\n}\n\nfunction serializeObject(value, depth) {\n if (depth === 0) return serializeValue(value);\n\n if (isPlainObject(value)) {\n return Object.keys(value).reduce(function(acc, key) {\n acc[key] = serializeObject(value[key], depth - 1);\n return acc;\n }, {});\n } else if (Array.isArray(value)) {\n return value.map(function(val) {\n return serializeObject(val, depth - 1);\n });\n }\n\n return serializeValue(value);\n}\n\nfunction serializeException(ex, depth, maxSize) {\n if (!isPlainObject(ex)) return ex;\n\n depth = typeof depth !== 'number' ? MAX_SERIALIZE_EXCEPTION_DEPTH : depth;\n maxSize = typeof depth !== 'number' ? MAX_SERIALIZE_EXCEPTION_SIZE : maxSize;\n\n var serialized = serializeObject(ex, depth);\n\n if (jsonSize(stringify(serialized)) > maxSize) {\n return serializeException(ex, depth - 1);\n }\n\n return serialized;\n}\n\nfunction serializeKeysForMessage(keys, maxLength) {\n if (typeof keys === 'number' || typeof keys === 'string') return keys.toString();\n if (!Array.isArray(keys)) return '';\n\n keys = keys.filter(function(key) {\n return typeof key === 'string';\n });\n if (keys.length === 0) return '[object has no keys]';\n\n maxLength = typeof maxLength !== 'number' ? MAX_SERIALIZE_KEYS_LENGTH : maxLength;\n if (keys[0].length >= maxLength) return keys[0];\n\n for (var usedKeys = keys.length; usedKeys > 0; usedKeys--) {\n var serialized = keys.slice(0, usedKeys).join(', ');\n if (serialized.length > maxLength) continue;\n if (usedKeys === keys.length) return serialized;\n return serialized + '\\u2026';\n }\n\n return '';\n}\n\nfunction sanitize(input, sanitizeKeys) {\n if (!isArray(sanitizeKeys) || (isArray(sanitizeKeys) && sanitizeKeys.length === 0))\n return input;\n\n var sanitizeRegExp = joinRegExp(sanitizeKeys);\n var sanitizeMask = '********';\n var safeInput;\n\n try {\n safeInput = JSON.parse(stringify(input));\n } catch (o_O) {\n return input;\n }\n\n function sanitizeWorker(workerInput) {\n if (isArray(workerInput)) {\n return workerInput.map(function(val) {\n return sanitizeWorker(val);\n });\n }\n\n if (isPlainObject(workerInput)) {\n return Object.keys(workerInput).reduce(function(acc, k) {\n if (sanitizeRegExp.test(k)) {\n acc[k] = sanitizeMask;\n } else {\n acc[k] = sanitizeWorker(workerInput[k]);\n }\n return acc;\n }, {});\n }\n\n return workerInput;\n }\n\n return sanitizeWorker(safeInput);\n}\n\nmodule.exports = {\n isObject: isObject,\n isError: isError,\n isErrorEvent: isErrorEvent,\n isDOMError: isDOMError,\n isDOMException: isDOMException,\n isUndefined: isUndefined,\n isFunction: isFunction,\n isPlainObject: isPlainObject,\n isString: isString,\n isArray: isArray,\n isEmptyObject: isEmptyObject,\n supportsErrorEvent: supportsErrorEvent,\n supportsDOMError: supportsDOMError,\n supportsDOMException: supportsDOMException,\n supportsFetch: supportsFetch,\n supportsReferrerPolicy: supportsReferrerPolicy,\n supportsPromiseRejectionEvent: supportsPromiseRejectionEvent,\n wrappedCallback: wrappedCallback,\n each: each,\n objectMerge: objectMerge,\n truncate: truncate,\n objectFrozen: objectFrozen,\n hasKey: hasKey,\n joinRegExp: joinRegExp,\n urlencode: urlencode,\n uuid4: uuid4,\n htmlTreeAsString: htmlTreeAsString,\n htmlElementAsString: htmlElementAsString,\n isSameException: isSameException,\n isSameStacktrace: isSameStacktrace,\n parseUrl: parseUrl,\n fill: fill,\n safeJoin: safeJoin,\n serializeException: serializeException,\n serializeKeysForMessage: serializeKeysForMessage,\n sanitize: sanitize\n};\n","var utils = require('../../src/utils');\n\n/*\n TraceKit - Cross brower stack traces\n\n This was originally forked from github.com/occ/TraceKit, but has since been\n largely re-written and is now maintained as part of raven-js. Tests for\n this are in test/vendor.\n\n MIT license\n*/\n\nvar TraceKit = {\n collectWindowErrors: true,\n debug: false\n};\n\n// This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785)\nvar _window =\n typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {};\n\n// global reference to slice\nvar _slice = [].slice;\nvar UNKNOWN_FUNCTION = '?';\n\n// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Error#Error_types\nvar ERROR_TYPES_RE = /^(?:[Uu]ncaught (?:exception: )?)?(?:((?:Eval|Internal|Range|Reference|Syntax|Type|URI|)Error): )?(.*)$/;\n\nfunction getLocationHref() {\n if (typeof document === 'undefined' || document.location == null) return '';\n return document.location.href;\n}\n\nfunction getLocationOrigin() {\n if (typeof document === 'undefined' || document.location == null) return '';\n\n // Oh dear IE10...\n if (!document.location.origin) {\n return (\n document.location.protocol +\n '//' +\n document.location.hostname +\n (document.location.port ? ':' + document.location.port : '')\n );\n }\n\n return document.location.origin;\n}\n\n/**\n * TraceKit.report: cross-browser processing of unhandled exceptions\n *\n * Syntax:\n * TraceKit.report.subscribe(function(stackInfo) { ... })\n * TraceKit.report.unsubscribe(function(stackInfo) { ... })\n * TraceKit.report(exception)\n * try { ...code... } catch(ex) { TraceKit.report(ex); }\n *\n * Supports:\n * - Firefox: full stack trace with line numbers, plus column number\n * on top frame; column number is not guaranteed\n * - Opera: full stack trace with line and column numbers\n * - Chrome: full stack trace with line and column numbers\n * - Safari: line and column number for the top frame only; some frames\n * may be missing, and column number is not guaranteed\n * - IE: line and column number for the top frame only; some frames\n * may be missing, and column number is not guaranteed\n *\n * In theory, TraceKit should work on all of the following versions:\n * - IE5.5+ (only 8.0 tested)\n * - Firefox 0.9+ (only 3.5+ tested)\n * - Opera 7+ (only 10.50 tested; versions 9 and earlier may require\n * Exceptions Have Stacktrace to be enabled in opera:config)\n * - Safari 3+ (only 4+ tested)\n * - Chrome 1+ (only 5+ tested)\n * - Konqueror 3.5+ (untested)\n *\n * Requires TraceKit.computeStackTrace.\n *\n * Tries to catch all unhandled exceptions and report them to the\n * subscribed handlers. Please note that TraceKit.report will rethrow the\n * exception. This is REQUIRED in order to get a useful stack trace in IE.\n * If the exception does not reach the top of the browser, you will only\n * get a stack trace from the point where TraceKit.report was called.\n *\n * Handlers receive a stackInfo object as described in the\n * TraceKit.computeStackTrace docs.\n */\nTraceKit.report = (function reportModuleWrapper() {\n var handlers = [],\n lastArgs = null,\n lastException = null,\n lastExceptionStack = null;\n\n /**\n * Add a crash handler.\n * @param {Function} handler\n */\n function subscribe(handler) {\n installGlobalHandler();\n handlers.push(handler);\n }\n\n /**\n * Remove a crash handler.\n * @param {Function} handler\n */\n function unsubscribe(handler) {\n for (var i = handlers.length - 1; i >= 0; --i) {\n if (handlers[i] === handler) {\n handlers.splice(i, 1);\n }\n }\n }\n\n /**\n * Remove all crash handlers.\n */\n function unsubscribeAll() {\n uninstallGlobalHandler();\n handlers = [];\n }\n\n /**\n * Dispatch stack information to all handlers.\n * @param {Object.<string, *>} stack\n */\n function notifyHandlers(stack, isWindowError) {\n var exception = null;\n if (isWindowError && !TraceKit.collectWindowErrors) {\n return;\n }\n for (var i in handlers) {\n if (handlers.hasOwnProperty(i)) {\n try {\n handlers[i].apply(null, [stack].concat(_slice.call(arguments, 2)));\n } catch (inner) {\n exception = inner;\n }\n }\n }\n\n if (exception) {\n throw exception;\n }\n }\n\n var _oldOnerrorHandler, _onErrorHandlerInstalled;\n\n /**\n * Ensures all global unhandled exceptions are recorded.\n * Supported by Gecko and IE.\n * @param {string} msg Error message.\n * @param {string} url URL of script that generated the exception.\n * @param {(number|string)} lineNo The line number at which the error\n * occurred.\n * @param {?(number|string)} colNo The column number at which the error\n * occurred.\n * @param {?Error} ex The actual Error object.\n */\n function traceKitWindowOnError(msg, url, lineNo, colNo, ex) {\n var stack = null;\n // If 'ex' is ErrorEvent, get real Error from inside\n var exception = utils.isErrorEvent(ex) ? ex.error : ex;\n // If 'msg' is ErrorEvent, get real message from inside\n var message = utils.isErrorEvent(msg) ? msg.message : msg;\n\n if (lastExceptionStack) {\n TraceKit.computeStackTrace.augmentStackTraceWithInitialElement(\n lastExceptionStack,\n url,\n lineNo,\n message\n );\n processLastException();\n } else if (exception && utils.isError(exception)) {\n // non-string `exception` arg; attempt to extract stack trace\n\n // New chrome and blink send along a real error object\n // Let's just report that like a normal error.\n // See: https://mikewest.org/2013/08/debugging-runtime-errors-with-window-onerror\n stack = TraceKit.computeStackTrace(exception);\n notifyHandlers(stack, true);\n } else {\n var location = {\n url: url,\n line: lineNo,\n column: colNo\n };\n\n var name = undefined;\n var groups;\n\n if ({}.toString.call(message) === '[object String]') {\n var groups = message.match(ERROR_TYPES_RE);\n if (groups) {\n name = groups[1];\n message = groups[2];\n }\n }\n\n location.func = UNKNOWN_FUNCTION;\n\n stack = {\n name: name,\n message: message,\n url: getLocationHref(),\n stack: [location]\n };\n notifyHandlers(stack, true);\n }\n\n if (_oldOnerrorHandler) {\n return _oldOnerrorHandler.apply(this, arguments);\n }\n\n return false;\n }\n\n function installGlobalHandler() {\n if (_onErrorHandlerInstalled) {\n return;\n }\n _oldOnerrorHandler = _window.onerror;\n _window.onerror = traceKitWindowOnError;\n _onErrorHandlerInstalled = true;\n }\n\n function uninstallGlobalHandler() {\n if (!_onErrorHandlerInstalled) {\n return;\n }\n _window.onerror = _oldOnerrorHandler;\n _onErrorHandlerInstalled = false;\n _oldOnerrorHandler = undefined;\n }\n\n function processLastException() {\n var _lastExceptionStack = lastExceptionStack,\n _lastArgs = lastArgs;\n lastArgs = null;\n lastExceptionStack = null;\n lastException = null;\n notifyHandlers.apply(null, [_lastExceptionStack, false].concat(_lastArgs));\n }\n\n /**\n * Reports an unhandled Error to TraceKit.\n * @param {Error} ex\n * @param {?boolean} rethrow If false, do not re-throw the exception.\n * Only used for window.onerror to not cause an infinite loop of\n * rethrowing.\n */\n function report(ex, rethrow) {\n var args = _slice.call(arguments, 1);\n if (lastExceptionStack) {\n if (lastException === ex) {\n return; // already caught by an inner catch block, ignore\n } else {\n processLastException();\n }\n }\n\n var stack = TraceKit.computeStackTrace(ex);\n lastExceptionStack = stack;\n lastException = ex;\n lastArgs = args;\n\n // If the stack trace is incomplete, wait for 2 seconds for\n // slow slow IE to see if onerror occurs or not before reporting\n // this exception; otherwise, we will end up with an incomplete\n // stack trace\n setTimeout(function() {\n if (lastException === ex) {\n processLastException();\n }\n }, stack.incomplete ? 2000 : 0);\n\n if (rethrow !== false) {\n throw ex; // re-throw to propagate to the top level (and cause window.onerror)\n }\n }\n\n report.subscribe = subscribe;\n report.unsubscribe = unsubscribe;\n report.uninstall = unsubscribeAll;\n return report;\n})();\n\n/**\n * TraceKit.computeStackTrace: cross-browser stack traces in JavaScript\n *\n * Syntax:\n * s = TraceKit.computeStackTrace(exception) // consider using TraceKit.report instead (see below)\n * Returns:\n * s.name - exception name\n * s.message - exception message\n * s.stack[i].url - JavaScript or HTML file URL\n * s.stack[i].func - function name, or empty for anonymous functions (if guessing did not work)\n * s.stack[i].args - arguments passed to the function, if known\n * s.stack[i].line - line number, if known\n * s.stack[i].column - column number, if known\n *\n * Supports:\n * - Firefox: full stack trace with line numbers and unreliable column\n * number on top frame\n * - Opera 10: full stack trace with line and column numbers\n * - Opera 9-: full stack trace with line numbers\n * - Chrome: full stack trace with line and column numbers\n * - Safari: line and column number for the topmost stacktrace element\n * only\n * - IE: no line numbers whatsoever\n *\n * Tries to guess names of anonymous functions by looking for assignments\n * in the source code. In IE and Safari, we have to guess source file names\n * by searching for function bodies inside all page scripts. This will not\n * work for scripts that are loaded cross-domain.\n * Here be dragons: some function names may be guessed incorrectly, and\n * duplicate functions may be mismatched.\n *\n * TraceKit.computeStackTrace should only be used for tracing purposes.\n * Logging of unhandled exceptions should be done with TraceKit.report,\n * which builds on top of TraceKit.computeStackTrace and provides better\n * IE support by utilizing the window.onerror event to retrieve information\n * about the top of the stack.\n *\n * Note: In IE and Safari, no stack trace is recorded on the Error object,\n * so computeStackTrace instead walks its *own* chain of callers.\n * This means that:\n * * in Safari, some methods may be missing from the stack trace;\n * * in IE, the topmost function in the stack trace will always be the\n * caller of computeStackTrace.\n *\n * This is okay for tracing (because you are likely to be calling\n * computeStackTrace from the function you want to be the topmost element\n * of the stack trace anyway), but not okay for logging unhandled\n * exceptions (because your catch block will likely be far away from the\n * inner function that actually caused the exception).\n *\n */\nTraceKit.computeStackTrace = (function computeStackTraceWrapper() {\n // Contents of Exception in various browsers.\n //\n // SAFARI:\n // ex.message = Can't find variable: qq\n // ex.line = 59\n // ex.sourceId = 580238192\n // ex.sourceURL = http://...\n // ex.expressionBeginOffset = 96\n // ex.expressionCaretOffset = 98\n // ex.expressionEndOffset = 98\n // ex.name = ReferenceError\n //\n // FIREFOX:\n // ex.message = qq is not defined\n // ex.fileName = http://...\n // ex.lineNumber = 59\n // ex.columnNumber = 69\n // ex.stack = ...stack trace... (see the example below)\n // ex.name = ReferenceError\n //\n // CHROME:\n // ex.message = qq is not defined\n // ex.name = ReferenceError\n // ex.type = not_defined\n // ex.arguments = ['aa']\n // ex.stack = ...stack trace...\n //\n // INTERNET EXPLORER:\n // ex.message = ...\n // ex.name = ReferenceError\n //\n // OPERA:\n // ex.message = ...message... (see the example below)\n // ex.name = ReferenceError\n // ex.opera#sourceloc = 11 (pretty much useless, duplicates the info in ex.message)\n // ex.stacktrace = n/a; see 'opera:config#UserPrefs|Exceptions Have Stacktrace'\n\n /**\n * Computes stack trace information from the stack property.\n * Chrome and Gecko use this property.\n * @param {Error} ex\n * @return {?Object.<string, *>} Stack trace information.\n */\n function computeStackTraceFromStackProp(ex) {\n if (typeof ex.stack === 'undefined' || !ex.stack) return;\n\n var chrome = /^\\s*at (?:(.*?) ?\\()?((?:file|https?|blob|chrome-extension|native|eval|webpack|<anonymous>|[a-z]:|\\/).*?)(?::(\\d+))?(?::(\\d+))?\\)?\\s*$/i;\n var winjs = /^\\s*at (?:((?:\\[object object\\])?.+) )?\\(?((?:file|ms-appx(?:-web)|https?|webpack|blob):.*?):(\\d+)(?::(\\d+))?\\)?\\s*$/i;\n // NOTE: blob urls are now supposed to always have an origin, therefore it's format\n // which is `blob:http://url/path/with-some-uuid`, is matched by `blob.*?:\\/` as well\n var gecko = /^\\s*(.*?)(?:\\((.*?)\\))?(?:^|@)((?:file|https?|blob|chrome|webpack|resource|moz-extension).*?:\\/.*?|\\[native code\\]|[^@]*bundle)(?::(\\d+))?(?::(\\d+))?\\s*$/i;\n // Used to additionally parse URL/line/column from eval frames\n var geckoEval = /(\\S+) line (\\d+)(?: > eval line \\d+)* > eval/i;\n var chromeEval = /\\((\\S*)(?::(\\d+))(?::(\\d+))\\)/;\n var lines = ex.stack.split('\\n');\n var stack = [];\n var submatch;\n var parts;\n var element;\n var reference = /^(.*) is undefined$/.exec(ex.message);\n\n for (var i = 0, j = lines.length; i < j; ++i) {\n if ((parts = chrome.exec(lines[i]))) {\n var isNative = parts[2] && parts[2].indexOf('native') === 0; // start of line\n var isEval = parts[2] && parts[2].indexOf('eval') === 0; // start of line\n if (isEval && (submatch = chromeEval.exec(parts[2]))) {\n // throw out eval line/column and use top-most line/column number\n parts[2] = submatch[1]; // url\n parts[3] = submatch[2]; // line\n parts[4] = submatch[3]; // column\n }\n element = {\n url: !isNative ? parts[2] : null,\n func: parts[1] || UNKNOWN_FUNCTION,\n args: isNative ? [parts[2]] : [],\n line: parts[3] ? +parts[3] : null,\n column: parts[4] ? +parts[4] : null\n };\n } else if ((parts = winjs.exec(lines[i]))) {\n element = {\n url: parts[2],\n func: parts[1] || UNKNOWN_FUNCTION,\n args: [],\n line: +parts[3],\n column: parts[4] ? +parts[4] : null\n };\n } else if ((parts = gecko.exec(lines[i]))) {\n var isEval = parts[3] && parts[3].indexOf(' > eval') > -1;\n if (isEval && (submatch = geckoEval.exec(parts[3]))) {\n // throw out eval line/column and use top-most line number\n parts[3] = submatch[1];\n parts[4] = submatch[2];\n parts[5] = null; // no column when eval\n } else if (i === 0 && !parts[5] && typeof ex.columnNumber !== 'undefined') {\n // FireFox uses this awesome columnNumber property for its top frame\n // Also note, Firefox's column number is 0-based and everything else expects 1-based,\n // so adding 1\n // NOTE: this hack doesn't work if top-most frame is eval\n stack[0].column = ex.columnNumber + 1;\n }\n element = {\n url: parts[3],\n func: parts[1] || UNKNOWN_FUNCTION,\n args: parts[2] ? parts[2].split(',') : [],\n line: parts[4] ? +parts[4] : null,\n column: parts[5] ? +parts[5] : null\n };\n } else {\n continue;\n }\n\n if (!element.func && element.line) {\n element.func = UNKNOWN_FUNCTION;\n }\n\n if (element.url && element.url.substr(0, 5) === 'blob:') {\n // Special case for handling JavaScript loaded into a blob.\n // We use a synchronous AJAX request here as a blob is already in\n // memory - it's not making a network request. This will generate a warning\n // in the browser console, but there has already been an error so that's not\n // that much of an issue.\n var xhr = new XMLHttpRequest();\n xhr.open('GET', element.url, false);\n xhr.send(null);\n\n // If we failed to download the source, skip this patch\n if (xhr.status === 200) {\n var source = xhr.responseText || '';\n\n // We trim the source down to the last 300 characters as sourceMappingURL is always at the end of the file.\n // Why 300? To be in line with: https://github.com/getsentry/sentry/blob/4af29e8f2350e20c28a6933354e4f42437b4ba42/src/sentry/lang/javascript/processor.py#L164-L175\n source = source.slice(-300);\n\n // Now we dig out the source map URL\n var sourceMaps = source.match(/\\/\\/# sourceMappingURL=(.*)$/);\n\n // If we don't find a source map comment or we find more than one, continue on to the next element.\n if (sourceMaps) {\n var sourceMapAddress = sourceMaps[1];\n\n // Now we check to see if it's a relative URL.\n // If it is, convert it to an absolute one.\n if (sourceMapAddress.charAt(0) === '~') {\n sourceMapAddress = getLocationOrigin() + sourceMapAddress.slice(1);\n }\n\n // Now we strip the '.map' off of the end of the URL and update the\n // element so that Sentry can match the map to the blob.\n element.url = sourceMapAddress.slice(0, -4);\n }\n }\n }\n\n stack.push(element);\n }\n\n if (!stack.length) {\n return null;\n }\n\n return {\n name: ex.name,\n message: ex.message,\n url: getLocationHref(),\n stack: stack\n };\n }\n\n /**\n * Adds information about the first frame to incomplete stack traces.\n * Safari and IE require this to get complete data on the first frame.\n * @param {Object.<string, *>} stackInfo Stack trace information from\n * one of the compute* methods.\n * @param {string} url The URL of the script that caused an error.\n * @param {(number|string)} lineNo The line number of the script that\n * caused an error.\n * @param {string=} message The error generated by the browser, which\n * hopefully contains the name of the object that caused the error.\n * @return {boolean} Whether or not the stack information was\n * augmented.\n */\n function augmentStackTraceWithInitialElement(stackInfo, url, lineNo, message) {\n var initial = {\n url: url,\n line: lineNo\n };\n\n if (initial.url && initial.line) {\n stackInfo.incomplete = false;\n\n if (!initial.func) {\n initial.func = UNKNOWN_FUNCTION;\n }\n\n if (stackInfo.stack.length > 0) {\n if (stackInfo.stack[0].url === initial.url) {\n if (stackInfo.stack[0].line === initial.line) {\n return false; // already in stack trace\n } else if (\n !stackInfo.stack[0].line &&\n stackInfo.stack[0].func === initial.func\n ) {\n stackInfo.stack[0].line = initial.line;\n return false;\n }\n }\n }\n\n stackInfo.stack.unshift(initial);\n stackInfo.partial = true;\n return true;\n } else {\n stackInfo.incomplete = true;\n }\n\n return false;\n }\n\n /**\n * Computes stack trace information by walking the arguments.caller\n * chain at the time the exception occurred. This will cause earlier\n * frames to be missed but is the only way to get any stack trace in\n * Safari and IE. The top frame is restored by\n * {@link augmentStackTraceWithInitialElement}.\n * @param {Error} ex\n * @return {?Object.<string, *>} Stack trace information.\n */\n function computeStackTraceByWalkingCallerChain(ex, depth) {\n var functionName = /function\\s+([_$a-zA-Z\\xA0-\\uFFFF][_$a-zA-Z0-9\\xA0-\\uFFFF]*)?\\s*\\(/i,\n stack = [],\n funcs = {},\n recursion = false,\n parts,\n item,\n source;\n\n for (\n var curr = computeStackTraceByWalkingCallerChain.caller;\n curr && !recursion;\n curr = curr.caller\n ) {\n if (curr === computeStackTrace || curr === TraceKit.report) {\n // console.log('skipping internal function');\n continue;\n }\n\n item = {\n url: null,\n func: UNKNOWN_FUNCTION,\n line: null,\n column: null\n };\n\n if (curr.name) {\n item.func = curr.name;\n } else if ((parts = functionName.exec(curr.toString()))) {\n item.func = parts[1];\n }\n\n if (typeof item.func === 'undefined') {\n try {\n item.func = parts.input.substring(0, parts.input.indexOf('{'));\n } catch (e) {}\n }\n\n if (funcs['' + curr]) {\n recursion = true;\n } else {\n funcs['' + curr] = true;\n }\n\n stack.push(item);\n }\n\n if (depth) {\n // console.log('depth is ' + depth);\n // console.log('stack is ' + stack.length);\n stack.splice(0, depth);\n }\n\n var result = {\n name: ex.name,\n message: ex.message,\n url: getLocationHref(),\n stack: stack\n };\n augmentStackTraceWithInitialElement(\n result,\n ex.sourceURL || ex.fileName,\n ex.line || ex.lineNumber,\n ex.message || ex.description\n );\n return result;\n }\n\n /**\n * Computes a stack trace for an exception.\n * @param {Error} ex\n * @param {(string|number)=} depth\n */\n function computeStackTrace(ex, depth) {\n var stack = null;\n depth = depth == null ? 0 : +depth;\n\n try {\n stack = computeStackTraceFromStackProp(ex);\n if (stack) {\n return stack;\n }\n } catch (e) {\n if (TraceKit.debug) {\n throw e;\n }\n }\n\n try {\n stack = computeStackTraceByWalkingCallerChain(ex, depth + 1);\n if (stack) {\n return stack;\n }\n } catch (e) {\n if (TraceKit.debug) {\n throw e;\n }\n }\n return {\n name: ex.name,\n message: ex.message,\n url: getLocationHref()\n };\n }\n\n computeStackTrace.augmentStackTraceWithInitialElement = augmentStackTraceWithInitialElement;\n computeStackTrace.computeStackTraceFromStackProp = computeStackTraceFromStackProp;\n\n return computeStackTrace;\n})();\n\nmodule.exports = TraceKit;\n","/*\n * JavaScript MD5\n * https://github.com/blueimp/JavaScript-MD5\n *\n * Copyright 2011, Sebastian Tschan\n * https://blueimp.net\n *\n * Licensed under the MIT license:\n * https://opensource.org/licenses/MIT\n *\n * Based on\n * A JavaScript implementation of the RSA Data Security, Inc. MD5 Message\n * Digest Algorithm, as defined in RFC 1321.\n * Version 2.2 Copyright (C) Paul Johnston 1999 - 2009\n * Other contributors: Greg Holt, Andrew Kepert, Ydnar, Lostinet\n * Distributed under the BSD License\n * See http://pajhome.org.uk/crypt/md5 for more info.\n */\n\n/*\n* Add integers, wrapping at 2^32. This uses 16-bit operations internally\n* to work around bugs in some JS interpreters.\n*/\nfunction safeAdd(x, y) {\n var lsw = (x & 0xffff) + (y & 0xffff);\n var msw = (x >> 16) + (y >> 16) + (lsw >> 16);\n return (msw << 16) | (lsw & 0xffff);\n}\n\n/*\n* Bitwise rotate a 32-bit number to the left.\n*/\nfunction bitRotateLeft(num, cnt) {\n return (num << cnt) | (num >>> (32 - cnt));\n}\n\n/*\n* These functions implement the four basic operations the algorithm uses.\n*/\nfunction md5cmn(q, a, b, x, s, t) {\n return safeAdd(bitRotateLeft(safeAdd(safeAdd(a, q), safeAdd(x, t)), s), b);\n}\nfunction md5ff(a, b, c, d, x, s, t) {\n return md5cmn((b & c) | (~b & d), a, b, x, s, t);\n}\nfunction md5gg(a, b, c, d, x, s, t) {\n return md5cmn((b & d) | (c & ~d), a, b, x, s, t);\n}\nfunction md5hh(a, b, c, d, x, s, t) {\n return md5cmn(b ^ c ^ d, a, b, x, s, t);\n}\nfunction md5ii(a, b, c, d, x, s, t) {\n return md5cmn(c ^ (b | ~d), a, b, x, s, t);\n}\n\n/*\n* Calculate the MD5 of an array of little-endian words, and a bit length.\n*/\nfunction binlMD5(x, len) {\n /* append padding */\n x[len >> 5] |= 0x80 << (len % 32);\n x[(((len + 64) >>> 9) << 4) + 14] = len;\n\n var i;\n var olda;\n var oldb;\n var oldc;\n var oldd;\n var a = 1732584193;\n var b = -271733879;\n var c = -1732584194;\n var d = 271733878;\n\n for (i = 0; i < x.length; i += 16) {\n olda = a;\n oldb = b;\n oldc = c;\n oldd = d;\n\n a = md5ff(a, b, c, d, x[i], 7, -680876936);\n d = md5ff(d, a, b, c, x[i + 1], 12, -389564586);\n c = md5ff(c, d, a, b, x[i + 2], 17, 606105819);\n b = md5ff(b, c, d, a, x[i + 3], 22, -1044525330);\n a = md5ff(a, b, c, d, x[i + 4], 7, -176418897);\n d = md5ff(d, a, b, c, x[i + 5], 12, 1200080426);\n c = md5ff(c, d, a, b, x[i + 6], 17, -1473231341);\n b = md5ff(b, c, d, a, x[i + 7], 22, -45705983);\n a = md5ff(a, b, c, d, x[i + 8], 7, 1770035416);\n d = md5ff(d, a, b, c, x[i + 9], 12, -1958414417);\n c = md5ff(c, d, a, b, x[i + 10], 17, -42063);\n b = md5ff(b, c, d, a, x[i + 11], 22, -1990404162);\n a = md5ff(a, b, c, d, x[i + 12], 7, 1804603682);\n d = md5ff(d, a, b, c, x[i + 13], 12, -40341101);\n c = md5ff(c, d, a, b, x[i + 14], 17, -1502002290);\n b = md5ff(b, c, d, a, x[i + 15], 22, 1236535329);\n\n a = md5gg(a, b, c, d, x[i + 1], 5, -165796510);\n d = md5gg(d, a, b, c, x[i + 6], 9, -1069501632);\n c = md5gg(c, d, a, b, x[i + 11], 14, 643717713);\n b = md5gg(b, c, d, a, x[i], 20, -373897302);\n a = md5gg(a, b, c, d, x[i + 5], 5, -701558691);\n d = md5gg(d, a, b, c, x[i + 10], 9, 38016083);\n c = md5gg(c, d, a, b, x[i + 15], 14, -660478335);\n b = md5gg(b, c, d, a, x[i + 4], 20, -405537848);\n a = md5gg(a, b, c, d, x[i + 9], 5, 568446438);\n d = md5gg(d, a, b, c, x[i + 14], 9, -1019803690);\n c = md5gg(c, d, a, b, x[i + 3], 14, -187363961);\n b = md5gg(b, c, d, a, x[i + 8], 20, 1163531501);\n a = md5gg(a, b, c, d, x[i + 13], 5, -1444681467);\n d = md5gg(d, a, b, c, x[i + 2], 9, -51403784);\n c = md5gg(c, d, a, b, x[i + 7], 14, 1735328473);\n b = md5gg(b, c, d, a, x[i + 12], 20, -1926607734);\n\n a = md5hh(a, b, c, d, x[i + 5], 4, -378558);\n d = md5hh(d, a, b, c, x[i + 8], 11, -2022574463);\n c = md5hh(c, d, a, b, x[i + 11], 16, 1839030562);\n b = md5hh(b, c, d, a, x[i + 14], 23, -35309556);\n a = md5hh(a, b, c, d, x[i + 1], 4, -1530992060);\n d = md5hh(d, a, b, c, x[i + 4], 11, 1272893353);\n c = md5hh(c, d, a, b, x[i + 7], 16, -155497632);\n b = md5hh(b, c, d, a, x[i + 10], 23, -1094730640);\n a = md5hh(a, b, c, d, x[i + 13], 4, 681279174);\n d = md5hh(d, a, b, c, x[i], 11, -358537222);\n c = md5hh(c, d, a, b, x[i + 3], 16, -722521979);\n b = md5hh(b, c, d, a, x[i + 6], 23, 76029189);\n a = md5hh(a, b, c, d, x[i + 9], 4, -640364487);\n d = md5hh(d, a, b, c, x[i + 12], 11, -421815835);\n c = md5hh(c, d, a, b, x[i + 15], 16, 530742520);\n b = md5hh(b, c, d, a, x[i + 2], 23, -995338651);\n\n a = md5ii(a, b, c, d, x[i], 6, -198630844);\n d = md5ii(d, a, b, c, x[i + 7], 10, 1126891415);\n c = md5ii(c, d, a, b, x[i + 14], 15, -1416354905);\n b = md5ii(b, c, d, a, x[i + 5], 21, -57434055);\n a = md5ii(a, b, c, d, x[i + 12], 6, 1700485571);\n d = md5ii(d, a, b, c, x[i + 3], 10, -1894986606);\n c = md5ii(c, d, a, b, x[i + 10], 15, -1051523);\n b = md5ii(b, c, d, a, x[i + 1], 21, -2054922799);\n a = md5ii(a, b, c, d, x[i + 8], 6, 1873313359);\n d = md5ii(d, a, b, c, x[i + 15], 10, -30611744);\n c = md5ii(c, d, a, b, x[i + 6], 15, -1560198380);\n b = md5ii(b, c, d, a, x[i + 13], 21, 1309151649);\n a = md5ii(a, b, c, d, x[i + 4], 6, -145523070);\n d = md5ii(d, a, b, c, x[i + 11], 10, -1120210379);\n c = md5ii(c, d, a, b, x[i + 2], 15, 718787259);\n b = md5ii(b, c, d, a, x[i + 9], 21, -343485551);\n\n a = safeAdd(a, olda);\n b = safeAdd(b, oldb);\n c = safeAdd(c, oldc);\n d = safeAdd(d, oldd);\n }\n return [a, b, c, d];\n}\n\n/*\n* Convert an array of little-endian words to a string\n*/\nfunction binl2rstr(input) {\n var i;\n var output = '';\n var length32 = input.length * 32;\n for (i = 0; i < length32; i += 8) {\n output += String.fromCharCode((input[i >> 5] >>> (i % 32)) & 0xff);\n }\n return output;\n}\n\n/*\n* Convert a raw string to an array of little-endian words\n* Characters >255 have their high-byte silently ignored.\n*/\nfunction rstr2binl(input) {\n var i;\n var output = [];\n output[(input.length >> 2) - 1] = undefined;\n for (i = 0; i < output.length; i += 1) {\n output[i] = 0;\n }\n var length8 = input.length * 8;\n for (i = 0; i < length8; i += 8) {\n output[i >> 5] |= (input.charCodeAt(i / 8) & 0xff) << (i % 32);\n }\n return output;\n}\n\n/*\n* Calculate the MD5 of a raw string\n*/\nfunction rstrMD5(s) {\n return binl2rstr(binlMD5(rstr2binl(s), s.length * 8));\n}\n\n/*\n* Calculate the HMAC-MD5, of a key and some data (raw strings)\n*/\nfunction rstrHMACMD5(key, data) {\n var i;\n var bkey = rstr2binl(key);\n var ipad = [];\n var opad = [];\n var hash;\n ipad[15] = opad[15] = undefined;\n if (bkey.length > 16) {\n bkey = binlMD5(bkey, key.length * 8);\n }\n for (i = 0; i < 16; i += 1) {\n ipad[i] = bkey[i] ^ 0x36363636;\n opad[i] = bkey[i] ^ 0x5c5c5c5c;\n }\n hash = binlMD5(ipad.concat(rstr2binl(data)), 512 + data.length * 8);\n return binl2rstr(binlMD5(opad.concat(hash), 512 + 128));\n}\n\n/*\n* Convert a raw string to a hex string\n*/\nfunction rstr2hex(input) {\n var hexTab = '0123456789abcdef';\n var output = '';\n var x;\n var i;\n for (i = 0; i < input.length; i += 1) {\n x = input.charCodeAt(i);\n output += hexTab.charAt((x >>> 4) & 0x0f) + hexTab.charAt(x & 0x0f);\n }\n return output;\n}\n\n/*\n* Encode a string as utf-8\n*/\nfunction str2rstrUTF8(input) {\n return unescape(encodeURIComponent(input));\n}\n\n/*\n* Take string arguments and return either raw or hex encoded strings\n*/\nfunction rawMD5(s) {\n return rstrMD5(str2rstrUTF8(s));\n}\nfunction hexMD5(s) {\n return rstr2hex(rawMD5(s));\n}\nfunction rawHMACMD5(k, d) {\n return rstrHMACMD5(str2rstrUTF8(k), str2rstrUTF8(d));\n}\nfunction hexHMACMD5(k, d) {\n return rstr2hex(rawHMACMD5(k, d));\n}\n\nfunction md5(string, key, raw) {\n if (!key) {\n if (!raw) {\n return hexMD5(string);\n }\n return rawMD5(string);\n }\n if (!raw) {\n return hexHMACMD5(key, string);\n }\n return rawHMACMD5(key, string);\n}\n\nmodule.exports = md5;\n","function RavenConfigError(message) {\n this.name = 'RavenConfigError';\n this.message = message;\n}\nRavenConfigError.prototype = new Error();\nRavenConfigError.prototype.constructor = RavenConfigError;\n\nmodule.exports = RavenConfigError;\n","var utils = require('./utils');\n\nvar wrapMethod = function(console, level, callback) {\n var originalConsoleLevel = console[level];\n var originalConsole = console;\n\n if (!(level in console)) {\n return;\n }\n\n var sentryLevel = level === 'warn' ? 'warning' : level;\n\n console[level] = function() {\n var args = [].slice.call(arguments);\n\n var msg = utils.safeJoin(args, ' ');\n var data = {level: sentryLevel, logger: 'console', extra: {arguments: args}};\n\n if (level === 'assert') {\n if (args[0] === false) {\n // Default browsers message\n msg =\n 'Assertion failed: ' + (utils.safeJoin(args.slice(1), ' ') || 'console.assert');\n data.extra.arguments = args.slice(1);\n callback && callback(msg, data);\n }\n } else {\n callback && callback(msg, data);\n }\n\n // this fails for some browsers. :(\n if (originalConsoleLevel) {\n // IE9 doesn't allow calling apply on console functions directly\n // See: https://stackoverflow.com/questions/5472938/does-ie9-support-console-log-and-is-it-a-real-function#answer-5473193\n Function.prototype.apply.call(originalConsoleLevel, originalConsole, args);\n }\n };\n};\n\nmodule.exports = {\n wrapMethod: wrapMethod\n};\n","/*global XDomainRequest:false */\n\nvar TraceKit = require('../vendor/TraceKit/tracekit');\nvar stringify = require('../vendor/json-stringify-safe/stringify');\nvar md5 = require('../vendor/md5/md5');\nvar RavenConfigError = require('./configError');\n\nvar utils = require('./utils');\nvar isErrorEvent = utils.isErrorEvent;\nvar isDOMError = utils.isDOMError;\nvar isDOMException = utils.isDOMException;\nvar isError = utils.isError;\nvar isObject = utils.isObject;\nvar isPlainObject = utils.isPlainObject;\nvar isUndefined = utils.isUndefined;\nvar isFunction = utils.isFunction;\nvar isString = utils.isString;\nvar isArray = utils.isArray;\nvar isEmptyObject = utils.isEmptyObject;\nvar each = utils.each;\nvar objectMerge = utils.objectMerge;\nvar truncate = utils.truncate;\nvar objectFrozen = utils.objectFrozen;\nvar hasKey = utils.hasKey;\nvar joinRegExp = utils.joinRegExp;\nvar urlencode = utils.urlencode;\nvar uuid4 = utils.uuid4;\nvar htmlTreeAsString = utils.htmlTreeAsString;\nvar isSameException = utils.isSameException;\nvar isSameStacktrace = utils.isSameStacktrace;\nvar parseUrl = utils.parseUrl;\nvar fill = utils.fill;\nvar supportsFetch = utils.supportsFetch;\nvar supportsReferrerPolicy = utils.supportsReferrerPolicy;\nvar serializeKeysForMessage = utils.serializeKeysForMessage;\nvar serializeException = utils.serializeException;\nvar sanitize = utils.sanitize;\n\nvar wrapConsoleMethod = require('./console').wrapMethod;\n\nvar dsnKeys = 'source protocol user pass host port path'.split(' '),\n dsnPattern = /^(?:(\\w+):)?\\/\\/(?:(\\w+)(:\\w+)?@)?([\\w\\.-]+)(?::(\\d+))?(\\/.*)/;\n\nfunction now() {\n return +new Date();\n}\n\n// This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785)\nvar _window =\n typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {};\nvar _document = _window.document;\nvar _navigator = _window.navigator;\n\nfunction keepOriginalCallback(original, callback) {\n return isFunction(callback)\n ? function(data) {\n return callback(data, original);\n }\n : callback;\n}\n\n// First, check for JSON support\n// If there is no JSON, we no-op the core features of Raven\n// since JSON is required to encode the payload\nfunction Raven() {\n this._hasJSON = !!(typeof JSON === 'object' && JSON.stringify);\n // Raven can run in contexts where there's no document (react-native)\n this._hasDocument = !isUndefined(_document);\n this._hasNavigator = !isUndefined(_navigator);\n this._lastCapturedException = null;\n this._lastData = null;\n this._lastEventId = null;\n this._globalServer = null;\n this._globalKey = null;\n this._globalProject = null;\n this._globalContext = {};\n this._globalOptions = {\n // SENTRY_RELEASE can be injected by https://github.com/getsentry/sentry-webpack-plugin\n release: _window.SENTRY_RELEASE && _window.SENTRY_RELEASE.id,\n logger: 'javascript',\n ignoreErrors: [],\n ignoreUrls: [],\n whitelistUrls: [],\n includePaths: [],\n headers: null,\n collectWindowErrors: true,\n captureUnhandledRejections: true,\n maxMessageLength: 0,\n // By default, truncates URL values to 250 chars\n maxUrlLength: 250,\n stackTraceLimit: 50,\n autoBreadcrumbs: true,\n instrument: true,\n sampleRate: 1,\n sanitizeKeys: []\n };\n this._fetchDefaults = {\n method: 'POST',\n // Despite all stars in the sky saying that Edge supports old draft syntax, aka 'never', 'always', 'origin' and 'default\n // https://caniuse.com/#feat=referrer-policy\n // It doesn't. And it throw exception instead of ignoring this parameter...\n // REF: https://github.com/getsentry/raven-js/issues/1233\n referrerPolicy: supportsReferrerPolicy() ? 'origin' : ''\n };\n this._ignoreOnError = 0;\n this._isRavenInstalled = false;\n this._originalErrorStackTraceLimit = Error.stackTraceLimit;\n // capture references to window.console *and* all its methods first\n // before the console plugin has a chance to monkey patch\n this._originalConsole = _window.console || {};\n this._originalConsoleMethods = {};\n this._plugins = [];\n this._startTime = now();\n this._wrappedBuiltIns = [];\n this._breadcrumbs = [];\n this._lastCapturedEvent = null;\n this._keypressTimeout;\n this._location = _window.location;\n this._lastHref = this._location && this._location.href;\n this._resetBackoff();\n\n // eslint-disable-next-line guard-for-in\n for (var method in this._originalConsole) {\n this._originalConsoleMethods[method] = this._originalConsole[method];\n }\n}\n\n/*\n * The core Raven singleton\n *\n * @this {Raven}\n */\n\nRaven.prototype = {\n // Hardcode version string so that raven source can be loaded directly via\n // webpack (using a build step causes webpack #1617). Grunt verifies that\n // this value matches package.json during build.\n // See: https://github.com/getsentry/raven-js/issues/465\n VERSION: '3.27.0',\n\n debug: false,\n\n TraceKit: TraceKit, // alias to TraceKit\n\n /*\n * Configure Raven with a DSN and extra options\n *\n * @param {string} dsn The public Sentry DSN\n * @param {object} options Set of global options [optional]\n * @return {Raven}\n */\n config: function(dsn, options) {\n var self = this;\n\n if (self._globalServer) {\n this._logDebug('error', 'Error: Raven has already been configured');\n return self;\n }\n if (!dsn) return self;\n\n var globalOptions = self._globalOptions;\n\n // merge in options\n if (options) {\n each(options, function(key, value) {\n // tags and extra are special and need to be put into context\n if (key === 'tags' || key === 'extra' || key === 'user') {\n self._globalContext[key] = value;\n } else {\n globalOptions[key] = value;\n }\n });\n }\n\n self.setDSN(dsn);\n\n // \"Script error.\" is hard coded into browsers for errors that it can't read.\n // this is the result of a script being pulled in from an external domain and CORS.\n globalOptions.ignoreErrors.push(/^Script error\\.?$/);\n globalOptions.ignoreErrors.push(/^Javascript error: Script error\\.? on line 0$/);\n\n // join regexp rules into one big rule\n globalOptions.ignoreErrors = joinRegExp(globalOptions.ignoreErrors);\n globalOptions.ignoreUrls = globalOptions.ignoreUrls.length\n ? joinRegExp(globalOptions.ignoreUrls)\n : false;\n globalOptions.whitelistUrls = globalOptions.whitelistUrls.length\n ? joinRegExp(globalOptions.whitelistUrls)\n : false;\n globalOptions.includePaths = joinRegExp(globalOptions.includePaths);\n globalOptions.maxBreadcrumbs = Math.max(\n 0,\n Math.min(globalOptions.maxBreadcrumbs || 100, 100)\n ); // default and hard limit is 100\n\n var autoBreadcrumbDefaults = {\n xhr: true,\n console: true,\n dom: true,\n location: true,\n sentry: true\n };\n\n var autoBreadcrumbs = globalOptions.autoBreadcrumbs;\n if ({}.toString.call(autoBreadcrumbs) === '[object Object]') {\n autoBreadcrumbs = objectMerge(autoBreadcrumbDefaults, autoBreadcrumbs);\n } else if (autoBreadcrumbs !== false) {\n autoBreadcrumbs = autoBreadcrumbDefaults;\n }\n globalOptions.autoBreadcrumbs = autoBreadcrumbs;\n\n var instrumentDefaults = {\n tryCatch: true\n };\n\n var instrument = globalOptions.instrument;\n if ({}.toString.call(instrument) === '[object Object]') {\n instrument = objectMerge(instrumentDefaults, instrument);\n } else if (instrument !== false) {\n instrument = instrumentDefaults;\n }\n globalOptions.instrument = instrument;\n\n TraceKit.collectWindowErrors = !!globalOptions.collectWindowErrors;\n\n // return for chaining\n return self;\n },\n\n /*\n * Installs a global window.onerror error handler\n * to capture and report uncaught exceptions.\n * At this point, install() is required to be called due\n * to the way TraceKit is set up.\n *\n * @return {Raven}\n */\n install: function() {\n var self = this;\n if (self.isSetup() && !self._isRavenInstalled) {\n TraceKit.report.subscribe(function() {\n self._handleOnErrorStackInfo.apply(self, arguments);\n });\n\n if (self._globalOptions.captureUnhandledRejections) {\n self._attachPromiseRejectionHandler();\n }\n\n self._patchFunctionToString();\n\n if (self._globalOptions.instrument && self._globalOptions.instrument.tryCatch) {\n self._instrumentTryCatch();\n }\n\n if (self._globalOptions.autoBreadcrumbs) self._instrumentBreadcrumbs();\n\n // Install all of the plugins\n self._drainPlugins();\n\n self._isRavenInstalled = true;\n }\n\n Error.stackTraceLimit = self._globalOptions.stackTraceLimit;\n return this;\n },\n\n /*\n * Set the DSN (can be called multiple time unlike config)\n *\n * @param {string} dsn The public Sentry DSN\n */\n setDSN: function(dsn) {\n var self = this,\n uri = self._parseDSN(dsn),\n lastSlash = uri.path.lastIndexOf('/'),\n path = uri.path.substr(1, lastSlash);\n\n self._dsn = dsn;\n self._globalKey = uri.user;\n self._globalSecret = uri.pass && uri.pass.substr(1);\n self._globalProject = uri.path.substr(lastSlash + 1);\n\n self._globalServer = self._getGlobalServer(uri);\n\n self._globalEndpoint =\n self._globalServer + '/' + path + 'api/' + self._globalProject + '/store/';\n\n // Reset backoff state since we may be pointing at a\n // new project/server\n this._resetBackoff();\n },\n\n /*\n * Wrap code within a context so Raven can capture errors\n * reliably across domains that is executed immediately.\n *\n * @param {object} options A specific set of options for this context [optional]\n * @param {function} func The callback to be immediately executed within the context\n * @param {array} args An array of arguments to be called with the callback [optional]\n */\n context: function(options, func, args) {\n if (isFunction(options)) {\n args = func || [];\n func = options;\n options = {};\n }\n\n return this.wrap(options, func).apply(this, args);\n },\n\n /*\n * Wrap code within a context and returns back a new function to be executed\n *\n * @param {object} options A specific set of options for this context [optional]\n * @param {function} func The function to be wrapped in a new context\n * @param {function} _before A function to call before the try/catch wrapper [optional, private]\n * @return {function} The newly wrapped functions with a context\n */\n wrap: function(options, func, _before) {\n var self = this;\n // 1 argument has been passed, and it's not a function\n // so just return it\n if (isUndefined(func) && !isFunction(options)) {\n return options;\n }\n\n // options is optional\n if (isFunction(options)) {\n func = options;\n options = undefined;\n }\n\n // At this point, we've passed along 2 arguments, and the second one\n // is not a function either, so we'll just return the second argument.\n if (!isFunction(func)) {\n return func;\n }\n\n // We don't wanna wrap it twice!\n try {\n if (func.__raven__) {\n return func;\n }\n\n // If this has already been wrapped in the past, return that\n if (func.__raven_wrapper__) {\n return func.__raven_wrapper__;\n }\n } catch (e) {\n // Just accessing custom props in some Selenium environments\n // can cause a \"Permission denied\" exception (see raven-js#495).\n // Bail on wrapping and return the function as-is (defers to window.onerror).\n return func;\n }\n\n function wrapped() {\n var args = [],\n i = arguments.length,\n deep = !options || (options && options.deep !== false);\n\n if (_before && isFunction(_before)) {\n _before.apply(this, arguments);\n }\n\n // Recursively wrap all of a function's arguments that are\n // functions themselves.\n while (i--) args[i] = deep ? self.wrap(options, arguments[i]) : arguments[i];\n\n try {\n // Attempt to invoke user-land function\n // NOTE: If you are a Sentry user, and you are seeing this stack frame, it\n // means Raven caught an error invoking your application code. This is\n // expected behavior and NOT indicative of a bug with Raven.js.\n return func.apply(this, args);\n } catch (e) {\n self._ignoreNextOnError();\n self.captureException(e, options);\n throw e;\n }\n }\n\n // copy over properties of the old function\n for (var property in func) {\n if (hasKey(func, property)) {\n wrapped[property] = func[property];\n }\n }\n wrapped.prototype = func.prototype;\n\n func.__raven_wrapper__ = wrapped;\n // Signal that this function has been wrapped/filled already\n // for both debugging and to prevent it to being wrapped/filled twice\n wrapped.__raven__ = true;\n wrapped.__orig__ = func;\n\n return wrapped;\n },\n\n /**\n * Uninstalls the global error handler.\n *\n * @return {Raven}\n */\n uninstall: function() {\n TraceKit.report.uninstall();\n\n this._detachPromiseRejectionHandler();\n this._unpatchFunctionToString();\n this._restoreBuiltIns();\n this._restoreConsole();\n\n Error.stackTraceLimit = this._originalErrorStackTraceLimit;\n this._isRavenInstalled = false;\n\n return this;\n },\n\n /**\n * Callback used for `unhandledrejection` event\n *\n * @param {PromiseRejectionEvent} event An object containing\n * promise: the Promise that was rejected\n * reason: the value with which the Promise was rejected\n * @return void\n */\n _promiseRejectionHandler: function(event) {\n this._logDebug('debug', 'Raven caught unhandled promise rejection:', event);\n this.captureException(event.reason, {\n mechanism: {\n type: 'onunhandledrejection',\n handled: false\n }\n });\n },\n\n /**\n * Installs the global promise rejection handler.\n *\n * @return {raven}\n */\n _attachPromiseRejectionHandler: function() {\n this._promiseRejectionHandler = this._promiseRejectionHandler.bind(this);\n _window.addEventListener &&\n _window.addEventListener('unhandledrejection', this._promiseRejectionHandler);\n return this;\n },\n\n /**\n * Uninstalls the global promise rejection handler.\n *\n * @return {raven}\n */\n _detachPromiseRejectionHandler: function() {\n _window.removeEventListener &&\n _window.removeEventListener('unhandledrejection', this._promiseRejectionHandler);\n return this;\n },\n\n /**\n * Manually capture an exception and send it over to Sentry\n *\n * @param {error} ex An exception to be logged\n * @param {object} options A specific set of options for this error [optional]\n * @return {Raven}\n */\n captureException: function(ex, options) {\n options = objectMerge({trimHeadFrames: 0}, options ? options : {});\n\n if (isErrorEvent(ex) && ex.error) {\n // If it is an ErrorEvent with `error` property, extract it to get actual Error\n ex = ex.error;\n } else if (isDOMError(ex) || isDOMException(ex)) {\n // If it is a DOMError or DOMException (which are legacy APIs, but still supported in some browsers)\n // then we just extract the name and message, as they don't provide anything else\n // https://developer.mozilla.org/en-US/docs/Web/API/DOMError\n // https://developer.mozilla.org/en-US/docs/Web/API/DOMException\n var name = ex.name || (isDOMError(ex) ? 'DOMError' : 'DOMException');\n var message = ex.message ? name + ': ' + ex.message : name;\n\n return this.captureMessage(\n message,\n objectMerge(options, {\n // neither DOMError or DOMException provide stack trace and we most likely wont get it this way as well\n // but it's barely any overhead so we may at least try\n stacktrace: true,\n trimHeadFrames: options.trimHeadFrames + 1\n })\n );\n } else if (isError(ex)) {\n // we have a real Error object\n ex = ex;\n } else if (isPlainObject(ex)) {\n // If it is plain Object, serialize it manually and extract options\n // This will allow us to group events based on top-level keys\n // which is much better than creating new group when any key/value change\n options = this._getCaptureExceptionOptionsFromPlainObject(options, ex);\n ex = new Error(options.message);\n } else {\n // If none of previous checks were valid, then it means that\n // it's not a DOMError/DOMException\n // it's not a plain Object\n // it's not a valid ErrorEvent (one with an error property)\n // it's not an Error\n // So bail out and capture it as a simple message:\n return this.captureMessage(\n ex,\n objectMerge(options, {\n stacktrace: true, // if we fall back to captureMessage, default to attempting a new trace\n trimHeadFrames: options.trimHeadFrames + 1\n })\n );\n }\n\n // Store the raw exception object for potential debugging and introspection\n this._lastCapturedException = ex;\n\n // TraceKit.report will re-raise any exception passed to it,\n // which means you have to wrap it in try/catch. Instead, we\n // can wrap it here and only re-raise if TraceKit.report\n // raises an exception different from the one we asked to\n // report on.\n try {\n var stack = TraceKit.computeStackTrace(ex);\n this._handleStackInfo(stack, options);\n } catch (ex1) {\n if (ex !== ex1) {\n throw ex1;\n }\n }\n\n return this;\n },\n\n _getCaptureExceptionOptionsFromPlainObject: function(currentOptions, ex) {\n var exKeys = Object.keys(ex).sort();\n var options = objectMerge(currentOptions, {\n message:\n 'Non-Error exception captured with keys: ' + serializeKeysForMessage(exKeys),\n fingerprint: [md5(exKeys)],\n extra: currentOptions.extra || {}\n });\n options.extra.__serialized__ = serializeException(ex);\n\n return options;\n },\n\n /*\n * Manually send a message to Sentry\n *\n * @param {string} msg A plain message to be captured in Sentry\n * @param {object} options A specific set of options for this message [optional]\n * @return {Raven}\n */\n captureMessage: function(msg, options) {\n // config() automagically converts ignoreErrors from a list to a RegExp so we need to test for an\n // early call; we'll error on the side of logging anything called before configuration since it's\n // probably something you should see:\n if (\n !!this._globalOptions.ignoreErrors.test &&\n this._globalOptions.ignoreErrors.test(msg)\n ) {\n return;\n }\n\n options = options || {};\n msg = msg + ''; // Make sure it's actually a string\n\n var data = objectMerge(\n {\n message: msg\n },\n options\n );\n\n var ex;\n // Generate a \"synthetic\" stack trace from this point.\n // NOTE: If you are a Sentry user, and you are seeing this stack frame, it is NOT indicative\n // of a bug with Raven.js. Sentry generates synthetic traces either by configuration,\n // or if it catches a thrown object without a \"stack\" property.\n try {\n throw new Error(msg);\n } catch (ex1) {\n ex = ex1;\n }\n\n // null exception name so `Error` isn't prefixed to msg\n ex.name = null;\n var stack = TraceKit.computeStackTrace(ex);\n\n // stack[0] is `throw new Error(msg)` call itself, we are interested in the frame that was just before that, stack[1]\n var initialCall = isArray(stack.stack) && stack.stack[1];\n\n // if stack[1] is `Raven.captureException`, it means that someone passed a string to it and we redirected that call\n // to be handled by `captureMessage`, thus `initialCall` is the 3rd one, not 2nd\n // initialCall => captureException(string) => captureMessage(string)\n if (initialCall && initialCall.func === 'Raven.captureException') {\n initialCall = stack.stack[2];\n }\n\n var fileurl = (initialCall && initialCall.url) || '';\n\n if (\n !!this._globalOptions.ignoreUrls.test &&\n this._globalOptions.ignoreUrls.test(fileurl)\n ) {\n return;\n }\n\n if (\n !!this._globalOptions.whitelistUrls.test &&\n !this._globalOptions.whitelistUrls.test(fileurl)\n ) {\n return;\n }\n\n // Always attempt to get stacktrace if message is empty.\n // It's the only way to provide any helpful information to the user.\n if (this._globalOptions.stacktrace || options.stacktrace || data.message === '') {\n // fingerprint on msg, not stack trace (legacy behavior, could be revisited)\n data.fingerprint = data.fingerprint == null ? msg : data.fingerprint;\n\n options = objectMerge(\n {\n trimHeadFrames: 0\n },\n options\n );\n // Since we know this is a synthetic trace, the top frame (this function call)\n // MUST be from Raven.js, so mark it for trimming\n // We add to the trim counter so that callers can choose to trim extra frames, such\n // as utility functions.\n options.trimHeadFrames += 1;\n\n var frames = this._prepareFrames(stack, options);\n data.stacktrace = {\n // Sentry expects frames oldest to newest\n frames: frames.reverse()\n };\n }\n\n // Make sure that fingerprint is always wrapped in an array\n if (data.fingerprint) {\n data.fingerprint = isArray(data.fingerprint)\n ? data.fingerprint\n : [data.fingerprint];\n }\n\n // Fire away!\n this._send(data);\n\n return this;\n },\n\n captureBreadcrumb: function(obj) {\n var crumb = objectMerge(\n {\n timestamp: now() / 1000\n },\n obj\n );\n\n if (isFunction(this._globalOptions.breadcrumbCallback)) {\n var result = this._globalOptions.breadcrumbCallback(crumb);\n\n if (isObject(result) && !isEmptyObject(result)) {\n crumb = result;\n } else if (result === false) {\n return this;\n }\n }\n\n this._breadcrumbs.push(crumb);\n if (this._breadcrumbs.length > this._globalOptions.maxBreadcrumbs) {\n this._breadcrumbs.shift();\n }\n return this;\n },\n\n addPlugin: function(plugin /*arg1, arg2, ... argN*/) {\n var pluginArgs = [].slice.call(arguments, 1);\n\n this._plugins.push([plugin, pluginArgs]);\n if (this._isRavenInstalled) {\n this._drainPlugins();\n }\n\n return this;\n },\n\n /*\n * Set/clear a user to be sent along with the payload.\n *\n * @param {object} user An object representing user data [optional]\n * @return {Raven}\n */\n setUserContext: function(user) {\n // Intentionally do not merge here since that's an unexpected behavior.\n this._globalContext.user = user;\n\n return this;\n },\n\n /*\n * Merge extra attributes to be sent along with the payload.\n *\n * @param {object} extra An object representing extra data [optional]\n * @return {Raven}\n */\n setExtraContext: function(extra) {\n this._mergeContext('extra', extra);\n\n return this;\n },\n\n /*\n * Merge tags to be sent along with the payload.\n *\n * @param {object} tags An object representing tags [optional]\n * @return {Raven}\n */\n setTagsContext: function(tags) {\n this._mergeContext('tags', tags);\n\n return this;\n },\n\n /*\n * Clear all of the context.\n *\n * @return {Raven}\n */\n clearContext: function() {\n this._globalContext = {};\n\n return this;\n },\n\n /*\n * Get a copy of the current context. This cannot be mutated.\n *\n * @return {object} copy of context\n */\n getContext: function() {\n // lol javascript\n return JSON.parse(stringify(this._globalContext));\n },\n\n /*\n * Set environment of application\n *\n * @param {string} environment Typically something like 'production'.\n * @return {Raven}\n */\n setEnvironment: function(environment) {\n this._globalOptions.environment = environment;\n\n return this;\n },\n\n /*\n * Set release version of application\n *\n * @param {string} release Typically something like a git SHA to identify version\n * @return {Raven}\n */\n setRelease: function(release) {\n this._globalOptions.release = release;\n\n return this;\n },\n\n /*\n * Set the dataCallback option\n *\n * @param {function} callback The callback to run which allows the\n * data blob to be mutated before sending\n * @return {Raven}\n */\n setDataCallback: function(callback) {\n var original = this._globalOptions.dataCallback;\n this._globalOptions.dataCallback = keepOriginalCallback(original, callback);\n return this;\n },\n\n /*\n * Set the breadcrumbCallback option\n *\n * @param {function} callback The callback to run which allows filtering\n * or mutating breadcrumbs\n * @return {Raven}\n */\n setBreadcrumbCallback: function(callback) {\n var original = this._globalOptions.breadcrumbCallback;\n this._globalOptions.breadcrumbCallback = keepOriginalCallback(original, callback);\n return this;\n },\n\n /*\n * Set the shouldSendCallback option\n *\n * @param {function} callback The callback to run which allows\n * introspecting the blob before sending\n * @return {Raven}\n */\n setShouldSendCallback: function(callback) {\n var original = this._globalOptions.shouldSendCallback;\n this._globalOptions.shouldSendCallback = keepOriginalCallback(original, callback);\n return this;\n },\n\n /**\n * Override the default HTTP transport mechanism that transmits data\n * to the Sentry server.\n *\n * @param {function} transport Function invoked instead of the default\n * `makeRequest` handler.\n *\n * @return {Raven}\n */\n setTransport: function(transport) {\n this._globalOptions.transport = transport;\n\n return this;\n },\n\n /*\n * Get the latest raw exception that was captured by Raven.\n *\n * @return {error}\n */\n lastException: function() {\n return this._lastCapturedException;\n },\n\n /*\n * Get the last event id\n *\n * @return {string}\n */\n lastEventId: function() {\n return this._lastEventId;\n },\n\n /*\n * Determine if Raven is setup and ready to go.\n *\n * @return {boolean}\n */\n isSetup: function() {\n if (!this._hasJSON) return false; // needs JSON support\n if (!this._globalServer) {\n if (!this.ravenNotConfiguredError) {\n this.ravenNotConfiguredError = true;\n this._logDebug('error', 'Error: Raven has not been configured.');\n }\n return false;\n }\n return true;\n },\n\n afterLoad: function() {\n // TODO: remove window dependence?\n\n // Attempt to initialize Raven on load\n var RavenConfig = _window.RavenConfig;\n if (RavenConfig) {\n this.config(RavenConfig.dsn, RavenConfig.config).install();\n }\n },\n\n showReportDialog: function(options) {\n if (\n !_document // doesn't work without a document (React native)\n )\n return;\n\n options = objectMerge(\n {\n eventId: this.lastEventId(),\n dsn: this._dsn,\n user: this._globalContext.user || {}\n },\n options\n );\n\n if (!options.eventId) {\n throw new RavenConfigError('Missing eventId');\n }\n\n if (!options.dsn) {\n throw new RavenConfigError('Missing DSN');\n }\n\n var encode = encodeURIComponent;\n var encodedOptions = [];\n\n for (var key in options) {\n if (key === 'user') {\n var user = options.user;\n if (user.name) encodedOptions.push('name=' + encode(user.name));\n if (user.email) encodedOptions.push('email=' + encode(user.email));\n } else {\n encodedOptions.push(encode(key) + '=' + encode(options[key]));\n }\n }\n var globalServer = this._getGlobalServer(this._parseDSN(options.dsn));\n\n var script = _document.createElement('script');\n script.async = true;\n script.src = globalServer + '/api/embed/error-page/?' + encodedOptions.join('&');\n (_document.head || _document.body).appendChild(script);\n },\n\n /**** Private functions ****/\n _ignoreNextOnError: function() {\n var self = this;\n this._ignoreOnError += 1;\n setTimeout(function() {\n // onerror should trigger before setTimeout\n self._ignoreOnError -= 1;\n });\n },\n\n _triggerEvent: function(eventType, options) {\n // NOTE: `event` is a native browser thing, so let's avoid conflicting wiht it\n var evt, key;\n\n if (!this._hasDocument) return;\n\n options = options || {};\n\n eventType = 'raven' + eventType.substr(0, 1).toUpperCase() + eventType.substr(1);\n\n if (_document.createEvent) {\n evt = _document.createEvent('HTMLEvents');\n evt.initEvent(eventType, true, true);\n } else {\n evt = _document.createEventObject();\n evt.eventType = eventType;\n }\n\n for (key in options)\n if (hasKey(options, key)) {\n evt[key] = options[key];\n }\n\n if (_document.createEvent) {\n // IE9 if standards\n _document.dispatchEvent(evt);\n } else {\n // IE8 regardless of Quirks or Standards\n // IE9 if quirks\n try {\n _document.fireEvent('on' + evt.eventType.toLowerCase(), evt);\n } catch (e) {\n // Do nothing\n }\n }\n },\n\n /**\n * Wraps addEventListener to capture UI breadcrumbs\n * @param evtName the event name (e.g. \"click\")\n * @returns {Function}\n * @private\n */\n _breadcrumbEventHandler: function(evtName) {\n var self = this;\n return function(evt) {\n // reset keypress timeout; e.g. triggering a 'click' after\n // a 'keypress' will reset the keypress debounce so that a new\n // set of keypresses can be recorded\n self._keypressTimeout = null;\n\n // It's possible this handler might trigger multiple times for the same\n // event (e.g. event propagation through node ancestors). Ignore if we've\n // already captured the event.\n if (self._lastCapturedEvent === evt) return;\n\n self._lastCapturedEvent = evt;\n\n // try/catch both:\n // - accessing evt.target (see getsentry/raven-js#838, #768)\n // - `htmlTreeAsString` because it's complex, and just accessing the DOM incorrectly\n // can throw an exception in some circumstances.\n var target;\n try {\n target = htmlTreeAsString(evt.target);\n } catch (e) {\n target = '<unknown>';\n }\n\n self.captureBreadcrumb({\n category: 'ui.' + evtName, // e.g. ui.click, ui.input\n message: target\n });\n };\n },\n\n /**\n * Wraps addEventListener to capture keypress UI events\n * @returns {Function}\n * @private\n */\n _keypressEventHandler: function() {\n var self = this,\n debounceDuration = 1000; // milliseconds\n\n // TODO: if somehow user switches keypress target before\n // debounce timeout is triggered, we will only capture\n // a single breadcrumb from the FIRST target (acceptable?)\n return function(evt) {\n var target;\n try {\n target = evt.target;\n } catch (e) {\n // just accessing event properties can throw an exception in some rare circumstances\n // see: https://github.com/getsentry/raven-js/issues/838\n return;\n }\n var tagName = target && target.tagName;\n\n // only consider keypress events on actual input elements\n // this will disregard keypresses targeting body (e.g. tabbing\n // through elements, hotkeys, etc)\n if (\n !tagName ||\n (tagName !== 'INPUT' && tagName !== 'TEXTAREA' && !target.isContentEditable)\n )\n return;\n\n // record first keypress in a series, but ignore subsequent\n // keypresses until debounce clears\n var timeout = self._keypressTimeout;\n if (!timeout) {\n self._breadcrumbEventHandler('input')(evt);\n }\n clearTimeout(timeout);\n self._keypressTimeout = setTimeout(function() {\n self._keypressTimeout = null;\n }, debounceDuration);\n };\n },\n\n /**\n * Captures a breadcrumb of type \"navigation\", normalizing input URLs\n * @param to the originating URL\n * @param from the target URL\n * @private\n */\n _captureUrlChange: function(from, to) {\n var parsedLoc = parseUrl(this._location.href);\n var parsedTo = parseUrl(to);\n var parsedFrom = parseUrl(from);\n\n // because onpopstate only tells you the \"new\" (to) value of location.href, and\n // not the previous (from) value, we need to track the value of the current URL\n // state ourselves\n this._lastHref = to;\n\n // Use only the path component of the URL if the URL matches the current\n // document (almost all the time when using pushState)\n if (parsedLoc.protocol === parsedTo.protocol && parsedLoc.host === parsedTo.host)\n to = parsedTo.relative;\n if (parsedLoc.protocol === parsedFrom.protocol && parsedLoc.host === parsedFrom.host)\n from = parsedFrom.relative;\n\n this.captureBreadcrumb({\n category: 'navigation',\n data: {\n to: to,\n from: from\n }\n });\n },\n\n _patchFunctionToString: function() {\n var self = this;\n self._originalFunctionToString = Function.prototype.toString;\n // eslint-disable-next-line no-extend-native\n Function.prototype.toString = function() {\n if (typeof this === 'function' && this.__raven__) {\n return self._originalFunctionToString.apply(this.__orig__, arguments);\n }\n return self._originalFunctionToString.apply(this, arguments);\n };\n },\n\n _unpatchFunctionToString: function() {\n if (this._originalFunctionToString) {\n // eslint-disable-next-line no-extend-native\n Function.prototype.toString = this._originalFunctionToString;\n }\n },\n\n /**\n * Wrap timer functions and event targets to catch errors and provide\n * better metadata.\n */\n _instrumentTryCatch: function() {\n var self = this;\n\n var wrappedBuiltIns = self._wrappedBuiltIns;\n\n function wrapTimeFn(orig) {\n return function(fn, t) {\n // preserve arity\n // Make a copy of the arguments to prevent deoptimization\n // https://github.com/petkaantonov/bluebird/wiki/Optimization-killers#32-leaking-arguments\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; ++i) {\n args[i] = arguments[i];\n }\n var originalCallback = args[0];\n if (isFunction(originalCallback)) {\n args[0] = self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {function: orig.name || '<anonymous>'}\n }\n },\n originalCallback\n );\n }\n\n // IE < 9 doesn't support .call/.apply on setInterval/setTimeout, but it\n // also supports only two arguments and doesn't care what this is, so we\n // can just call the original function directly.\n if (orig.apply) {\n return orig.apply(this, args);\n } else {\n return orig(args[0], args[1]);\n }\n };\n }\n\n var autoBreadcrumbs = this._globalOptions.autoBreadcrumbs;\n\n function wrapEventTarget(global) {\n var proto = _window[global] && _window[global].prototype;\n if (proto && proto.hasOwnProperty && proto.hasOwnProperty('addEventListener')) {\n fill(\n proto,\n 'addEventListener',\n function(orig) {\n return function(evtName, fn, capture, secure) {\n // preserve arity\n try {\n if (fn && fn.handleEvent) {\n fn.handleEvent = self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {\n target: global,\n function: 'handleEvent',\n handler: (fn && fn.name) || '<anonymous>'\n }\n }\n },\n fn.handleEvent\n );\n }\n } catch (err) {\n // can sometimes get 'Permission denied to access property \"handle Event'\n }\n\n // More breadcrumb DOM capture ... done here and not in `_instrumentBreadcrumbs`\n // so that we don't have more than one wrapper function\n var before, clickHandler, keypressHandler;\n\n if (\n autoBreadcrumbs &&\n autoBreadcrumbs.dom &&\n (global === 'EventTarget' || global === 'Node')\n ) {\n // NOTE: generating multiple handlers per addEventListener invocation, should\n // revisit and verify we can just use one (almost certainly)\n clickHandler = self._breadcrumbEventHandler('click');\n keypressHandler = self._keypressEventHandler();\n before = function(evt) {\n // need to intercept every DOM event in `before` argument, in case that\n // same wrapped method is re-used for different events (e.g. mousemove THEN click)\n // see #724\n if (!evt) return;\n\n var eventType;\n try {\n eventType = evt.type;\n } catch (e) {\n // just accessing event properties can throw an exception in some rare circumstances\n // see: https://github.com/getsentry/raven-js/issues/838\n return;\n }\n if (eventType === 'click') return clickHandler(evt);\n else if (eventType === 'keypress') return keypressHandler(evt);\n };\n }\n return orig.call(\n this,\n evtName,\n self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {\n target: global,\n function: 'addEventListener',\n handler: (fn && fn.name) || '<anonymous>'\n }\n }\n },\n fn,\n before\n ),\n capture,\n secure\n );\n };\n },\n wrappedBuiltIns\n );\n fill(\n proto,\n 'removeEventListener',\n function(orig) {\n return function(evt, fn, capture, secure) {\n try {\n fn = fn && (fn.__raven_wrapper__ ? fn.__raven_wrapper__ : fn);\n } catch (e) {\n // ignore, accessing __raven_wrapper__ will throw in some Selenium environments\n }\n return orig.call(this, evt, fn, capture, secure);\n };\n },\n wrappedBuiltIns\n );\n }\n }\n\n fill(_window, 'setTimeout', wrapTimeFn, wrappedBuiltIns);\n fill(_window, 'setInterval', wrapTimeFn, wrappedBuiltIns);\n if (_window.requestAnimationFrame) {\n fill(\n _window,\n 'requestAnimationFrame',\n function(orig) {\n return function(cb) {\n return orig(\n self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {\n function: 'requestAnimationFrame',\n handler: (orig && orig.name) || '<anonymous>'\n }\n }\n },\n cb\n )\n );\n };\n },\n wrappedBuiltIns\n );\n }\n\n // event targets borrowed from bugsnag-js:\n // https://github.com/bugsnag/bugsnag-js/blob/master/src/bugsnag.js#L666\n var eventTargets = [\n 'EventTarget',\n 'Window',\n 'Node',\n 'ApplicationCache',\n 'AudioTrackList',\n 'ChannelMergerNode',\n 'CryptoOperation',\n 'EventSource',\n 'FileReader',\n 'HTMLUnknownElement',\n 'IDBDatabase',\n 'IDBRequest',\n 'IDBTransaction',\n 'KeyOperation',\n 'MediaController',\n 'MessagePort',\n 'ModalWindow',\n 'Notification',\n 'SVGElementInstance',\n 'Screen',\n 'TextTrack',\n 'TextTrackCue',\n 'TextTrackList',\n 'WebSocket',\n 'WebSocketWorker',\n 'Worker',\n 'XMLHttpRequest',\n 'XMLHttpRequestEventTarget',\n 'XMLHttpRequestUpload'\n ];\n for (var i = 0; i < eventTargets.length; i++) {\n wrapEventTarget(eventTargets[i]);\n }\n },\n\n /**\n * Instrument browser built-ins w/ breadcrumb capturing\n * - XMLHttpRequests\n * - DOM interactions (click/typing)\n * - window.location changes\n * - console\n *\n * Can be disabled or individually configured via the `autoBreadcrumbs` config option\n */\n _instrumentBreadcrumbs: function() {\n var self = this;\n var autoBreadcrumbs = this._globalOptions.autoBreadcrumbs;\n\n var wrappedBuiltIns = self._wrappedBuiltIns;\n\n function wrapProp(prop, xhr) {\n if (prop in xhr && isFunction(xhr[prop])) {\n fill(xhr, prop, function(orig) {\n return self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {function: prop, handler: (orig && orig.name) || '<anonymous>'}\n }\n },\n orig\n );\n }); // intentionally don't track filled methods on XHR instances\n }\n }\n\n if (autoBreadcrumbs.xhr && 'XMLHttpRequest' in _window) {\n var xhrproto = _window.XMLHttpRequest && _window.XMLHttpRequest.prototype;\n fill(\n xhrproto,\n 'open',\n function(origOpen) {\n return function(method, url) {\n // preserve arity\n\n // if Sentry key appears in URL, don't capture\n if (isString(url) && url.indexOf(self._globalKey) === -1) {\n this.__raven_xhr = {\n method: method,\n url: url,\n status_code: null\n };\n }\n\n return origOpen.apply(this, arguments);\n };\n },\n wrappedBuiltIns\n );\n\n fill(\n xhrproto,\n 'send',\n function(origSend) {\n return function() {\n // preserve arity\n var xhr = this;\n\n function onreadystatechangeHandler() {\n if (xhr.__raven_xhr && xhr.readyState === 4) {\n try {\n // touching statusCode in some platforms throws\n // an exception\n xhr.__raven_xhr.status_code = xhr.status;\n } catch (e) {\n /* do nothing */\n }\n\n self.captureBreadcrumb({\n type: 'http',\n category: 'xhr',\n data: xhr.__raven_xhr\n });\n }\n }\n\n var props = ['onload', 'onerror', 'onprogress'];\n for (var j = 0; j < props.length; j++) {\n wrapProp(props[j], xhr);\n }\n\n if ('onreadystatechange' in xhr && isFunction(xhr.onreadystatechange)) {\n fill(\n xhr,\n 'onreadystatechange',\n function(orig) {\n return self.wrap(\n {\n mechanism: {\n type: 'instrument',\n data: {\n function: 'onreadystatechange',\n handler: (orig && orig.name) || '<anonymous>'\n }\n }\n },\n orig,\n onreadystatechangeHandler\n );\n } /* intentionally don't track this instrumentation */\n );\n } else {\n // if onreadystatechange wasn't actually set by the page on this xhr, we\n // are free to set our own and capture the breadcrumb\n xhr.onreadystatechange = onreadystatechangeHandler;\n }\n\n return origSend.apply(this, arguments);\n };\n },\n wrappedBuiltIns\n );\n }\n\n if (autoBreadcrumbs.xhr && supportsFetch()) {\n fill(\n _window,\n 'fetch',\n function(origFetch) {\n return function() {\n // preserve arity\n // Make a copy of the arguments to prevent deoptimization\n // https://github.com/petkaantonov/bluebird/wiki/Optimization-killers#32-leaking-arguments\n var args = new Array(arguments.length);\n for (var i = 0; i < args.length; ++i) {\n args[i] = arguments[i];\n }\n\n var fetchInput = args[0];\n var method = 'GET';\n var url;\n\n if (typeof fetchInput === 'string') {\n url = fetchInput;\n } else if ('Request' in _window && fetchInput instanceof _window.Request) {\n url = fetchInput.url;\n if (fetchInput.method) {\n method = fetchInput.method;\n }\n } else {\n url = '' + fetchInput;\n }\n\n // if Sentry key appears in URL, don't capture, as it's our own request\n if (url.indexOf(self._globalKey) !== -1) {\n return origFetch.apply(this, args);\n }\n\n if (args[1] && args[1].method) {\n method = args[1].method;\n }\n\n var fetchData = {\n method: method,\n url: url,\n status_code: null\n };\n\n return origFetch\n .apply(this, args)\n .then(function(response) {\n fetchData.status_code = response.status;\n\n self.captureBreadcrumb({\n type: 'http',\n category: 'fetch',\n data: fetchData\n });\n\n return response;\n })\n ['catch'](function(err) {\n // if there is an error performing the request\n self.captureBreadcrumb({\n type: 'http',\n category: 'fetch',\n data: fetchData,\n level: 'error'\n });\n\n throw err;\n });\n };\n },\n wrappedBuiltIns\n );\n }\n\n // Capture breadcrumbs from any click that is unhandled / bubbled up all the way\n // to the document. Do this before we instrument addEventListener.\n if (autoBreadcrumbs.dom && this._hasDocument) {\n if (_document.addEventListener) {\n _document.addEventListener('click', self._breadcrumbEventHandler('click'), false);\n _document.addEventListener('keypress', self._keypressEventHandler(), false);\n } else if (_document.attachEvent) {\n // IE8 Compatibility\n _document.attachEvent('onclick', self._breadcrumbEventHandler('click'));\n _document.attachEvent('onkeypress', self._keypressEventHandler());\n }\n }\n\n // record navigation (URL) changes\n // NOTE: in Chrome App environment, touching history.pushState, *even inside\n // a try/catch block*, will cause Chrome to output an error to console.error\n // borrowed from: https://github.com/angular/angular.js/pull/13945/files\n var chrome = _window.chrome;\n var isChromePackagedApp = chrome && chrome.app && chrome.app.runtime;\n var hasPushAndReplaceState =\n !isChromePackagedApp &&\n _window.history &&\n _window.history.pushState &&\n _window.history.replaceState;\n if (autoBreadcrumbs.location && hasPushAndReplaceState) {\n // TODO: remove onpopstate handler on uninstall()\n var oldOnPopState = _window.onpopstate;\n _window.onpopstate = function() {\n var currentHref = self._location.href;\n self._captureUrlChange(self._lastHref, currentHref);\n\n if (oldOnPopState) {\n return oldOnPopState.apply(this, arguments);\n }\n };\n\n var historyReplacementFunction = function(origHistFunction) {\n // note history.pushState.length is 0; intentionally not declaring\n // params to preserve 0 arity\n return function(/* state, title, url */) {\n var url = arguments.length > 2 ? arguments[2] : undefined;\n\n // url argument is optional\n if (url) {\n // coerce to string (this is what pushState does)\n self._captureUrlChange(self._lastHref, url + '');\n }\n\n return origHistFunction.apply(this, arguments);\n };\n };\n\n fill(_window.history, 'pushState', historyReplacementFunction, wrappedBuiltIns);\n fill(_window.history, 'replaceState', historyReplacementFunction, wrappedBuiltIns);\n }\n\n if (autoBreadcrumbs.console && 'console' in _window && console.log) {\n // console\n var consoleMethodCallback = function(msg, data) {\n self.captureBreadcrumb({\n message: msg,\n level: data.level,\n category: 'console'\n });\n };\n\n each(['debug', 'info', 'warn', 'error', 'log'], function(_, level) {\n wrapConsoleMethod(console, level, consoleMethodCallback);\n });\n }\n },\n\n _restoreBuiltIns: function() {\n // restore any wrapped builtins\n var builtin;\n while (this._wrappedBuiltIns.length) {\n builtin = this._wrappedBuiltIns.shift();\n\n var obj = builtin[0],\n name = builtin[1],\n orig = builtin[2];\n\n obj[name] = orig;\n }\n },\n\n _restoreConsole: function() {\n // eslint-disable-next-line guard-for-in\n for (var method in this._originalConsoleMethods) {\n this._originalConsole[method] = this._originalConsoleMethods[method];\n }\n },\n\n _drainPlugins: function() {\n var self = this;\n\n // FIX ME TODO\n each(this._plugins, function(_, plugin) {\n var installer = plugin[0];\n var args = plugin[1];\n installer.apply(self, [self].concat(args));\n });\n },\n\n _parseDSN: function(str) {\n var m = dsnPattern.exec(str),\n dsn = {},\n i = 7;\n\n try {\n while (i--) dsn[dsnKeys[i]] = m[i] || '';\n } catch (e) {\n throw new RavenConfigError('Invalid DSN: ' + str);\n }\n\n if (dsn.pass && !this._globalOptions.allowSecretKey) {\n throw new RavenConfigError(\n 'Do not specify your secret key in the DSN. See: http://bit.ly/raven-secret-key'\n );\n }\n\n return dsn;\n },\n\n _getGlobalServer: function(uri) {\n // assemble the endpoint from the uri pieces\n var globalServer = '//' + uri.host + (uri.port ? ':' + uri.port : '');\n\n if (uri.protocol) {\n globalServer = uri.protocol + ':' + globalServer;\n }\n return globalServer;\n },\n\n _handleOnErrorStackInfo: function(stackInfo, options) {\n options = options || {};\n options.mechanism = options.mechanism || {\n type: 'onerror',\n handled: false\n };\n\n // if we are intentionally ignoring errors via onerror, bail out\n if (!this._ignoreOnError) {\n this._handleStackInfo(stackInfo, options);\n }\n },\n\n _handleStackInfo: function(stackInfo, options) {\n var frames = this._prepareFrames(stackInfo, options);\n\n this._triggerEvent('handle', {\n stackInfo: stackInfo,\n options: options\n });\n\n this._processException(\n stackInfo.name,\n stackInfo.message,\n stackInfo.url,\n stackInfo.lineno,\n frames,\n options\n );\n },\n\n _prepareFrames: function(stackInfo, options) {\n var self = this;\n var frames = [];\n if (stackInfo.stack && stackInfo.stack.length) {\n each(stackInfo.stack, function(i, stack) {\n var frame = self._normalizeFrame(stack, stackInfo.url);\n if (frame) {\n frames.push(frame);\n }\n });\n\n // e.g. frames captured via captureMessage throw\n if (options && options.trimHeadFrames) {\n for (var j = 0; j < options.trimHeadFrames && j < frames.length; j++) {\n frames[j].in_app = false;\n }\n }\n }\n frames = frames.slice(0, this._globalOptions.stackTraceLimit);\n return frames;\n },\n\n _normalizeFrame: function(frame, stackInfoUrl) {\n // normalize the frames data\n var normalized = {\n filename: frame.url,\n lineno: frame.line,\n colno: frame.column,\n function: frame.func || '?'\n };\n\n // Case when we don't have any information about the error\n // E.g. throwing a string or raw object, instead of an `Error` in Firefox\n // Generating synthetic error doesn't add any value here\n //\n // We should probably somehow let a user know that they should fix their code\n if (!frame.url) {\n normalized.filename = stackInfoUrl; // fallback to whole stacks url from onerror handler\n }\n\n normalized.in_app = !// determine if an exception came from outside of our app\n // first we check the global includePaths list.\n (\n (!!this._globalOptions.includePaths.test &&\n !this._globalOptions.includePaths.test(normalized.filename)) ||\n // Now we check for fun, if the function name is Raven or TraceKit\n /(Raven|TraceKit)\\./.test(normalized['function']) ||\n // finally, we do a last ditch effort and check for raven.min.js\n /raven\\.(min\\.)?js$/.test(normalized.filename)\n );\n\n return normalized;\n },\n\n _processException: function(type, message, fileurl, lineno, frames, options) {\n var prefixedMessage = (type ? type + ': ' : '') + (message || '');\n if (\n !!this._globalOptions.ignoreErrors.test &&\n (this._globalOptions.ignoreErrors.test(message) ||\n this._globalOptions.ignoreErrors.test(prefixedMessage))\n ) {\n return;\n }\n\n var stacktrace;\n\n if (frames && frames.length) {\n fileurl = frames[0].filename || fileurl;\n // Sentry expects frames oldest to newest\n // and JS sends them as newest to oldest\n frames.reverse();\n stacktrace = {frames: frames};\n } else if (fileurl) {\n stacktrace = {\n frames: [\n {\n filename: fileurl,\n lineno: lineno,\n in_app: true\n }\n ]\n };\n }\n\n if (\n !!this._globalOptions.ignoreUrls.test &&\n this._globalOptions.ignoreUrls.test(fileurl)\n ) {\n return;\n }\n\n if (\n !!this._globalOptions.whitelistUrls.test &&\n !this._globalOptions.whitelistUrls.test(fileurl)\n ) {\n return;\n }\n\n var data = objectMerge(\n {\n // sentry.interfaces.Exception\n exception: {\n values: [\n {\n type: type,\n value: message,\n stacktrace: stacktrace\n }\n ]\n },\n transaction: fileurl\n },\n options\n );\n\n var ex = data.exception.values[0];\n if (ex.type == null && ex.value === '') {\n ex.value = 'Unrecoverable error caught';\n }\n\n // Move mechanism from options to exception interface\n // We do this, as requiring user to pass `{exception:{mechanism:{ ... }}}` would be\n // too much\n if (!data.exception.mechanism && data.mechanism) {\n data.exception.mechanism = data.mechanism;\n delete data.mechanism;\n }\n\n data.exception.mechanism = objectMerge(\n {\n type: 'generic',\n handled: true\n },\n data.exception.mechanism || {}\n );\n\n // Fire away!\n this._send(data);\n },\n\n _trimPacket: function(data) {\n // For now, we only want to truncate the two different messages\n // but this could/should be expanded to just trim everything\n var max = this._globalOptions.maxMessageLength;\n if (data.message) {\n data.message = truncate(data.message, max);\n }\n if (data.exception) {\n var exception = data.exception.values[0];\n exception.value = truncate(exception.value, max);\n }\n\n var request = data.request;\n if (request) {\n if (request.url) {\n request.url = truncate(request.url, this._globalOptions.maxUrlLength);\n }\n if (request.Referer) {\n request.Referer = truncate(request.Referer, this._globalOptions.maxUrlLength);\n }\n }\n\n if (data.breadcrumbs && data.breadcrumbs.values)\n this._trimBreadcrumbs(data.breadcrumbs);\n\n return data;\n },\n\n /**\n * Truncate breadcrumb values (right now just URLs)\n */\n _trimBreadcrumbs: function(breadcrumbs) {\n // known breadcrumb properties with urls\n // TODO: also consider arbitrary prop values that start with (https?)?://\n var urlProps = ['to', 'from', 'url'],\n urlProp,\n crumb,\n data;\n\n for (var i = 0; i < breadcrumbs.values.length; ++i) {\n crumb = breadcrumbs.values[i];\n if (\n !crumb.hasOwnProperty('data') ||\n !isObject(crumb.data) ||\n objectFrozen(crumb.data)\n )\n continue;\n\n data = objectMerge({}, crumb.data);\n for (var j = 0; j < urlProps.length; ++j) {\n urlProp = urlProps[j];\n if (data.hasOwnProperty(urlProp) && data[urlProp]) {\n data[urlProp] = truncate(data[urlProp], this._globalOptions.maxUrlLength);\n }\n }\n breadcrumbs.values[i].data = data;\n }\n },\n\n _getHttpData: function() {\n if (!this._hasNavigator && !this._hasDocument) return;\n var httpData = {};\n\n if (this._hasNavigator && _navigator.userAgent) {\n httpData.headers = {\n 'User-Agent': _navigator.userAgent\n };\n }\n\n // Check in `window` instead of `document`, as we may be in ServiceWorker environment\n if (_window.location && _window.location.href) {\n httpData.url = _window.location.href;\n }\n\n if (this._hasDocument && _document.referrer) {\n if (!httpData.headers) httpData.headers = {};\n httpData.headers.Referer = _document.referrer;\n }\n\n return httpData;\n },\n\n _resetBackoff: function() {\n this._backoffDuration = 0;\n this._backoffStart = null;\n },\n\n _shouldBackoff: function() {\n return this._backoffDuration && now() - this._backoffStart < this._backoffDuration;\n },\n\n /**\n * Returns true if the in-process data payload matches the signature\n * of the previously-sent data\n *\n * NOTE: This has to be done at this level because TraceKit can generate\n * data from window.onerror WITHOUT an exception object (IE8, IE9,\n * other old browsers). This can take the form of an \"exception\"\n * data object with a single frame (derived from the onerror args).\n */\n _isRepeatData: function(current) {\n var last = this._lastData;\n\n if (\n !last ||\n current.message !== last.message || // defined for captureMessage\n current.transaction !== last.transaction // defined for captureException/onerror\n )\n return false;\n\n // Stacktrace interface (i.e. from captureMessage)\n if (current.stacktrace || last.stacktrace) {\n return isSameStacktrace(current.stacktrace, last.stacktrace);\n } else if (current.exception || last.exception) {\n // Exception interface (i.e. from captureException/onerror)\n return isSameException(current.exception, last.exception);\n }\n\n return true;\n },\n\n _setBackoffState: function(request) {\n // If we are already in a backoff state, don't change anything\n if (this._shouldBackoff()) {\n return;\n }\n\n var status = request.status;\n\n // 400 - project_id doesn't exist or some other fatal\n // 401 - invalid/revoked dsn\n // 429 - too many requests\n if (!(status === 400 || status === 401 || status === 429)) return;\n\n var retry;\n try {\n // If Retry-After is not in Access-Control-Expose-Headers, most\n // browsers will throw an exception trying to access it\n if (supportsFetch()) {\n retry = request.headers.get('Retry-After');\n } else {\n retry = request.getResponseHeader('Retry-After');\n }\n\n // Retry-After is returned in seconds\n retry = parseInt(retry, 10) * 1000;\n } catch (e) {\n /* eslint no-empty:0 */\n }\n\n this._backoffDuration = retry\n ? // If Sentry server returned a Retry-After value, use it\n retry\n : // Otherwise, double the last backoff duration (starts at 1 sec)\n this._backoffDuration * 2 || 1000;\n\n this._backoffStart = now();\n },\n\n _send: function(data) {\n var globalOptions = this._globalOptions;\n\n var baseData = {\n project: this._globalProject,\n logger: globalOptions.logger,\n platform: 'javascript'\n },\n httpData = this._getHttpData();\n\n if (httpData) {\n baseData.request = httpData;\n }\n\n // HACK: delete `trimHeadFrames` to prevent from appearing in outbound payload\n if (data.trimHeadFrames) delete data.trimHeadFrames;\n\n data = objectMerge(baseData, data);\n\n // Merge in the tags and extra separately since objectMerge doesn't handle a deep merge\n data.tags = objectMerge(objectMerge({}, this._globalContext.tags), data.tags);\n data.extra = objectMerge(objectMerge({}, this._globalContext.extra), data.extra);\n\n // Send along our own collected metadata with extra\n data.extra['session:duration'] = now() - this._startTime;\n\n if (this._breadcrumbs && this._breadcrumbs.length > 0) {\n // intentionally make shallow copy so that additions\n // to breadcrumbs aren't accidentally sent in this request\n data.breadcrumbs = {\n values: [].slice.call(this._breadcrumbs, 0)\n };\n }\n\n if (this._globalContext.user) {\n // sentry.interfaces.User\n data.user = this._globalContext.user;\n }\n\n // Include the environment if it's defined in globalOptions\n if (globalOptions.environment) data.environment = globalOptions.environment;\n\n // Include the release if it's defined in globalOptions\n if (globalOptions.release) data.release = globalOptions.release;\n\n // Include server_name if it's defined in globalOptions\n if (globalOptions.serverName) data.server_name = globalOptions.serverName;\n\n data = this._sanitizeData(data);\n\n // Cleanup empty properties before sending them to the server\n Object.keys(data).forEach(function(key) {\n if (data[key] == null || data[key] === '' || isEmptyObject(data[key])) {\n delete data[key];\n }\n });\n\n if (isFunction(globalOptions.dataCallback)) {\n data = globalOptions.dataCallback(data) || data;\n }\n\n // Why??????????\n if (!data || isEmptyObject(data)) {\n return;\n }\n\n // Check if the request should be filtered or not\n if (\n isFunction(globalOptions.shouldSendCallback) &&\n !globalOptions.shouldSendCallback(data)\n ) {\n return;\n }\n\n // Backoff state: Sentry server previously responded w/ an error (e.g. 429 - too many requests),\n // so drop requests until \"cool-off\" period has elapsed.\n if (this._shouldBackoff()) {\n this._logDebug('warn', 'Raven dropped error due to backoff: ', data);\n return;\n }\n\n if (typeof globalOptions.sampleRate === 'number') {\n if (Math.random() < globalOptions.sampleRate) {\n this._sendProcessedPayload(data);\n }\n } else {\n this._sendProcessedPayload(data);\n }\n },\n\n _sanitizeData: function(data) {\n return sanitize(data, this._globalOptions.sanitizeKeys);\n },\n\n _getUuid: function() {\n return uuid4();\n },\n\n _sendProcessedPayload: function(data, callback) {\n var self = this;\n var globalOptions = this._globalOptions;\n\n if (!this.isSetup()) return;\n\n // Try and clean up the packet before sending by truncating long values\n data = this._trimPacket(data);\n\n // ideally duplicate error testing should occur *before* dataCallback/shouldSendCallback,\n // but this would require copying an un-truncated copy of the data packet, which can be\n // arbitrarily deep (extra_data) -- could be worthwhile? will revisit\n if (!this._globalOptions.allowDuplicates && this._isRepeatData(data)) {\n this._logDebug('warn', 'Raven dropped repeat event: ', data);\n return;\n }\n\n // Send along an event_id if not explicitly passed.\n // This event_id can be used to reference the error within Sentry itself.\n // Set lastEventId after we know the error should actually be sent\n this._lastEventId = data.event_id || (data.event_id = this._getUuid());\n\n // Store outbound payload after trim\n this._lastData = data;\n\n this._logDebug('debug', 'Raven about to send:', data);\n\n var auth = {\n sentry_version: '7',\n sentry_client: 'raven-js/' + this.VERSION,\n sentry_key: this._globalKey\n };\n\n if (this._globalSecret) {\n auth.sentry_secret = this._globalSecret;\n }\n\n var exception = data.exception && data.exception.values[0];\n\n // only capture 'sentry' breadcrumb is autoBreadcrumbs is truthy\n if (\n this._globalOptions.autoBreadcrumbs &&\n this._globalOptions.autoBreadcrumbs.sentry\n ) {\n this.captureBreadcrumb({\n category: 'sentry',\n message: exception\n ? (exception.type ? exception.type + ': ' : '') + exception.value\n : data.message,\n event_id: data.event_id,\n level: data.level || 'error' // presume error unless specified\n });\n }\n\n var url = this._globalEndpoint;\n (globalOptions.transport || this._makeRequest).call(this, {\n url: url,\n auth: auth,\n data: data,\n options: globalOptions,\n onSuccess: function success() {\n self._resetBackoff();\n\n self._triggerEvent('success', {\n data: data,\n src: url\n });\n callback && callback();\n },\n onError: function failure(error) {\n self._logDebug('error', 'Raven transport failed to send: ', error);\n\n if (error.request) {\n self._setBackoffState(error.request);\n }\n\n self._triggerEvent('failure', {\n data: data,\n src: url\n });\n error = error || new Error('Raven send failed (no additional details provided)');\n callback && callback(error);\n }\n });\n },\n\n _makeRequest: function(opts) {\n // Auth is intentionally sent as part of query string (NOT as custom HTTP header) to avoid preflight CORS requests\n var url = opts.url + '?' + urlencode(opts.auth);\n\n var evaluatedHeaders = null;\n var evaluatedFetchParameters = {};\n\n if (opts.options.headers) {\n evaluatedHeaders = this._evaluateHash(opts.options.headers);\n }\n\n if (opts.options.fetchParameters) {\n evaluatedFetchParameters = this._evaluateHash(opts.options.fetchParameters);\n }\n\n if (supportsFetch()) {\n evaluatedFetchParameters.body = stringify(opts.data);\n\n var defaultFetchOptions = objectMerge({}, this._fetchDefaults);\n var fetchOptions = objectMerge(defaultFetchOptions, evaluatedFetchParameters);\n\n if (evaluatedHeaders) {\n fetchOptions.headers = evaluatedHeaders;\n }\n\n return _window\n .fetch(url, fetchOptions)\n .then(function(response) {\n if (response.ok) {\n opts.onSuccess && opts.onSuccess();\n } else {\n var error = new Error('Sentry error code: ' + response.status);\n // It's called request only to keep compatibility with XHR interface\n // and not add more redundant checks in setBackoffState method\n error.request = response;\n opts.onError && opts.onError(error);\n }\n })\n ['catch'](function() {\n opts.onError &&\n opts.onError(new Error('Sentry error code: network unavailable'));\n });\n }\n\n var request = _window.XMLHttpRequest && new _window.XMLHttpRequest();\n if (!request) return;\n\n // if browser doesn't support CORS (e.g. IE7), we are out of luck\n var hasCORS = 'withCredentials' in request || typeof XDomainRequest !== 'undefined';\n\n if (!hasCORS) return;\n\n if ('withCredentials' in request) {\n request.onreadystatechange = function() {\n if (request.readyState !== 4) {\n return;\n } else if (request.status === 200) {\n opts.onSuccess && opts.onSuccess();\n } else if (opts.onError) {\n var err = new Error('Sentry error code: ' + request.status);\n err.request = request;\n opts.onError(err);\n }\n };\n } else {\n request = new XDomainRequest();\n // xdomainrequest cannot go http -> https (or vice versa),\n // so always use protocol relative\n url = url.replace(/^https?:/, '');\n\n // onreadystatechange not supported by XDomainRequest\n if (opts.onSuccess) {\n request.onload = opts.onSuccess;\n }\n if (opts.onError) {\n request.onerror = function() {\n var err = new Error('Sentry error code: XDomainRequest');\n err.request = request;\n opts.onError(err);\n };\n }\n }\n\n request.open('POST', url);\n\n if (evaluatedHeaders) {\n each(evaluatedHeaders, function(key, value) {\n request.setRequestHeader(key, value);\n });\n }\n\n request.send(stringify(opts.data));\n },\n\n _evaluateHash: function(hash) {\n var evaluated = {};\n\n for (var key in hash) {\n if (hash.hasOwnProperty(key)) {\n var value = hash[key];\n evaluated[key] = typeof value === 'function' ? value() : value;\n }\n }\n\n return evaluated;\n },\n\n _logDebug: function(level) {\n // We allow `Raven.debug` and `Raven.config(DSN, { debug: true })` to not make backward incompatible API change\n if (\n this._originalConsoleMethods[level] &&\n (this.debug || this._globalOptions.debug)\n ) {\n // In IE<10 console methods do not have their own 'apply' method\n Function.prototype.apply.call(\n this._originalConsoleMethods[level],\n this._originalConsole,\n [].slice.call(arguments, 1)\n );\n }\n },\n\n _mergeContext: function(key, context) {\n if (isUndefined(context)) {\n delete this._globalContext[key];\n } else {\n this._globalContext[key] = objectMerge(this._globalContext[key] || {}, context);\n }\n }\n};\n\n// Deprecations\nRaven.prototype.setUser = Raven.prototype.setUserContext;\nRaven.prototype.setReleaseContext = Raven.prototype.setRelease;\n\nmodule.exports = Raven;\n","/**\n * Enforces a single instance of the Raven client, and the\n * main entry point for Raven. If you are a consumer of the\n * Raven library, you SHOULD load this file (vs raven.js).\n **/\n\nvar RavenConstructor = require('./raven');\n\n// This is to be defensive in environments where window does not exist (see https://github.com/getsentry/raven-js/pull/785)\nvar _window =\n typeof window !== 'undefined'\n ? window\n : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {};\nvar _Raven = _window.Raven;\n\nvar Raven = new RavenConstructor();\n\n/*\n * Allow multiple versions of Raven to be installed.\n * Strip Raven from the global context and returns the instance.\n *\n * @return {Raven}\n */\nRaven.noConflict = function() {\n _window.Raven = _Raven;\n return Raven;\n};\n\nRaven.afterLoad();\n\nmodule.exports = Raven;\n\n/**\n * DISCLAIMER:\n *\n * Expose `Client` constructor for cases where user want to track multiple \"sub-applications\" in one larger app.\n * It's not meant to be used by a wide audience, so pleaaase make sure that you know what you're doing before using it.\n * Accidentally calling `install` multiple times, may result in an unexpected behavior that's very hard to debug.\n *\n * It's called `Client' to be in-line with Raven Node implementation.\n *\n * HOWTO:\n *\n * import Raven from 'raven-js';\n *\n * const someAppReporter = new Raven.Client();\n * const someOtherAppReporter = new Raven.Client();\n *\n * someAppReporter.config('__DSN__', {\n * ...config goes here\n * });\n *\n * someOtherAppReporter.config('__OTHER_DSN__', {\n * ...config goes here\n * });\n *\n * someAppReporter.captureMessage(...);\n * someAppReporter.captureException(...);\n * someAppReporter.captureBreadcrumb(...);\n *\n * someOtherAppReporter.captureMessage(...);\n * someOtherAppReporter.captureException(...);\n * someOtherAppReporter.captureBreadcrumb(...);\n *\n * It should \"just work\".\n */\nmodule.exports.Client = RavenConstructor;\n","// ==========================================================================\n// Plyr.io demo\n// This code is purely for the https://plyr.io website\n// Please see readme.md in the root or github.com/sampotts/plyr\n// ==========================================================================\n\nimport Raven from 'raven-js';\n\n(() => {\n const { host } = window.location;\n const env = {\n prod: host === 'plyr.io',\n dev: host === 'dev.plyr.io',\n };\n\n document.addEventListener('DOMContentLoaded', () => {\n Raven.context(() => {\n const selector = '#player';\n const container = document.getElementById('container');\n\n if (window.shr) {\n window.shr.setup({\n count: {\n classname: 'button__count',\n },\n });\n }\n\n // Setup tab focus\n const tabClassName = 'tab-focus';\n\n // Remove class on blur\n document.addEventListener('focusout', event => {\n if (!event.target.classList || container.contains(event.target)) {\n return;\n }\n\n event.target.classList.remove(tabClassName);\n });\n\n // Add classname to tabbed elements\n document.addEventListener('keydown', event => {\n if (event.keyCode !== 9) {\n return;\n }\n\n // Delay the adding of classname until the focus has changed\n // This event fires before the focusin event\n setTimeout(() => {\n const focused = document.activeElement;\n\n if (!focused || !focused.classList || container.contains(focused)) {\n return;\n }\n\n focused.classList.add(tabClassName);\n }, 10);\n });\n\n // Setup the player\n const player = new Plyr(selector, {\n debug: true,\n title: 'View From A Blue Moon',\n iconUrl: '../dist/plyr.svg',\n keyboard: {\n global: true,\n },\n tooltips: {\n controls: true,\n },\n captions: {\n active: true,\n },\n keys: {\n google: 'AIzaSyDrNwtN3nLH_8rjCmu5Wq3ZCm4MNAVdc0c',\n },\n ads: {\n enabled: env.prod || env.dev,\n publisherId: '918848828995742',\n },\n });\n\n // Expose for tinkering in the console\n window.player = player;\n\n // Setup type toggle\n const buttons = document.querySelectorAll('[data-source]');\n const types = {\n video: 'video',\n audio: 'audio',\n youtube: 'youtube',\n vimeo: 'vimeo',\n };\n let currentType = window.location.hash.replace('#', '');\n const historySupport = window.history && window.history.pushState;\n\n // Toggle class on an element\n function toggleClass(element, className, state) {\n if (element) {\n element.classList[state ? 'add' : 'remove'](className);\n }\n }\n\n // Set a new source\n function newSource(type, init) {\n // Bail if new type isn't known, it's the current type, or current type is empty (video is default) and new type is video\n if (\n !(type in types) ||\n (!init && type === currentType) ||\n (!currentType.length && type === types.video)\n ) {\n return;\n }\n\n switch (type) {\n case types.video:\n player.source = {\n type: 'video',\n title: 'View From A Blue Moon',\n sources: [\n {\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-576p.mp4',\n type: 'video/mp4',\n size: 576,\n },\n {\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-720p.mp4',\n type: 'video/mp4',\n size: 720,\n },\n {\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-1080p.mp4',\n type: 'video/mp4',\n size: 1080,\n },\n {\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-1440p.mp4',\n type: 'video/mp4',\n size: 1440,\n },\n ],\n poster: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.jpg',\n tracks: [\n {\n kind: 'captions',\n label: 'English',\n srclang: 'en',\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.en.vtt',\n default: true,\n },\n {\n kind: 'captions',\n label: 'French',\n srclang: 'fr',\n src: 'https://cdn.plyr.io/static/demo/View_From_A_Blue_Moon_Trailer-HD.fr.vtt',\n },\n ],\n };\n\n break;\n\n case types.audio:\n player.source = {\n type: 'audio',\n title: 'Kishi Bashi – “It All Began With A Burst”',\n sources: [\n {\n src: 'https://cdn.plyr.io/static/demo/Kishi_Bashi_-_It_All_Began_With_a_Burst.mp3',\n type: 'audio/mp3',\n },\n {\n src: 'https://cdn.plyr.io/static/demo/Kishi_Bashi_-_It_All_Began_With_a_Burst.ogg',\n type: 'audio/ogg',\n },\n ],\n };\n\n break;\n\n case types.youtube:\n player.source = {\n type: 'video',\n sources: [\n {\n src: 'https://youtube.com/watch?v=bTqVqk7FSmY',\n provider: 'youtube',\n },\n ],\n };\n\n break;\n\n case types.vimeo:\n player.source = {\n type: 'video',\n sources: [\n {\n src: 'https://vimeo.com/76979871',\n provider: 'vimeo',\n },\n ],\n };\n\n break;\n\n default:\n break;\n }\n\n // Set the current type for next time\n currentType = type;\n\n // Remove active classes\n Array.from(buttons).forEach(button => toggleClass(button.parentElement, 'active', false));\n\n // Set active on parent\n toggleClass(document.querySelector(`[data-source=\"${type}\"]`), 'active', true);\n\n // Show cite\n Array.from(document.querySelectorAll('.plyr__cite')).forEach(cite => {\n cite.setAttribute('hidden', '');\n });\n document.querySelector(`.plyr__cite--${type}`).removeAttribute('hidden');\n }\n\n // Bind to each button\n Array.from(buttons).forEach(button => {\n button.addEventListener('click', () => {\n const type = button.getAttribute('data-source');\n\n newSource(type);\n\n if (historySupport) {\n window.history.pushState({ type }, '', `#${type}`);\n }\n });\n });\n\n // List for backwards/forwards\n window.addEventListener('popstate', event => {\n if (event.state && 'type' in event.state) {\n newSource(event.state.type);\n }\n });\n\n // On load\n if (historySupport) {\n const video = !currentType.length;\n\n // If there's no current type set, assume video\n if (video) {\n currentType = types.video;\n }\n\n // Replace current history state\n if (currentType in types) {\n window.history.replaceState(\n {\n type: currentType,\n },\n '',\n video ? '' : `#${currentType}`,\n );\n }\n\n // If it's not video, load the source\n if (currentType !== types.video) {\n newSource(currentType, true);\n }\n }\n });\n });\n\n // Raven / Sentry\n // For demo site (https://plyr.io) only\n if (env.prod) {\n Raven.config('https://d4ad9866ad834437a4754e23937071e4@sentry.io/305555').install();\n }\n\n // Google analytics\n // For demo site (https://plyr.io) only\n /* eslint-disable */\n if (env.prod) {\n ((i, s, o, g, r, a, m) => {\n i.GoogleAnalyticsObject = r;\n i[r] =\n i[r] ||\n function() {\n (i[r].q = i[r].q || []).push(arguments);\n };\n i[r].l = 1 * new Date();\n a = s.createElement(o);\n m = s.getElementsByTagName(o)[0];\n a.async = 1;\n a.src = g;\n m.parentNode.insertBefore(a, m);\n })(window, document, 'script', 'https://www.google-analytics.com/analytics.js', 'ga');\n window.ga('create', 'UA-40881672-11', 'auto');\n window.ga('send', 'pageview');\n }\n /* eslint-enable */\n})();\n"]}
\ No newline at end of file diff --git a/demo/dist/demo.svg b/demo/dist/demo.svg new file mode 100644 index 00000000..10370be4 --- /dev/null +++ b/demo/dist/demo.svg @@ -0,0 +1 @@ +<?xml version="1.0" encoding="UTF-8"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink"><symbol id="plyr-airplay"><path d="M16 1H2a1 1 0 0 0-1 1v10a1 1 0 0 0 1 1h3v-2H3V3h12v8h-2v2h3a1 1 0 0 0 1-1V2a1 1 0 0 0-1-1z"/><path d="M4 17h10l-5-6z"/></symbol><symbol id="plyr-captions-off"><path d="M1 1c-.6 0-1 .4-1 1v11c0 .6.4 1 1 1h4.6l2.7 2.7c.2.2.4.3.7.3.3 0 .5-.1.7-.3l2.7-2.7H17c.6 0 1-.4 1-1V2c0-.6-.4-1-1-1H1zm4.52 10.15c1.99 0 3.01-1.32 3.28-2.41l-1.29-.39c-.19.66-.78 1.45-1.99 1.45-1.14 0-2.2-.83-2.2-2.34 0-1.61 1.12-2.37 2.18-2.37 1.23 0 1.78.75 1.95 1.43l1.3-.41C8.47 4.96 7.46 3.76 5.5 3.76c-1.9 0-3.61 1.44-3.61 3.7 0 2.26 1.65 3.69 3.63 3.69zm7.57 0c1.99 0 3.01-1.32 3.28-2.41l-1.29-.39c-.19.66-.78 1.45-1.99 1.45-1.14 0-2.2-.83-2.2-2.34 0-1.61 1.12-2.37 2.18-2.37 1.23 0 1.78.75 1.95 1.43l1.3-.41c-.28-1.15-1.29-2.35-3.25-2.35-1.9 0-3.61 1.44-3.61 3.7 0 2.26 1.65 3.69 3.63 3.69z" fill-rule="evenodd" fill-opacity=".5"/></symbol><symbol id="plyr-captions-on"><path d="M1 1c-.6 0-1 .4-1 1v11c0 .6.4 1 1 1h4.6l2.7 2.7c.2.2.4.3.7.3.3 0 .5-.1.7-.3l2.7-2.7H17c.6 0 1-.4 1-1V2c0-.6-.4-1-1-1H1zm4.52 10.15c1.99 0 3.01-1.32 3.28-2.41l-1.29-.39c-.19.66-.78 1.45-1.99 1.45-1.14 0-2.2-.83-2.2-2.34 0-1.61 1.12-2.37 2.18-2.37 1.23 0 1.78.75 1.95 1.43l1.3-.41C8.47 4.96 7.46 3.76 5.5 3.76c-1.9 0-3.61 1.44-3.61 3.7 0 2.26 1.65 3.69 3.63 3.69zm7.57 0c1.99 0 3.01-1.32 3.28-2.41l-1.29-.39c-.19.66-.78 1.45-1.99 1.45-1.14 0-2.2-.83-2.2-2.34 0-1.61 1.12-2.37 2.18-2.37 1.23 0 1.78.75 1.95 1.43l1.3-.41c-.28-1.15-1.29-2.35-3.25-2.35-1.9 0-3.61 1.44-3.61 3.7 0 2.26 1.65 3.69 3.63 3.69z" fill-rule="evenodd"/></symbol><symbol id="plyr-download"><path d="M9 13c.3 0 .5-.1.7-.3L15.4 7 14 5.6l-4 4V1H8v8.6l-4-4L2.6 7l5.7 5.7c.2.2.4.3.7.3zm-7 2h14v2H2z"/></symbol><symbol id="plyr-enter-fullscreen"><path d="M10 3h3.6l-4 4L11 8.4l4-4V8h2V1h-7zM7 9.6l-4 4V10H1v7h7v-2H4.4l4-4z"/></symbol><symbol id="plyr-exit-fullscreen"><path d="M1 12h3.6l-4 4L2 17.4l4-4V17h2v-7H1zM16 .6l-4 4V1h-2v7h7V6h-3.6l4-4z"/></symbol><symbol id="plyr-fast-forward"><path d="M7.875 7.171L0 1v16l7.875-6.171V17L18 9 7.875 1z"/></symbol><symbol id="plyr-logo-vimeo"><path d="M17 5.3c-.1 1.6-1.2 3.7-3.3 6.4-2.2 2.8-4 4.2-5.5 4.2-.9 0-1.7-.9-2.4-2.6C5 10.9 4.4 6 3 6c-.1 0-.5.3-1.2.8l-.8-1c.8-.7 3.5-3.4 4.7-3.5 1.2-.1 2 .7 2.3 2.5.3 2 .8 6.1 1.8 6.1.9 0 2.5-3.4 2.6-4 .1-.9-.3-1.9-2.3-1.1.8-2.6 2.3-3.8 4.5-3.8 1.7.1 2.5 1.2 2.4 3.3z"/></symbol><symbol id="plyr-logo-youtube"><path d="M16.8 5.8c-.2-1.3-.8-2.2-2.2-2.4C12.4 3 9 3 9 3s-3.4 0-5.6.4C2 3.6 1.3 4.5 1.2 5.8 1 7.1 1 9 1 9s0 1.9.2 3.2c.2 1.3.8 2.2 2.2 2.4C5.6 15 9 15 9 15s3.4 0 5.6-.4c1.4-.3 2-1.1 2.2-2.4.2-1.3.2-3.2.2-3.2s0-1.9-.2-3.2zM7 12V6l5 3-5 3z"/></symbol><symbol id="plyr-muted"><path d="M12.4 12.5l2.1-2.1 2.1 2.1 1.4-1.4L15.9 9 18 6.9l-1.4-1.4-2.1 2.1-2.1-2.1L11 6.9 13.1 9 11 11.1zM3.786 6.008H.714C.286 6.008 0 6.31 0 6.76v4.512c0 .452.286.752.714.752h3.072l4.071 3.858c.5.3 1.143 0 1.143-.602V2.752c0-.601-.643-.977-1.143-.601L3.786 6.008z"/></symbol><symbol id="plyr-pause"><path d="M6 1H3c-.6 0-1 .4-1 1v14c0 .6.4 1 1 1h3c.6 0 1-.4 1-1V2c0-.6-.4-1-1-1zm6 0c-.6 0-1 .4-1 1v14c0 .6.4 1 1 1h3c.6 0 1-.4 1-1V2c0-.6-.4-1-1-1h-3z"/></symbol><symbol id="plyr-pip"><path d="M13.293 3.293L7.022 9.564l1.414 1.414 6.271-6.271L17 7V1h-6z"/><path d="M13 15H3V5h5V3H2a1 1 0 0 0-1 1v12a1 1 0 0 0 1 1h12a1 1 0 0 0 1-1v-6h-2v5z"/></symbol><symbol id="plyr-play"><path d="M15.562 8.1L3.87.225c-.818-.562-1.87 0-1.87.9v15.75c0 .9 1.052 1.462 1.87.9L15.563 9.9c.584-.45.584-1.35 0-1.8z"/></symbol><symbol id="plyr-restart"><path d="M9.7 1.2l.7 6.4 2.1-2.1c1.9 1.9 1.9 5.1 0 7-.9 1-2.2 1.5-3.5 1.5-1.3 0-2.6-.5-3.5-1.5-1.9-1.9-1.9-5.1 0-7 .6-.6 1.4-1.1 2.3-1.3l-.6-1.9C6 2.6 4.9 3.2 4 4.1 1.3 6.8 1.3 11.2 4 14c1.3 1.3 3.1 2 4.9 2 1.9 0 3.6-.7 4.9-2 2.7-2.7 2.7-7.1 0-9.9L16 1.9l-6.3-.7z"/></symbol><symbol id="plyr-rewind"><path d="M10.125 1L0 9l10.125 8v-6.171L18 17V1l-7.875 6.171z"/></symbol><symbol id="plyr-settings"><path d="M16.135 7.784a2 2 0 0 1-1.23-2.969c.322-.536.225-.998-.094-1.316l-.31-.31c-.318-.318-.78-.415-1.316-.094a2 2 0 0 1-2.969-1.23C10.065 1.258 9.669 1 9.219 1h-.438c-.45 0-.845.258-.997.865a2 2 0 0 1-2.969 1.23c-.536-.322-.999-.225-1.317.093l-.31.31c-.318.318-.415.781-.093 1.317a2 2 0 0 1-1.23 2.969C1.26 7.935 1 8.33 1 8.781v.438c0 .45.258.845.865.997a2 2 0 0 1 1.23 2.969c-.322.536-.225.998.094 1.316l.31.31c.319.319.782.415 1.316.094a2 2 0 0 1 2.969 1.23c.151.607.547.865.997.865h.438c.45 0 .845-.258.997-.865a2 2 0 0 1 2.969-1.23c.535.321.997.225 1.316-.094l.31-.31c.318-.318.415-.781.094-1.316a2 2 0 0 1 1.23-2.969c.607-.151.865-.547.865-.997v-.438c0-.451-.26-.846-.865-.997zM9 12a3 3 0 1 1 0-6 3 3 0 0 1 0 6z"/></symbol><symbol id="plyr-volume"><path d="M15.6 3.3c-.4-.4-1-.4-1.4 0-.4.4-.4 1 0 1.4C15.4 5.9 16 7.4 16 9c0 1.6-.6 3.1-1.8 4.3-.4.4-.4 1 0 1.4.2.2.5.3.7.3.3 0 .5-.1.7-.3C17.1 13.2 18 11.2 18 9s-.9-4.2-2.4-5.7z"/><path d="M11.282 5.282a.909.909 0 0 0 0 1.316c.735.735.995 1.458.995 2.402 0 .936-.425 1.917-.995 2.487a.909.909 0 0 0 0 1.316c.145.145.636.262 1.018.156a.725.725 0 0 0 .298-.156C13.773 11.733 14.13 10.16 14.13 9c0-.17-.002-.34-.011-.51-.053-.992-.319-2.005-1.522-3.208a.909.909 0 0 0-1.316 0zm-7.496.726H.714C.286 6.008 0 6.31 0 6.76v4.512c0 .452.286.752.714.752h3.072l4.071 3.858c.5.3 1.143 0 1.143-.602V2.752c0-.601-.643-.977-1.143-.601L3.786 6.008z"/></symbol></svg>
\ No newline at end of file |